diff options
| author | Étienne Loks <etienne.loks@iggdrasil.net> | 2017-04-07 12:22:27 +0200 |
|---|---|---|
| committer | Étienne Loks <etienne.loks@iggdrasil.net> | 2017-04-07 12:22:27 +0200 |
| commit | 93364489ab4e6daf16f924b2d8212f7fcdc5e477 (patch) | |
| tree | e0686c289c399330f414b50ff8ef58f642833db2 | |
| parent | c788bef47de6bca5dda5dd1fa67dd6a2ac02e9b9 (diff) | |
| parent | a8271676a0598594762cc53e4f577337eb275313 (diff) | |
| download | Ishtar-93364489ab4e6daf16f924b2d8212f7fcdc5e477.tar.bz2 Ishtar-93364489ab4e6daf16f924b2d8212f7fcdc5e477.zip | |
Merge branch 'v0.9' into wheezy
130 files changed, 17124 insertions, 3192 deletions
diff --git a/CHANGES.md b/CHANGES.md index 34d7ccd2e..e5ce0ac3c 100644 --- a/CHANGES.md +++ b/CHANGES.md @@ -1,6 +1,37 @@ Ishtar changelog ================ +v0.99.17 (2017-04-07) +--------------------- + +### Features ### +- Operations: add collaborators field +- Operation wizard: an operation cannot be related to herself +- Operation forms: filter some fields if "files" module is not activated +- Replace MultipleAutocompleteField with Select2MultipleField +- JS: new version of select2 +- Base finds: bulk update of finds on context record change +- Warehouse sheet: provide statistics +- Sheets: larger tables +- Treatment - Treatment files dashboard: first overview +- Documentation generation: add some variables to treatments +- Shortcut menu: hide/show information saved in the session +- Allow old operations + +### Bug fixes ### +- Many fixes on access controls and permissions +- UI: use the url to detect the current action (more accurate) +- UI: prevent menu from dancing (less cool but prevent seasickness) +- Warehouse: divisions forms is readonly if containers are localised in this warehouse +- Warehouse form: name can be up to 200 chars +- Base finds: fix cache generation on context record change +- Fix find modify action +- Finds: do not resize the image and regenerate a thumb on find duplication +- New person form: fix empty title +- Filter autocomplete by own if relevant +- Sources: fix query owns requests +- Widget: fix Select2Multiple initialization with string + v0.99.16 (2017-03-21) --------------------- diff --git a/archaeological_context_records/locale/django.pot b/archaeological_context_records/locale/django.pot index eedcad733..82c64ac4c 100644 --- a/archaeological_context_records/locale/django.pot +++ b/archaeological_context_records/locale/django.pot @@ -4,14 +4,15 @@ # Étienne Loks <etienne.loks at peacefrogs net>, 2010-2015. # Valérie-Emma Leroux <emma@iggdrasil.net>, 2016. #zanata # Valérie-Emma Leroux <emma@iggdrasil.net>, 2017. #zanata +# Étienne Loks <etienne.loks@iggdrasil.net>, 2017. #zanata msgid "" msgstr "" -#: forms.py:47 forms.py:51 models.py:216 models.py:589 wizards.py:77 +#: forms.py:47 forms.py:51 models.py:216 models.py:599 wizards.py:77 msgid "Operation" msgstr "" -#: forms.py:59 forms.py:141 models.py:218 models.py:557 +#: forms.py:59 forms.py:141 models.py:218 models.py:567 msgid "ID" msgstr "" @@ -63,11 +64,11 @@ msgstr "" msgid "General" msgstr "" -#: forms.py:140 models.py:181 models.py:214 models.py:559 +#: forms.py:140 models.py:181 models.py:214 models.py:569 msgid "Parcel" msgstr "" -#: forms.py:143 models.py:219 models.py:560 +#: forms.py:143 models.py:219 models.py:570 #: templates/ishtar/sheet_contextrecord.html:30 msgid "Description" msgstr "" @@ -104,7 +105,7 @@ msgstr "" msgid "Depth of appearance (m)" msgstr "" -#: forms.py:156 forms.py:376 models.py:241 models.py:558 +#: forms.py:156 forms.py:376 models.py:241 models.py:568 msgid "Context record type" msgstr "" @@ -151,7 +152,7 @@ msgstr "" msgid "Dating type" msgstr "" -#: forms.py:285 ishtar_menu.py:29 models.py:619 +#: forms.py:285 ishtar_menu.py:29 models.py:641 msgid "Context record" msgstr "" @@ -320,7 +321,7 @@ msgstr "" msgid "Documentation types" msgstr "" -#: models.py:172 models.py:561 +#: models.py:172 models.py:571 msgid "Periods" msgstr "" @@ -425,74 +426,94 @@ msgctxt "short" msgid "Context record" msgstr "" -#: models.py:491 +#: models.py:501 msgid "Inverse relation" msgstr "" -#: models.py:495 models.py:518 models.py:556 +#: models.py:505 models.py:528 models.py:566 msgid "Relation type" msgstr "" -#: models.py:496 +#: models.py:506 msgid "Relation types" msgstr "" -#: models.py:513 +#: models.py:523 msgid "ID (left)" msgstr "" -#: models.py:514 +#: models.py:524 msgid "Context record type (left)" msgstr "" -#: models.py:515 +#: models.py:525 msgid "Parcel (left)" msgstr "" -#: models.py:516 +#: models.py:526 msgid "Description (left)" msgstr "" -#: models.py:517 +#: models.py:527 msgid "Periods (left)" msgstr "" -#: models.py:519 +#: models.py:529 msgid "ID (right)" msgstr "" -#: models.py:520 +#: models.py:530 msgid "Context record type (right)" msgstr "" -#: models.py:521 +#: models.py:531 msgid "Parcel (right)" msgstr "" -#: models.py:522 +#: models.py:532 msgid "Description (right)" msgstr "" -#: models.py:523 +#: models.py:533 msgid "Periods (right)" msgstr "" -#: models.py:532 +#: models.py:542 msgid "Record relation" msgstr "" -#: models.py:533 +#: models.py:543 msgid "Record relations" msgstr "" -#: models.py:616 +#: models.py:626 msgid "Context record documentation" msgstr "" -#: models.py:617 +#: models.py:627 msgid "Context record documentations" msgstr "" +#: models.py:630 +msgid "Can view all Context record sources" +msgstr "" + +#: models.py:632 +msgid "Can view own Context record source" +msgstr "" + +#: models.py:634 +msgid "Can add own Context record source" +msgstr "" + +#: models.py:636 +msgid "Can change own Context record source" +msgstr "" + +#: models.py:638 +msgid "Can delete own Context record source" +msgstr "" + #: views.py:102 msgid "New context record" msgstr "" diff --git a/archaeological_context_records/models.py b/archaeological_context_records/models.py index 4df56c49f..bb3afc899 100644 --- a/archaeological_context_records/models.py +++ b/archaeological_context_records/models.py @@ -159,7 +159,7 @@ class CRBulkView(object): class ContextRecord(BaseHistorizedItem, ImageModel, OwnPerms, - ValueGetter, ShortMenuItem): + ValueGetter, ShortMenuItem): SHOW_URL = 'show-contextrecord' SLUG = 'contextrecord' TABLE_COLS = ['label', 'operation__common_name', 'parcel__town__name', @@ -365,9 +365,11 @@ class ContextRecord(BaseHistorizedItem, ImageModel, OwnPerms, @classmethod def get_query_owns(cls, user): - return Q(operation__scientist=user.ishtaruser.person) |\ - Q(operation__in_charge=user.ishtaruser.person) |\ - Q(history_creator=user) + return (Q(operation__scientist=user.ishtaruser.person) | + Q(operation__in_charge=user.ishtaruser.person) | + Q(operation__collaborators__pk=user.ishtaruser.person.pk) | + Q(history_creator=user)) \ + & Q(operation__end_date__isnull=True) @classmethod def get_owns(cls, user, menu_filtr=None, limit=None, @@ -401,8 +403,16 @@ class ContextRecord(BaseHistorizedItem, ImageModel, OwnPerms, return self.full_label() def _get_associated_cached_labels(self): - from archaeological_finds.models import Find - return list(Find.objects.filter(base_finds__context_record=self).all()) + from archaeological_finds.models import Find, BaseFind + return list(Find.objects.filter(base_finds__context_record=self).all())\ + + list(BaseFind.objects.filter(context_record=self).all()) + + def _cached_labels_bulk_update(self): + if settings.TESTING and settings.USE_SPATIALITE_FOR_TESTS: + return + self.base_finds.model.cached_label_bulk_update( + context_record_id=self.pk) + return True @property def reference(self): @@ -615,6 +625,18 @@ class ContextRecordSource(Source): class Meta: verbose_name = _(u"Context record documentation") verbose_name_plural = _(u"Context record documentations") + permissions = ( + ("view_contextrecordsource", + ugettext(u"Can view all Context record sources")), + ("view_own_contextrecordsource", + ugettext(u"Can view own Context record source")), + ("add_own_contextrecordsource", + ugettext(u"Can add own Context record source")), + ("change_own_contextrecordsource", + ugettext(u"Can change own Context record source")), + ("delete_own_contextrecordsource", + ugettext(u"Can delete own Context record source")), + ) context_record = models.ForeignKey( ContextRecord, verbose_name=_(u"Context record"), related_name="source") @@ -622,3 +644,12 @@ class ContextRecordSource(Source): @property def owner(self): return self.context_record + + @classmethod + def get_query_owns(cls, user): + return ( + Q(context_record__operation__scientist=user.ishtaruser.person) | + Q(context_record__operation__in_charge=user.ishtaruser.person) | + Q(context_record__operation__collaborators__pk= + user.ishtaruser.person.pk)) \ + & Q(context_record__operation__end_date__isnull=True) diff --git a/archaeological_context_records/templates/ishtar/sheet_contextrecord.html b/archaeological_context_records/templates/ishtar/sheet_contextrecord.html index 272dcb28e..29e45d3a9 100644 --- a/archaeological_context_records/templates/ishtar/sheet_contextrecord.html +++ b/archaeological_context_records/templates/ishtar/sheet_contextrecord.html @@ -15,7 +15,7 @@ {% include "ishtar/blocks/sheet_external_id.html" %} <ul class='form-flex'> -<li><label>{% if item.operation.code_patriarche %}{%trans "Complete ID:"%}{% else %}{%trans "Temporary ID:"%}{% endif %}</label><span class='value'>{{item.full_label}}</span></li> +<li><label>{% if item.operation.code_patriarche %}{%trans "Complete ID"%}{% else %}{%trans "Temporary ID"%}{% endif %}</label><span class='value'>{{item.full_label}}</span></li> {% include "ishtar/blocks/sheet_creation_section.html" %} @@ -79,9 +79,9 @@ {% field_li num_ref_label item.operation.operation_code %} {% field_li "Patriarche OA code" item.operation.code_patriarche %} {% field_li_detail "Head scientist" item.operation.scientist %} -<li><label>{%trans "State:"%}</label><span class='value'>{% if item.operation.is_active %}{% trans "Active file" %}{% else %}{%trans "Closed operation" %}{% endif %}</span></li> +<li><label>{%trans "State"%}</label><span class='value'>{% if item.operation.is_active %}{% trans "Active file" %}{% else %}{%trans "Closed operation" %}{% endif %}</span></li> {% if not item.operation.is_active %} -<li><label>{%trans "Closing date:"%}</label> <span class='value'>{{ item.operation.closing.date }} <strong>{%trans "by" %}</strong> {{ item.operation.closing.user }}</span></li> +<li><label>{%trans "Closing date"%}</label> <span class='value'>{{ item.operation.closing.date }} <strong>{%trans "by" %}</strong> {{ item.operation.closing.user }}</span></li> {% endif %} {% field_li "Type" item.operation.operation_type %} {% field_li_multiple "Remains" item.operation.remains %} @@ -90,8 +90,8 @@ {% field "Comment" item.operation.comment "<pre>" "</pre>" %} <h3>{% trans "Localisation"%}</h3> -<p><label>{%trans "Towns:"%}</label> <span class='value'>{{ item.operation.towns.all|join:", " }}</span></p> -<p><label>{%trans "Related operation:"%}</label> +<p><label>{%trans "Towns"%}</label> <span class='value'>{{ item.operation.towns.all|join:", " }}</span></p> +<p><label>{%trans "Related operation"%}</label> <span class='value'><a href="#" onclick='load_window("{% url show-operation item.operation.pk ''%}");'>{{ item.operation }}</a></span></p> {% else %}<p class='alert'><i class="fa fa-exclamation-triangle" aria-hidden="true"></i> <label>{%trans "No operation linked to this context unit!"%}</label></p> {% endif %} diff --git a/archaeological_context_records/tests.py b/archaeological_context_records/tests.py index 6bb293e4d..4226b42ea 100644 --- a/archaeological_context_records/tests.py +++ b/archaeological_context_records/tests.py @@ -235,7 +235,7 @@ class ContextRecordTest(ContextRecordInit, TestCase): models.RecordRelations.objects.create( left_record=cr_1, right_record=cr_2, relation_type=sym_rel_type) - def testExternalID(self): + def test_external_id(self): cr = self.context_records[0] self.assertEqual( cr.external_id, @@ -255,7 +255,7 @@ class ContextRecordTest(ContextRecordInit, TestCase): cr.operation ) - def test_cache_update(self): + def test_upstream_cache_update(self): cr = self.create_context_record()[0] cr_pk = cr.pk # OP2010 - 1 | A | 1 | CR 1 @@ -288,6 +288,54 @@ class ContextRecordTest(ContextRecordInit, TestCase): ope_id, parcel_sec, parcel_nb, cr_label = cr.cached_label.split(' | ') self.assertEqual(ope_id, 'OP2017-1') + def test_downstream_cache_update(self): + if settings.USE_SPATIALITE_FOR_TESTS: + # using views - can only be tested with postgresql + return + + cr = self.create_context_record()[0] + + from archaeological_finds.models import Find, BaseFind, MaterialType + + data = { + 'label': "Find me a reason", + 'context_record': cr, + 'history_modifier': self.get_default_user() + } + bf = BaseFind.objects.create(**data) + find = Find.objects.create( + history_modifier=self.get_default_user(), + label='Find me too' + ) + find.base_finds.add(bf) + + mat = MaterialType.objects.create( + label='Adamentium', txt_idx='admentium', code='ADA') + find.material_types.add(mat) + + class TestObj(object): + def __init__(self): + self.find_reached = [] + + def reached(self, sender, **kwargs): + instance = kwargs.get('instance') + if sender in (Find, BaseFind): + self.find_reached.append(instance) + + test_obj = TestObj() + cr = models.ContextRecord.objects.get(pk=cr.pk) + cr.test_obj = test_obj + cr.label = "New label!" + cr.save() + + # verify the relevance of the update + bf = BaseFind.objects.get(pk=bf.pk) + self.assertIn("New label!", bf.cache_complete_id) + + # bulk update of find cached label gen don't have to be + # reached + self.assertEqual(len(test_obj.find_reached), 0) + class ContextRecordSearchTest(ContextRecordInit, TestCase): fixtures = ImportContextRecordTest.fixtures diff --git a/archaeological_context_records/urls.py b/archaeological_context_records/urls.py index 341d321f9..e89a76aef 100644 --- a/archaeological_context_records/urls.py +++ b/archaeological_context_records/urls.py @@ -23,7 +23,7 @@ from archaeological_context_records import models from ishtar_common.wizards import check_rights import views -# be carreful: each check_rights must be relevant with ishtar_menu +# be careful: each check_rights must be relevant with ishtar_menu # forms urlpatterns = patterns( @@ -33,7 +33,7 @@ urlpatterns = patterns( check_rights(['view_contextrecord', 'view_own_contextrecord'])( views.record_search_wizard), name='record_search'), url(r'record_creation/(?P<step>.+)?$', - check_rights(['add_contextrecord'])( + check_rights(['add_contextrecord', 'add_own_contextrecord'])( views.record_creation_wizard), name='record_creation'), url(r'record_modification/(?P<step>.+)?$', check_rights(['change_contextrecord', 'change_own_contextrecord'])( diff --git a/archaeological_files/forms.py b/archaeological_files/forms.py index 45a05b9b1..d8738f511 100644 --- a/archaeological_files/forms.py +++ b/archaeological_files/forms.py @@ -209,7 +209,7 @@ class FileFormGeneral(ManageOldType, forms.Form): validators=[valid_id(Person)]) year = forms.IntegerField(label=_("Year"), initial=lambda: datetime.datetime.now().year, - validators=[validators.MinValueValidator(1900), + validators=[validators.MinValueValidator(1600), validators.MaxValueValidator(2100)]) numeric_reference = forms.IntegerField( label=_("Numeric reference"), widget=forms.HiddenInput, required=False) @@ -336,10 +336,8 @@ class FileFormResearch(ManageOldType, forms.Form): 'requested_operation_type': OperationType, 'organization': Organization, 'department': Department} - department = widgets.MultipleAutocompleteField( - model=Department, - label=_("Departments"), - required=False) + department = widgets.Select2MultipleField( + model=Department, label=_("Departments"), required=False) scientist = forms.IntegerField( widget=widgets.JQueryAutoComplete( reverse_lazy( diff --git a/archaeological_files/locale/django.pot b/archaeological_files/locale/django.pot index 1e513ae12..62dcf19ae 100644 --- a/archaeological_files/locale/django.pot +++ b/archaeological_files/locale/django.pot @@ -9,7 +9,7 @@ msgid "" msgstr "" -#: forms.py:47 forms.py:210 forms.py:255 forms.py:396 forms.py:423 +#: forms.py:47 forms.py:210 forms.py:255 forms.py:394 forms.py:421 #: models.py:108 templates/ishtar/sheet_file.html:144 msgid "Year" msgstr "" @@ -22,15 +22,15 @@ msgstr "" msgid "Other reference" msgstr "" -#: forms.py:52 forms.py:431 +#: forms.py:52 forms.py:429 msgid "Parcel (section/number/public domain)" msgstr "" -#: forms.py:55 forms.py:407 forms.py:434 models.py:558 +#: forms.py:55 forms.py:405 forms.py:432 models.py:558 msgid "Department" msgstr "" -#: forms.py:56 forms.py:443 +#: forms.py:56 forms.py:441 msgid "File name" msgstr "" @@ -54,7 +54,7 @@ msgstr "" msgid "Permit reference" msgstr "" -#: forms.py:63 forms.py:227 forms.py:364 models.py:180 +#: forms.py:63 forms.py:227 forms.py:362 models.py:180 #: templates/ishtar/sheet_file.html:97 msgid "Comment" msgstr "" @@ -63,19 +63,19 @@ msgstr "" msgid "In charge" msgstr "" -#: forms.py:72 forms.py:281 forms.py:445 models.py:126 +#: forms.py:72 forms.py:281 forms.py:443 models.py:126 msgid "General contractor" msgstr "" -#: forms.py:79 forms.py:453 +#: forms.py:79 forms.py:451 msgid "Organization of general contractor" msgstr "" -#: forms.py:87 forms.py:476 +#: forms.py:87 forms.py:474 msgid "Created by" msgstr "" -#: forms.py:94 forms.py:484 +#: forms.py:94 forms.py:482 msgid "Modified by" msgstr "" @@ -169,83 +169,83 @@ msgstr "" msgid "Research archaeology" msgstr "" -#: forms.py:341 models.py:183 templates/ishtar/sheet_file.html:88 +#: forms.py:340 models.py:183 templates/ishtar/sheet_file.html:88 msgid "Departments" msgstr "" -#: forms.py:351 models.py:192 +#: forms.py:349 models.py:192 msgid "Scientist in charge" msgstr "" -#: forms.py:353 models.py:186 templates/ishtar/sheet_file.html:90 +#: forms.py:351 models.py:186 templates/ishtar/sheet_file.html:90 msgid "Requested operation type" msgstr "" -#: forms.py:355 +#: forms.py:353 msgid "Lead organization" msgstr "" -#: forms.py:371 models.py:196 templates/ishtar/sheet_file.html:95 +#: forms.py:369 models.py:196 templates/ishtar/sheet_file.html:95 msgid "Classified area" msgstr "" -#: forms.py:373 models.py:198 templates/ishtar/sheet_file.html:96 +#: forms.py:371 models.py:198 templates/ishtar/sheet_file.html:96 msgid "Protected area" msgstr "" -#: forms.py:387 +#: forms.py:385 msgid "Would you like to close this archaeological file?" msgstr "" -#: forms.py:392 +#: forms.py:390 msgid "Would you like to delete this archaeological file ?" msgstr "" -#: forms.py:397 forms.py:424 forms.py:547 +#: forms.py:395 forms.py:422 forms.py:545 msgid "Index" msgstr "" -#: forms.py:401 forms.py:428 forms.py:533 +#: forms.py:399 forms.py:426 forms.py:531 msgid "Act type" msgstr "" -#: forms.py:402 +#: forms.py:400 msgid "Object (full text search)" msgstr "" -#: forms.py:429 +#: forms.py:427 msgid "Indexed?" msgstr "" -#: forms.py:435 +#: forms.py:433 msgid "Object" msgstr "" -#: forms.py:439 +#: forms.py:437 msgid "Signature date after" msgstr "" -#: forms.py:441 +#: forms.py:439 msgid "Signature date before" msgstr "" -#: forms.py:461 +#: forms.py:459 msgid "File numeric reference" msgstr "" -#: forms.py:462 +#: forms.py:460 msgid "File year" msgstr "" -#: forms.py:464 +#: forms.py:462 msgid "File other reference" msgstr "" -#: forms.py:466 +#: forms.py:464 msgid "File in charge" msgstr "" -#: forms.py:474 +#: forms.py:472 msgid "File permit reference" msgstr "" diff --git a/archaeological_files/models.py b/archaeological_files/models.py index 7f37a298f..52f628817 100644 --- a/archaeological_files/models.py +++ b/archaeological_files/models.py @@ -1,6 +1,6 @@ #!/usr/bin/env python # -*- coding: utf-8 -*- -# Copyright (C) 2012-2016 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> +# Copyright (C) 2012-2017 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as diff --git a/archaeological_files/templates/ishtar/sheet_file.html b/archaeological_files/templates/ishtar/sheet_file.html index bfd92eb6f..9d0948660 100644 --- a/archaeological_files/templates/ishtar/sheet_file.html +++ b/archaeological_files/templates/ishtar/sheet_file.html @@ -25,41 +25,41 @@ {% comment %} {% if item.deadline_date and not item.acts %} - <p><label>{%trans "Deadline:"%}</label> <span class='value'>{% item.deadline_date %}</span></p> <!-- calculated deadline for some preventive files , see saisine_type, not displayed if an act as been send --> + <p><label>{%trans "Deadline"%}</label> <span class='value'>{% item.deadline_date %}</span></p> <!-- calculated deadline for some preventive files , see saisine_type, not displayed if an act as been send --> {% endif %} {% endcomment %} {% field_li_detail "In charge" item.in_charge %} -<li><label>{%trans "State:"%}</label> <span class='value'>{% if item.is_active %}{%trans "Active file"%}</span></p> +<li><label>{%trans "State"%}</label> <span class='value'>{% if item.is_active %}{%trans "Active file"%}</span></p> {% else %}{%trans "Closed file"%}</span></li> -{% if item.closing %}<li><label>{%trans "Closing date:"%}</label> <span class='value'>{{ item.closing.date }} <strong>{%trans "by" %}</strong> {{ item.closing.user.full_label }}</span></li>{% endif %} +{% if item.closing %}<li><label>{%trans "Closing date"%}</label> <span class='value'>{{ item.closing.date }} <strong>{%trans "by" %}</strong> {{ item.closing.user.full_label }}</span></li>{% endif %} {% endif %} {% field_li "Type" item.file_type %} -{% if item.related_file %}<li><label>{%trans "Related file:"%}</label> <span class='value'><a href='#' onclick='load_window("{% url show-file item.related_file.pk "" %}")'>{{ item.related_file }}</a></span></li>{% endif %} +{% if item.related_file %}<li><label>{%trans "Related file"%}</label> <span class='value'><a href='#' onclick='load_window("{% url show-file item.related_file.pk "" %}")'>{{ item.related_file }}</a></span></li>{% endif %} </ul> {% field "Comment" item.comment "<pre>" "</pre>" %} <h3>{% trans "Localisation"%}</h3> -{% if item.towns.count %}<p><label>{%trans "Towns:"%}</label> <span class='value'>{{ item.towns.all|join:", " }}</span></p>{% endif %} -{% if item.departments.count %}<p><label>{%trans "Departments:"%}</label> <span class='value'>{{ item.departments.all|join:", " }}</span></p>{% endif %} +{% if item.towns.count %}<p><label>{%trans "Towns"%}</label> <span class='value'>{{ item.towns.all|join:", " }}</span></p>{% endif %} +{% if item.departments.count %}<p><label>{%trans "Departments"%}</label> <span class='value'>{{ item.departments.all|join:", " }}</span></p>{% endif %} {% if item.address %} -<p><label>{%trans "Main address:"%}</label> <span class='value'>{{ item.address }}</span></p> -{% if item.address_complement %}<p><label>{%trans "Complement:"%}</label> <span class='value'>{{ item.address_complement }}</span></p>{%endif%} -{% if item.postal_code %}<p><label>{%trans "Postal code:"%}</label> <span class='value'>{{ item.postal_code }}</span></p>{%endif%} +<p><label>{%trans "Main address"%}</label> <span class='value'>{{ item.address }}</span></p> +{% if item.address_complement %}<p><label>{%trans "Complement"%}</label> <span class='value'>{{ item.address_complement }}</span></p>{%endif%} +{% if item.postal_code %}<p><label>{%trans "Postal code"%}</label> <span class='value'>{{ item.postal_code }}</span></p>{%endif%} {% endif %} -{% if item.total_surface %}<p><label>{%trans "Surface:"%}</label> <span class='value'>{{ item.total_surface }} m<sup>2</sup> ({{ item.total_surface_ha }} ha)</span></p>{%endif%} +{% if item.total_surface %}<p><label>{%trans "Surface"%}</label> <span class='value'>{{ item.total_surface }} m<sup>2</sup> ({{ item.total_surface_ha }} ha)</span></p>{%endif%} {% if item.is_preventive %} <h3>{% trans "Preventive archaeological file"%}</h3> <ul class='form-flex'> -{% if item.total_developed_surface %}<li><label>{%trans "Developed surface:"%}</label> <span class='value'>{{ item.total_developed_surface }} m<sup>2</sup> ({{ item.total_developed_surface_ha }} ha)</span></li>{% endif %} +{% if item.total_developed_surface %}<li><label>{%trans "Developed surface"%}</label> <span class='value'>{{ item.total_developed_surface }} m<sup>2</sup> ({{ item.total_developed_surface_ha }} ha)</span></li>{% endif %} {% field_li "Saisine type" item.saisine_type %} @@ -85,16 +85,16 @@ {% else %} <h3>{% trans "Research archaeology"%}</h3> -{% if item.departments.count %}<p><label>{%trans "Departments"%}{%trans ":"%}</label> <span class='value'>{% for department in item.departments.all %}{% if forloop.counter0 %}, {% endif %}{{ department }}{% endfor %}</span></p>{% endif %} -{% if item.scientist %}<p><label>{%trans "Head scientist"%}{%trans ":"%}</label> <span class='value'>{{ item.scientist }}</span></p>{% endif %} -{% if item.requested_operation_type %}<p><label>{%trans "Requested operation type"%}{%trans ":"%}</label> <span class='value'>{{ item.requested_operation_type }}</span></p>{% endif %} -{% if item.organization %}<p><label>{%trans "Organization"%}{%trans ":"%}</label> <span class='value'>{{ item.organization }}</span></p>{% endif %} +{% if item.departments.count %}<p><label>{%trans "Departments"%}</label> <span class='value'>{% for department in item.departments.all %}{% if forloop.counter0 %}, {% endif %}{{ department }}{% endfor %}</span></p>{% endif %} +{% if item.scientist %}<p><label>{%trans "Head scientist"%}</label> <span class='value'>{{ item.scientist }}</span></p>{% endif %} +{% if item.requested_operation_type %}<p><label>{%trans "Requested operation type"%}</label> <span class='value'>{{ item.requested_operation_type }}</span></p>{% endif %} +{% if item.organization %}<p><label>{%trans "Organization"%}</label> <span class='value'>{{ item.organization }}</span></p>{% endif %} {% if item.cira_advised != None %}<p><label>Passage en CIRA</label> <span class='value'>{{ item.cira_advised|yesno }}</span></p>{% endif %} {% if item.mh_register != None %}<p><label>Sur Monument Historique classé</label> <span class='value'>{{ item.mh_register|yesno }}</span></p>{% endif %} {% if item.mh_listing != None %}<p><label>Sur Monument Historique inscrit</label> <span class='value'>{{ item.mh_listing|yesno }}</span></p>{% endif %} {% if item.classified_area != None %}<p><label>{% trans "Classified area" %}</label> <span class='value'>{{ item.classified_area|yesno }}</span></p>{% endif %} {% if item.protected_area != None %}<p><label>{% trans "Protected area" %}</label> <span class='value'>{{ item.protected_area|yesno }}</span></p>{% endif %} -{% if item.research_comment %}<p><label>{%trans "Comment"%}{%trans ":"%}</label> <span class='value'>{{ item.research_comment }}</span></p>{% endif %} +{% if item.research_comment %}<p><label>{%trans "Comment"%}</label> <span class='value'>{{ item.research_comment }}</span></p>{% endif %} {% endif %} diff --git a/archaeological_files_pdl/forms.py b/archaeological_files_pdl/forms.py index 4890eb5d6..73f1d789c 100644 --- a/archaeological_files_pdl/forms.py +++ b/archaeological_files_pdl/forms.py @@ -40,7 +40,7 @@ class FileFormGeneral(ManageOldType, forms.Form): file_type = forms.ChoiceField(label=_("File type"), choices=[]) year = forms.IntegerField(label=_("Year"), initial=lambda: datetime.datetime.now().year, - validators=[validators.MinValueValidator(1900), + validators=[validators.MinValueValidator(1600), validators.MaxValueValidator(2100)]) creation_date = forms.DateField(label=_(u"Creation date"), initial=get_now, widget=widgets.JQueryDate) @@ -86,9 +86,9 @@ class FileFormPlanning(forms.Form): associated_models = {'town': Town, 'department': Department} name = forms.CharField(label=_(u"Planning name"), required=False, max_length=100) - town = widgets.MultipleAutocompleteField( - model=Town, label=_("Towns"), required=False) - department = widgets.MultipleAutocompleteField( + town = widgets.Select2MultipleField( + model=Town, label=_("Towns"), required=False, remote=True) + department = widgets.Select2MultipleField( model=Department, label=_("Departments"), required=False) locality = forms.CharField(label=_(u"Locality"), max_length=100, required=False) @@ -118,9 +118,9 @@ class FileFormResearchAddress(forms.Form): associated_models = {'town': Town, 'department': Department} name = forms.CharField(label=_(u"Project name"), required=False, max_length=100) - town = widgets.MultipleAutocompleteField( - model=Town, label=_("Towns"), required=False) - department = widgets.MultipleAutocompleteField( + town = widgets.Select2MultipleField( + model=Town, label=_("Towns"), required=False, remote=True) + department = widgets.Select2MultipleField( model=Department, label=_("Departments"), required=False) locality = forms.CharField(label=_(u"Locality"), max_length=100, required=False) @@ -413,7 +413,7 @@ class FileFormInstruction(forms.Form): instruction_deadline = forms.DateField(widget=widgets.JQueryDate, required=False) year = forms.IntegerField(label=_("Year"), - validators=[validators.MinValueValidator(1900), + validators=[validators.MinValueValidator(1600), validators.MaxValueValidator(2100)]) numeric_reference = forms.IntegerField(label=_("Numeric reference"), required=False) diff --git a/archaeological_finds/forms.py b/archaeological_finds/forms.py index 09d23a3bc..8fe945e88 100644 --- a/archaeological_finds/forms.py +++ b/archaeological_finds/forms.py @@ -147,18 +147,22 @@ class FindForm(ManageOldType, forms.Form): required=False) is_complete = forms.NullBooleanField(label=_(u"Is complete?"), required=False) - material_type = widgets.MultipleAutocompleteField( - model=models.MaterialType, label=_(u"Material type"), required=False) + material_type = widgets.Select2MultipleField( + model=models.MaterialType, label=_(u"Material type"), required=False, + available=True + ) conservatory_state = forms.ChoiceField(label=_(u"Conservatory state"), choices=[], required=False) conservatory_comment = forms.CharField( label=_(u"Conservatory comment"), required=False, widget=forms.Textarea) - object_type = widgets.MultipleAutocompleteField( - model=models.ObjectType, label=_(u"Object types"), required=False) + object_type = widgets.Select2MultipleField( + model=models.ObjectType, label=_(u"Object types"), required=False, + available=True + ) preservation_to_consider = forms.MultipleChoiceField( label=_(u"Preservation type"), choices=[], - widget=widgets.CheckboxSelectMultiple, required=False) + widget=widgets.Select2Multiple, required=False) integritie = forms.MultipleChoiceField( label=_(u"Integrity / interest"), choices=[], widget=widgets.CheckboxSelectMultiple, required=False) diff --git a/archaeological_finds/forms_treatments.py b/archaeological_finds/forms_treatments.py index 3c6668c9d..b3ad8b115 100644 --- a/archaeological_finds/forms_treatments.py +++ b/archaeological_finds/forms_treatments.py @@ -95,7 +95,7 @@ class BaseTreatmentForm(ManageOldType, forms.Form): label=_(u"Other ref."), max_length=200, required=False) year = forms.IntegerField(label=_("Year"), initial=lambda: datetime.datetime.now().year, - validators=[validators.MinValueValidator(1900), + validators=[validators.MinValueValidator(1600), validators.MaxValueValidator(2100)]) treatment_type = forms.MultipleChoiceField( label=_(u"Treatment type"), choices=[], @@ -405,7 +405,7 @@ class TreatmentFileForm(ManageOldType, forms.Form): max_length=1000, required=False) year = forms.IntegerField(label=_("Year"), initial=lambda: datetime.datetime.now().year, - validators=[validators.MinValueValidator(1900), + validators=[validators.MinValueValidator(1600), validators.MaxValueValidator(2100)]) internal_reference = forms.CharField( label=_(u"Internal ref."), max_length=60, required=False) diff --git a/archaeological_finds/ishtar_menu.py b/archaeological_finds/ishtar_menu.py index 44a19dc02..4877e442c 100644 --- a/archaeological_finds/ishtar_menu.py +++ b/archaeological_finds/ishtar_menu.py @@ -112,23 +112,23 @@ MENU_SECTIONS = [ MenuItem('treatmentfle_search', _(u"Search"), model=models.TreatmentFile, - access_controls=['view_find', - 'view_own_find']), + access_controls=['view_treatmentfile', + 'view_own_treatmentfile']), MenuItem('treatmentfle_creation', _(u"Creation"), model=models.TreatmentFile, - access_controls=['change_find', - 'change_own_find']), + access_controls=['change_treatmentfile', + 'change_own_treatmentfile']), MenuItem('treatmentfle_modification', _(u"Modification"), model=models.TreatmentFile, - access_controls=['change_find', - 'change_own_find']), + access_controls=['change_treatmentfile', + 'change_own_treatmentfile']), MenuItem('treatmentfle_deletion', _(u"Deletion"), model=models.TreatmentFile, - access_controls=['change_find', - 'change_own_find']), + access_controls=['change_treatmentfile', + 'change_own_treatmentfile']), SectionItem( 'admin_act_fletreatments', _(u"Administrative act"), childs=[ @@ -192,23 +192,23 @@ MENU_SECTIONS = [ MenuItem('treatment_search', _(u"Search"), model=models.Treatment, - access_controls=['view_find', - 'view_own_find']), + access_controls=['view_treatment', + 'view_own_treatment']), MenuItem('treatment_creation', _(u"Creation"), model=models.Treatment, - access_controls=['change_find', - 'change_own_find']), + access_controls=['change_treatment', + 'change_own_treatment']), MenuItem('treatment_modification', _(u"Modification"), model=models.Treatment, - access_controls=['change_find', - 'change_own_find']), + access_controls=['change_treatment', + 'change_own_treatment']), MenuItem('treatment_deletion', _(u"Deletion"), model=models.Treatment, - access_controls=['change_find', - 'change_own_find']), + access_controls=['change_treatment', + 'change_own_treatment']), ]), SectionItem( 'admin_act_treatments', _(u"Administrative act"), diff --git a/archaeological_finds/locale/django.pot b/archaeological_finds/locale/django.pot index d48cbe962..5947def9d 100644 --- a/archaeological_finds/locale/django.pot +++ b/archaeological_finds/locale/django.pot @@ -5,370 +5,371 @@ # Valérie-Emma Leroux <emma@iggdrasil.net>, 2016. #zanata # Étienne Loks <etienne.loks@iggdrasil.net>, 2016. #zanata # Valérie-Emma Leroux <emma@iggdrasil.net>, 2017. #zanata +# Étienne Loks <etienne.loks@iggdrasil.net>, 2017. #zanata msgid "" msgstr "" -#: forms.py:93 forms.py:97 models_finds.py:505 wizards.py:64 +#: forms.py:93 forms.py:97 models_finds.py:519 wizards.py:64 msgid "Context record" msgstr "" -#: forms.py:126 ishtar_menu.py:32 models_finds.py:668 models_finds.py:1071 -#: models_finds.py:1080 models_treatments.py:281 +#: forms.py:126 ishtar_menu.py:32 models_finds.py:683 models_finds.py:1114 +#: models_finds.py:1135 models_treatments.py:298 #: templates/ishtar/sheet_find.html:5 msgid "Find" msgstr "" -#: forms.py:140 forms.py:333 forms.py:601 models_finds.py:151 -#: models_finds.py:599 +#: forms.py:140 forms.py:337 forms.py:605 models_finds.py:150 +#: models_finds.py:613 msgid "Free ID" msgstr "" -#: forms.py:142 models_finds.py:651 +#: forms.py:142 models_finds.py:666 msgid "Previous ID" msgstr "" -#: forms.py:143 forms.py:364 forms_treatments.py:134 models_finds.py:155 -#: models_finds.py:600 models_treatments.py:127 +#: forms.py:143 forms.py:368 forms_treatments.py:134 models_finds.py:154 +#: models_finds.py:614 models_treatments.py:128 msgid "Description" msgstr "" -#: forms.py:146 forms.py:366 models_finds.py:164 +#: forms.py:146 forms.py:370 models_finds.py:163 msgid "Batch/object" msgstr "" -#: forms.py:148 models_finds.py:628 +#: forms.py:148 models_finds.py:643 msgid "Is complete?" msgstr "" -#: forms.py:151 forms.py:354 forms.py:605 models_finds.py:51 +#: forms.py:151 forms.py:358 forms.py:609 models_finds.py:50 msgid "Material type" msgstr "" -#: forms.py:152 forms.py:358 models_finds.py:63 models_finds.py:604 +#: forms.py:154 forms.py:362 models_finds.py:62 models_finds.py:618 msgid "Conservatory state" msgstr "" -#: forms.py:155 models_finds.py:606 +#: forms.py:157 models_finds.py:620 msgid "Conservatory comment" msgstr "" -#: forms.py:158 models_finds.py:113 models_finds.py:631 +#: forms.py:160 models_finds.py:112 models_finds.py:646 msgid "Object types" msgstr "" -#: forms.py:160 forms.py:357 models_finds.py:72 +#: forms.py:164 forms.py:361 models_finds.py:71 msgid "Preservation type" msgstr "" -#: forms.py:163 forms.py:360 models_finds.py:633 +#: forms.py:167 forms.py:364 models_finds.py:648 msgid "Integrity / interest" msgstr "" -#: forms.py:166 forms.py:362 models_finds.py:636 +#: forms.py:170 forms.py:366 models_finds.py:651 msgid "Remarkability" msgstr "" -#: forms.py:169 models_finds.py:169 +#: forms.py:173 models_finds.py:168 msgid "Point of topographic reference" msgstr "" -#: forms.py:172 models_finds.py:171 +#: forms.py:176 models_finds.py:170 msgid "X" msgstr "" -#: forms.py:173 models_finds.py:172 +#: forms.py:177 models_finds.py:171 msgid "Y" msgstr "" -#: forms.py:174 models_finds.py:173 +#: forms.py:178 models_finds.py:172 msgid "Z" msgstr "" -#: forms.py:176 models_finds.py:181 +#: forms.py:180 models_finds.py:180 msgid "Spatial Reference System" msgstr "" -#: forms.py:179 models_finds.py:174 +#: forms.py:183 models_finds.py:173 msgid "Estimated error for X" msgstr "" -#: forms.py:181 models_finds.py:176 +#: forms.py:185 models_finds.py:175 msgid "Estimated error for Y" msgstr "" -#: forms.py:183 models_finds.py:178 +#: forms.py:187 models_finds.py:177 msgid "Estimated error for Z" msgstr "" -#: forms.py:184 models_finds.py:640 +#: forms.py:188 models_finds.py:655 msgid "Length (cm)" msgstr "" -#: forms.py:185 models_finds.py:641 +#: forms.py:189 models_finds.py:656 msgid "Width (cm)" msgstr "" -#: forms.py:186 models_finds.py:642 +#: forms.py:190 models_finds.py:657 msgid "Height (cm)" msgstr "" -#: forms.py:187 models_finds.py:643 +#: forms.py:191 models_finds.py:658 msgid "Diameter (cm)" msgstr "" -#: forms.py:188 models_finds.py:644 +#: forms.py:192 models_finds.py:659 msgid "Thickness (cm)" msgstr "" -#: forms.py:189 forms.py:606 models_finds.py:611 +#: forms.py:193 forms.py:610 models_finds.py:625 msgid "Volume (l)" msgstr "" -#: forms.py:190 forms.py:607 models_finds.py:612 +#: forms.py:194 forms.py:611 models_finds.py:626 msgid "Weight (g)" msgstr "" -#: forms.py:192 models_finds.py:645 +#: forms.py:196 models_finds.py:660 msgid "Dimensions comment" msgstr "" -#: forms.py:193 forms.py:608 models_finds.py:615 +#: forms.py:197 forms.py:612 models_finds.py:629 msgid "Find number" msgstr "" -#: forms.py:195 models_finds.py:639 +#: forms.py:199 models_finds.py:654 msgid "Minimum number of individuals (MNI)" msgstr "" -#: forms.py:196 models_finds.py:647 +#: forms.py:200 models_finds.py:662 msgid "Mark" msgstr "" -#: forms.py:197 forms.py:367 models_finds.py:653 +#: forms.py:201 forms.py:371 models_finds.py:668 msgid "Check" msgstr "" -#: forms.py:199 models_finds.py:655 +#: forms.py:203 models_finds.py:670 msgid "Check date" msgstr "" -#: forms.py:200 forms_treatments.py:132 forms_treatments.py:434 -#: models_finds.py:156 models_finds.py:648 models_treatments.py:126 -#: models_treatments.py:494 +#: forms.py:204 forms_treatments.py:132 forms_treatments.py:434 +#: models_finds.py:155 models_finds.py:663 models_treatments.py:127 +#: models_treatments.py:511 msgid "Comment" msgstr "" -#: forms.py:203 models_finds.py:649 +#: forms.py:207 models_finds.py:664 msgid "Comment on dating" msgstr "" -#: forms.py:204 models_finds.py:657 +#: forms.py:208 models_finds.py:672 msgid "Estimated value" msgstr "" -#: forms.py:206 forms_treatments.py:151 +#: forms.py:210 forms_treatments.py:151 msgid "Image" msgstr "" -#: forms.py:207 forms_treatments.py:152 +#: forms.py:211 forms_treatments.py:152 #, python-format msgid "" "<p>Heavy images are resized to: %(width)dx%(height)d (ratio is preserved).</" "p>" msgstr "" -#: forms.py:281 +#: forms.py:285 msgid "You should at least provide X, Y and the spatial reference system used." msgstr "" -#: forms.py:290 +#: forms.py:294 msgid "Coordinates are not relevant for the spatial reference system used: {}." msgstr "" -#: forms.py:296 forms.py:327 models_finds.py:623 +#: forms.py:300 forms.py:331 models_finds.py:637 msgid "Dating" msgstr "" -#: forms.py:301 forms.py:353 +#: forms.py:305 forms.py:357 msgid "Period" msgstr "" -#: forms.py:302 forms_treatments.py:138 forms_treatments.py:436 -#: models_finds.py:1085 models_treatments.py:129 models_treatments.py:292 +#: forms.py:306 forms_treatments.py:138 forms_treatments.py:436 +#: models_finds.py:1140 models_treatments.py:130 models_treatments.py:309 #: templates/ishtar/sheet_find.html:91 templates/ishtar/sheet_find.html:133 msgid "Start date" msgstr "" -#: forms.py:304 models_finds.py:1086 models_treatments.py:293 +#: forms.py:308 models_finds.py:1141 models_treatments.py:310 #: templates/ishtar/sheet_find.html:92 templates/ishtar/sheet_find.html:134 msgid "End date" msgstr "" -#: forms.py:305 +#: forms.py:309 msgid "Quality" msgstr "" -#: forms.py:307 +#: forms.py:311 msgid "Dating type" msgstr "" -#: forms.py:309 +#: forms.py:313 msgid "Precise dating" msgstr "" -#: forms.py:331 models_finds.py:188 +#: forms.py:335 models_finds.py:187 msgid "Short ID" msgstr "" -#: forms.py:332 models_finds.py:191 +#: forms.py:336 models_finds.py:190 msgid "Complete ID" msgstr "" -#: forms.py:336 forms_treatments.py:54 forms_treatments.py:96 +#: forms.py:340 forms_treatments.py:54 forms_treatments.py:96 #: forms_treatments.py:284 forms_treatments.py:356 forms_treatments.py:406 -#: forms_treatments.py:489 models_treatments.py:102 models_treatments.py:466 +#: forms_treatments.py:489 models_treatments.py:103 models_treatments.py:483 msgid "Year" msgstr "" -#: forms.py:338 +#: forms.py:342 msgid "Operation's number (index by year)" msgstr "" -#: forms.py:341 +#: forms.py:345 msgid "Code PATRIARCHE" msgstr "" -#: forms.py:345 +#: forms.py:349 msgid "Archaeological site" msgstr "" -#: forms.py:351 +#: forms.py:355 msgid "Search within related operations" msgstr "" -#: forms.py:355 models_finds.py:112 +#: forms.py:359 models_finds.py:111 msgid "Object type" msgstr "" -#: forms.py:368 forms_treatments.py:57 +#: forms.py:372 forms_treatments.py:57 msgid "Has an image?" msgstr "" -#: forms.py:417 +#: forms.py:421 msgid "Warehouse (location)" msgstr "" -#: forms.py:423 +#: forms.py:427 msgid "Warehouse (responsible)" msgstr "" -#: forms.py:428 +#: forms.py:432 msgid "Container ID" msgstr "" -#: forms.py:429 +#: forms.py:433 msgid "Container ref." msgstr "" -#: forms.py:433 forms.py:456 views.py:149 +#: forms.py:437 forms.py:460 views.py:149 msgid "Find search" msgstr "" -#: forms.py:481 templates/ishtar/sheet_treatment.html:46 +#: forms.py:485 templates/ishtar/sheet_treatment.html:46 msgid "Upstream finds" msgstr "" -#: forms.py:483 models_finds.py:669 +#: forms.py:487 models_finds.py:684 msgid "Finds" msgstr "" -#: forms.py:495 +#: forms.py:499 msgid "You should at least select one archaeological find." msgstr "" -#: forms.py:598 +#: forms.py:602 msgid "Resulting find" msgstr "" -#: forms.py:603 +#: forms.py:607 msgid "Precise description" msgstr "" -#: forms.py:618 +#: forms.py:622 msgid "Resulting finds" msgstr "" -#: forms.py:623 +#: forms.py:627 msgid "Would you like to delete this find?" msgstr "" -#: forms.py:627 models_treatments.py:90 +#: forms.py:631 models_treatments.py:91 msgid "Upstream find" msgstr "" -#: forms.py:640 +#: forms.py:644 msgid "Archaeological find search" msgstr "" -#: forms.py:642 +#: forms.py:646 msgid "You should select an archaeological find." msgstr "" -#: forms.py:647 +#: forms.py:651 msgid "Year of the operation" msgstr "" -#: forms.py:649 +#: forms.py:653 msgid "Numeric reference" msgstr "" -#: forms.py:656 +#: forms.py:660 msgid "Period of the archaeological find" msgstr "" -#: forms.py:658 +#: forms.py:662 msgid "Material type of the archaeological find" msgstr "" -#: forms.py:660 +#: forms.py:664 msgid "Description of the archaeological find" msgstr "" -#: forms.py:672 forms_treatments.py:590 forms_treatments.py:616 +#: forms.py:676 forms_treatments.py:590 forms_treatments.py:616 msgid "Documentation search" msgstr "" -#: forms.py:674 forms_treatments.py:592 forms_treatments.py:618 +#: forms.py:678 forms_treatments.py:592 forms_treatments.py:618 msgid "You should select a document." msgstr "" -#: forms.py:691 +#: forms.py:695 msgid "Another basket already exists with this name." msgstr "" -#: forms.py:701 forms.py:705 forms_treatments.py:175 ishtar_menu.py:57 +#: forms.py:705 forms.py:709 forms_treatments.py:175 ishtar_menu.py:57 msgid "Basket" msgstr "" -#: forms_treatments.py:52 forms_treatments.py:92 models_treatments.py:98 +#: forms_treatments.py:52 forms_treatments.py:92 models_treatments.py:99 #: templates/ishtar/sheet_find.html:85 templates/ishtar/sheet_find.html:127 msgid "Label" msgstr "" -#: forms_treatments.py:53 forms_treatments.py:95 models_treatments.py:100 +#: forms_treatments.py:53 forms_treatments.py:95 models_treatments.py:101 msgid "Other ref." msgstr "" #: forms_treatments.py:55 forms_treatments.py:237 forms_treatments.py:285 #: forms_treatments.py:348 forms_treatments.py:357 forms_treatments.py:459 -#: forms_treatments.py:490 forms_treatments.py:557 models_treatments.py:104 -#: models_treatments.py:468 +#: forms_treatments.py:490 forms_treatments.py:557 models_treatments.py:105 +#: models_treatments.py:485 msgid "Index" msgstr "" #: forms_treatments.py:56 forms_treatments.py:101 forms_treatments.py:301 -#: forms_treatments.py:578 models_treatments.py:56 models_treatments.py:109 -#: models_treatments.py:291 +#: forms_treatments.py:578 models_treatments.py:56 models_treatments.py:110 +#: models_treatments.py:308 msgid "Treatment type" msgstr "" @@ -380,7 +381,7 @@ msgstr "" msgid "Base treatment" msgstr "" -#: forms_treatments.py:103 models_treatments.py:92 models_treatments.py:111 +#: forms_treatments.py:103 models_treatments.py:93 models_treatments.py:112 #: templates/ishtar/sheet_find.html:87 templates/ishtar/sheet_find.html:129 msgid "State" msgstr "" @@ -389,15 +390,15 @@ msgstr "" msgid "Target" msgstr "" -#: forms_treatments.py:107 forms_treatments.py:417 models_treatments.py:119 +#: forms_treatments.py:107 forms_treatments.py:417 models_treatments.py:120 msgid "Responsible" msgstr "" -#: forms_treatments.py:113 models_treatments.py:122 +#: forms_treatments.py:113 models_treatments.py:123 msgid "Organization" msgstr "" -#: forms_treatments.py:119 models_treatments.py:114 models_treatments.py:294 +#: forms_treatments.py:119 models_treatments.py:115 models_treatments.py:311 msgid "Location" msgstr "" @@ -409,12 +410,12 @@ msgstr "" msgid "External ref." msgstr "" -#: forms_treatments.py:136 models_treatments.py:128 +#: forms_treatments.py:136 models_treatments.py:129 msgid "Goal" msgstr "" -#: forms_treatments.py:140 forms_treatments.py:442 models_treatments.py:130 -#: models_treatments.py:488 +#: forms_treatments.py:140 forms_treatments.py:442 models_treatments.py:131 +#: models_treatments.py:505 msgid "Closing date" msgstr "" @@ -460,12 +461,12 @@ msgstr "" msgid "Another treatment with this index exists for {}." msgstr "" -#: forms_treatments.py:262 models_treatments.py:107 +#: forms_treatments.py:262 models_treatments.py:108 msgid "Associated request" msgstr "" #: forms_treatments.py:266 forms_treatments.py:397 ishtar_menu.py:108 -#: models_treatments.py:499 models_treatments.py:521 models_treatments.py:584 +#: models_treatments.py:516 models_treatments.py:544 models_treatments.py:619 #: wizards.py:187 templates/ishtar/sheet_treatmentfile.html:5 msgid "Treatment request" msgstr "" @@ -521,7 +522,7 @@ msgstr "" msgid "Modified by" msgstr "" -#: forms_treatments.py:354 forms_treatments.py:404 models_treatments.py:473 +#: forms_treatments.py:354 forms_treatments.py:404 models_treatments.py:490 msgid "Name" msgstr "" @@ -529,7 +530,7 @@ msgstr "" msgid "Internal ref." msgstr "" -#: forms_treatments.py:358 forms_treatments.py:415 models_treatments.py:91 +#: forms_treatments.py:358 forms_treatments.py:415 models_treatments.py:92 #: templates/ishtar/sheet_find.html:86 templates/ishtar/sheet_find.html:128 #: templates/ishtar/sheet_find.html:228 msgid "Type" @@ -539,12 +540,12 @@ msgstr "" msgid "In charge" msgstr "" -#: forms_treatments.py:366 forms_treatments.py:423 models_treatments.py:482 +#: forms_treatments.py:366 forms_treatments.py:423 models_treatments.py:499 #: templates/ishtar/sheet_treatmentfile.html:31 msgid "Applicant" msgstr "" -#: forms_treatments.py:372 forms_treatments.py:429 models_treatments.py:486 +#: forms_treatments.py:372 forms_treatments.py:429 models_treatments.py:503 #: templates/ishtar/sheet_treatmentfile.html:38 msgid "Applicant organisation" msgstr "" @@ -553,7 +554,7 @@ msgstr "" msgid "Treatment request search" msgstr "" -#: forms_treatments.py:439 models_treatments.py:492 +#: forms_treatments.py:439 models_treatments.py:509 msgid "Reception date" msgstr "" @@ -585,8 +586,8 @@ msgstr "" msgid "Treatment request internal reference" msgstr "" -#: forms_treatments.py:508 forms_treatments.py:604 models_treatments.py:451 -#: models_treatments.py:475 +#: forms_treatments.py:508 forms_treatments.py:604 models_treatments.py:468 +#: models_treatments.py:492 msgid "Treatment request type" msgstr "" @@ -628,7 +629,7 @@ msgstr "" msgid "Documentation" msgstr "" -#: ishtar_menu.py:133 ishtar_menu.py:214 models_finds.py:1082 +#: ishtar_menu.py:133 ishtar_menu.py:214 models_finds.py:1137 msgid "Administrative act" msgstr "" @@ -641,8 +642,8 @@ msgstr "" msgid "Source" msgstr "" -#: ishtar_menu.py:185 models_treatments.py:147 models_treatments.py:283 -#: models_treatments.py:567 models_treatments.py:570 +#: ishtar_menu.py:185 models_treatments.py:148 models_treatments.py:300 +#: models_treatments.py:590 models_treatments.py:593 #: templates/ishtar/sheet_treatment.html:5 msgid "Treatment" msgstr "" @@ -651,113 +652,113 @@ msgstr "" msgid "Simple treatments" msgstr "" -#: models_finds.py:44 +#: models_finds.py:43 msgid "Code" msgstr "" -#: models_finds.py:45 +#: models_finds.py:44 msgid "Recommendation" msgstr "" -#: models_finds.py:48 +#: models_finds.py:47 msgid "Parent material" msgstr "" -#: models_finds.py:52 models_finds.py:525 models_finds.py:602 +#: models_finds.py:51 models_finds.py:539 models_finds.py:616 msgid "Material types" msgstr "" -#: models_finds.py:60 +#: models_finds.py:59 msgid "Parent conservatory state" msgstr "" -#: models_finds.py:64 +#: models_finds.py:63 msgid "Conservatory states" msgstr "" -#: models_finds.py:73 +#: models_finds.py:72 msgid "Preservation types" msgstr "" -#: models_finds.py:81 +#: models_finds.py:80 msgid "Integrity / interest type" msgstr "" -#: models_finds.py:82 +#: models_finds.py:81 msgid "Integrity / interest types" msgstr "" -#: models_finds.py:90 +#: models_finds.py:89 msgid "Remarkability type" msgstr "" -#: models_finds.py:91 +#: models_finds.py:90 msgid "Remarkability types" msgstr "" -#: models_finds.py:98 models_finds.py:598 models_treatments.py:40 -#: models_treatments.py:287 +#: models_finds.py:97 models_finds.py:612 models_treatments.py:40 +#: models_treatments.py:304 msgid "Order" msgstr "" -#: models_finds.py:100 +#: models_finds.py:99 msgid "Batch type" msgstr "" -#: models_finds.py:101 +#: models_finds.py:100 msgid "Batch types" msgstr "" -#: models_finds.py:109 +#: models_finds.py:108 msgid "Parent" msgstr "" -#: models_finds.py:152 models_finds.py:595 models_treatments.py:124 -#: models_treatments.py:471 +#: models_finds.py:151 models_finds.py:609 models_treatments.py:125 +#: models_treatments.py:488 msgid "External ID" msgstr "" -#: models_finds.py:154 models_finds.py:597 +#: models_finds.py:153 models_finds.py:611 msgid "External ID is set automatically" msgstr "" -#: models_finds.py:157 +#: models_finds.py:156 msgid "Special interest" msgstr "" -#: models_finds.py:161 +#: models_finds.py:160 msgid "Context Record" msgstr "" -#: models_finds.py:162 +#: models_finds.py:161 msgid "Discovery date" msgstr "" -#: models_finds.py:167 +#: models_finds.py:166 msgid "Material index" msgstr "" -#: models_finds.py:183 +#: models_finds.py:182 msgid "Point (2D)" msgstr "" -#: models_finds.py:184 +#: models_finds.py:183 msgid "Point" msgstr "" -#: models_finds.py:185 +#: models_finds.py:184 msgid "Line" msgstr "" -#: models_finds.py:186 +#: models_finds.py:185 msgid "Polygon" msgstr "" -#: models_finds.py:189 models_finds.py:192 +#: models_finds.py:188 models_finds.py:191 msgid "Cached value - do not edit" msgstr "" -#: models_finds.py:197 models_finds.py:593 +#: models_finds.py:197 models_finds.py:607 msgid "Base find" msgstr "" @@ -785,149 +786,169 @@ msgstr "" msgid "Can delete own Base find" msgstr "" -#: models_finds.py:430 +#: models_finds.py:443 msgid "g" msgstr "" -#: models_finds.py:431 +#: models_finds.py:444 msgid "kg" msgstr "" -#: models_finds.py:433 +#: models_finds.py:446 msgid "Not checked" msgstr "" -#: models_finds.py:434 +#: models_finds.py:447 msgid "Checked but incorrect" msgstr "" -#: models_finds.py:435 +#: models_finds.py:448 msgid "Checked and correct" msgstr "" -#: models_finds.py:506 +#: models_finds.py:520 msgid "Base find - Short ID" msgstr "" -#: models_finds.py:507 +#: models_finds.py:521 msgid "Base find - Complete ID" msgstr "" -#: models_finds.py:509 +#: models_finds.py:523 msgid "Operation (code)" msgstr "" -#: models_finds.py:511 +#: models_finds.py:525 msgid "Town" msgstr "" -#: models_finds.py:513 +#: models_finds.py:527 msgid "Operation (name)" msgstr "" -#: models_finds.py:515 +#: models_finds.py:529 msgid "Parcel" msgstr "" -#: models_finds.py:516 +#: models_finds.py:530 msgid "Batch" msgstr "" -#: models_finds.py:517 +#: models_finds.py:531 msgid "Base find - Comment" msgstr "" -#: models_finds.py:518 +#: models_finds.py:532 msgid "Base find - Description" msgstr "" -#: models_finds.py:519 +#: models_finds.py:533 msgid "Base find - Topographic localisation" msgstr "" -#: models_finds.py:521 +#: models_finds.py:535 msgid "Base find - Special interest" msgstr "" -#: models_finds.py:522 +#: models_finds.py:536 msgid "Base find - Discovery date" msgstr "" -#: models_finds.py:523 models_finds.py:626 models_treatments.py:131 -#: models_treatments.py:295 templates/ishtar/sheet_find.html:90 +#: models_finds.py:537 models_finds.py:640 models_treatments.py:132 +#: models_treatments.py:312 templates/ishtar/sheet_find.html:90 #: templates/ishtar/sheet_find.html:132 msgid "Container" msgstr "" -#: models_finds.py:524 +#: models_finds.py:538 msgid "Periods" msgstr "" -#: models_finds.py:609 +#: models_finds.py:623 msgid "Type of preservation to consider" msgstr "" -#: models_finds.py:613 +#: models_finds.py:627 msgid "Weight unit" msgstr "" -#: models_finds.py:619 templates/ishtar/sheet_find.html:78 +#: models_finds.py:633 templates/ishtar/sheet_find.html:78 msgid "Upstream treatment" msgstr "" -#: models_finds.py:622 templates/ishtar/sheet_find.html:120 +#: models_finds.py:636 templates/ishtar/sheet_find.html:120 msgid "Downstream treatment" msgstr "" -#: models_finds.py:660 +#: models_finds.py:675 msgid "Collection" msgstr "" -#: models_finds.py:662 models_treatments.py:143 models_treatments.py:495 +#: models_finds.py:677 models_treatments.py:144 models_treatments.py:512 msgid "Cached name" msgstr "" -#: models_finds.py:671 +#: models_finds.py:686 msgid "Can view all Finds" msgstr "" -#: models_finds.py:672 +#: models_finds.py:687 msgid "Can view own Find" msgstr "" -#: models_finds.py:673 +#: models_finds.py:688 msgid "Can add own Find" msgstr "" -#: models_finds.py:674 +#: models_finds.py:689 msgid "Can change own Find" msgstr "" -#: models_finds.py:675 +#: models_finds.py:690 msgid "Can delete own Find" msgstr "" -#: models_finds.py:681 +#: models_finds.py:696 msgid "FIND" msgstr "" -#: models_finds.py:1069 +#: models_finds.py:1100 msgid "Find documentation" msgstr "" -#: models_finds.py:1070 +#: models_finds.py:1101 msgid "Find documentations" msgstr "" -#: models_finds.py:1083 +#: models_finds.py:1104 +msgid "Can view all Find sources" +msgstr "" + +#: models_finds.py:1106 +msgid "Can view own Find source" +msgstr "" + +#: models_finds.py:1108 +msgid "Can add own Find source" +msgstr "" + +#: models_finds.py:1110 +msgid "Can change own Find source" +msgstr "" + +#: models_finds.py:1112 +msgid "Can delete own Find source" +msgstr "" + +#: models_finds.py:1138 msgid "Person" msgstr "" -#: models_finds.py:1089 +#: models_finds.py:1144 msgid "Property" msgstr "" -#: models_finds.py:1090 +#: models_finds.py:1145 msgid "Properties" msgstr "" @@ -967,136 +988,200 @@ msgstr "" msgid "Treatment state types" msgstr "" -#: models_treatments.py:89 +#: models_treatments.py:90 msgid "Downstream find" msgstr "" -#: models_treatments.py:116 +#: models_treatments.py:117 msgid "Location where the treatment is done. Target warehouse for a move." msgstr "" -#: models_treatments.py:133 +#: models_treatments.py:134 msgid "Estimated cost" msgstr "" -#: models_treatments.py:135 +#: models_treatments.py:136 msgid "Quoted cost" msgstr "" -#: models_treatments.py:137 +#: models_treatments.py:138 msgid "Realized cost" msgstr "" -#: models_treatments.py:139 +#: models_treatments.py:140 msgid "Insurance cost" msgstr "" -#: models_treatments.py:141 +#: models_treatments.py:142 msgid "Target a basket" msgstr "" -#: models_treatments.py:148 templates/ishtar/sheet_find.html:75 +#: models_treatments.py:149 templates/ishtar/sheet_find.html:75 #: templates/ishtar/sheet_treatmentfile.html:46 msgid "Treatments" msgstr "" -#: models_treatments.py:151 +#: models_treatments.py:152 msgid "Can view all Treatments" msgstr "" -#: models_treatments.py:152 +#: models_treatments.py:153 msgid "Can view own Treatment" msgstr "" -#: models_treatments.py:153 +#: models_treatments.py:154 msgid "Can add own Treatment" msgstr "" -#: models_treatments.py:154 +#: models_treatments.py:155 msgid "Can change own Treatment" msgstr "" -#: models_treatments.py:155 +#: models_treatments.py:156 msgid "Can delete own Treatment" msgstr "" -#: models_treatments.py:167 +#: models_treatments.py:168 msgid "TREATMENT" msgstr "" -#: models_treatments.py:296 templates/ishtar/sheet_find.html:89 +#: models_treatments.py:313 templates/ishtar/sheet_find.html:89 #: templates/ishtar/sheet_find.html:131 msgid "Doer" msgstr "" -#: models_treatments.py:297 models_treatments.py:298 +#: models_treatments.py:314 models_treatments.py:315 msgid "Related finds" msgstr "" -#: models_treatments.py:440 +#: models_treatments.py:457 msgid "Is upstream" msgstr "" -#: models_treatments.py:452 +#: models_treatments.py:469 msgid "Treatment request types" msgstr "" -#: models_treatments.py:469 +#: models_treatments.py:486 msgid "Internal reference" msgstr "" -#: models_treatments.py:478 +#: models_treatments.py:495 msgid "Person in charge" msgstr "" -#: models_treatments.py:490 +#: models_treatments.py:507 msgid "Creation date" msgstr "" -#: models_treatments.py:500 +#: models_treatments.py:517 msgid "Treatment requests" msgstr "" -#: models_treatments.py:504 +#: models_treatments.py:521 msgid "Can view all Treatment requests" msgstr "" -#: models_treatments.py:506 +#: models_treatments.py:523 +msgid "Can add Treatment request" +msgstr "" + +#: models_treatments.py:525 +msgid "Can change Treatment request" +msgstr "" + +#: models_treatments.py:527 +msgid "Can delete Treatment request" +msgstr "" + +#: models_treatments.py:529 msgid "Can view own Treatment request" msgstr "" -#: models_treatments.py:508 +#: models_treatments.py:531 msgid "Can add own Treatment request" msgstr "" -#: models_treatments.py:510 +#: models_treatments.py:533 msgid "Can change own Treatment request" msgstr "" -#: models_treatments.py:512 +#: models_treatments.py:535 msgid "Can delete own Treatment request" msgstr "" -#: models_treatments.py:574 +#: models_treatments.py:597 msgid "Treatment documentation" msgstr "" -#: models_treatments.py:575 +#: models_treatments.py:598 msgid "Treament documentations" msgstr "" -#: models_treatments.py:588 +#: models_treatments.py:601 +msgid "Can view all Treatment source" +msgstr "" + +#: models_treatments.py:603 +msgid "Can view own Treatment source" +msgstr "" + +#: models_treatments.py:605 +msgid "Can add own Treatment source" +msgstr "" + +#: models_treatments.py:607 +msgid "Can change own Treatment source" +msgstr "" + +#: models_treatments.py:609 +msgid "Can delete own Treatment source" +msgstr "" + +#: models_treatments.py:623 msgid "Treatment file" msgstr "" -#: models_treatments.py:592 +#: models_treatments.py:627 msgid "Treatment request documentation" msgstr "" -#: models_treatments.py:593 +#: models_treatments.py:628 msgid "Treatment request documentations" msgstr "" +#: models_treatments.py:631 +msgid "Can view all Treatment request source" +msgstr "" + +#: models_treatments.py:633 +msgid "Can add Treatment request source" +msgstr "" + +#: models_treatments.py:635 +msgid "Can change Treatment request source" +msgstr "" + +#: models_treatments.py:637 +msgid "Can delete Treatment request source" +msgstr "" + +#: models_treatments.py:639 +msgid "Can view own Treatment request source" +msgstr "" + +#: models_treatments.py:641 +msgid "Can add own Treatment request source" +msgstr "" + +#: models_treatments.py:643 +msgid "Can change own Treatment request source" +msgstr "" + +#: models_treatments.py:645 +msgid "Can delete own Treatment request source" +msgstr "" + #: views.py:138 msgid "New find" msgstr "" diff --git a/archaeological_finds/models_finds.py b/archaeological_finds/models_finds.py index c54fd1ed9..d33933264 100644 --- a/archaeological_finds/models_finds.py +++ b/archaeological_finds/models_finds.py @@ -31,13 +31,12 @@ from ishtar_common.utils import cached_label_changed, post_save_point from ishtar_common.models import GeneralType, ImageModel, BaseHistorizedItem, \ ShortMenuItem, LightHistorizedItem, HistoricalRecords, OwnPerms, Source, \ - Person, Basket, get_external_id, post_save_cache + Person, Basket, get_external_id, post_save_cache, ValueGetter from archaeological_operations.models import AdministrativeAct from archaeological_context_records.models import ContextRecord, Dating from ishtar_common.models import PRIVATE_FIELDS, SpatialReferenceSystem -from archaeological_warehouse.models import Container, Collection class MaterialType(GeneralType): @@ -192,6 +191,7 @@ class BaseFind(BaseHistorizedItem, OwnPerms): help_text=_(u"Cached value - do not edit")) history = HistoricalRecords() RELATED_POST_PROCESS = ['find'] + CACHED_LABELS = ['cache_short_id', 'cache_complete_id'] class Meta: verbose_name = _(u"Base find") @@ -254,6 +254,9 @@ class BaseFind(BaseHistorizedItem, OwnPerms): ).format(self.index)) return settings.JOINT.join(c_id) + def _generate_cache_complete_id(self): + return self.complete_id() + def short_id(self): # OPE|FIND_index c_id = [self._ope_code()] @@ -261,6 +264,9 @@ class BaseFind(BaseHistorizedItem, OwnPerms): ).format(self.index)) return settings.JOINT.join(c_id) + def _generate_cache_short_id(self): + return self.short_id() + def full_label(self): return self._real_label() or self._temp_label() or u"" @@ -323,7 +329,8 @@ class BaseFind(BaseHistorizedItem, OwnPerms): return returned @classmethod - def cached_label_bulk_update(cls, operation_id=None, parcel_id=None): + def cached_label_bulk_update(cls, operation_id=None, parcel_id=None, + context_record_id=None): if operation_id: filters = """ INNER JOIN archaeological_context_records_contextrecord acr @@ -338,6 +345,12 @@ class BaseFind(BaseHistorizedItem, OwnPerms): """ args = [int(parcel_id)] kwargs = {'parcel_id': parcel_id} + elif context_record_id: + filters = """ + WHERE mybf.context_record_id = %s + """ + args = [int(context_record_id)] + kwargs = {'context_record_id': context_record_id} else: return @@ -477,7 +490,8 @@ class FBulkView(object): """ -class Find(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): +class Find(ValueGetter, BaseHistorizedItem, ImageModel, OwnPerms, + ShortMenuItem): CHECK_DICT = dict(CHECK_CHOICES) SHOW_URL = 'show-find' SLUG = 'find' @@ -623,7 +637,8 @@ class Find(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): datings = models.ManyToManyField(Dating, verbose_name=_(u"Dating"), related_name='find') container = models.ForeignKey( - Container, verbose_name=_(u"Container"), blank=True, null=True, + "archaeological_warehouse.Container", verbose_name=_(u"Container"), + blank=True, null=True, related_name='finds', on_delete=models.SET_NULL) is_complete = models.NullBooleanField(_(u"Is complete?"), blank=True, null=True) @@ -657,8 +672,8 @@ class Find(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): estimated_value = models.FloatField(_(u"Estimated value"), blank=True, null=True) collection = models.ForeignKey( - Collection, verbose_name=_(u"Collection"), blank=True, null=True, - related_name='finds', on_delete=models.SET_NULL) + "archaeological_warehouse.Collection", verbose_name=_(u"Collection"), + blank=True, null=True, related_name='finds', on_delete=models.SET_NULL) cached_label = models.TextField(_(u"Cached name"), null=True, blank=True) history = HistoricalRecords() BASKET_MODEL = FindBasket @@ -847,16 +862,20 @@ class Find(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): def duplicate(self, user): model = self.__class__ - # base fields - table_cols = [field.name for field in model._meta.fields - if field.name not in PRIVATE_FIELDS or - field.name == 'order'] - dct = dict([(attr, getattr(self, attr)) for attr in - table_cols]) - dct['order'] += 1 - dct['history_modifier'] = user - new = self.__class__(**dct) - new.save() + + new = model.objects.get(pk=self.pk) + + for field in model._meta.fields: + # pk is in PRIVATE_FIELDS so: new.pk = None and a new + # item will be created on save + if field.name in PRIVATE_FIELDS: + setattr(new, field.name, None) + new.order = self.order + 1 + new.history_order = user + new.image.name = self.image.name + # force_copy is necessary to not regenerate a thumb and resize + # again the image + new.save(force_copy=True) # m2m fields m2m = [field.name for field in model._meta.many_to_many @@ -868,11 +887,14 @@ class Find(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): @classmethod def get_query_owns(cls, user): - return Q(base_finds__context_record__operation__scientist=user. - ishtaruser.person) | \ - Q(base_finds__context_record__operation__in_charge=user. - ishtaruser.person) | \ - Q(history_creator=user) + return (Q(base_finds__context_record__operation__scientist=user. + ishtaruser.person) | + Q(base_finds__context_record__operation__in_charge=user. + ishtaruser.person) | + Q(base_finds__context_record__operation__collaborators__pk=user. + ishtaruser.person.pk) | + Q(history_creator=user)) \ + & Q(base_finds__context_record__operation__end_date__isnull=True) @classmethod def get_owns(cls, user, menu_filtr=None, limit=None, @@ -891,7 +913,8 @@ class Find(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): return unicode(self) @classmethod - def cached_label_bulk_update(cls, operation_id=None, parcel_id=None): + def cached_label_bulk_update(cls, operation_id=None, parcel_id=None, + context_record_id=None): if operation_id: filters = """ INNER JOIN find_first_base_find myfbf @@ -912,6 +935,14 @@ class Find(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): ON acr.parcel_id = %s AND acr.id = mybf.context_record_id """ args = [int(parcel_id)] + elif context_record_id: + filters = """ + INNER JOIN find_first_base_find myfbf + ON myfbf.find_id = myf.id + INNER JOIN archaeological_finds_basefind mybf + ON myfbf.basefind_id = mybf.id AND mybf.context_record_id = %s + """ + args = [int(context_record_id)] else: return @@ -1068,6 +1099,18 @@ class FindSource(Source): class Meta: verbose_name = _(u"Find documentation") verbose_name_plural = _(u"Find documentations") + permissions = ( + ("view_findsource", + ugettext(u"Can view all Find sources")), + ("view_own_findsource", + ugettext(u"Can view own Find source")), + ("add_own_findsource", + ugettext(u"Can add own Find source")), + ("change_own_findsource", + ugettext(u"Can change own Find source")), + ("delete_own_findsource", + ugettext(u"Can delete own Find source")), + ) find = models.ForeignKey(Find, verbose_name=_(u"Find"), related_name="source") @@ -1075,6 +1118,18 @@ class FindSource(Source): def owner(self): return self.find + @classmethod + def get_query_owns(cls, user): + return (Q(find__base_finds__context_record__operation__scientist=user. + ishtaruser.person) | + Q(find__base_finds__context_record__operation__in_charge=user. + ishtaruser.person) | + Q( + find__base_finds__context_record__operation__collaborators__pk=user. + ishtaruser.person.pk)) \ + & Q( + find__base_finds__context_record__operation__end_date__isnull=True) + class Property(LightHistorizedItem): find = models.ForeignKey(Find, verbose_name=_(u"Find")) diff --git a/archaeological_finds/models_treatments.py b/archaeological_finds/models_treatments.py index 4a453f538..d3e18122c 100644 --- a/archaeological_finds/models_treatments.py +++ b/archaeological_finds/models_treatments.py @@ -1,6 +1,6 @@ #!/usr/bin/env python # -*- coding: utf-8 -*- -# Copyright (C) 2016 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> +# Copyright (C) 2016-2017 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as @@ -30,7 +30,7 @@ from django.utils.translation import ugettext_lazy as _, ugettext from ishtar_common.utils import cached_label_changed from ishtar_common.models import GeneralType, ImageModel, BaseHistorizedItem, \ OwnPerms, HistoricalRecords, Person, Organization, Source, \ - ValueGetter, post_save_cache, ShortMenuItem + ValueGetter, post_save_cache, ShortMenuItem, DashboardFormItem from archaeological_warehouse.models import Warehouse, Container from archaeological_finds.models_finds import Find, FindBasket from archaeological_operations.models import ClosedItem, Operation @@ -69,7 +69,8 @@ post_save.connect(post_save_cache, sender=TreatmentState) post_delete.connect(post_save_cache, sender=TreatmentState) -class Treatment(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): +class Treatment(DashboardFormItem, ValueGetter, BaseHistorizedItem, + ImageModel, OwnPerms, ShortMenuItem): SHOW_URL = 'show-treatment' TABLE_COLS = ('year', 'index', 'treatment_types__label', 'treatment_state__label', @@ -179,7 +180,8 @@ class Treatment(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): if menu_filtr: if 'treatmentfile' in menu_filtr: replace_query = Q(file=menu_filtr['treatmentfile']) - if 'find' in menu_filtr and 'basket' not in str(menu_filtr['find']): + if 'find' in menu_filtr and \ + 'basket' not in str(menu_filtr['find']): q = Q(upstream=menu_filtr['find']) | Q( downstream=menu_filtr['find']) if replace_query: @@ -208,6 +210,21 @@ class Treatment(BaseHistorizedItem, ImageModel, OwnPerms, ShortMenuItem): """ return u" ; ".join([unicode(t) for t in self.treatment_types.all()]) + def get_values(self, prefix=''): + values = super(Treatment, self).get_values(prefix=prefix) + values[prefix + "upstream_finds"] = u" ; ".join( + [unicode(up) for up in self.upstream.all()]) + values[prefix + "downstream_finds"] = u" ; ".join( + [unicode(down) for down in self.downstream.all()]) + values[prefix + "operations"] = u" ; ".join( + [unicode(ope) for ope in self.get_query_operations().all()]) + if self.upstream.count(): + find = self.upstream.all()[0] + if 'associatedfind_' not in prefix: + values.update( + find.get_values(prefix=prefix + 'associatedfind_')) + return values + def pre_save(self): # is not new if self.pk is not None: @@ -455,8 +472,8 @@ post_save.connect(post_save_cache, sender=TreatmentFileType) post_delete.connect(post_save_cache, sender=TreatmentFileType) -class TreatmentFile(ClosedItem, BaseHistorizedItem, OwnPerms, ValueGetter, - ShortMenuItem): +class TreatmentFile(DashboardFormItem, ClosedItem, BaseHistorizedItem, + OwnPerms, ValueGetter, ShortMenuItem): SLUG = 'treatmentfile' SHOW_URL = 'show-treatmentfile' TABLE_COLS = ['type', 'year', 'index', 'internal_reference', 'name'] @@ -502,6 +519,12 @@ class TreatmentFile(ClosedItem, BaseHistorizedItem, OwnPerms, ValueGetter, permissions = ( ("view_filetreatment", ugettext(u"Can view all Treatment requests")), + ("add_filetreatment", + ugettext(u"Can add Treatment request")), + ("change_filetreatment", + ugettext(u"Can change Treatment request")), + ("delete_filetreatment", + ugettext(u"Can delete Treatment request")), ("view_own_filetreatment", ugettext(u"Can view own Treatment request")), ("add_own_filetreatment", @@ -573,6 +596,18 @@ class TreatmentSource(Source): class Meta: verbose_name = _(u"Treatment documentation") verbose_name_plural = _(u"Treament documentations") + permissions = ( + ("view_treatmentsource", + ugettext(u"Can view all Treatment sources")), + ("view_own_treatmentsource", + ugettext(u"Can view own Treatment source")), + ("add_own_treatmentsource", + ugettext(u"Can add own Treatment source")), + ("change_own_treatmentsource", + ugettext(u"Can change own Treatment source")), + ("delete_own_treatmentsource", + ugettext(u"Can delete own Treatment source")), + ) @property def owner(self): @@ -591,6 +626,24 @@ class TreatmentFileSource(Source): class Meta: verbose_name = _(u"Treatment request documentation") verbose_name_plural = _(u"Treatment request documentations") + permissions = ( + ("view_filetreatmentsource", + ugettext(u"Can view Treatment request source")), + ("add_filetreatmentsource", + ugettext(u"Can add Treatment request source")), + ("change_filetreatmentsource", + ugettext(u"Can change Treatment request source")), + ("delete_filetreatmentsource", + ugettext(u"Can delete Treatment request source")), + ("view_own_filetreatmentsource", + ugettext(u"Can view own Treatment request source")), + ("add_own_filetreatmentsource", + ugettext(u"Can add own Treatment request source")), + ("change_own_filetreatmentsource", + ugettext(u"Can change own Treatment request source")), + ("delete_own_filetreatmentsource", + ugettext(u"Can delete own Treatment request source")), + ) @property def owner(self): diff --git a/archaeological_finds/templates/ishtar/sheet_find.html b/archaeological_finds/templates/ishtar/sheet_find.html index 912bf1b93..a78eb7706 100644 --- a/archaeological_finds/templates/ishtar/sheet_find.html +++ b/archaeological_finds/templates/ishtar/sheet_find.html @@ -200,14 +200,14 @@ {% field_li "Point of topographic reference" base_find.topographic_localisation %} {% if base_find.x or base_find.y %} - <li><label>{% trans "Coordinates:" %}</label> + <li><label>{% trans "Coordinates" %}</label> <span class="value"> - {% trans "X:"%} {{base_find.x|default_if_none:"-"}}, - {% trans "Y:"%} {{base_find.y|default_if_none:"-"}}, - {% trans "Z:"%} {{base_find.z|default_if_none:"-"}} + {% trans "X"%} {{base_find.x|default_if_none:"-"}}, + {% trans "Y"%} {{base_find.y|default_if_none:"-"}}, + {% trans "Z"%} {{base_find.z|default_if_none:"-"}} {% if base_find.spatial_reference_system %} ({{base_find.spatial_reference_system.label}}{% if base_find.spatial_reference_system.srid %} - - {% trans "SRID:"%} {{base_find.spatial_reference_system.srid}}{% endif %}) + {% trans "SRID"%} {{base_find.spatial_reference_system.srid}}{% endif %}) {% endif %} </span> {% endif %} diff --git a/archaeological_finds/templates/ishtar/sheet_findbasket.html b/archaeological_finds/templates/ishtar/sheet_findbasket.html index 6f8b12e6d..b6d4ffd42 100644 --- a/archaeological_finds/templates/ishtar/sheet_findbasket.html +++ b/archaeological_finds/templates/ishtar/sheet_findbasket.html @@ -9,5 +9,5 @@ <p class="window-refs">{{ item.label|default:"" }}</p> {% field "Owned by" item.user %} {% field "Comment" item.comment %} -{% dynamic_table_document_large finds 'finds_for_ope' 'basket' item.pk 'TABLE_COLS_FOR_OPE' output %} +{% dynamic_table_document finds 'finds_for_ope' 'basket' item.pk 'TABLE_COLS_FOR_OPE' output %} {% endblock %} diff --git a/archaeological_finds/tests.py b/archaeological_finds/tests.py index e274c757f..1268b4f03 100644 --- a/archaeological_finds/tests.py +++ b/archaeological_finds/tests.py @@ -21,6 +21,7 @@ import json from django.conf import settings from django.contrib.auth.models import User +from django.core.files import File from django.core.files.uploadedfile import SimpleUploadedFile from django.core.urlresolvers import reverse from django.test.client import Client @@ -474,8 +475,14 @@ class PackagingTest(FindInit, TestCase): model = models.Find def setUp(self): + img = settings.ROOT_PATH + \ + '../ishtar_common/static/media/images/ishtar-bg.jpg' + self.create_finds({"label": u"Find 1"}, force=True) self.create_finds({"label": u"Find 2"}, force=True) + self.finds[0].image.save('ishtar-bg.jpg', File(open(img))) + self.finds[0].save() + self.basket = models.FindBasket.objects.create( label="My basket", user=IshtarUser.objects.get( pk=self.get_default_user().pk)) @@ -490,11 +497,26 @@ class PackagingTest(FindInit, TestCase): treatment_type = models.TreatmentType.objects.get(txt_idx='packaging') treatment = models.Treatment() items_nb = models.Find.objects.count() + + first_find = self.finds[0] + treatment.save(user=self.get_default_user(), items=self.basket) self.assertEqual(items_nb + self.basket.items.count(), models.Find.objects.count(), msg="Packaging doesn't generate enough new finds") treatment.treatment_types.add(treatment_type) + + resulting_find = models.Find.objects.get( + upstream_treatment__upstream=first_find, + base_finds__pk=first_find.base_finds.all()[0].pk + ) + + # image names used to be altered on save: check for this bug + self.assertEqual( + resulting_find.image.name, + models.Find.objects.get(pk=first_find.pk).image.name + ) + # new version of the find is in the basket for item in self.basket.items.all(): self.assertNotIn( diff --git a/archaeological_finds/urls.py b/archaeological_finds/urls.py index 06d505896..9c331ccc9 100644 --- a/archaeological_finds/urls.py +++ b/archaeological_finds/urls.py @@ -24,7 +24,7 @@ import views from archaeological_finds import models -# be carreful: each check_rights must be relevant with ishtar_menu +# be careful: each check_rights must be relevant with ishtar_menu # forms urlpatterns = patterns( @@ -33,7 +33,7 @@ urlpatterns = patterns( check_rights(['view_find', 'view_own_find'])( views.find_search_wizard), name='find_search'), url(r'find_creation/(?P<step>.+)?$', - check_rights(['add_find'])( + check_rights(['add_find', 'add_own_find'])( views.find_creation_wizard), name='find_creation'), url(r'find_modification/(?P<step>.+)?$', check_rights(['change_find', 'change_own_find'])( diff --git a/archaeological_finds/views.py b/archaeological_finds/views.py index 03094cbb0..680faf421 100644 --- a/archaeological_finds/views.py +++ b/archaeological_finds/views.py @@ -169,7 +169,7 @@ find_modification_wizard = FindModificationWizard.as_view([ def find_modify(request, pk): - # view = find_modification_wizard(request) + find_modification_wizard(request) FindModificationWizard.session_set_value( request, 'selec-find_modification', 'pk', pk, reset=True) return redirect( diff --git a/archaeological_operations/forms.py b/archaeological_operations/forms.py index 27ab4670a..86bea4ed5 100644 --- a/archaeological_operations/forms.py +++ b/archaeological_operations/forms.py @@ -72,7 +72,7 @@ class ParcelForm(forms.Form): town = forms.ChoiceField(label=_("Town"), choices=(), required=False, validators=[valid_id(models.Town)]) year = forms.IntegerField(label=_("Year"), required=False, - validators=[validators.MinValueValidator(1900), + validators=[validators.MinValueValidator(1600), validators.MaxValueValidator(2100)]) section = forms.CharField(label=_(u"Section"), required=False, validators=[validators.MaxLengthValidator(4)]) @@ -387,6 +387,9 @@ class RecordRelationsForm(ManageOldType, forms.Form): validators=[valid_id(models.Operation)], required=False) def __init__(self, *args, **kwargs): + self.left_record = None + if 'left_record' in kwargs: + self.left_record = kwargs.pop('left_record') super(RecordRelationsForm, self).__init__(*args, **kwargs) self.fields['relation_type'].choices = \ models.RelationType.get_types( @@ -413,6 +416,9 @@ class RecordRelationsForm(ManageOldType, forms.Form): cleaned_data.get('right_record', None)): raise forms.ValidationError( _(u"You should select a relation type.")) + if str(cleaned_data.get('right_record')) == str(self.left_record.pk): + raise forms.ValidationError( + _(u"An operation cannot be related to herself.")) return cleaned_data @classmethod @@ -447,7 +453,27 @@ class RecordRelationsForm(ManageOldType, forms.Form): result.append((_("Deleted relations"), u" ; ".join(deleted))) return result -RecordRelationsFormSet = formset_factory(RecordRelationsForm, can_delete=True) + +class RecordRelationsFormSetBase(FormSet): + # passing left_record should be nicely done with form_kwargs with Django 1.9 + # with no need of all these complications + + def __init__(self, *args, **kwargs): + self.left_record = None + if 'left_record' in kwargs: + self.left_record = kwargs.pop('left_record') + super(RecordRelationsFormSetBase, self).__init__(*args, **kwargs) + + def _construct_forms(self): + # instantiate all the forms and put them in self.forms + self.forms = [] + for i in xrange(self.total_form_count()): + self.forms.append(self._construct_form( + i, left_record=self.left_record)) + + +RecordRelationsFormSet = formset_factory( + RecordRelationsForm, can_delete=True, formset=RecordRelationsFormSetBase) RecordRelationsFormSet.form_label = _(u"Relations") @@ -733,10 +759,11 @@ class DashboardForm(forms.Form): class OperationFormGeneral(ManageOldType, forms.Form): form_label = _(u"General") - base_model = 'archaeological_site' + base_models = ['collaborator'] file_upload = True associated_models = {'scientist': Person, 'in_charge': Person, + 'collaborator': Person, 'cira_rapporteur': Person, 'operator': Organization, 'operation_type': models.OperationType, @@ -755,7 +782,7 @@ class OperationFormGeneral(ManageOldType, forms.Form): choices=[]) year = forms.IntegerField(label=_(u"Year"), initial=lambda: datetime.datetime.now().year, - validators=[validators.MinValueValidator(1900), + validators=[validators.MinValueValidator(1600), validators.MaxValueValidator(2100)]) old_code = forms.CharField( label=_(u"Old code"), required=False, @@ -792,14 +819,13 @@ class OperationFormGeneral(ManageOldType, forms.Form): limit={'person_types': [person_type_pk_lazy('sra_agent')]}, new=True), validators=[valid_id(Person)], required=False) + collaborator = widgets.Select2MultipleField( + model=Person, label=_("Collaborators"), required=False, remote=True) surface = forms.IntegerField( required=False, widget=widgets.AreaWidget, label=_(u"Total surface (m2)"), validators=[validators.MinValueValidator(0), validators.MaxValueValidator(999999999)]) - # archaeological_site = widgets.MultipleAutocompleteField( - # model=models.ArchaeologicalSite, - # label=_("Associated archaeological sites"), new=True, required=False) start_date = forms.DateField( label=_(u"Start date"), required=False, widget=widgets.JQueryDate) excavation_end_date = forms.DateField( @@ -857,21 +883,29 @@ class OperationFormGeneral(ManageOldType, forms.Form): def __init__(self, *args, **kwargs): super(OperationFormGeneral, self).__init__(*args, **kwargs) - if not get_current_profile().warehouse: - self.fields.pop('documentation_deadline') - self.fields.pop('documentation_received') - self.fields.pop('finds_deadline') - self.fields.pop('finds_received') + profile = get_current_profile() + if not profile.files: + self.fields.pop('report_delivery_date') + self.fields.pop('report_processing') + self.fields.pop('cira_rapporteur') + self.fields.pop('cira_date') + self.fields.pop('negative_result') + if not profile.warehouse: + self.fields.pop('documentation_deadline') + self.fields.pop('documentation_received') + self.fields.pop('finds_deadline') + self.fields.pop('finds_received') self.fields['operation_type'].choices = \ models.OperationType.get_types( initial=self.init_data.get('operation_type')) self.fields['operation_type'].help_text = \ models.OperationType.get_help() - self.fields['report_processing'].choices = \ - models.ReportState.get_types( - initial=self.init_data.get('report_processing')) - self.fields['report_processing'].help_text = \ - models.ReportState.get_help() + if 'report_processing' in self.fields: + self.fields['report_processing'].choices = \ + models.ReportState.get_types( + initial=self.init_data.get('report_processing')) + self.fields['report_processing'].help_text = \ + models.ReportState.get_help() self.fields['record_quality'].choices = \ [('', '--')] + list(models.QUALITY) if 'operation_code' in self.fields: diff --git a/archaeological_operations/locale/django.pot b/archaeological_operations/locale/django.pot index 3323d638d..f875f6b9a 100644 --- a/archaeological_operations/locale/django.pot +++ b/archaeological_operations/locale/django.pot @@ -10,13 +10,13 @@ msgid "" msgstr "" -#: forms.py:69 forms.py:371 forms.py:1013 forms.py:1035 forms.py:1039 -#: models.py:1247 templates/ishtar/sheet_operation.html:151 +#: forms.py:69 forms.py:371 forms.py:1047 forms.py:1069 forms.py:1073 +#: models.py:1252 templates/ishtar/sheet_operation.html:153 #: templates/ishtar/blocks/window_tables/parcels.html:10 msgid "Parcels" msgstr "" -#: forms.py:72 forms.py:205 forms.py:989 models.py:1233 +#: forms.py:72 forms.py:205 forms.py:1023 models.py:1238 #: templates/ishtar/blocks/window_tables/parcels.html:7 #: templates/ishtar/dashboards/dashboard_operation.html:432 #: templates/ishtar/dashboards/dashboard_operation.html:446 @@ -25,22 +25,22 @@ msgstr "" msgid "Town" msgstr "" -#: forms.py:74 forms.py:455 forms.py:756 forms.py:1259 models.py:272 -#: models.py:1039 models.py:1231 +#: forms.py:74 forms.py:481 forms.py:783 forms.py:1293 models.py:276 +#: models.py:1044 models.py:1236 #: templates/ishtar/blocks/window_tables/parcels.html:8 msgid "Year" msgstr "" -#: forms.py:77 models.py:1234 +#: forms.py:77 models.py:1239 #: templates/ishtar/blocks/window_tables/parcels.html:9 msgid "Section" msgstr "" -#: forms.py:80 models.py:1236 +#: forms.py:80 models.py:1241 msgid "Parcel number" msgstr "" -#: forms.py:82 models.py:1238 models.py:1255 models.py:1304 +#: forms.py:82 models.py:1243 models.py:1260 models.py:1309 msgid "Public domain" msgstr "" @@ -76,45 +76,49 @@ msgstr "" msgid "Relation type" msgstr "" -#: forms.py:383 ishtar_menu.py:30 models.py:368 models.py:849 models.py:884 -#: models.py:917 models.py:1021 models.py:1230 wizards.py:344 wizards.py:355 +#: forms.py:383 ishtar_menu.py:30 models.py:372 models.py:847 models.py:882 +#: models.py:922 models.py:1026 models.py:1235 wizards.py:353 wizards.py:364 #: templates/ishtar/sheet_operation.html:4 msgid "Operation" msgstr "" -#: forms.py:403 +#: forms.py:406 msgid ":" msgstr "" -#: forms.py:411 forms.py:607 forms.py:1224 +#: forms.py:414 forms.py:633 forms.py:1258 msgid "You should select an operation." msgstr "" -#: forms.py:415 +#: forms.py:418 msgid "You should select a relation type." msgstr "" -#: forms.py:445 +#: forms.py:421 +msgid "An operation cannot be related to herself." +msgstr "" + +#: forms.py:451 msgid "Current relations" msgstr "" -#: forms.py:447 +#: forms.py:453 msgid "Deleted relations" msgstr "" -#: forms.py:451 templates/ishtar/sheet_operation.html:85 +#: forms.py:477 templates/ishtar/sheet_operation.html:86 msgid "Relations" msgstr "" -#: forms.py:456 forms.py:1230 models.py:273 +#: forms.py:482 forms.py:1264 models.py:277 msgid "Numeric reference" msgstr "" -#: forms.py:462 forms.py:1270 +#: forms.py:488 forms.py:1304 msgid "Parcel (section/number/public domain)" msgstr "" -#: forms.py:465 forms.py:1273 models.py:850 +#: forms.py:491 forms.py:1307 models.py:848 #: templates/ishtar/dashboards/dashboard_operation.html:390 #: templates/ishtar/dashboards/dashboard_operation.html:411 #: templates/ishtar/dashboards/dashboard_operation.html:643 @@ -123,454 +127,458 @@ msgstr "" msgid "Department" msgstr "" -#: forms.py:466 forms.py:1101 models.py:86 +#: forms.py:492 forms.py:1135 models.py:86 #: templates/ishtar/sheet_operation.html:22 #: templates/ishtar/blocks/window_tables/archaeologicalsites.html:8 msgid "Name" msgstr "" -#: forms.py:468 forms.py:752 models.py:334 +#: forms.py:494 forms.py:779 models.py:338 msgid "Address / Locality" msgstr "" -#: forms.py:470 forms.py:674 forms.py:754 forms.py:1236 models.py:280 +#: forms.py:496 forms.py:700 forms.py:781 forms.py:1270 models.py:284 msgid "Operation type" msgstr "" -#: forms.py:472 +#: forms.py:498 msgid "Is open?" msgstr "" -#: forms.py:480 forms.py:786 models.py:269 +#: forms.py:506 forms.py:813 models.py:269 msgid "In charge" msgstr "" -#: forms.py:487 models.py:1015 +#: forms.py:513 models.py:1020 msgid "Scientist in charge" msgstr "" -#: forms.py:489 forms.py:676 forms.py:776 models.py:267 +#: forms.py:515 forms.py:702 forms.py:803 models.py:267 msgid "Operator" msgstr "" -#: forms.py:498 forms.py:1106 models.py:90 models.py:282 +#: forms.py:524 forms.py:1140 models.py:90 models.py:286 #: templates/ishtar/blocks/window_tables/archaeologicalsites.html:10 msgid "Remains" msgstr "" -#: forms.py:499 forms.py:1084 forms.py:1103 models.py:88 models.py:288 +#: forms.py:525 forms.py:1118 forms.py:1137 models.py:88 models.py:292 #: templates/ishtar/blocks/window_tables/archaeologicalsites.html:9 msgid "Periods" msgstr "" -#: forms.py:500 +#: forms.py:526 msgid "Started before" msgstr "" -#: forms.py:502 +#: forms.py:528 msgid "Started after" msgstr "" -#: forms.py:504 +#: forms.py:530 msgid "Ended before" msgstr "" -#: forms.py:506 +#: forms.py:532 msgid "Ended after" msgstr "" -#: forms.py:509 +#: forms.py:535 msgid "Search within relations" msgstr "" -#: forms.py:511 forms.py:841 +#: forms.py:537 forms.py:867 msgid "Comment" msgstr "" -#: forms.py:512 +#: forms.py:538 msgid "Abstract (full text search)" msgstr "" -#: forms.py:514 forms.py:844 models.py:337 +#: forms.py:540 forms.py:870 models.py:341 msgid "Comment about scientific documentation" msgstr "" -#: forms.py:515 forms.py:846 models.py:349 +#: forms.py:541 forms.py:872 models.py:353 msgid "Record quality" msgstr "" -#: forms.py:516 forms.py:811 models.py:300 +#: forms.py:542 forms.py:837 models.py:304 msgid "Report processing" msgstr "" -#: forms.py:518 forms.py:849 models.py:344 +#: forms.py:544 forms.py:875 models.py:348 msgid "Virtual operation" msgstr "" -#: forms.py:520 forms.py:1146 forms.py:1150 models.py:94 +#: forms.py:546 forms.py:1180 forms.py:1184 models.py:94 msgid "Archaeological site" msgstr "" -#: forms.py:526 forms.py:1277 +#: forms.py:552 forms.py:1311 msgid "Created by" msgstr "" -#: forms.py:532 forms.py:1283 +#: forms.py:558 forms.py:1317 msgid "Modified by" msgstr "" -#: forms.py:539 +#: forms.py:565 msgid "Documentation deadline before" msgstr "" -#: forms.py:541 +#: forms.py:567 msgid "Documentation deadline after" msgstr "" -#: forms.py:543 forms.py:834 models.py:356 +#: forms.py:569 forms.py:860 models.py:360 msgid "Documentation received" msgstr "" -#: forms.py:545 +#: forms.py:571 msgid "Finds deadline before" msgstr "" -#: forms.py:547 +#: forms.py:573 msgid "Finds deadline after" msgstr "" -#: forms.py:549 forms.py:839 models.py:360 +#: forms.py:575 forms.py:865 models.py:364 msgid "Finds received" msgstr "" -#: forms.py:594 forms.py:1222 views.py:168 +#: forms.py:620 forms.py:1256 views.py:168 msgid "Operation search" msgstr "" -#: forms.py:638 +#: forms.py:664 msgid "Associated file" msgstr "" -#: forms.py:642 forms.py:937 models.py:516 models.py:916 models.py:1026 +#: forms.py:668 forms.py:971 models.py:520 models.py:921 models.py:1031 #: wizards.py:80 msgid "Archaeological file" msgstr "" -#: forms.py:649 forms.py:651 models.py:351 +#: forms.py:675 forms.py:677 models.py:355 msgid "Abstract" msgstr "" -#: forms.py:654 +#: forms.py:680 msgid "months" msgstr "" -#: forms.py:654 +#: forms.py:680 msgid "years" msgstr "" -#: forms.py:656 models.py:253 +#: forms.py:682 models.py:253 msgid "Creation date" msgstr "" -#: forms.py:657 +#: forms.py:683 msgid "Start of field work" msgstr "" -#: forms.py:659 +#: forms.py:685 msgid "All" msgstr "" -#: forms.py:660 +#: forms.py:686 msgid "Preventive" msgstr "" -#: forms.py:661 +#: forms.py:687 msgid "Research" msgstr "" -#: forms.py:665 +#: forms.py:691 msgid "Slicing" msgstr "" -#: forms.py:668 +#: forms.py:694 msgid "Department detail" msgstr "" -#: forms.py:670 +#: forms.py:696 msgid "Date get from" msgstr "" -#: forms.py:672 +#: forms.py:698 msgid "Preventive/Research" msgstr "" -#: forms.py:678 +#: forms.py:704 msgid "Date after" msgstr "" -#: forms.py:680 +#: forms.py:706 msgid "Date before" msgstr "" -#: forms.py:682 +#: forms.py:708 msgid "With reports" msgstr "" -#: forms.py:683 +#: forms.py:709 msgid "With finds" msgstr "" -#: forms.py:735 forms.py:1331 templates/ishtar/sheet_administrativeact.html:20 +#: forms.py:761 forms.py:1365 templates/ishtar/sheet_administrativeact.html:20 #: templates/ishtar/sheet_operation.html:26 msgid "General" msgstr "" -#: forms.py:750 models.py:333 +#: forms.py:777 models.py:337 msgid "Generic name" msgstr "" -#: forms.py:761 models.py:302 +#: forms.py:788 models.py:306 msgid "Old code" msgstr "" -#: forms.py:764 +#: forms.py:791 msgid "Head scientist" msgstr "" -#: forms.py:783 models.py:332 +#: forms.py:810 models.py:336 msgid "Operator reference" msgstr "" -#: forms.py:797 +#: forms.py:823 models.py:273 +msgid "Collaborators" +msgstr "" + +#: forms.py:826 msgid "Total surface (m2)" msgstr "" -#: forms.py:804 models.py:54 models.py:256 models.py:1443 +#: forms.py:830 models.py:54 models.py:256 models.py:1448 msgid "Start date" msgstr "" -#: forms.py:806 models.py:258 +#: forms.py:832 models.py:258 msgid "Excavation end date" msgstr "" -#: forms.py:809 models.py:259 +#: forms.py:835 models.py:259 msgid "Report delivery date" msgstr "" -#: forms.py:831 models.py:353 +#: forms.py:857 models.py:357 msgid "Deadline for submission of the documentation" msgstr "" -#: forms.py:836 models.py:358 +#: forms.py:862 models.py:362 msgid "Deadline for submission of the finds" msgstr "" -#: forms.py:851 +#: forms.py:877 msgid "Image" msgstr "" -#: forms.py:852 +#: forms.py:878 #, python-format msgid "" "<p>Heavy images are resized to: %(width)dx%(height)d (ratio is preserved).</" "p>" msgstr "" -#: forms.py:890 +#: forms.py:924 msgid "" "If you want to set an excavation end date you have to provide a start date." msgstr "" -#: forms.py:895 +#: forms.py:929 msgid "The excavation end date cannot be before the start date." msgstr "" -#: forms.py:923 +#: forms.py:957 #, python-format msgid "" "Operation code already exists for year: %(year)d - use a value bigger than " "%(last_val)d" msgstr "" -#: forms.py:927 +#: forms.py:961 msgid "Bad operation code" msgstr "" -#: forms.py:933 models.py:531 models.py:879 +#: forms.py:967 models.py:535 models.py:877 msgid "Operation code" msgstr "" -#: forms.py:959 +#: forms.py:993 msgid "Preventive informations - excavation" msgstr "" -#: forms.py:960 models.py:286 +#: forms.py:994 models.py:290 #: templates/ishtar/dashboards/dashboard_operation.html:701 msgid "Cost (euros)" msgstr "" -#: forms.py:961 models.py:291 +#: forms.py:995 models.py:295 msgid "Scheduled man-days" msgstr "" -#: forms.py:963 models.py:294 +#: forms.py:997 models.py:298 msgid "Optional man-days" msgstr "" -#: forms.py:965 models.py:297 +#: forms.py:999 models.py:301 msgid "Effective man-days" msgstr "" -#: forms.py:975 +#: forms.py:1009 msgid "Preventive informations - diagnostic" msgstr "" -#: forms.py:978 models.py:316 +#: forms.py:1012 models.py:320 msgid "Prescription on zoning" msgstr "" -#: forms.py:980 models.py:319 +#: forms.py:1014 models.py:323 msgid "Prescription on large area" msgstr "" -#: forms.py:983 models.py:321 +#: forms.py:1017 models.py:325 msgid "Prescription on geoarchaeological context" msgstr "" -#: forms.py:987 forms.py:1009 models.py:284 models.py:1049 +#: forms.py:1021 forms.py:1043 models.py:288 models.py:1054 msgid "Towns" msgstr "" -#: forms.py:1016 models.py:1246 models.py:1441 +#: forms.py:1050 models.py:1251 models.py:1446 msgid "Parcel" msgstr "" -#: forms.py:1068 models.py:46 +#: forms.py:1102 models.py:46 msgid "Remain types" msgstr "" -#: forms.py:1072 models.py:45 +#: forms.py:1106 models.py:45 msgid "Remain type" msgstr "" -#: forms.py:1088 templates/ishtar/sheet_operation.html:171 -#: templates/ishtar/sheet_operation.html:202 +#: forms.py:1122 templates/ishtar/sheet_operation.html:173 +#: templates/ishtar/sheet_operation.html:204 msgid "Period" msgstr "" -#: forms.py:1100 models.py:85 +#: forms.py:1134 models.py:85 msgid "Reference" msgstr "" -#: forms.py:1129 +#: forms.py:1163 msgid "This reference already exists." msgstr "" -#: forms.py:1161 models.py:95 models.py:341 -#: templates/ishtar/sheet_operation.html:96 +#: forms.py:1195 models.py:95 models.py:345 +#: templates/ishtar/sheet_operation.html:97 msgid "Archaeological sites" msgstr "" -#: forms.py:1165 +#: forms.py:1199 msgid "Associated archaeological sites" msgstr "" -#: forms.py:1171 ishtar_menu.py:34 ishtar_menu.py:64 ishtar_menu.py:93 +#: forms.py:1205 ishtar_menu.py:34 ishtar_menu.py:64 ishtar_menu.py:93 msgid "Search" msgstr "" -#: forms.py:1176 +#: forms.py:1210 msgid "Would you like to close this operation?" msgstr "" -#: forms.py:1181 +#: forms.py:1215 msgid "Would you like to delete this operation?" msgstr "" -#: forms.py:1190 forms.py:1260 forms.py:1396 models.py:886 models.py:1006 +#: forms.py:1224 forms.py:1294 forms.py:1430 models.py:884 models.py:1011 msgid "Index" msgstr "" -#: forms.py:1216 +#: forms.py:1250 #, python-format msgid "" "Index already exists for operation: %(operation)s - use a value bigger than " "%(last_val)d" msgstr "" -#: forms.py:1228 +#: forms.py:1262 msgid "Operation's year" msgstr "" -#: forms.py:1235 +#: forms.py:1269 msgid "Operation's town" msgstr "" -#: forms.py:1248 +#: forms.py:1282 msgid "Documentation search" msgstr "" -#: forms.py:1250 +#: forms.py:1284 msgid "You should select a document." msgstr "" -#: forms.py:1267 forms.py:1334 models.py:930 models.py:1000 +#: forms.py:1301 forms.py:1368 models.py:935 models.py:1005 msgid "Act type" msgstr "" -#: forms.py:1268 forms.py:1466 +#: forms.py:1302 forms.py:1500 msgid "Indexed?" msgstr "" -#: forms.py:1274 forms.py:1339 models.py:1040 +#: forms.py:1308 forms.py:1373 models.py:1045 #: templates/ishtar/blocks/window_tables/administrativacts.html:10 msgid "Object" msgstr "" -#: forms.py:1311 views.py:333 +#: forms.py:1345 views.py:348 msgid "Administrative act search" msgstr "" -#: forms.py:1326 forms.py:1424 forms.py:1491 +#: forms.py:1360 forms.py:1458 forms.py:1525 msgid "You should select an administrative act." msgstr "" -#: forms.py:1342 models.py:1037 +#: forms.py:1376 models.py:1042 msgid "Signature date" msgstr "" -#: forms.py:1384 +#: forms.py:1418 #, python-format msgid "" "This index already exists for year: %(year)d - use a value bigger than " "%(last_val)d" msgstr "" -#: forms.py:1388 +#: forms.py:1422 msgid "Bad index" msgstr "" -#: forms.py:1401 +#: forms.py:1435 msgid "Would you like to delete this administrative act?" msgstr "" -#: forms.py:1406 +#: forms.py:1440 msgid "Template" msgstr "" -#: forms.py:1430 forms.py:1434 +#: forms.py:1464 forms.py:1468 msgid "This document is not intended for this type of act." msgstr "" -#: forms.py:1452 +#: forms.py:1486 msgid "Doc generation" msgstr "" -#: forms.py:1454 +#: forms.py:1488 msgid "Generate the associated doc?" msgstr "" -#: forms.py:1475 ishtar_menu.py:123 views.py:386 +#: forms.py:1509 ishtar_menu.py:123 views.py:401 msgctxt "admin act register" msgid "Register" msgstr "" @@ -591,7 +599,7 @@ msgstr "" msgid "Deletion" msgstr "" -#: ishtar_menu.py:59 models.py:1056 +#: ishtar_menu.py:59 models.py:1061 #: templates/ishtar/sheet_administrativeact.html:4 msgid "Administrative act" msgstr "" @@ -616,16 +624,16 @@ msgstr "" msgid "General informations" msgstr "" -#: ishtar_menu.py:139 models.py:369 +#: ishtar_menu.py:139 models.py:373 #: templates/ishtar/dashboards/dashboard_operation.html:8 msgid "Operations" msgstr "" -#: models.py:53 models.py:71 models.py:1913 +#: models.py:53 models.py:71 models.py:1918 msgid "Order" msgstr "" -#: models.py:55 models.py:1444 +#: models.py:55 models.py:1449 msgid "End date" msgstr "" @@ -741,357 +749,357 @@ msgstr "" msgid "In charge scientist" msgstr "" -#: models.py:277 models.py:1226 +#: models.py:281 models.py:1231 msgid "File" msgstr "" -#: models.py:281 +#: models.py:285 msgid "Surface (m2)" msgstr "" -#: models.py:335 +#: models.py:339 msgid "General comment" msgstr "" -#: models.py:338 +#: models.py:342 msgid "Cached name" msgstr "" -#: models.py:346 +#: models.py:350 msgid "" "If checked, it means that this operation have not been officialy registered." msgstr "" -#: models.py:362 +#: models.py:366 msgid "Point" msgstr "" -#: models.py:363 +#: models.py:367 msgid "Multi polygon" msgstr "" -#: models.py:371 +#: models.py:375 msgid "Can view all Operations" msgstr "" -#: models.py:372 +#: models.py:376 msgid "Can view own Operation" msgstr "" -#: models.py:373 +#: models.py:377 msgid "Can add own Operation" msgstr "" -#: models.py:374 +#: models.py:378 msgid "Can change own Operation" msgstr "" -#: models.py:375 +#: models.py:379 msgid "Can delete own Operation" msgstr "" -#: models.py:376 +#: models.py:380 msgid "Can close Operation" msgstr "" -#: models.py:405 +#: models.py:409 msgid "OPE" msgstr "" -#: models.py:479 +#: models.py:483 msgid "Intercommunal" msgstr "" -#: models.py:517 +#: models.py:521 msgid "Code patriarche" msgstr "" -#: models.py:557 +#: models.py:561 msgid "This operation code already exists for this year" msgstr "" -#: models.py:582 +#: models.py:588 msgid "Number of parcels" msgstr "" -#: models.py:600 +#: models.py:598 msgid "Number of administrative acts" msgstr "" -#: models.py:608 +#: models.py:606 msgid "Number of indexed administrative acts" msgstr "" -#: models.py:616 +#: models.py:614 msgid "Number of context records" msgstr "" -#: models.py:652 +#: models.py:650 msgid "Number of finds" msgstr "" -#: models.py:697 +#: models.py:695 msgid "No type" msgstr "" -#: models.py:728 +#: models.py:726 msgid "Number of sources" msgstr "" -#: models.py:770 templates/ishtar/dashboards/dashboard_operation.html:309 +#: models.py:768 templates/ishtar/dashboards/dashboard_operation.html:309 #: templates/ishtar/dashboards/dashboard_operation.html:575 #: templates/ishtar/dashboards/dashboard_operation.html:611 msgid "Mean" msgstr "" -#: models.py:820 +#: models.py:818 msgid "Inverse relation" msgstr "" -#: models.py:824 +#: models.py:822 msgid "Operation relation type" msgstr "" -#: models.py:825 +#: models.py:823 msgid "Operation relation types" msgstr "" -#: models.py:838 +#: models.py:836 msgid "Operation record relation" msgstr "" -#: models.py:839 +#: models.py:837 msgid "Operation record relations" msgstr "" -#: models.py:878 +#: models.py:876 msgid "Operation year" msgstr "" -#: models.py:880 +#: models.py:878 msgid "Document code" msgstr "" -#: models.py:890 +#: models.py:888 msgid "Operation documentation" msgstr "" -#: models.py:891 +#: models.py:889 msgid "Operation documentations" msgstr "" -#: models.py:894 +#: models.py:892 msgid "Can view all Operation sources" msgstr "" -#: models.py:896 +#: models.py:894 msgid "Can view own Operation source" msgstr "" -#: models.py:898 +#: models.py:896 msgid "Can add own Operation source" msgstr "" -#: models.py:900 +#: models.py:898 msgid "Can change own Operation source" msgstr "" -#: models.py:902 +#: models.py:900 msgid "Can delete own Operation source" msgstr "" -#: models.py:918 models.py:1031 +#: models.py:923 models.py:1036 msgid "Treatment request" msgstr "" -#: models.py:919 models.py:1036 +#: models.py:924 models.py:1041 msgid "Treatment" msgstr "" -#: models.py:921 +#: models.py:926 msgid "Intended to" msgstr "" -#: models.py:923 +#: models.py:928 msgid "Code" msgstr "" -#: models.py:926 +#: models.py:931 msgid "Associated template" msgstr "" -#: models.py:927 +#: models.py:932 msgid "Indexed" msgstr "" -#: models.py:931 +#: models.py:936 msgid "Act types" msgstr "" -#: models.py:997 models.py:1077 +#: models.py:1002 models.py:1082 #: templates/ishtar/blocks/window_tables/administrativacts.html:7 #: templates/ishtar/blocks/window_tables/archaeologicalsites.html:7 msgid "Ref." msgstr "" -#: models.py:1004 +#: models.py:1009 msgid "Person in charge of the operation" msgstr "" -#: models.py:1010 +#: models.py:1015 msgid "Archaeological preventive operator" msgstr "" -#: models.py:1018 +#: models.py:1023 msgid "Signatory" msgstr "" -#: models.py:1046 +#: models.py:1051 msgid "Departments" msgstr "" -#: models.py:1047 +#: models.py:1052 msgid "Cached values get from associated departments" msgstr "" -#: models.py:1050 +#: models.py:1055 msgid "Cached values get from associated towns" msgstr "" -#: models.py:1057 templates/ishtar/sheet_operation.html:104 -#: templates/ishtar/sheet_operation.html:145 +#: models.py:1062 templates/ishtar/sheet_operation.html:105 +#: templates/ishtar/sheet_operation.html:147 msgid "Administrative acts" msgstr "" -#: models.py:1060 +#: models.py:1065 msgid "Can view all Administrative acts" msgstr "" -#: models.py:1062 +#: models.py:1067 msgid "Can view own Administrative act" msgstr "" -#: models.py:1064 +#: models.py:1069 msgid "Can add own Administrative act" msgstr "" -#: models.py:1066 +#: models.py:1071 msgid "Can change own Administrative act" msgstr "" -#: models.py:1068 +#: models.py:1073 msgid "Can delete own Administrative act" msgstr "" -#: models.py:1171 +#: models.py:1176 msgid "This index already exists for this year" msgstr "" -#: models.py:1239 +#: models.py:1244 msgid "External ID" msgstr "" -#: models.py:1242 +#: models.py:1247 msgid "External ID is set automatically" msgstr "" -#: models.py:1243 +#: models.py:1248 msgid "Address - Locality" msgstr "" -#: models.py:1439 +#: models.py:1444 msgid "Owner" msgstr "" -#: models.py:1447 +#: models.py:1452 msgid "Parcel owner" msgstr "" -#: models.py:1448 +#: models.py:1453 msgid "Parcel owners" msgstr "" -#: models.py:1474 +#: models.py:1479 msgid "Recorded" msgstr "" -#: models.py:1475 +#: models.py:1480 msgid "Effective" msgstr "" -#: models.py:1476 +#: models.py:1481 msgid "Active" msgstr "" -#: models.py:1477 +#: models.py:1482 msgid "Field completed" msgstr "" -#: models.py:1478 +#: models.py:1483 msgid "Associated report" msgstr "" -#: models.py:1479 +#: models.py:1484 msgid "Closed" msgstr "" -#: models.py:1480 +#: models.py:1485 msgid "Documented and closed" msgstr "" -#: models.py:1914 +#: models.py:1919 msgid "Is preventive" msgstr "" -#: models.py:1917 +#: models.py:1922 msgid "Operation type old" msgstr "" -#: models.py:1918 +#: models.py:1923 msgid "Operation types old" msgstr "" -#: views.py:214 +#: views.py:223 msgid "New operation" msgstr "" -#: views.py:237 +#: views.py:267 msgid "Operation modification" msgstr "" -#: views.py:280 +#: views.py:295 msgid "Operation closing" msgstr "" -#: views.py:291 +#: views.py:306 msgid "Operation deletion" msgstr "" -#: views.py:296 +#: views.py:311 msgid "Operation: source search" msgstr "" -#: views.py:304 +#: views.py:319 msgid "Operation: source creation" msgstr "" -#: views.py:312 +#: views.py:327 msgid "Operation: source modification" msgstr "" -#: views.py:327 +#: views.py:342 msgid "Operation: source deletion" msgstr "" -#: views.py:346 +#: views.py:361 msgid "Operation: new administrative act" msgstr "" -#: views.py:356 +#: views.py:371 msgid "Operation: administrative act modification" msgstr "" -#: views.py:380 +#: views.py:395 msgid "Operation: administrative act deletion" msgstr "" @@ -1106,7 +1114,7 @@ msgid "" msgstr "" #: templates/ishtar/sheet_administrativeact.html:36 -#: templates/ishtar/sheet_operation.html:40 +#: templates/ishtar/sheet_operation.html:41 msgid "Surface:" msgstr "" @@ -1126,92 +1134,96 @@ msgstr "" msgid "Begining date" msgstr "" -#: templates/ishtar/sheet_operation.html:36 +#: templates/ishtar/sheet_operation.html:37 msgid "State:" msgstr "" -#: templates/ishtar/sheet_operation.html:36 +#: templates/ishtar/sheet_operation.html:37 msgid "Active file" msgstr "" -#: templates/ishtar/sheet_operation.html:37 +#: templates/ishtar/sheet_operation.html:38 msgid "Closed operation" msgstr "" -#: templates/ishtar/sheet_operation.html:38 +#: templates/ishtar/sheet_operation.html:39 msgid "Closing date:" msgstr "" -#: templates/ishtar/sheet_operation.html:38 +#: templates/ishtar/sheet_operation.html:39 msgid "by" msgstr "" -#: templates/ishtar/sheet_operation.html:41 +#: templates/ishtar/sheet_operation.html:42 msgid "Cost:" msgstr "" -#: templates/ishtar/sheet_operation.html:42 +#: templates/ishtar/sheet_operation.html:43 msgid "Duration:" msgstr "" -#: templates/ishtar/sheet_operation.html:42 +#: templates/ishtar/sheet_operation.html:43 msgid "Day" msgstr "" -#: templates/ishtar/sheet_operation.html:75 +#: templates/ishtar/sheet_operation.html:76 msgid "Localisation" msgstr "" -#: templates/ishtar/sheet_operation.html:100 +#: templates/ishtar/sheet_operation.html:101 msgid "Associated parcels" msgstr "" -#: templates/ishtar/sheet_operation.html:108 +#: templates/ishtar/sheet_operation.html:109 msgid "Document from this operation" msgstr "" -#: templates/ishtar/sheet_operation.html:114 -#: templates/ishtar/sheet_operation.html:156 +#: templates/ishtar/sheet_operation.html:115 +#: templates/ishtar/sheet_operation.html:158 msgid "Context records" msgstr "" -#: templates/ishtar/sheet_operation.html:119 +#: templates/ishtar/sheet_operation.html:120 msgid "Context record relations" msgstr "" -#: templates/ishtar/sheet_operation.html:124 +#: templates/ishtar/sheet_operation.html:125 msgid "Documents from associated context records" msgstr "" -#: templates/ishtar/sheet_operation.html:129 -#: templates/ishtar/sheet_operation.html:179 +#: templates/ishtar/sheet_operation.html:130 +#: templates/ishtar/sheet_operation.html:181 msgid "Finds" msgstr "" -#: templates/ishtar/sheet_operation.html:134 +#: templates/ishtar/sheet_operation.html:135 msgid "Documents from associated finds" msgstr "" -#: templates/ishtar/sheet_operation.html:139 +#: templates/ishtar/sheet_operation.html:140 msgid "Associated containers" msgstr "" -#: templates/ishtar/sheet_operation.html:143 +#: templates/ishtar/sheet_operation.html:144 msgid "Statistics" msgstr "" -#: templates/ishtar/sheet_operation.html:163 -#: templates/ishtar/sheet_operation.html:217 +#: templates/ishtar/sheet_operation.html:145 +msgid "Theses number are updated hourly" +msgstr "" + +#: templates/ishtar/sheet_operation.html:165 +#: templates/ishtar/sheet_operation.html:219 #: templates/ishtar/blocks/window_tables/administrativacts.html:8 msgid "Type" msgstr "" -#: templates/ishtar/sheet_operation.html:163 -#: templates/ishtar/sheet_operation.html:171 -#: templates/ishtar/sheet_operation.html:186 -#: templates/ishtar/sheet_operation.html:194 -#: templates/ishtar/sheet_operation.html:202 -#: templates/ishtar/sheet_operation.html:217 +#: templates/ishtar/sheet_operation.html:165 +#: templates/ishtar/sheet_operation.html:173 +#: templates/ishtar/sheet_operation.html:188 +#: templates/ishtar/sheet_operation.html:196 +#: templates/ishtar/sheet_operation.html:204 +#: templates/ishtar/sheet_operation.html:219 #: templates/ishtar/dashboards/dashboard_operation.html:18 #: templates/ishtar/dashboards/dashboard_operation.html:164 #: templates/ishtar/dashboards/dashboard_operation.html:432 @@ -1220,19 +1232,19 @@ msgstr "" msgid "Number" msgstr "" -#: templates/ishtar/sheet_operation.html:186 +#: templates/ishtar/sheet_operation.html:188 msgid "Material type" msgstr "" -#: templates/ishtar/sheet_operation.html:194 +#: templates/ishtar/sheet_operation.html:196 msgid "Object type" msgstr "" -#: templates/ishtar/sheet_operation.html:210 +#: templates/ishtar/sheet_operation.html:212 msgid "Sources" msgstr "" -#: templates/ishtar/sheet_operation.html:226 +#: templates/ishtar/sheet_operation.html:228 msgid "Finds by context records" msgstr "" diff --git a/archaeological_operations/migrations/0015_auto.py b/archaeological_operations/migrations/0015_auto.py new file mode 100644 index 000000000..f09437198 --- /dev/null +++ b/archaeological_operations/migrations/0015_auto.py @@ -0,0 +1,851 @@ +# -*- coding: utf-8 -*- +import datetime +from south.db import db +from south.v2 import SchemaMigration +from django.db import models + + +class Migration(SchemaMigration): + + def forwards(self, orm): + # Adding M2M table for field collaborators on 'Operation' + db.create_table('archaeological_operations_operation_collaborators', ( + ('id', models.AutoField(verbose_name='ID', primary_key=True, auto_created=True)), + ('operation', models.ForeignKey(orm['archaeological_operations.operation'], null=False)), + ('person', models.ForeignKey(orm['ishtar_common.person'], null=False)) + )) + db.create_unique('archaeological_operations_operation_collaborators', ['operation_id', 'person_id']) + + + def backwards(self, orm): + # Removing M2M table for field collaborators on 'Operation' + db.delete_table('archaeological_operations_operation_collaborators') + + + models = { + 'archaeological_files.file': { + 'Meta': {'ordering': "('cached_label',)", 'object_name': 'File'}, + 'address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'auto_external_id': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'cached_label': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'cira_advised': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'classified_area': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'corporation_general_contractor': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'general_contractor_files'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Organization']"}), + 'creation_date': ('django.db.models.fields.DateField', [], {'default': 'datetime.date.today', 'null': 'True', 'blank': 'True'}), + 'departments': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['ishtar_common.Department']", 'null': 'True', 'blank': 'True'}), + 'end_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'external_id': ('django.db.models.fields.CharField', [], {'max_length': '120', 'null': 'True', 'blank': 'True'}), + 'file_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_files.FileType']"}), + 'general_contractor': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'general_contractor_files'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imported_line': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_files_file'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'in_charge': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'file_responsability'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'instruction_deadline': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'internal_reference': ('django.db.models.fields.CharField', [], {'max_length': '60', 'null': 'True', 'blank': 'True'}), + 'locality': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), + 'main_town': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'file_main'", 'null': 'True', 'to': "orm['ishtar_common.Town']"}), + 'mh_listing': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'mh_register': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'name': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'numeric_reference': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'organization': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'files'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Organization']"}), + 'permit_reference': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'permit_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_files.PermitType']", 'null': 'True', 'blank': 'True'}), + 'planning_service': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'planning_service_files'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Organization']"}), + 'postal_code': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), + 'protected_area': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'raw_general_contractor': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'raw_town_planning_service': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'reception_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'related_file': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_files.File']", 'null': 'True', 'blank': 'True'}), + 'requested_operation_type': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'to': "orm['ishtar_common.OperationType']"}), + 'research_comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'responsible_town_planning_service': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'responsible_town_planning_service_files'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'saisine_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_files.SaisineType']", 'null': 'True', 'blank': 'True'}), + 'scientist': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'scientist'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'total_developed_surface': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'total_surface': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'towns': ('django.db.models.fields.related.ManyToManyField', [], {'related_name': "'file'", 'symmetrical': 'False', 'to': "orm['ishtar_common.Town']"}), + 'year': ('django.db.models.fields.IntegerField', [], {'default': '2017'}) + }, + 'archaeological_files.filetype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'FileType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_files.permittype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'PermitType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_files.saisinetype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'SaisineType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'delay': ('django.db.models.fields.IntegerField', [], {'default': '30'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_finds.treatment': { + 'Meta': {'unique_together': "(('year', 'index'),)", 'object_name': 'Treatment'}, + 'cached_label': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'container': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_warehouse.Container']", 'null': 'True', 'blank': 'True'}), + 'description': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'end_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'estimated_cost': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'external_id': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'file': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'treatments'", 'null': 'True', 'to': "orm['archaeological_finds.TreatmentFile']"}), + 'goal': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'image': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_finds_treatment'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'index': ('django.db.models.fields.IntegerField', [], {'default': '1'}), + 'insurance_cost': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'location': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_warehouse.Warehouse']", 'null': 'True', 'blank': 'True'}), + 'organization': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'treatments'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Organization']"}), + 'other_reference': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'person': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'treatments'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'quoted_cost': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'realized_cost': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'start_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'target_is_basket': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'thumbnail': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'treatment_state': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_finds.TreatmentState']", 'null': 'True', 'blank': 'True'}), + 'treatment_types': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['archaeological_finds.TreatmentType']", 'symmetrical': 'False'}), + 'year': ('django.db.models.fields.IntegerField', [], {'default': '2017'}) + }, + 'archaeological_finds.treatmentfile': { + 'Meta': {'ordering': "('cached_label',)", 'unique_together': "(('year', 'index'),)", 'object_name': 'TreatmentFile'}, + 'applicant': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'treatmentfile_applicant'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'applicant_organisation': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'treatmentfile_applicant'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Organization']"}), + 'cached_label': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'creation_date': ('django.db.models.fields.DateField', [], {'default': 'datetime.date.today', 'null': 'True', 'blank': 'True'}), + 'end_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'external_id': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_finds_treatmentfile'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'in_charge': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'treatmentfile_responsability'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'index': ('django.db.models.fields.IntegerField', [], {'default': '1'}), + 'internal_reference': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'name': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'reception_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_finds.TreatmentFileType']"}), + 'year': ('django.db.models.fields.IntegerField', [], {'default': '2017'}) + }, + 'archaeological_finds.treatmentfiletype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'TreatmentFileType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_finds.treatmentstate': { + 'Meta': {'ordering': "('label',)", 'object_name': 'TreatmentState'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_finds.treatmenttype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'TreatmentType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'downstream_is_many': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'order': ('django.db.models.fields.IntegerField', [], {'default': '10'}), + 'parent': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_finds.TreatmentType']", 'null': 'True', 'blank': 'True'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}), + 'upstream_is_many': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'virtual': ('django.db.models.fields.BooleanField', [], {'default': 'False'}) + }, + 'archaeological_operations.acttype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'ActType'}, + 'associated_template': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'acttypes'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.DocumentTemplate']"}), + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'code': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'indexed': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'intented_to': ('django.db.models.fields.CharField', [], {'max_length': '2'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_operations.administrativeact': { + 'Meta': {'ordering': "('year', 'signature_date', 'index', 'act_type')", 'object_name': 'AdministrativeAct'}, + 'act_object': ('django.db.models.fields.TextField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'act_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_operations.ActType']"}), + 'associated_file': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'administrative_act'", 'null': 'True', 'to': "orm['archaeological_files.File']"}), + 'departments_label': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_operations_administrativeact'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'in_charge': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'adminact_operation_in_charge'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'index': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'operation': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'administrative_act'", 'null': 'True', 'to': "orm['archaeological_operations.Operation']"}), + 'operator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'adminact_operator'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Organization']"}), + 'ref_sra': ('django.db.models.fields.CharField', [], {'max_length': '15', 'null': 'True', 'blank': 'True'}), + 'scientist': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'adminact_scientist'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'signatory': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'signatory'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'signature_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'towns_label': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'treatment': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'administrative_act'", 'null': 'True', 'to': "orm['archaeological_finds.Treatment']"}), + 'treatment_file': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'administrative_act'", 'null': 'True', 'to': "orm['archaeological_finds.TreatmentFile']"}), + 'year': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}) + }, + 'archaeological_operations.archaeologicalsite': { + 'Meta': {'object_name': 'ArchaeologicalSite'}, + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_operations_archaeologicalsite'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'periods': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['archaeological_operations.Period']", 'null': 'True', 'blank': 'True'}), + 'reference': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '20'}), + 'remains': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['archaeological_operations.RemainType']", 'null': 'True', 'blank': 'True'}) + }, + 'archaeological_operations.historicaladministrativeact': { + 'Meta': {'ordering': "('-history_date', '-history_id')", 'object_name': 'HistoricalAdministrativeAct'}, + 'act_object': ('django.db.models.fields.TextField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'act_type_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'associated_file_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'departments_label': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'history_creator_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'history_date': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}), + 'history_id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'history_modifier_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'history_type': ('django.db.models.fields.CharField', [], {'max_length': '1'}), + 'history_user': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']", 'null': 'True'}), + 'id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'blank': 'True'}), + 'in_charge_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'index': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'operation_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'operator_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'ref_sra': ('django.db.models.fields.CharField', [], {'max_length': '15', 'null': 'True', 'blank': 'True'}), + 'scientist_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'signatory_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'signature_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'towns_label': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'treatment_file_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'treatment_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'year': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}) + }, + 'archaeological_operations.historicaloperation': { + 'Meta': {'ordering': "('-history_date', '-history_id')", 'object_name': 'HistoricalOperation'}, + 'abstract': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'associated_file_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'cached_label': ('django.db.models.fields.CharField', [], {'max_length': '500', 'null': 'True', 'blank': 'True'}), + 'cira_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'cira_rapporteur_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'code_patriarche': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'common_name': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'cost': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'creation_date': ('django.db.models.fields.DateField', [], {'default': 'datetime.date.today'}), + 'documentation_deadline': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'documentation_received': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'eas_number': ('django.db.models.fields.CharField', [], {'max_length': '20', 'null': 'True', 'blank': 'True'}), + 'effective_man_days': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'end_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'excavation_end_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'finds_deadline': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'finds_received': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'fnap_cost': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'fnap_financing': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'geoarchaeological_context_prescription': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'history_creator_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'history_date': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}), + 'history_id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'history_modifier_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'history_type': ('django.db.models.fields.CharField', [], {'max_length': '1'}), + 'history_user': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']", 'null': 'True'}), + 'id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'blank': 'True'}), + 'image': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'in_charge_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'large_area_prescription': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'multi_polygon': ('django.contrib.gis.db.models.fields.MultiPolygonField', [], {'null': 'True', 'blank': 'True'}), + 'negative_result': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'old_code': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'operation_code': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'operation_type_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'operator_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'operator_reference': ('django.db.models.fields.CharField', [], {'max_length': '20', 'null': 'True', 'blank': 'True'}), + 'optional_man_days': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'point': ('django.contrib.gis.db.models.fields.PointField', [], {'null': 'True', 'blank': 'True'}), + 'record_quality': ('django.db.models.fields.CharField', [], {'max_length': '2', 'null': 'True', 'blank': 'True'}), + 'report_delivery_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'report_processing_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'scheduled_man_days': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'scientific_documentation_comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'scientist_id': ('django.db.models.fields.IntegerField', [], {'db_index': 'True', 'null': 'True', 'blank': 'True'}), + 'start_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'surface': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'thumbnail': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'virtual_operation': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'year': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'zoning_prescription': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}) + }, + 'archaeological_operations.operation': { + 'Meta': {'ordering': "('cached_label',)", 'object_name': 'Operation'}, + 'abstract': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'archaeological_sites': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['archaeological_operations.ArchaeologicalSite']", 'null': 'True', 'blank': 'True'}), + 'associated_file': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'operations'", 'null': 'True', 'to': "orm['archaeological_files.File']"}), + 'cached_label': ('django.db.models.fields.CharField', [], {'max_length': '500', 'null': 'True', 'blank': 'True'}), + 'cira_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'cira_rapporteur': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'cira_rapporteur'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'code_patriarche': ('django.db.models.fields.IntegerField', [], {'unique': 'True', 'null': 'True', 'blank': 'True'}), + 'collaborators': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['ishtar_common.Person']", 'null': 'True', 'blank': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'common_name': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'cost': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'creation_date': ('django.db.models.fields.DateField', [], {'default': 'datetime.date.today'}), + 'documentation_deadline': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'documentation_received': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'eas_number': ('django.db.models.fields.CharField', [], {'max_length': '20', 'null': 'True', 'blank': 'True'}), + 'effective_man_days': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'end_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'excavation_end_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'finds_deadline': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'finds_received': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'fnap_cost': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'fnap_financing': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'geoarchaeological_context_prescription': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'image': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_operations_operation'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'in_charge': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'operation_responsability'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'large_area_prescription': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'multi_polygon': ('django.contrib.gis.db.models.fields.MultiPolygonField', [], {'null': 'True', 'blank': 'True'}), + 'negative_result': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}), + 'old_code': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'operation_code': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'operation_type': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'+'", 'to': "orm['ishtar_common.OperationType']"}), + 'operator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'operator'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Organization']"}), + 'operator_reference': ('django.db.models.fields.CharField', [], {'max_length': '20', 'null': 'True', 'blank': 'True'}), + 'optional_man_days': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'periods': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['archaeological_operations.Period']", 'null': 'True', 'blank': 'True'}), + 'point': ('django.contrib.gis.db.models.fields.PointField', [], {'null': 'True', 'blank': 'True'}), + 'record_quality': ('django.db.models.fields.CharField', [], {'max_length': '2', 'null': 'True', 'blank': 'True'}), + 'remains': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['archaeological_operations.RemainType']", 'null': 'True', 'blank': 'True'}), + 'report_delivery_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'report_processing': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_operations.ReportState']", 'null': 'True', 'blank': 'True'}), + 'scheduled_man_days': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'scientific_documentation_comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'scientist': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'operation_scientist_responsability'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'start_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'surface': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'thumbnail': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'towns': ('django.db.models.fields.related.ManyToManyField', [], {'related_name': "'operations'", 'symmetrical': 'False', 'to': "orm['ishtar_common.Town']"}), + 'virtual_operation': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'year': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'zoning_prescription': ('django.db.models.fields.NullBooleanField', [], {'null': 'True', 'blank': 'True'}) + }, + 'archaeological_operations.operationbydepartment': { + 'Meta': {'object_name': 'OperationByDepartment', 'db_table': "'operation_department'", 'managed': 'False'}, + 'department': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.Department']", 'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'operation': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_operations.Operation']"}) + }, + 'archaeological_operations.operationsource': { + 'Meta': {'object_name': 'OperationSource'}, + 'additional_information': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'associated_url': ('django.db.models.fields.URLField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'authors': ('django.db.models.fields.related.ManyToManyField', [], {'related_name': "'operationsource_related'", 'symmetrical': 'False', 'to': "orm['ishtar_common.Author']"}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'creation_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'description': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'duplicate': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'external_id': ('django.db.models.fields.CharField', [], {'max_length': '12', 'null': 'True', 'blank': 'True'}), + 'format_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.Format']", 'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'image': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'index': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'internal_reference': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), + 'item_number': ('django.db.models.fields.IntegerField', [], {'default': '1'}), + 'operation': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'source'", 'to': "orm['archaeological_operations.Operation']"}), + 'receipt_date': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'receipt_date_in_documentation': ('django.db.models.fields.DateField', [], {'null': 'True', 'blank': 'True'}), + 'reference': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), + 'scale': ('django.db.models.fields.CharField', [], {'max_length': '30', 'null': 'True', 'blank': 'True'}), + 'source_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.SourceType']"}), + 'support_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.SupportType']", 'null': 'True', 'blank': 'True'}), + 'thumbnail': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'title': ('django.db.models.fields.CharField', [], {'max_length': '300'}) + }, + 'archaeological_operations.operationtypeold': { + 'Meta': {'ordering': "['-preventive', 'order', 'label']", 'object_name': 'OperationTypeOld'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'order': ('django.db.models.fields.IntegerField', [], {'default': '1'}), + 'preventive': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_operations.parcel': { + 'Meta': {'ordering': "('year', 'section', 'parcel_number')", 'object_name': 'Parcel'}, + 'address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'associated_file': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'parcels'", 'null': 'True', 'to': "orm['archaeological_files.File']"}), + 'auto_external_id': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'external_id': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_date': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_operations_parcel'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'operation': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'parcels'", 'null': 'True', 'to': "orm['archaeological_operations.Operation']"}), + 'parcel_number': ('django.db.models.fields.CharField', [], {'max_length': '6', 'null': 'True', 'blank': 'True'}), + 'public_domain': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'section': ('django.db.models.fields.CharField', [], {'max_length': '4', 'null': 'True', 'blank': 'True'}), + 'town': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'parcels'", 'to': "orm['ishtar_common.Town']"}), + 'year': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}) + }, + 'archaeological_operations.parcelowner': { + 'Meta': {'object_name': 'ParcelOwner'}, + 'end_date': ('django.db.models.fields.DateField', [], {}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_date': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_operations_parcelowner'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'owner': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'parcel_owner'", 'to': "orm['ishtar_common.Person']"}), + 'parcel': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'owners'", 'to': "orm['archaeological_operations.Parcel']"}), + 'start_date': ('django.db.models.fields.DateField', [], {}) + }, + 'archaeological_operations.period': { + 'Meta': {'ordering': "('order',)", 'object_name': 'Period'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'end_date': ('django.db.models.fields.IntegerField', [], {}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'order': ('django.db.models.fields.IntegerField', [], {}), + 'parent': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_operations.Period']", 'null': 'True', 'blank': 'True'}), + 'start_date': ('django.db.models.fields.IntegerField', [], {}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_operations.recordrelations': { + 'Meta': {'ordering': "('left_record', 'relation_type')", 'object_name': 'RecordRelations'}, + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'left_record': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'right_relations'", 'to': "orm['archaeological_operations.Operation']"}), + 'relation_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_operations.RelationType']"}), + 'right_record': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'left_relations'", 'to': "orm['archaeological_operations.Operation']"}) + }, + 'archaeological_operations.relationtype': { + 'Meta': {'ordering': "('order', 'label')", 'object_name': 'RelationType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'inverse_relation': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_operations.RelationType']", 'null': 'True', 'blank': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'order': ('django.db.models.fields.IntegerField', [], {'default': '1'}), + 'symmetrical': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'tiny_label': ('django.db.models.fields.CharField', [], {'max_length': '50', 'null': 'True', 'blank': 'True'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_operations.remaintype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'RemainType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_operations.reportstate': { + 'Meta': {'ordering': "('order',)", 'object_name': 'ReportState'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'order': ('django.db.models.fields.IntegerField', [], {}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_warehouse.container': { + 'Meta': {'ordering': "('cached_label',)", 'unique_together': "(('index', 'location'),)", 'object_name': 'Container'}, + 'auto_external_id': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'cached_label': ('django.db.models.fields.CharField', [], {'max_length': '500', 'null': 'True', 'blank': 'True'}), + 'cached_location': ('django.db.models.fields.CharField', [], {'max_length': '500', 'null': 'True', 'blank': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'container_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_warehouse.ContainerType']"}), + 'external_id': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_date': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'image': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_warehouse_container'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'index': ('django.db.models.fields.IntegerField', [], {'default': '0'}), + 'location': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'containers'", 'to': "orm['archaeological_warehouse.Warehouse']"}), + 'reference': ('django.db.models.fields.CharField', [], {'max_length': '40'}), + 'responsible': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'owned_containers'", 'to': "orm['archaeological_warehouse.Warehouse']"}), + 'thumbnail': ('django.db.models.fields.files.ImageField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}) + }, + 'archaeological_warehouse.containertype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'ContainerType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'height': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'length': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'reference': ('django.db.models.fields.CharField', [], {'max_length': '30'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}), + 'volume': ('django.db.models.fields.FloatField', [], {'null': 'True', 'blank': 'True'}), + 'width': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}) + }, + 'archaeological_warehouse.warehouse': { + 'Meta': {'object_name': 'Warehouse'}, + 'address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'address_complement': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address_complement': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address_is_prefered': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'alt_country': ('django.db.models.fields.CharField', [], {'max_length': '30', 'null': 'True', 'blank': 'True'}), + 'alt_postal_code': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), + 'alt_town': ('django.db.models.fields.CharField', [], {'max_length': '70', 'null': 'True', 'blank': 'True'}), + 'associated_divisions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['archaeological_warehouse.WarehouseDivision']", 'symmetrical': 'False', 'through': "orm['archaeological_warehouse.WarehouseDivisionLink']", 'blank': 'True'}), + 'auto_external_id': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'country': ('django.db.models.fields.CharField', [], {'max_length': '30', 'null': 'True', 'blank': 'True'}), + 'email': ('django.db.models.fields.EmailField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'external_id': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_archaeological_warehouse_warehouse'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'mobile_phone': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '200'}), + 'person_in_charge': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'warehouse_in_charge'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Person']"}), + 'phone': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone2': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone3': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone_desc': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'phone_desc2': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'phone_desc3': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'postal_code': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), + 'raw_phone': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'town': ('django.db.models.fields.CharField', [], {'max_length': '70', 'null': 'True', 'blank': 'True'}), + 'warehouse_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_warehouse.WarehouseType']"}) + }, + 'archaeological_warehouse.warehousedivision': { + 'Meta': {'object_name': 'WarehouseDivision'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'archaeological_warehouse.warehousedivisionlink': { + 'Meta': {'ordering': "('warehouse', 'order')", 'unique_together': "(('warehouse', 'division'),)", 'object_name': 'WarehouseDivisionLink'}, + 'division': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_warehouse.WarehouseDivision']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'order': ('django.db.models.fields.IntegerField', [], {'default': '10'}), + 'warehouse': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['archaeological_warehouse.Warehouse']"}) + }, + 'archaeological_warehouse.warehousetype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'WarehouseType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'auth.group': { + 'Meta': {'object_name': 'Group'}, + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), + 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) + }, + 'auth.permission': { + 'Meta': {'ordering': "('content_type__app_label', 'content_type__model', 'codename')", 'unique_together': "(('content_type', 'codename'),)", 'object_name': 'Permission'}, + 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['contenttypes.ContentType']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) + }, + 'auth.user': { + 'Meta': {'object_name': 'User'}, + 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), + 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), + 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), + 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), + 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), + 'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}), + 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}), + 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}) + }, + 'contenttypes.contenttype': { + 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"}, + 'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) + }, + 'ishtar_common.arrondissement': { + 'Meta': {'object_name': 'Arrondissement'}, + 'department': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.Department']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '30'}) + }, + 'ishtar_common.author': { + 'Meta': {'ordering': "('author_type__order', 'person__name')", 'object_name': 'Author'}, + 'author_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.AuthorType']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'person': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'author'", 'to': "orm['ishtar_common.Person']"}) + }, + 'ishtar_common.authortype': { + 'Meta': {'ordering': "['order', 'label']", 'object_name': 'AuthorType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'order': ('django.db.models.fields.IntegerField', [], {'default': '1'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'ishtar_common.canton': { + 'Meta': {'object_name': 'Canton'}, + 'arrondissement': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.Arrondissement']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '30'}) + }, + 'ishtar_common.department': { + 'Meta': {'ordering': "['number']", 'object_name': 'Department'}, + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '30'}), + 'number': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '3'}), + 'state': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.State']", 'null': 'True', 'blank': 'True'}) + }, + 'ishtar_common.documenttemplate': { + 'Meta': {'ordering': "['associated_object_name', 'name']", 'object_name': 'DocumentTemplate'}, + 'associated_object_name': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'template': ('django.db.models.fields.files.FileField', [], {'max_length': '100'}) + }, + 'ishtar_common.format': { + 'Meta': {'ordering': "['label']", 'object_name': 'Format'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'ishtar_common.import': { + 'Meta': {'object_name': 'Import'}, + 'conservative_import': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'creation_date': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'null': 'True', 'blank': 'True'}), + 'encoding': ('django.db.models.fields.CharField', [], {'default': "'utf-8'", 'max_length': '15'}), + 'end_date': ('django.db.models.fields.DateTimeField', [], {'null': 'True', 'blank': 'True'}), + 'error_file': ('django.db.models.fields.files.FileField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imported_file': ('django.db.models.fields.files.FileField', [], {'max_length': '220'}), + 'imported_images': ('django.db.models.fields.files.FileField', [], {'max_length': '220', 'null': 'True', 'blank': 'True'}), + 'importer_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.ImporterType']"}), + 'match_file': ('django.db.models.fields.files.FileField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '500', 'null': 'True', 'blank': 'True'}), + 'result_file': ('django.db.models.fields.files.FileField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), + 'seconds_remaining': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), + 'skip_lines': ('django.db.models.fields.IntegerField', [], {'default': '1'}), + 'state': ('django.db.models.fields.CharField', [], {'default': "'C'", 'max_length': '2'}), + 'user': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.IshtarUser']"}) + }, + 'ishtar_common.importermodel': { + 'Meta': {'ordering': "('name',)", 'object_name': 'ImporterModel'}, + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'klass': ('django.db.models.fields.CharField', [], {'max_length': '200'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '200'}) + }, + 'ishtar_common.importertype': { + 'Meta': {'ordering': "('name',)", 'object_name': 'ImporterType'}, + 'associated_models': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'to': "orm['ishtar_common.ImporterModel']"}), + 'created_models': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.ImporterModel']"}), + 'description': ('django.db.models.fields.CharField', [], {'max_length': '500', 'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'is_template': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), + 'slug': ('django.db.models.fields.SlugField', [], {'max_length': '100', 'unique': 'True', 'null': 'True', 'blank': 'True'}), + 'unicity_keys': ('django.db.models.fields.CharField', [], {'max_length': '500', 'null': 'True', 'blank': 'True'}), + 'users': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['ishtar_common.IshtarUser']", 'null': 'True', 'blank': 'True'}) + }, + 'ishtar_common.ishtaruser': { + 'Meta': {'object_name': 'IshtarUser', '_ormbases': ['auth.User']}, + 'advanced_shortcut_menu': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'person': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'ishtaruser'", 'unique': 'True', 'to': "orm['ishtar_common.Person']"}), + 'user_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['auth.User']", 'unique': 'True', 'primary_key': 'True'}) + }, + 'ishtar_common.operationtype': { + 'Meta': {'ordering': "['-preventive', 'order', 'label']", 'object_name': 'OperationType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'order': ('django.db.models.fields.IntegerField', [], {'default': '1'}), + 'preventive': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'ishtar_common.organization': { + 'Meta': {'object_name': 'Organization'}, + 'address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'address_complement': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address_complement': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address_is_prefered': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'alt_country': ('django.db.models.fields.CharField', [], {'max_length': '30', 'null': 'True', 'blank': 'True'}), + 'alt_postal_code': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), + 'alt_town': ('django.db.models.fields.CharField', [], {'max_length': '70', 'null': 'True', 'blank': 'True'}), + 'archived': ('django.db.models.fields.NullBooleanField', [], {'default': 'False', 'null': 'True', 'blank': 'True'}), + 'country': ('django.db.models.fields.CharField', [], {'max_length': '30', 'null': 'True', 'blank': 'True'}), + 'email': ('django.db.models.fields.EmailField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_ishtar_common_organization'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'merge_candidate': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'merge_candidate_rel_+'", 'null': 'True', 'to': "orm['ishtar_common.Organization']"}), + 'merge_exclusion': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'merge_exclusion_rel_+'", 'null': 'True', 'to': "orm['ishtar_common.Organization']"}), + 'merge_key': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'mobile_phone': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '500'}), + 'organization_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.OrganizationType']"}), + 'phone': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone2': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone3': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone_desc': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'phone_desc2': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'phone_desc3': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'postal_code': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), + 'raw_phone': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'town': ('django.db.models.fields.CharField', [], {'max_length': '70', 'null': 'True', 'blank': 'True'}) + }, + 'ishtar_common.organizationtype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'OrganizationType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'ishtar_common.person': { + 'Meta': {'object_name': 'Person'}, + 'address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'address_complement': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address_complement': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'alt_address_is_prefered': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), + 'alt_country': ('django.db.models.fields.CharField', [], {'max_length': '30', 'null': 'True', 'blank': 'True'}), + 'alt_postal_code': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), + 'alt_town': ('django.db.models.fields.CharField', [], {'max_length': '70', 'null': 'True', 'blank': 'True'}), + 'archived': ('django.db.models.fields.NullBooleanField', [], {'default': 'False', 'null': 'True', 'blank': 'True'}), + 'attached_to': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'members'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['ishtar_common.Organization']"}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'contact_type': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'country': ('django.db.models.fields.CharField', [], {'max_length': '30', 'null': 'True', 'blank': 'True'}), + 'email': ('django.db.models.fields.EmailField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'history_creator': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'history_modifier': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "'+'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['auth.User']"}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_ishtar_common_person'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'merge_candidate': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'merge_candidate_rel_+'", 'null': 'True', 'to': "orm['ishtar_common.Person']"}), + 'merge_exclusion': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'merge_exclusion_rel_+'", 'null': 'True', 'to': "orm['ishtar_common.Person']"}), + 'merge_key': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'mobile_phone': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'old_title': ('django.db.models.fields.CharField', [], {'max_length': '100', 'null': 'True', 'blank': 'True'}), + 'person_types': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['ishtar_common.PersonType']", 'symmetrical': 'False'}), + 'phone': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone2': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone3': ('django.db.models.fields.CharField', [], {'max_length': '18', 'null': 'True', 'blank': 'True'}), + 'phone_desc': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'phone_desc2': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'phone_desc3': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'postal_code': ('django.db.models.fields.CharField', [], {'max_length': '10', 'null': 'True', 'blank': 'True'}), + 'raw_name': ('django.db.models.fields.CharField', [], {'max_length': '300', 'null': 'True', 'blank': 'True'}), + 'raw_phone': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'salutation': ('django.db.models.fields.CharField', [], {'max_length': '200', 'null': 'True', 'blank': 'True'}), + 'surname': ('django.db.models.fields.CharField', [], {'max_length': '50', 'null': 'True', 'blank': 'True'}), + 'title': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.TitleType']", 'null': 'True', 'blank': 'True'}), + 'town': ('django.db.models.fields.CharField', [], {'max_length': '70', 'null': 'True', 'blank': 'True'}) + }, + 'ishtar_common.persontype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'PersonType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'to': "orm['auth.Group']", 'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'ishtar_common.sourcetype': { + 'Meta': {'ordering': "['label']", 'object_name': 'SourceType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'ishtar_common.state': { + 'Meta': {'ordering': "['number']", 'object_name': 'State'}, + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '30'}), + 'number': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '3'}) + }, + 'ishtar_common.supporttype': { + 'Meta': {'object_name': 'SupportType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'ishtar_common.titletype': { + 'Meta': {'ordering': "('label',)", 'object_name': 'TitleType'}, + 'available': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), + 'comment': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'txt_idx': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '100'}) + }, + 'ishtar_common.town': { + 'Meta': {'ordering': "['numero_insee']", 'object_name': 'Town'}, + 'canton': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.Canton']", 'null': 'True', 'blank': 'True'}), + 'center': ('django.contrib.gis.db.models.fields.PointField', [], {'srid': '27572', 'null': 'True', 'blank': 'True'}), + 'departement': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['ishtar_common.Department']", 'null': 'True', 'blank': 'True'}), + 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), + 'imports': ('django.db.models.fields.related.ManyToManyField', [], {'blank': 'True', 'related_name': "'imported_ishtar_common_town'", 'null': 'True', 'symmetrical': 'False', 'to': "orm['ishtar_common.Import']"}), + 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}), + 'numero_insee': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '6'}), + 'surface': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}) + } + } + + complete_apps = ['archaeological_operations']
\ No newline at end of file diff --git a/archaeological_operations/models.py b/archaeological_operations/models.py index e741f5644..3826678c3 100644 --- a/archaeological_operations/models.py +++ b/archaeological_operations/models.py @@ -269,6 +269,10 @@ class Operation(ClosedItem, BaseHistorizedItem, ImageModel, OwnPerms, verbose_name=_(u"In charge"), on_delete=models.SET_NULL, related_name='operation_responsability') + collaborators = models.ManyToManyField( + Person, blank=True, null=True, verbose_name=_(u"Collaborators"), + related_name='operation_collaborator' + ) year = models.IntegerField(_(u"Year"), null=True, blank=True) operation_code = models.IntegerField(_(u"Numeric reference"), null=True, blank=True) @@ -570,8 +574,10 @@ class Operation(ClosedItem, BaseHistorizedItem, ImageModel, OwnPerms, @classmethod def get_query_owns(cls, user): - return (Q(in_charge=user.ishtaruser.person) |\ - Q(scientist=user.ishtaruser.person) |\ + return ( + Q(in_charge=user.ishtaruser.person) | + Q(scientist=user.ishtaruser.person) | + Q(collaborators__pk=user.ishtaruser.person.pk) | Q(history_creator=user)) & Q(end_date__isnull=True) def is_active(self): @@ -587,14 +593,6 @@ class Operation(ClosedItem, BaseHistorizedItem, ImageModel, OwnPerms, nb = self.parcels.count() return nb - def _get_or_set_stats(self, funcname, update): - key, val = get_cache(self.__class__, [funcname, self.pk]) - if not update and val is not None: - return val - val = getattr(self, funcname)() - cache.set(key, val, settings.CACHE_TIMEOUT) - return val - @property def nb_acts(self, update=False): _(u"Number of administrative acts") @@ -911,6 +909,13 @@ class OperationSource(Source): return u"{}-{:04d}".format(self.operation.code_patriarche or '', self.index) + @classmethod + def get_query_owns(cls, user): + return (Q(operation__in_charge=user.ishtaruser.person) | + Q(operation__scientist=user.ishtaruser.person) | + Q(operation__collaborators__pk=user.ishtaruser.person.pk)) \ + & Q(operation__end_date__isnull=True) + class ActType(GeneralType): TYPE = (('F', _(u'Archaeological file')), diff --git a/archaeological_operations/templates/ishtar/sheet_administrativeact.html b/archaeological_operations/templates/ishtar/sheet_administrativeact.html index 080275aa9..92246ba80 100644 --- a/archaeological_operations/templates/ishtar/sheet_administrativeact.html +++ b/archaeological_operations/templates/ishtar/sheet_administrativeact.html @@ -33,13 +33,13 @@ {% field_li_detail "Treatment request" item.treatment_file %} {% if item.operation and item.operation.surface %} - <li><label>{% trans "Surface:"%}</label> <span class='value'>{{ item.operation.surface }} m<sup>2</sup> ({{ item.operation.surface_ha }} ha)</span></li> + <li><label>{% trans "Surface"%}</label> <span class='value'>{{ item.operation.surface }} m<sup>2</sup> ({{ item.operation.surface_ha }} ha)</span></li> {% endif %} {% field_li_detail "Created by" item.history_creator.ishtaruser.person %} {% comment %}{% if item.general_contractor.attached_to %}<p> - <label>{% trans "General contractor organisation:"%}</label> + <label>{% trans "General contractor organisation"%}</label> <span class='value'>{{ item.general_contractor.attached_to }}</span></p>{% endif %} <!-- Contractor's organisation displayed as concat of Name/Adress/postal_code/city --> -{% if item.general_contractor %}<p><label>{%trans "General contractor:"%}</label> <span class='value'>{{ item.general_contractor.full_label }}</span></p>{% endif %} +{% if item.general_contractor %}<p><label>{%trans "General contractor"%}</label> <span class='value'>{{ item.general_contractor.full_label }}</span></p>{% endif %} {% endcomment %} </ul> diff --git a/archaeological_operations/templates/ishtar/sheet_operation.html b/archaeological_operations/templates/ishtar/sheet_operation.html index 48116433c..5a02236a3 100644 --- a/archaeological_operations/templates/ishtar/sheet_operation.html +++ b/archaeological_operations/templates/ishtar/sheet_operation.html @@ -29,17 +29,18 @@ {% include "ishtar/blocks/sheet_creation_section.html" %} {% trans "Begining date" as begining_date_label %} {% field_li begining_date_label item.start_date %} -{% field_li "Excavation end date" item.excavation_end_date|default:"-" %} -{% field_li_detail "Head scientist" item.scientist %} -{% field_li_detail "In charge" item.in_charge %} -{% field_li_detail "Operator" item.operator %} + {% field_li "Excavation end date" item.excavation_end_date|default:"-" %} + {% field_li_detail "Head scientist" item.scientist %} + {% field_li_detail "In charge" item.in_charge %} + {% field_li_multiple "Collaborators" item.collaborators %} + {% field_li_detail "Operator" item.operator %} <li><label>{%trans "State:"%}</label> <span class='value'>{% if item.is_active %}{%trans "Active file"%}</span></p> {% else %}{%trans "Closed operation"%}</span></li> {% endif %} -{% if item.closing.date %}<li><label>{%trans "Closing date:"%}</label> <span class='value'>{{ item.closing.date }} <strong>{%trans "by" %}</strong> {{ item.closing.user }}</span></li>{% endif %} +{% if item.closing.date %}<li><label>{%trans "Closing date"%}</label> <span class='value'>{{ item.closing.date }} <strong>{%trans "by" %}</strong> {{ item.closing.user }}</span></li>{% endif %} {% field_li "Type" item.operation_type %} -{% if item.surface %}<li><label>{%trans "Surface:"%}</label> <span class='value'>{{ item.surface }} m<sup>2</sup> ({{ item.surface_ha }} ha)</span></li>{% endif %} -{% if item.cost %}<li><label>{%trans "Cost:"%}</label> <span class='value'>{{ item.cost }} €{% if item.cost_by_m2 %}, ({{ item.cost_by_m2 }} €/m<sup>2</sup>){%endif%}</span></li>{%endif%} -{% if item.duration %}<li><label>{%trans "Duration:"%}</label> <span class='value'>{{ item.duration }} {%trans "Day"%}s</span></li>{%endif%} +{% if item.surface %}<li><label>{%trans "Surface"%}</label> <span class='value'>{{ item.surface }} m<sup>2</sup> ({{ item.surface_ha }} ha)</span></li>{% endif %} +{% if item.cost %}<li><label>{%trans "Cost"%}</label> <span class='value'>{{ item.cost }} €{% if item.cost_by_m2 %}, ({{ item.cost_by_m2 }} €/m<sup>2</sup>){%endif%}</span></li>{%endif%} +{% if item.duration %}<li><label>{%trans "Duration"%}</label> <span class='value'>{{ item.duration }} {%trans "Day"%}s</span></li>{%endif%} {% field_li_multiple "Remains" item.remains %} {% field_li_multiple "Periods" item.periods %} {% if item.QUALITY_DICT %}{% field_li "Record quality" item.record_quality|from_dict:item.QUALITY_DICT %}{% endif %} @@ -141,6 +142,7 @@ {% endif %} <h3>{% trans "Statistics" %}</h3> +<small class="centered"><em>{% trans "These numbers are updated hourly" %}</em></small> <h4>{% trans "Administrative acts" %}</h4> <ul class='form-flex'> diff --git a/archaeological_operations/tests.py b/archaeological_operations/tests.py index 9d5b9c616..67f9454fa 100644 --- a/archaeological_operations/tests.py +++ b/archaeological_operations/tests.py @@ -1,6 +1,6 @@ #!/usr/bin/env python # -*- coding: utf-8 -*- -# Copyright (C) 2012-2016 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> +# Copyright (C) 2012-2017 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as @@ -699,7 +699,8 @@ class OperationTest(TestCase, OperationInitTest): '../archaeological_operations/fixtures/initial_data-fr.json'] def setUp(self): - IshtarSiteProfile.objects.create() + IshtarSiteProfile.objects.get_or_create( + slug='default', active=True) self.username, self.password, self.user = create_superuser() self.alt_username, self.alt_password, self.alt_user = create_user() self.alt_user.user_permissions.add(Permission.objects.get( @@ -886,7 +887,8 @@ class OperationSearchTest(TestCase, OperationInitTest): '../archaeological_operations/fixtures/initial_data-fr.json'] def setUp(self): - IshtarSiteProfile.objects.create() + IshtarSiteProfile.objects.get_or_create( + slug='default', active=True) self.username, self.password, self.user = create_superuser() self.alt_username, self.alt_password, self.alt_user = create_user() self.alt_user.user_permissions.add(Permission.objects.get( @@ -1012,7 +1014,7 @@ class RegisterTest(TestCase, OperationInitTest): def testSearch(self): c = Client() response = c.get(reverse('get-administrativeact'), {'year': '2014'}) - # no result when no authentification + # no result when no authentication self.assertTrue(not json.loads(response.content)) c.login(username=self.username, password=self.password) response = c.get(reverse('get-administrativeact'), {'year': '2014'}) @@ -1037,34 +1039,39 @@ class OperationWizardCreationTest(WizardTest, OperationInitTest, TestCase): FormData( "Create a preventive diag", form_datas={ + 'filechoice-operation_creation': {}, 'general-operation_creation': { 'operation_type': 1, # preventive diag 'year': 2016}, 'townsgeneral-operation_creation': [], 'parcelsgeneral-operation_creation': [], }, - ignored=('filechoice-operation_creation', - 'towns-operation_creation', + ignored=('towns-operation_creation', 'parcels-operation_creation', 'preventive-operation_creation',) ), FormData( "Create another preventive diag with same parcel name", form_datas={ + 'filechoice-operation_creation': {}, 'general-operation_creation': { 'operation_type': 1, # preventive diag 'year': 2016}, 'townsgeneral-operation_creation': [], 'parcelsgeneral-operation_creation': [], }, - ignored=('filechoice-operation_creation', - 'towns-operation_creation', + ignored=('towns-operation_creation', 'parcels-operation_creation', 'preventive-operation_creation',) ) ] def pre_wizard(self): + profile, created = IshtarSiteProfile.objects.get_or_create( + slug='default', active=True) + profile.files = True + profile.save() + if 'townsgeneral-operation_creation' not in \ self.form_datas[0].form_datas: return super(OperationWizardCreationTest, self).pre_wizard() diff --git a/archaeological_operations/urls.py b/archaeological_operations/urls.py index e98ddc93f..bc6bc4bee 100644 --- a/archaeological_operations/urls.py +++ b/archaeological_operations/urls.py @@ -69,7 +69,8 @@ urlpatterns = patterns( check_rights(['view_operation', 'view_own_operation'])( views.operation_search_wizard), name='operation_search'), url(r'operation_creation/(?P<step>.+)?$', - check_rights(['add_operation'])(views.operation_creation_wizard), + check_rights(['add_operation', 'add_own_operation'])( + views.operation_creation_wizard), name='operation_creation'), url(r'operation_add/(?P<file_id>\d+)$', views.operation_add, name='operation_add'), diff --git a/archaeological_operations/utils.py b/archaeological_operations/utils.py index a84ff44ae..40ca71c05 100644 --- a/archaeological_operations/utils.py +++ b/archaeological_operations/utils.py @@ -254,9 +254,9 @@ def parse_year(value): value = parse_string(value) try: yr = int(value) - except: + except ValueError: return None - if yr < 1900 or yr > 2100: + if yr < 1600 or yr > 2100: return None return yr diff --git a/archaeological_operations/views.py b/archaeological_operations/views.py index c4e4acb5e..9b420f594 100644 --- a/archaeological_operations/views.py +++ b/archaeological_operations/views.py @@ -1,6 +1,6 @@ #!/usr/bin/env python # -*- coding: utf-8 -*- -# Copyright (C) 2010-2016 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> +# Copyright (C) 2010-2017 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as @@ -185,20 +185,29 @@ wizard_steps = [ ('final-operation_creation', FinalForm)] -def check_files_for_operation(self): - if not check_rights_condition(['view_file'])(self): - return False - return get_current_profile().files +def get_check_files_for_operation(other_check=None): + def func(self): + if not get_current_profile().files or \ + not check_rights_condition(['view_file'])(self): + return False + if not other_check: + return True + return other_check(self) + return func + +check_files_for_operation = get_check_files_for_operation() + ope_crea_condition_dict = { - 'filechoice-operation_creation': - check_files_for_operation, + 'filechoice-operation_creation': check_files_for_operation, 'preventive-operation_creation': - is_preventive('general-operation_creation', models.OperationType, - 'operation_type', 'prev_excavation'), + get_check_files_for_operation( + is_preventive('general-operation_creation', models.OperationType, + 'operation_type', 'prev_excavation')), 'preventivediag-operation_creation': - is_preventive('general-operation_creation', models.OperationType, - 'operation_type', 'arch_diagnostic'), + get_check_files_for_operation( + is_preventive('general-operation_creation', models.OperationType, + 'operation_type', 'arch_diagnostic')), 'townsgeneral-operation_creation': has_associated_file( 'filechoice-operation_creation', negate=True), 'towns-operation_creation': has_associated_file( @@ -232,25 +241,31 @@ operation_modif_wizard_steps = [ ('final-operation_modification', FinalForm) ] + +ope_modif_condition_dict = { + 'preventive-operation_modification': + get_check_files_for_operation( + is_preventive('general-operation_modification', models.OperationType, + 'operation_type', 'prev_excavation')), + 'preventivediag-operation_modification': + get_check_files_for_operation( + is_preventive('general-operation_modification', models.OperationType, + 'operation_type', 'arch_diagnostic')), + 'townsgeneral-operation_modification': has_associated_file( + 'general-operation_modification', negate=True), + 'towns-operation_modification': has_associated_file( + 'general-operation_modification'), + 'parcelsgeneral-operation_modification': has_associated_file( + 'general-operation_modification', negate=True), + 'parcels-operation_modification': has_associated_file( + 'general-operation_modification'), + +} + operation_modification_wizard = OperationModificationWizard.as_view( operation_modif_wizard_steps, label=_(u"Operation modification"), - condition_dict={ - 'preventive-operation_modification': is_preventive( - 'general-operation_modification', models.OperationType, - 'operation_type', 'prev_excavation'), - 'preventivediag-operation_modification': is_preventive( - 'general-operation_modification', models.OperationType, - 'operation_type', 'arch_diagnostic'), - 'townsgeneral-operation_modification': has_associated_file( - 'general-operation_modification', negate=True), - 'towns-operation_modification': has_associated_file( - 'general-operation_modification'), - 'parcelsgeneral-operation_modification': has_associated_file( - 'general-operation_modification', negate=True), - 'parcels-operation_modification': has_associated_file( - 'general-operation_modification'), -}, + condition_dict=ope_modif_condition_dict, url_name='operation_modification',) diff --git a/archaeological_operations/wizards.py b/archaeological_operations/wizards.py index 5410b37f8..c132c24be 100644 --- a/archaeological_operations/wizards.py +++ b/archaeological_operations/wizards.py @@ -1,6 +1,6 @@ #!/usr/bin/env python # -*- coding: utf-8 -*- -# Copyright (C) 2012-2016 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> +# Copyright (C) 2012-2017 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as @@ -275,6 +275,15 @@ class OperationModificationWizard(OperationWizard): modification = True filter_owns = {'selec-operation_modification': ['pk']} + def get_form_kwargs(self, step, **kwargs): + kwargs = super(OperationModificationWizard, self).get_form_kwargs( + step, **kwargs) + print(step) + if step != "relations-operation_modification": + return kwargs + kwargs["left_record"] = self.get_current_object() + return kwargs + class OperationClosingWizard(ClosingWizard): model = models.Operation diff --git a/archaeological_warehouse/forms.py b/archaeological_warehouse/forms.py index 3dd38d747..94e31b759 100644 --- a/archaeological_warehouse/forms.py +++ b/archaeological_warehouse/forms.py @@ -100,7 +100,7 @@ class WarehouseForm(ManageOldType, forms.Form): associated_models = {'warehouse_type': models.WarehouseType, 'person_in_charge': Person} - name = forms.CharField(label=_(u"Name"), max_length=40, + name = forms.CharField(label=_(u"Name"), max_length=200, validators=[name_validator]) warehouse_type = forms.ChoiceField(label=_(u"Warehouse type"), choices=[]) diff --git a/archaeological_warehouse/locale/django.pot b/archaeological_warehouse/locale/django.pot index d5d6e9b63..eb88b13af 100644 --- a/archaeological_warehouse/locale/django.pot +++ b/archaeological_warehouse/locale/django.pot @@ -4,19 +4,20 @@ # Étienne Loks <etienne.loks at peacefrogs net>, 2010-2011. # Valérie-Emma Leroux <emma@iggdrasil.net>, 2016. #zanata # Valérie-Emma Leroux <emma@iggdrasil.net>, 2017. #zanata +# Étienne Loks <etienne.loks@iggdrasil.net>, 2017. #zanata msgid "" msgstr "" -#: forms.py:36 forms.py:99 ishtar_menu.py:40 models.py:63 models.py:103 +#: forms.py:36 forms.py:99 ishtar_menu.py:40 models.py:65 models.py:204 #: templates/ishtar/sheet_warehouse.html:4 msgid "Warehouse" msgstr "" -#: forms.py:45 forms.py:50 models.py:281 +#: forms.py:45 forms.py:50 models.py:389 msgid "Division" msgstr "" -#: forms.py:52 models.py:127 +#: forms.py:52 models.py:228 msgid "Order" msgstr "" @@ -24,15 +25,15 @@ msgstr "" msgid "There are identical divisions." msgstr "" -#: forms.py:70 models.py:53 +#: forms.py:70 models.py:55 msgid "Divisions" msgstr "" -#: forms.py:74 forms.py:103 models.py:45 models.py:100 +#: forms.py:74 forms.py:103 models.py:47 models.py:201 msgid "Name" msgstr "" -#: forms.py:75 forms.py:105 models.py:36 models.py:47 +#: forms.py:75 forms.py:105 models.py:38 models.py:49 msgid "Warehouse type" msgstr "" @@ -44,11 +45,11 @@ msgstr "" msgid "Warehouse search" msgstr "" -#: forms.py:108 models.py:50 +#: forms.py:108 models.py:52 msgid "Person in charge" msgstr "" -#: forms.py:114 forms.py:184 models.py:51 models.py:181 +#: forms.py:114 forms.py:184 models.py:53 models.py:282 msgid "Comment" msgstr "" @@ -80,16 +81,16 @@ msgstr "" msgid "Would you like to delete this warehouse?" msgstr "" -#: forms.py:158 models.py:192 models.py:279 +#: forms.py:158 models.py:293 models.py:386 #: templates/ishtar/sheet_container.html:4 msgid "Container" msgstr "" -#: forms.py:163 forms.py:237 models.py:142 +#: forms.py:163 forms.py:237 models.py:243 msgid "Ref." msgstr "" -#: forms.py:164 forms.py:236 models.py:145 models.py:179 +#: forms.py:164 forms.py:236 models.py:246 models.py:280 msgid "Container type" msgstr "" @@ -97,7 +98,7 @@ msgstr "" msgid "Current location (warehouse)" msgstr "" -#: forms.py:172 models.py:176 +#: forms.py:172 models.py:277 msgid "Responsible warehouse" msgstr "" @@ -148,7 +149,7 @@ msgstr "" msgid "Packaged finds" msgstr "" -#: forms.py:280 models.py:182 +#: forms.py:280 models.py:283 msgid "Localisation" msgstr "" @@ -176,115 +177,116 @@ msgstr "" msgid "Deletion" msgstr "" -#: ishtar_menu.py:57 models.py:193 templates/ishtar/sheet_warehouse.html:20 +#: ishtar_menu.py:57 models.py:294 templates/ishtar/sheet_warehouse.html:20 +#: templates/ishtar/sheet_warehouse.html:53 msgid "Containers" msgstr "" -#: models.py:37 +#: models.py:39 msgid "Warehouse types" msgstr "" -#: models.py:56 models.py:187 +#: models.py:58 models.py:288 msgid "External ID" msgstr "" -#: models.py:58 models.py:189 +#: models.py:60 models.py:290 msgid "External ID is set automatically" msgstr "" -#: models.py:64 +#: models.py:66 msgid "Warehouses" msgstr "" -#: models.py:66 +#: models.py:68 msgid "Can view all Warehouses" msgstr "" -#: models.py:67 +#: models.py:69 msgid "Can view own Warehouse" msgstr "" -#: models.py:68 +#: models.py:70 msgid "Can add own Warehouse" msgstr "" -#: models.py:69 +#: models.py:71 msgid "Can change own Warehouse" msgstr "" -#: models.py:70 +#: models.py:72 msgid "Can delete own Warehouse" msgstr "" -#: models.py:102 +#: models.py:203 msgid "Description" msgstr "" -#: models.py:107 models.py:108 +#: models.py:208 models.py:209 msgid "Collection" msgstr "" -#: models.py:117 +#: models.py:218 msgid "Warehouse division type" msgstr "" -#: models.py:118 +#: models.py:219 msgid "Warehouse division types" msgstr "" -#: models.py:138 +#: models.py:239 msgid "Length (mm)" msgstr "" -#: models.py:139 +#: models.py:240 msgid "Width (mm)" msgstr "" -#: models.py:140 +#: models.py:241 msgid "Height (mm)" msgstr "" -#: models.py:141 +#: models.py:242 msgid "Volume (l)" msgstr "" -#: models.py:146 +#: models.py:247 msgid "Container types" msgstr "" -#: models.py:165 +#: models.py:266 msgid "Location - index" msgstr "" -#: models.py:166 +#: models.py:267 msgid "Precise localisation" msgstr "" -#: models.py:167 +#: models.py:268 msgid "Type" msgstr "" -#: models.py:173 +#: models.py:274 msgid "Location (warehouse)" msgstr "" -#: models.py:180 +#: models.py:281 msgid "Container ref." msgstr "" -#: models.py:184 +#: models.py:285 msgid "Cached location" msgstr "" -#: models.py:282 +#: models.py:390 msgid "Reference" msgstr "" -#: models.py:285 +#: models.py:393 msgid "Container localisation" msgstr "" -#: models.py:286 +#: models.py:394 msgid "Container localisations" msgstr "" @@ -320,8 +322,34 @@ msgstr "" msgid "Attached containers" msgstr "" -#: templates/ishtar/wizard/wizard_containerlocalisation.html:6 +#: templates/ishtar/sheet_warehouse.html:29 +msgid "Statistics" +msgstr "" + +#: templates/ishtar/sheet_warehouse.html:30 +msgid "Theses number are updated hourly" +msgstr "" + +#: templates/ishtar/sheet_warehouse.html:32 +msgid "Finds" +msgstr "" + +#: templates/ishtar/sheet_warehouse.html:39 +msgid "Finds by location in the warehouse" +msgstr "" + +#: templates/ishtar/sheet_warehouse.html:59 +msgid "Containers by location in the warehouse" +msgstr "" + +#: templates/ishtar/wizard/wizard_containerlocalisation.html:8 msgid "" "No division set for this warehouse. Define at least one division to localise " "containers in this warehouse." msgstr "" + +#: templates/ishtar/wizard/wizard_warehouse_divisions.html:8 +msgid "" +"Containers with localisation are associated to this warehouse. You cannot " +"change divisions." +msgstr "" diff --git a/archaeological_warehouse/models.py b/archaeological_warehouse/models.py index d1918f46a..96814339c 100644 --- a/archaeological_warehouse/models.py +++ b/archaeological_warehouse/models.py @@ -21,6 +21,7 @@ import datetime from django.conf import settings from django.contrib.gis.db import models +from django.db.models import Q, Count from django.db.models.signals import post_save, post_delete from django.template.defaultfilters import slugify from django.utils.translation import ugettext_lazy as _, ugettext @@ -28,7 +29,8 @@ from django.utils.translation import ugettext_lazy as _, ugettext from ishtar_common.utils import cached_label_changed from ishtar_common.models import GeneralType, get_external_id, \ - LightHistorizedItem, OwnPerms, Address, Person, post_save_cache, ImageModel + LightHistorizedItem, OwnPerms, Address, Person, post_save_cache, \ + ImageModel, DashboardFormItem class WarehouseType(GeneralType): @@ -40,7 +42,7 @@ post_save.connect(post_save_cache, sender=WarehouseType) post_delete.connect(post_save_cache, sender=WarehouseType) -class Warehouse(Address, OwnPerms): +class Warehouse(Address, DashboardFormItem, OwnPerms): SHOW_URL = 'show-warehouse' name = models.CharField(_(u"Name"), max_length=200) warehouse_type = models.ForeignKey(WarehouseType, @@ -78,6 +80,105 @@ class Warehouse(Address, OwnPerms): return datetime.date.today().strftime('%Y-%m-%d') + '-' + \ slugify(unicode(self)) + @classmethod + def get_query_owns(cls, user): + return Q(person_in_charge__ishtaruser=user.ishtaruser) + + @property + def number_of_finds(self): + from archaeological_finds.models import Find + return Find.objects.filter(container__responsible=self).count() + + @property + def number_of_finds_hosted(self): + from archaeological_finds.models import Find + return Find.objects.filter(container__location=self).count() + + @property + def number_of_containers(self): + return Container.objects.filter(location=self).count() + + def _get_divisions(self, current_path, remaining_division, depth=0): + if not remaining_division: + return [current_path] + current_division = remaining_division.pop(0) + q = ContainerLocalisation.objects.filter( + division=current_division, + ) + for div, ref in current_path: + q = q.filter( + container__division__division=div, + container__division__reference=ref + ) + res = [] + old_ref = None + for ref in q.values('reference').order_by('reference').all(): + if ref['reference'] == old_ref: + continue + old_ref = ref['reference'] + cpath = current_path[:] + cpath.append((current_division, ref['reference'])) + for r in self._get_divisions(cpath, remaining_division[:], + depth + 1): + res.append(r) + return res + + @property + def available_division_tuples(self): + """ + :return: ordered list of available paths. Each path is a list of + tuple with the WarehouseDivisionLink and the reference. + """ + divisions = list( + WarehouseDivisionLink.objects.filter(warehouse=self + ).order_by('order').all()) + return self._get_divisions([], divisions) + + def _number_of_items_by_place(self, model, division_key='division'): + res = {} + paths = self.available_division_tuples[:] + for path in paths: + q = model.objects + cpath = [] + for division, ref in path: + lbl = u"{} {}".format(division.division, ref) + cpath.append(lbl) + attrs = { + division_key + "__division": division, + division_key + "__reference": ref + } + q = q.filter(**attrs) + if tuple(cpath) not in res: + res[tuple(cpath)] = q.count() + res = [(k, res[k]) for k in res] + final_res, current_res, depth = [], [], 1 + for path, nb in sorted(res, key=lambda x: (len(x[0]), x[0])): + if depth != len(path): + final_res.append(current_res[:]) + current_res = [] + depth = len(path) + current_res.append((u" | ".join(path), nb)) + final_res.append(current_res[:]) + return final_res + + def _number_of_finds_by_place(self): + from archaeological_finds.models import Find + return self._number_of_items_by_place( + Find, division_key='container__division') + + @property + def number_of_finds_by_place(self, update=False): + return self._get_or_set_stats('_number_of_finds_by_place', update, + settings.CACHE_SMALLTIMEOUT) + + def _number_of_containers_by_place(self): + return self._number_of_items_by_place(Container) + + @property + def number_of_containers_by_place(self, update=False): + return self._get_or_set_stats('_number_of_containers_by_place', update, + settings.CACHE_SMALLTIMEOUT) + def save(self, *args, **kwargs): super(Warehouse, self).save(*args, **kwargs) for container in self.containers.all(): @@ -208,6 +309,12 @@ class Container(LightHistorizedItem, ImageModel): cached_label = u" - ".join(items) return cached_label + @classmethod + def get_query_owns(cls, user): + return Q(history_creator=user) | \ + Q(location__person_in_charge__ishtaruser=user.ishtaruser) | \ + Q(responsible__person_in_charge__ishtaruser=user.ishtaruser) + @property def associated_filename(self): filename = datetime.date.today().strftime('%Y-%m-%d') @@ -276,7 +383,8 @@ post_save.connect(cached_label_changed, sender=Container) class ContainerLocalisation(models.Model): - container = models.ForeignKey(Container, verbose_name=_(u"Container")) + container = models.ForeignKey(Container, verbose_name=_(u"Container"), + related_name='division') division = models.ForeignKey(WarehouseDivisionLink, verbose_name=_(u"Division")) reference = models.CharField(_(u"Reference"), max_length=200, default='') diff --git a/archaeological_warehouse/templates/ishtar/sheet_warehouse.html b/archaeological_warehouse/templates/ishtar/sheet_warehouse.html index c31fc93b4..eb31392e4 100644 --- a/archaeological_warehouse/templates/ishtar/sheet_warehouse.html +++ b/archaeological_warehouse/templates/ishtar/sheet_warehouse.html @@ -26,4 +26,48 @@ {% dynamic_table_document '' 'containers' 'responsible' item.pk 'TABLE_COLS' output %} {% endif %} +<h3>{% trans "Statistics" %}</h3> +<small class="centered"><em>{% trans "These numbers are updated hourly" %}</em></small> + +<h4>{% trans "Finds" %}</h4> +<ul class='form-flex'> + {% field_li "Number of attached finds" item.number_of_finds %} + {% field_li "Number of hosted finds" item.number_of_finds_hosted %} +</ul> + +{% if item.number_of_finds_by_place %} +<h4>{% trans "Finds by location in the warehouse" %}</h4> +<ul class='form-flex'> + {% for items in item.number_of_finds_by_place %} + <li> + <table class='clean-table small'> + {% for item in items %} + <tr><th>{{item.0}}</th><td>{{item.1}}</td></tr> + {% endfor %} + </table> + </li> + {% endfor %} +</ul> +{% endif %} + +<h4>{% trans "Containers" %}</h4> +<ul class='form-flex'> + {% field_li "Number of containers" item.number_of_containers %} +</ul> + +{% if item.number_of_containers_by_place %} +<h4>{% trans "Containers by location in the warehouse" %}</h4> +<ul class='form-flex'> + {% for items in item.number_of_containers_by_place %} + <li> + <table class='clean-table small'> + {% for item in items %} + <tr><th>{{item.0}}</th><td>{{item.1}}</td></tr> + {% endfor %} + </table> + </li> + {% endfor %} +</ul> +{% endif %} + {% endblock %} diff --git a/archaeological_warehouse/templates/ishtar/wizard/wizard_containerlocalisation.html b/archaeological_warehouse/templates/ishtar/wizard/wizard_containerlocalisation.html index 2e817ff41..41be02748 100644 --- a/archaeological_warehouse/templates/ishtar/wizard/wizard_containerlocalisation.html +++ b/archaeological_warehouse/templates/ishtar/wizard/wizard_containerlocalisation.html @@ -3,7 +3,9 @@ {% load url from future %} {% block form_head %} {% if not wizard.form.fields %} -<p class='warning'>{% trans "No division set for this warehouse. Define at least one division to localise containers in this warehouse." %}<br/> +<p class="alert"> + <i class="fa fa-exclamation-triangle"></i> + {% trans "No division set for this warehouse. Define at least one division to localise containers in this warehouse." %}<br/> {{wizard.form.warehouse}} <a href="{% url 'warehouse_modify' wizard.form.warehouse.pk %}"> <span class="fa-stack fa-lg"> diff --git a/archaeological_warehouse/templates/ishtar/wizard/wizard_warehouse_divisions.html b/archaeological_warehouse/templates/ishtar/wizard/wizard_warehouse_divisions.html new file mode 100644 index 000000000..83dbfc0fe --- /dev/null +++ b/archaeological_warehouse/templates/ishtar/wizard/wizard_warehouse_divisions.html @@ -0,0 +1,11 @@ +{% extends "ishtar/wizard/default_wizard.html" %} +{% load i18n %} +{% load url from future %} +{% block form_head %} +{% if wizard.form.readonly %} +<p class="alert"> + <i class="fa fa-exclamation-triangle"></i> + {% trans "Containers with localisation are associated to this warehouse. You cannot change divisions." %}<br/> +</p> +{% endif %} +{% endblock %} diff --git a/archaeological_warehouse/wizards.py b/archaeological_warehouse/wizards.py index 9ecc16b3f..571e56b1b 100644 --- a/archaeological_warehouse/wizards.py +++ b/archaeological_warehouse/wizards.py @@ -64,6 +64,20 @@ class WarehouseModificationWizard(Wizard): model = models.Warehouse modification = True wizard_done_window = reverse_lazy('show-warehouse') + wizard_templates = { + 'divisions-warehouse_modification': + 'ishtar/wizard/wizard_warehouse_divisions.html', + } + + def get_form_kwargs(self, step=None): + kwargs = super(WarehouseModificationWizard, self).get_form_kwargs(step) + if step == "divisions-warehouse_modification": + current_warehouse = self.get_current_object() + q = models.ContainerLocalisation.objects.filter( + division__warehouse=current_warehouse) + if q.count(): + kwargs['readonly'] = True + return kwargs class WarehouseDeletionWizard(DeletionWizard): diff --git a/example_project/settings.py b/example_project/settings.py index e569aa1c1..d26639732 100644 --- a/example_project/settings.py +++ b/example_project/settings.py @@ -18,7 +18,7 @@ if "test" in sys.argv: IMAGE_MAX_SIZE = (1024, 768) THUMB_MAX_SIZE = (300, 300) -CACHE_SMALLTIMEOUT = 120 +CACHE_SMALLTIMEOUT = 60 CACHE_TIMEOUT = 3600 CACHE_BACKEND = 'memcached://127.0.0.1:11211/' diff --git a/ishtar_common/context_processors.py b/ishtar_common/context_processors.py index 8e14d8506..5050d667e 100644 --- a/ishtar_common/context_processors.py +++ b/ishtar_common/context_processors.py @@ -1,6 +1,6 @@ #!/usr/bin/env python # -*- coding: utf-8 -*- -# Copyright (C) 2010-2013 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> +# Copyright (C) 2010-2017 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as @@ -44,6 +44,7 @@ def get_base_context(request): if 'CURRENT_ACTION' in request.session: dct['CURRENT_ACTION'] = request.session['CURRENT_ACTION'] current_action = dct['CURRENT_ACTION'] + dct['CURRENT_PATH'] = request.path menu = Menu(request.user, current_action=current_action, session=request.session) menu.init() diff --git a/ishtar_common/forms.py b/ishtar_common/forms.py index 42d74f9ef..ecae18c5e 100644 --- a/ishtar_common/forms.py +++ b/ishtar_common/forms.py @@ -22,6 +22,7 @@ Forms definition """ import datetime import re +import types from django import forms from django.core.urlresolvers import reverse @@ -94,7 +95,32 @@ class FinalDeleteForm(FinalForm): confirm_end_msg = _(u"Are you sure you want to delete?") +def get_readonly_clean(key): + def func(self): + instance = getattr(self, 'instance', None) + if instance and getattr(instance, key): + return getattr(instance, key) + else: + return self.cleaned_data[key] + return func + + class FormSet(BaseFormSet): + def __init__(self, *args, **kwargs): + self.readonly = False + if 'readonly' in kwargs: + self.readonly = kwargs.pop('readonly') + self.can_delete = False + # no extra fields + if 'data' in kwargs: + prefix = "" + if "prefix" in kwargs: + prefix = kwargs['prefix'] + if prefix + '-INITIAL_FORMS' in kwargs['data']: + kwargs['data'][prefix + '-TOTAL_FORMS'] = \ + kwargs["data"][prefix + '-INITIAL_FORMS'] + super(FormSet, self).__init__(*args, **kwargs) + def check_duplicate(self, key_names, error_msg=""): """Check for duplicate items in the formset""" if any(self.errors): @@ -117,8 +143,17 @@ class FormSet(BaseFormSet): def add_fields(self, form, index): super(FormSet, self).add_fields(form, index) - form.fields[DELETION_FIELD_NAME].label = '' - form.fields[DELETION_FIELD_NAME].widget = widgets.DeleteWidget() + if self.readonly: + for k in form.fields: + # django 1.9: use disabled + form.fields[k].widget.attrs['readonly'] = True + clean = get_readonly_clean(k) + clean.__name__ = 'clean_' + k + clean.__doc__ = 'autogenerated: clean_' + k + setattr(form, clean.__name__, types.MethodType(clean, form)) + if self.can_delete: + form.fields[DELETION_FIELD_NAME].label = '' + form.fields[DELETION_FIELD_NAME].widget = widgets.DeleteWidget() class TableSelect(forms.Form): diff --git a/ishtar_common/forms_common.py b/ishtar_common/forms_common.py index 078ccfb15..b317f77e3 100644 --- a/ishtar_common/forms_common.py +++ b/ishtar_common/forms_common.py @@ -529,11 +529,11 @@ class PersonForm(SimplePersonForm): pk=dct['attached_to']) except models.Organization.DoesNotExist: dct.pop('attached_to') - if 'title' in dct and dct['title']: + if 'title' in dct: try: dct['title'] = models.TitleType.objects.get( pk=dct['title']) - except models.TitleType.DoesNotExist: + except (models.TitleType.DoesNotExist, ValueError): dct.pop('title') person_types = dct.pop('person_types') new_item = models.Person.objects.create(**dct) diff --git a/ishtar_common/locale/django.pot b/ishtar_common/locale/django.pot index d56b7cbcd..9611caded 100644 --- a/ishtar_common/locale/django.pot +++ b/ishtar_common/locale/django.pot @@ -148,40 +148,40 @@ msgstr "" msgid "\"%(value)s\" not in %(values)s" msgstr "" -#: forms.py:73 +#: forms.py:74 msgid "Enter a valid name consisting of letters, spaces and hyphens." msgstr "" -#: forms.py:89 forms_common.py:626 +#: forms.py:90 forms_common.py:626 msgid "Confirm" msgstr "" -#: forms.py:94 +#: forms.py:95 msgid "Are you sure you want to delete?" msgstr "" -#: forms.py:103 +#: forms.py:129 msgid "There are identical items." msgstr "" -#: forms.py:141 forms.py:142 +#: forms.py:176 forms.py:177 msgid "Closing date" msgstr "" -#: forms.py:155 +#: forms.py:190 msgid "You should select an item." msgstr "" -#: forms.py:156 +#: forms.py:191 msgid "Add a new item" msgstr "" -#: forms.py:262 models.py:1482 +#: forms.py:297 models.py:1501 msgid "Template" msgstr "" #: forms_common.py:41 forms_common.py:59 forms_common.py:184 -#: forms_common.py:408 models.py:1548 models.py:2989 +#: forms_common.py:408 models.py:1567 models.py:3030 #: templates/blocks/JQueryAdvancedTown.html:19 #: templates/ishtar/sheet_organization.html:13 msgid "Town" @@ -197,8 +197,8 @@ msgid "" "french town Saint-Denis in the Seine-Saint-Denis department.</p>" msgstr "" -#: forms_common.py:68 forms_common.py:863 ishtar_menu.py:47 models.py:2610 -#: models.py:2791 models.py:2856 templates/ishtar/sheet_person.html:4 +#: forms_common.py:68 forms_common.py:863 ishtar_menu.py:47 models.py:2630 +#: models.py:2823 models.py:2885 templates/ishtar/sheet_person.html:4 msgid "Person" msgstr "" @@ -209,64 +209,64 @@ msgid "" msgstr "" #: forms_common.py:172 forms_common.py:329 forms_common.py:453 -#: ishtar_menu.py:75 models.py:2493 models.py:2584 +#: ishtar_menu.py:75 models.py:2513 models.py:2604 #: templates/ishtar/sheet_organization.html:4 msgid "Organization" msgstr "" #: forms_common.py:175 forms_common.py:212 forms_common.py:324 -#: forms_common.py:378 forms_common.py:448 models.py:1103 models.py:1481 -#: models.py:1750 models.py:1766 models.py:2003 models.py:2279 models.py:2487 -#: models.py:2596 models.py:2975 templates/ishtar/import_list.html:13 +#: forms_common.py:378 forms_common.py:448 models.py:1109 models.py:1500 +#: models.py:1769 models.py:1785 models.py:2023 models.py:2301 models.py:2507 +#: models.py:2616 models.py:3016 templates/ishtar/import_list.html:13 #: templates/ishtar/sheet_organization.html:8 #: templates/ishtar/sheet_organization.html:21 msgid "Name" msgstr "" -#: forms_common.py:176 models.py:1703 models.py:2134 +#: forms_common.py:176 models.py:1722 models.py:2154 msgid "Organization type" msgstr "" -#: forms_common.py:178 forms_common.py:402 models.py:1543 +#: forms_common.py:178 forms_common.py:402 models.py:1562 #: templates/ishtar/sheet_organization.html:10 msgid "Address" msgstr "" -#: forms_common.py:180 forms_common.py:405 models.py:1544 +#: forms_common.py:180 forms_common.py:405 models.py:1563 #: templates/ishtar/sheet_organization.html:11 msgid "Address complement" msgstr "" -#: forms_common.py:182 forms_common.py:406 models.py:1546 +#: forms_common.py:182 forms_common.py:406 models.py:1565 #: templates/ishtar/sheet_organization.html:12 msgid "Postal code" msgstr "" -#: forms_common.py:185 forms_common.py:409 models.py:1549 +#: forms_common.py:185 forms_common.py:409 models.py:1568 msgid "Country" msgstr "" #: forms_common.py:187 forms_common.py:326 forms_common.py:382 -#: forms_common.py:450 forms_common.py:574 models.py:1576 +#: forms_common.py:450 forms_common.py:574 models.py:1595 msgid "Email" msgstr "" -#: forms_common.py:188 forms_common.py:385 models.py:1561 +#: forms_common.py:188 forms_common.py:385 models.py:1580 #: templates/ishtar/sheet_organization.html:14 #: templates/ishtar/sheet_person.html:21 #: templates/ishtar/wizard/wizard_person.html:17 msgid "Phone" msgstr "" -#: forms_common.py:189 forms_common.py:394 models.py:1573 +#: forms_common.py:189 forms_common.py:394 models.py:1592 #: templates/ishtar/sheet_organization.html:15 #: templates/ishtar/sheet_person.html:39 #: templates/ishtar/wizard/wizard_person.html:35 msgid "Mobile phone" msgstr "" -#: forms_common.py:213 forms_common.py:327 forms_common.py:451 models.py:2170 -#: models.py:2489 models.py:2910 templates/sheet_ope.html:85 +#: forms_common.py:213 forms_common.py:327 forms_common.py:451 models.py:2192 +#: models.py:2509 models.py:2951 templates/sheet_ope.html:85 #: templates/sheet_ope.html.py:105 templates/sheet_ope.html:126 #: templates/ishtar/import_list.html:14 #: templates/ishtar/sheet_organization.html:23 @@ -290,7 +290,7 @@ msgstr "" msgid "Organization to merge" msgstr "" -#: forms_common.py:325 forms_common.py:376 forms_common.py:449 models.py:2594 +#: forms_common.py:325 forms_common.py:376 forms_common.py:449 models.py:2614 #: templates/ishtar/sheet_organization.html:22 msgid "Surname" msgstr "" @@ -308,25 +308,25 @@ msgstr "" msgid "Identity" msgstr "" -#: forms_common.py:373 forms_common.py:781 forms_common.py:830 models.py:2135 -#: models.py:2588 models.py:2590 models.py:2907 templates/sheet_ope.html:104 +#: forms_common.py:373 forms_common.py:781 forms_common.py:830 models.py:2155 +#: models.py:2608 models.py:2610 models.py:2948 templates/sheet_ope.html:104 #: templates/ishtar/blocks/window_tables/documents.html:7 msgid "Title" msgstr "" -#: forms_common.py:374 models.py:2592 +#: forms_common.py:374 models.py:2612 msgid "Salutation" msgstr "" -#: forms_common.py:380 models.py:2598 +#: forms_common.py:380 models.py:2618 msgid "Raw name" msgstr "" -#: forms_common.py:383 models.py:1562 +#: forms_common.py:383 models.py:1581 msgid "Phone description" msgstr "" -#: forms_common.py:386 models.py:1564 models.py:1566 +#: forms_common.py:386 models.py:1583 models.py:1585 msgid "Phone description 2" msgstr "" @@ -334,11 +334,11 @@ msgstr "" msgid "Phone 2" msgstr "" -#: forms_common.py:390 models.py:1570 +#: forms_common.py:390 models.py:1589 msgid "Phone description 3" msgstr "" -#: forms_common.py:392 models.py:1568 +#: forms_common.py:392 models.py:1587 msgid "Phone 3" msgstr "" @@ -346,23 +346,23 @@ msgstr "" msgid "Current organization" msgstr "" -#: forms_common.py:411 models.py:1551 +#: forms_common.py:411 models.py:1570 msgid "Other address: address" msgstr "" -#: forms_common.py:414 models.py:1554 +#: forms_common.py:414 models.py:1573 msgid "Other address: address complement" msgstr "" -#: forms_common.py:416 models.py:1555 +#: forms_common.py:416 models.py:1574 msgid "Other address: postal code" msgstr "" -#: forms_common.py:418 models.py:1557 +#: forms_common.py:418 models.py:1576 msgid "Other address: town" msgstr "" -#: forms_common.py:420 models.py:1559 +#: forms_common.py:420 models.py:1578 msgid "Other address: country" msgstr "" @@ -378,7 +378,7 @@ msgstr "" msgid "Account search" msgstr "" -#: forms_common.py:512 forms_common.py:552 forms_common.py:556 models.py:2541 +#: forms_common.py:512 forms_common.py:552 forms_common.py:556 models.py:2561 msgid "Person type" msgstr "" @@ -386,7 +386,7 @@ msgstr "" msgid "Account" msgstr "" -#: forms_common.py:577 wizards.py:1339 +#: forms_common.py:577 wizards.py:1347 msgid "New password" msgstr "" @@ -410,7 +410,7 @@ msgstr "" msgid "Send the new password by email?" msgstr "" -#: forms_common.py:636 forms_common.py:649 models.py:2990 +#: forms_common.py:636 forms_common.py:649 models.py:3031 msgid "Towns" msgstr "" @@ -426,7 +426,7 @@ msgstr "" msgid "Documentation informations" msgstr "" -#: forms_common.py:783 forms_common.py:831 models.py:2136 models.py:2882 +#: forms_common.py:783 forms_common.py:831 models.py:2156 models.py:2923 msgid "Source type" msgstr "" @@ -438,37 +438,37 @@ msgstr "" msgid "Internal reference" msgstr "" -#: forms_common.py:791 models.py:2921 +#: forms_common.py:791 models.py:2962 msgid "Numerical ressource (web address)" msgstr "" -#: forms_common.py:792 models.py:2923 +#: forms_common.py:792 models.py:2964 msgid "Receipt date" msgstr "" -#: forms_common.py:794 models.py:2304 models.py:2925 +#: forms_common.py:794 models.py:2327 models.py:2966 msgid "Creation date" msgstr "" -#: forms_common.py:797 models.py:2928 +#: forms_common.py:797 models.py:2969 msgid "Receipt date in documentation" msgstr "" -#: forms_common.py:799 forms_common.py:835 models.py:379 models.py:696 -#: models.py:2030 models.py:2602 models.py:2935 +#: forms_common.py:799 forms_common.py:835 models.py:381 models.py:698 +#: models.py:2050 models.py:2622 models.py:2976 msgid "Comment" msgstr "" -#: forms_common.py:801 forms_common.py:834 models.py:1105 models.py:1770 -#: models.py:1957 models.py:2004 models.py:2934 templates/sheet_ope.html:128 +#: forms_common.py:801 forms_common.py:834 models.py:1111 models.py:1789 +#: models.py:1977 models.py:2024 models.py:2975 templates/sheet_ope.html:128 msgid "Description" msgstr "" -#: forms_common.py:804 models.py:2936 +#: forms_common.py:804 models.py:2977 msgid "Additional information" msgstr "" -#: forms_common.py:806 forms_common.py:838 models.py:2938 +#: forms_common.py:806 forms_common.py:838 models.py:2979 msgid "Has a duplicate" msgstr "" @@ -483,7 +483,7 @@ msgid "" "p>" msgstr "" -#: forms_common.py:827 forms_common.py:856 forms_common.py:890 models.py:2861 +#: forms_common.py:827 forms_common.py:856 forms_common.py:890 models.py:2890 #: templates/ishtar/wizard/wizard_person_deletion.html:124 msgid "Author" msgstr "" @@ -496,7 +496,7 @@ msgstr "" msgid "Would you like to delete this documentation?" msgstr "" -#: forms_common.py:864 models.py:2137 models.py:2848 models.py:2858 +#: forms_common.py:864 models.py:2157 models.py:2877 models.py:2887 msgid "Author type" msgstr "" @@ -508,7 +508,7 @@ msgstr "" msgid "There are identical authors." msgstr "" -#: forms_common.py:901 models.py:2862 models.py:2917 +#: forms_common.py:901 models.py:2891 models.py:2958 #: templates/sheet_ope.html:106 #: templates/ishtar/blocks/window_tables/documents.html:9 msgid "Authors" @@ -526,7 +526,7 @@ msgstr "" msgid "Deletion" msgstr "" -#: ishtar_menu.py:39 models.py:1277 views.py:1608 +#: ishtar_menu.py:39 models.py:1283 views.py:1644 msgid "Global variables" msgstr "" @@ -554,19 +554,19 @@ msgstr "" msgid "Manual merge" msgstr "" -#: ishtar_menu.py:109 models.py:2315 +#: ishtar_menu.py:109 models.py:2335 msgid "Imports" msgstr "" -#: ishtar_menu.py:112 views.py:1616 +#: ishtar_menu.py:112 views.py:1652 msgid "New import" msgstr "" -#: ishtar_menu.py:116 views.py:1630 +#: ishtar_menu.py:116 views.py:1666 msgid "Current imports" msgstr "" -#: ishtar_menu.py:120 views.py:1669 +#: ishtar_menu.py:120 views.py:1705 msgid "Old imports" msgstr "" @@ -574,258 +574,258 @@ msgstr "" msgid "Not a valid item." msgstr "" -#: models.py:199 +#: models.py:201 msgid "A selected item is not a valid item." msgstr "" -#: models.py:210 +#: models.py:212 msgid "This item already exists." msgstr "" -#: models.py:375 models.py:695 models.py:1516 models.py:1528 models.py:1954 +#: models.py:377 models.py:697 models.py:1535 models.py:1547 models.py:1973 msgid "Label" msgstr "" -#: models.py:377 +#: models.py:379 msgid "Textual ID" msgstr "" -#: models.py:380 models.py:698 models.py:1485 +#: models.py:382 models.py:700 models.py:1504 msgid "Available" msgstr "" -#: models.py:722 models.py:2076 +#: models.py:724 models.py:2096 msgid "Key" msgstr "" -#: models.py:728 +#: models.py:730 msgid "Specific key to an import" msgstr "" -#: models.py:820 +#: models.py:826 msgid "Last editor" msgstr "" -#: models.py:823 +#: models.py:829 msgid "Creator" msgstr "" -#: models.py:965 models.py:2846 models.py:3001 models.py:3057 +#: models.py:971 models.py:2874 models.py:3042 models.py:3098 msgid "Order" msgstr "" -#: models.py:966 +#: models.py:972 msgid "Symmetrical" msgstr "" -#: models.py:967 +#: models.py:973 msgid "Tiny label" msgstr "" -#: models.py:981 +#: models.py:987 msgid "Cannot have symmetrical and an inverse_relation" msgstr "" -#: models.py:1097 +#: models.py:1103 msgid "Euro" msgstr "" -#: models.py:1098 +#: models.py:1104 msgid "US dollar" msgstr "" -#: models.py:1104 models.py:1768 +#: models.py:1110 models.py:1787 msgid "Slug" msgstr "" -#: models.py:1107 +#: models.py:1113 msgid "CSS color code for base module" msgstr "" -#: models.py:1109 +#: models.py:1115 msgid "Files module" msgstr "" -#: models.py:1111 +#: models.py:1117 msgid "CSS color code for files module" msgstr "" -#: models.py:1113 +#: models.py:1119 msgid "Context records module" msgstr "" -#: models.py:1116 +#: models.py:1122 msgid "CSS color code for context record module" msgstr "" -#: models.py:1118 +#: models.py:1124 msgid "Finds module" msgstr "" -#: models.py:1119 +#: models.py:1125 msgid "Need context records module" msgstr "" -#: models.py:1121 +#: models.py:1127 msgid "CSS color code for find module" msgstr "" -#: models.py:1124 +#: models.py:1130 msgid "Warehouses module" msgstr "" -#: models.py:1125 +#: models.py:1131 msgid "Need finds module" msgstr "" -#: models.py:1127 +#: models.py:1133 msgid "CSS code for warehouse module" msgstr "" -#: models.py:1129 +#: models.py:1135 msgid "Mapping module" msgstr "" -#: models.py:1131 +#: models.py:1137 msgid "CSS code for mapping module" msgstr "" -#: models.py:1134 +#: models.py:1140 msgid "Home page" msgstr "" -#: models.py:1135 +#: models.py:1141 #, python-brace-format msgid "" "Homepage of Ishtar - if not defined a default homepage will appear. Use the " "markdown syntax. {random_image} can be used to display a random image." msgstr "" -#: models.py:1139 +#: models.py:1145 msgid "File external id" msgstr "" -#: models.py:1141 +#: models.py:1147 msgid "" "Formula to manage file external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " "be destructive." msgstr "" -#: models.py:1146 +#: models.py:1152 msgid "Parcel external id" msgstr "" -#: models.py:1149 +#: models.py:1155 msgid "" "Formula to manage parcel external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " "be destructive." msgstr "" -#: models.py:1154 +#: models.py:1160 msgid "Context record external id" msgstr "" -#: models.py:1156 +#: models.py:1162 msgid "" "Formula to manage context record external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " "data can be destructive." msgstr "" -#: models.py:1161 +#: models.py:1167 msgid "Base find external id" msgstr "" -#: models.py:1163 +#: models.py:1169 msgid "" "Formula to manage base find external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " "data can be destructive." msgstr "" -#: models.py:1168 +#: models.py:1174 msgid "Find external id" msgstr "" -#: models.py:1170 +#: models.py:1176 msgid "" "Formula to manage find external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " "be destructive." msgstr "" -#: models.py:1175 +#: models.py:1181 msgid "Container external id" msgstr "" -#: models.py:1177 +#: models.py:1183 msgid "" "Formula to manage container external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " "data can be destructive." msgstr "" -#: models.py:1182 +#: models.py:1188 msgid "Warehouse external id" msgstr "" -#: models.py:1184 +#: models.py:1190 msgid "" "Formula to manage warehouse external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " "data can be destructive." msgstr "" -#: models.py:1189 +#: models.py:1195 msgid "Raw name for person" msgstr "" -#: models.py:1191 +#: models.py:1197 msgid "" "Formula to manage person raw_name. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " "be destructive." msgstr "" -#: models.py:1195 +#: models.py:1201 msgid "Current active" msgstr "" -#: models.py:1196 +#: models.py:1202 msgid "Currency" msgstr "" -#: models.py:1200 +#: models.py:1206 msgid "Ishtar site profile" msgstr "" -#: models.py:1201 +#: models.py:1207 msgid "Ishtar site profiles" msgstr "" -#: models.py:1270 +#: models.py:1276 msgid "Variable name" msgstr "" -#: models.py:1271 +#: models.py:1277 msgid "Description of the variable" msgstr "" -#: models.py:1273 models.py:2077 +#: models.py:1279 models.py:2097 msgid "Value" msgstr "" -#: models.py:1276 +#: models.py:1282 msgid "Global variable" msgstr "" -#: models.py:1386 models.py:1416 +#: models.py:1405 models.py:1435 msgid "Total" msgstr "" -#: models.py:1393 models.py:1517 models.py:1529 +#: models.py:1412 models.py:1536 models.py:1548 #: templates/ishtar/sheet_person.html:24 #: templates/ishtar/dashboards/dashboard_main_detail.html:141 #: templates/ishtar/dashboards/dashboard_main_detail_users.html:26 @@ -833,643 +833,663 @@ msgstr "" msgid "Number" msgstr "" -#: models.py:1480 +#: models.py:1499 msgid "Administrative Act" msgstr "" -#: models.py:1484 +#: models.py:1503 msgid "Associated object" msgstr "" -#: models.py:1488 +#: models.py:1507 msgid "Document template" msgstr "" -#: models.py:1489 +#: models.py:1508 msgid "Document templates" msgstr "" -#: models.py:1520 models.py:1530 models.py:2299 +#: models.py:1539 models.py:1549 models.py:2321 msgid "State" msgstr "" -#: models.py:1534 templates/blocks/JQueryAdvancedTown.html:12 +#: models.py:1553 templates/blocks/JQueryAdvancedTown.html:12 msgid "Department" msgstr "" -#: models.py:1535 +#: models.py:1554 msgid "Departments" msgstr "" -#: models.py:1572 +#: models.py:1591 msgid "Raw phone" msgstr "" -#: models.py:1578 +#: models.py:1597 msgid "Alternative address is prefered" msgstr "" -#: models.py:1617 +#: models.py:1636 msgid "Tel: " msgstr "" -#: models.py:1621 +#: models.py:1640 msgid "Mobile: " msgstr "" -#: models.py:1625 +#: models.py:1644 msgid "Email: " msgstr "" -#: models.py:1630 +#: models.py:1649 msgid "Merge key" msgstr "" -#: models.py:1704 +#: models.py:1723 msgid "Organization types" msgstr "" -#: models.py:1751 +#: models.py:1770 msgid "Class name" msgstr "" -#: models.py:1754 +#: models.py:1773 msgid "Importer - Model" msgstr "" -#: models.py:1755 +#: models.py:1774 msgid "Importer - Models" msgstr "" -#: models.py:1772 templates/ishtar/dashboards/dashboard_main.html:25 +#: models.py:1791 templates/ishtar/dashboards/dashboard_main.html:34 msgid "Users" msgstr "" -#: models.py:1775 +#: models.py:1794 msgid "Associated model" msgstr "" -#: models.py:1778 +#: models.py:1797 msgid "Models that can accept new items" msgstr "" -#: models.py:1779 +#: models.py:1798 msgid "Leave blank for no restrictions" msgstr "" -#: models.py:1781 +#: models.py:1800 msgid "Is template" msgstr "" -#: models.py:1782 +#: models.py:1801 msgid "Unicity keys (separator \";\")" msgstr "" -#: models.py:1786 +#: models.py:1805 msgid "Importer - Type" msgstr "" -#: models.py:1787 +#: models.py:1806 msgid "Importer - Types" msgstr "" -#: models.py:1886 +#: models.py:1905 msgid "Importer - Default" msgstr "" -#: models.py:1887 +#: models.py:1906 msgid "Importer - Defaults" msgstr "" -#: models.py:1922 +#: models.py:1941 msgid "Importer - Default value" msgstr "" -#: models.py:1923 +#: models.py:1942 msgid "Importer - Default values" msgstr "" -#: models.py:1956 +#: models.py:1976 msgid "Column number" msgstr "" -#: models.py:1959 +#: models.py:1979 msgid "Required" msgstr "" -#: models.py:1961 +#: models.py:1981 msgid "Export field name" msgstr "" -#: models.py:1962 +#: models.py:1982 msgid "" "Fill this field if the field name is ambiguous for export. For instance: " "concatenated fields." msgstr "" -#: models.py:1967 +#: models.py:1987 msgid "Importer - Column" msgstr "" -#: models.py:1968 +#: models.py:1988 msgid "Importer - Columns" msgstr "" -#: models.py:1988 +#: models.py:2008 msgid "Field name" msgstr "" -#: models.py:1990 models.py:2024 +#: models.py:2010 models.py:2044 msgid "Force creation of new items" msgstr "" -#: models.py:1992 models.py:2026 +#: models.py:2012 models.py:2046 msgid "Concatenate with existing" msgstr "" -#: models.py:1994 models.py:2028 +#: models.py:2014 models.py:2048 msgid "Concatenate character" msgstr "" -#: models.py:1998 +#: models.py:2018 msgid "Importer - Duplicate field" msgstr "" -#: models.py:1999 +#: models.py:2019 msgid "Importer - Duplicate fields" msgstr "" -#: models.py:2006 +#: models.py:2026 msgid "Regular expression" msgstr "" -#: models.py:2009 +#: models.py:2029 msgid "Importer - Regular expression" msgstr "" -#: models.py:2010 +#: models.py:2030 msgid "Importer - Regular expressions" msgstr "" -#: models.py:2033 +#: models.py:2053 msgid "Importer - Target" msgstr "" -#: models.py:2034 +#: models.py:2054 msgid "Importer - Targets" msgstr "" -#: models.py:2058 views.py:549 +#: models.py:2078 views.py:568 msgid "True" msgstr "" -#: models.py:2059 views.py:551 +#: models.py:2079 views.py:570 msgid "False" msgstr "" -#: models.py:2078 +#: models.py:2098 msgid "Is set" msgstr "" -#: models.py:2085 +#: models.py:2105 msgid "Importer - Target key" msgstr "" -#: models.py:2086 +#: models.py:2106 msgid "Importer - Targets keys" msgstr "" -#: models.py:2138 models.py:2913 +#: models.py:2158 models.py:2954 msgid "Format" msgstr "" -#: models.py:2139 models.py:3005 +#: models.py:2159 models.py:3046 msgid "Operation type" msgstr "" -#: models.py:2140 +#: models.py:2160 msgid "Period" msgstr "" -#: models.py:2141 +#: models.py:2161 msgid "Report state" msgstr "" -#: models.py:2142 +#: models.py:2162 msgid "Remain type" msgstr "" -#: models.py:2143 +#: models.py:2163 msgid "Unit" msgstr "" -#: models.py:2144 +#: models.py:2165 msgid "Activity type" msgstr "" -#: models.py:2145 +#: models.py:2166 msgid "Material" msgstr "" -#: models.py:2147 +#: models.py:2168 msgid "Conservatory state" msgstr "" -#: models.py:2148 +#: models.py:2169 msgid "Container type" msgstr "" -#: models.py:2149 +#: models.py:2170 msgid "Preservation type" msgstr "" -#: models.py:2150 +#: models.py:2171 msgid "Object type" msgstr "" -#: models.py:2151 +#: models.py:2172 msgid "Integrity type" msgstr "" -#: models.py:2152 +#: models.py:2174 msgid "Remarkability type" msgstr "" -#: models.py:2153 +#: models.py:2175 msgid "Batch type" msgstr "" -#: models.py:2155 +#: models.py:2177 msgid "Identification type" msgstr "" -#: models.py:2157 +#: models.py:2179 msgid "Context record relation type" msgstr "" -#: models.py:2158 models.py:3063 +#: models.py:2180 models.py:3104 msgid "Spatial reference system" msgstr "" -#: models.py:2159 models.py:2891 +#: models.py:2181 models.py:2932 msgid "Support type" msgstr "" -#: models.py:2160 models.py:2553 +#: models.py:2182 models.py:2573 msgid "Title type" msgstr "" -#: models.py:2166 +#: models.py:2188 msgid "Integer" msgstr "" -#: models.py:2167 +#: models.py:2189 msgid "Float" msgstr "" -#: models.py:2168 +#: models.py:2190 msgid "String" msgstr "" -#: models.py:2169 templates/sheet_ope.html:86 +#: models.py:2191 templates/sheet_ope.html:86 msgid "Date" msgstr "" -#: models.py:2171 templates/sheet_ope.html:61 templates/sheet_ope.html.py:83 +#: models.py:2193 templates/sheet_ope.html:61 templates/sheet_ope.html.py:83 #: templates/ishtar/dashboards/dashboard_main_detail.html:126 msgid "Year" msgstr "" -#: models.py:2172 +#: models.py:2194 msgid "String to boolean" msgstr "" -#: models.py:2173 +#: models.py:2195 msgctxt "filesystem" msgid "File" msgstr "" -#: models.py:2174 +#: models.py:2196 msgid "Unknow type" msgstr "" -#: models.py:2190 +#: models.py:2212 msgid "4 digit year. e.g.: \"2015\"" msgstr "" -#: models.py:2191 +#: models.py:2213 msgid "4 digit year/month/day. e.g.: \"2015/02/04\"" msgstr "" -#: models.py:2192 +#: models.py:2214 msgid "Day/month/4 digit year. e.g.: \"04/02/2015\"" msgstr "" -#: models.py:2202 +#: models.py:2224 msgid "Options" msgstr "" -#: models.py:2204 +#: models.py:2226 msgid "Split character(s)" msgstr "" -#: models.py:2208 +#: models.py:2230 msgid "Importer - Formater type" msgstr "" -#: models.py:2209 +#: models.py:2231 msgid "Importer - Formater types" msgstr "" -#: models.py:2261 templates/ishtar/dashboards/dashboard_main_detail.html:63 +#: models.py:2283 templates/ishtar/dashboards/dashboard_main_detail.html:63 msgid "Created" msgstr "" -#: models.py:2262 +#: models.py:2284 msgid "Analyse in progress" msgstr "" -#: models.py:2263 +#: models.py:2285 msgid "Analysed" msgstr "" -#: models.py:2264 +#: models.py:2286 msgid "Import pending" msgstr "" -#: models.py:2265 +#: models.py:2287 msgid "Import in progress" msgstr "" -#: models.py:2266 +#: models.py:2288 msgid "Finished with errors" msgstr "" -#: models.py:2267 +#: models.py:2289 msgid "Finished" msgstr "" -#: models.py:2268 +#: models.py:2290 msgid "Archived" msgstr "" -#: models.py:2283 +#: models.py:2305 msgid "Imported file" msgstr "" -#: models.py:2285 +#: models.py:2307 msgid "Associated images (zip file)" msgstr "" -#: models.py:2287 +#: models.py:2309 msgid "Encoding" msgstr "" -#: models.py:2289 +#: models.py:2311 msgid "Skip lines" msgstr "" -#: models.py:2290 templates/ishtar/import_list.html:51 +#: models.py:2312 templates/ishtar/import_list.html:51 msgid "Error file" msgstr "" -#: models.py:2293 +#: models.py:2315 msgid "Result file" msgstr "" -#: models.py:2296 templates/ishtar/import_list.html:57 +#: models.py:2318 templates/ishtar/import_list.html:57 msgid "Match file" msgstr "" -#: models.py:2302 +#: models.py:2324 msgid "Conservative import" msgstr "" -#: models.py:2307 +#: models.py:2328 msgid "End date" msgstr "" -#: models.py:2309 +#: models.py:2331 msgid "Remaining seconds" msgstr "" -#: models.py:2314 +#: models.py:2334 msgid "Import" msgstr "" -#: models.py:2343 +#: models.py:2363 msgid "Analyse" msgstr "" -#: models.py:2345 models.py:2348 +#: models.py:2365 models.py:2368 msgid "Re-analyse" msgstr "" -#: models.py:2346 +#: models.py:2366 msgid "Launch import" msgstr "" -#: models.py:2349 +#: models.py:2369 msgid "Re-import" msgstr "" -#: models.py:2350 +#: models.py:2370 msgid "Archive" msgstr "" -#: models.py:2352 +#: models.py:2372 msgid "Unarchive" msgstr "" -#: models.py:2353 widgets.py:130 templates/ishtar/form_delete.html:11 +#: models.py:2373 widgets.py:184 templates/ishtar/form_delete.html:11 msgid "Delete" msgstr "" -#: models.py:2494 +#: models.py:2514 msgid "Organizations" msgstr "" -#: models.py:2496 +#: models.py:2516 msgid "Can view all Organizations" msgstr "" -#: models.py:2497 +#: models.py:2517 msgid "Can view own Organization" msgstr "" -#: models.py:2498 +#: models.py:2518 msgid "Can add own Organization" msgstr "" -#: models.py:2500 +#: models.py:2520 msgid "Can change own Organization" msgstr "" -#: models.py:2502 +#: models.py:2522 msgid "Can delete own Organization" msgstr "" -#: models.py:2537 +#: models.py:2557 msgid "Groups" msgstr "" -#: models.py:2542 +#: models.py:2562 msgid "Person types" msgstr "" -#: models.py:2554 +#: models.py:2574 msgid "Title types" msgstr "" -#: models.py:2563 +#: models.py:2583 msgid "Mr" msgstr "" -#: models.py:2564 +#: models.py:2584 msgid "Miss" msgstr "" -#: models.py:2565 +#: models.py:2585 msgid "Mr and Mrs" msgstr "" -#: models.py:2566 +#: models.py:2586 msgid "Mrs" msgstr "" -#: models.py:2567 +#: models.py:2587 msgid "Doctor" msgstr "" -#: models.py:2600 +#: models.py:2620 msgid "Contact type" msgstr "" -#: models.py:2603 models.py:2667 +#: models.py:2623 models.py:2687 msgid "Types" msgstr "" -#: models.py:2606 +#: models.py:2626 msgid "Is attached to" msgstr "" -#: models.py:2611 +#: models.py:2631 msgid "Persons" msgstr "" -#: models.py:2613 +#: models.py:2633 msgid "Can view all Persons" msgstr "" -#: models.py:2614 +#: models.py:2634 msgid "Can view own Person" msgstr "" -#: models.py:2615 +#: models.py:2635 msgid "Can add own Person" msgstr "" -#: models.py:2616 +#: models.py:2636 msgid "Can change own Person" msgstr "" -#: models.py:2617 +#: models.py:2637 msgid "Can delete own Person" msgstr "" -#: models.py:2794 +#: models.py:2826 msgid "Advanced shortcut menu" msgstr "" -#: models.py:2797 +#: models.py:2829 msgid "Ishtar user" msgstr "" -#: models.py:2798 +#: models.py:2830 msgid "Ishtar users" msgstr "" -#: models.py:2842 +#: models.py:2870 msgid "To modify the password use the form in Auth > User" msgstr "" -#: models.py:2849 +#: models.py:2878 msgid "Author types" msgstr "" -#: models.py:2883 +#: models.py:2895 +msgid "Can view all Authors" +msgstr "" + +#: models.py:2897 +msgid "Can view own Author" +msgstr "" + +#: models.py:2899 +msgid "Can add own Author" +msgstr "" + +#: models.py:2901 +msgid "Can change own Author" +msgstr "" + +#: models.py:2903 +msgid "Can delete own Author" +msgstr "" + +#: models.py:2924 msgid "Source types" msgstr "" -#: models.py:2892 +#: models.py:2933 msgid "Support types" msgstr "" -#: models.py:2899 +#: models.py:2940 msgid "Format type" msgstr "" -#: models.py:2900 +#: models.py:2941 msgid "Format types" msgstr "" -#: models.py:2908 +#: models.py:2949 msgid "External ID" msgstr "" -#: models.py:2911 +#: models.py:2952 msgid "Support" msgstr "" -#: models.py:2915 +#: models.py:2956 msgid "Scale" msgstr "" -#: models.py:2929 +#: models.py:2970 msgid "Item number" msgstr "" -#: models.py:2930 +#: models.py:2971 msgid "Ref." msgstr "" -#: models.py:2933 +#: models.py:2974 msgid "Internal ref." msgstr "" -#: models.py:2976 +#: models.py:3017 msgid "Surface (m2)" msgstr "" -#: models.py:2977 templates/sheet_ope.html:46 templates/sheet_ope.html.py:107 +#: models.py:3018 templates/sheet_ope.html:46 templates/sheet_ope.html.py:107 msgid "Localisation" msgstr "" -#: models.py:3002 +#: models.py:3043 msgid "Is preventive" msgstr "" -#: models.py:3006 +#: models.py:3047 msgid "Operation types" msgstr "" -#: models.py:3035 +#: models.py:3076 msgid "Preventive" msgstr "" -#: models.py:3036 +#: models.py:3077 msgid "Research" msgstr "" -#: models.py:3059 +#: models.py:3100 msgid "Authority name" msgstr "" -#: models.py:3060 +#: models.py:3101 msgid "Authority SRID" msgstr "" -#: models.py:3064 +#: models.py:3105 msgid "Spatial reference systems" msgstr "" @@ -1513,108 +1533,116 @@ msgstr "" msgid "Account deletion" msgstr "" -#: views.py:241 +#: views.py:251 msgid "Archaeological file" msgstr "" -#: views.py:242 +#: views.py:252 msgid "Operation" msgstr "" -#: views.py:244 +#: views.py:254 msgid "Context record" msgstr "" -#: views.py:246 +#: views.py:256 msgid "Find" msgstr "" -#: views.py:248 +#: views.py:258 msgid "Treatment request" msgstr "" -#: views.py:249 +#: views.py:259 msgid "Treatment" msgstr "" -#: views.py:1363 views.py:1406 +#: views.py:1387 views.py:1430 msgid "Operation not permitted." msgstr "" -#: views.py:1365 +#: views.py:1389 #, python-format msgid "New %s" msgstr "" -#: views.py:1424 views.py:1474 +#: views.py:1448 views.py:1501 msgid "Archaeological files" msgstr "" -#: views.py:1425 views.py:1478 +#: views.py:1449 views.py:1505 msgid "Operations" msgstr "" -#: views.py:1427 views.py:1482 +#: views.py:1451 views.py:1509 msgid "Context records" msgstr "" -#: views.py:1429 views.py:1485 +#: views.py:1453 views.py:1512 msgid "Finds" msgstr "" -#: views.py:1683 templates/ishtar/import_list.html:47 +#: views.py:1455 views.py:1517 +msgid "Treatment requests" +msgstr "" + +#: views.py:1456 views.py:1521 +msgid "Treatments" +msgstr "" + +#: views.py:1719 templates/ishtar/import_list.html:47 msgid "Link unmatched items" msgstr "" -#: views.py:1698 +#: views.py:1734 msgid "Delete import" msgstr "" -#: views.py:1737 +#: views.py:1773 msgid "Merge persons" msgstr "" -#: views.py:1761 +#: views.py:1797 msgid "Select the main person" msgstr "" -#: views.py:1770 +#: views.py:1806 msgid "Merge organization" msgstr "" -#: views.py:1780 +#: views.py:1816 msgid "Select the main organization" msgstr "" -#: views.py:1820 views.py:1836 +#: views.py:1856 views.py:1872 msgid "Corporation manager" msgstr "" -#: widgets.py:259 widgets.py:366 widgets.py:481 +#: widgets.py:313 widgets.py:420 widgets.py:535 msgid "Search..." msgstr "" -#: widgets.py:670 templatetags/window_tables.py:96 +#: widgets.py:724 templatetags/window_tables.py:96 msgid "No results" msgstr "" -#: widgets.py:671 templatetags/window_tables.py:97 +#: widgets.py:725 templatetags/window_tables.py:97 msgid "Loading..." msgstr "" -#: widgets.py:672 +#: widgets.py:726 msgid "Remove" msgstr "" -#: wizards.py:374 templates/ishtar/import_delete.html:21 +#: wizards.py:380 templates/ishtar/import_delete.html:21 msgid "Yes" msgstr "" -#: wizards.py:376 +#: wizards.py:382 msgid "No" msgstr "" -#: wizards.py:1396 +#: wizards.py:1404 #, python-format msgid "[%(app_name)s] Account creation/modification" msgstr "" @@ -1689,19 +1717,19 @@ msgstr "" msgid ":" msgstr "" -#: templates/base.html:120 +#: templates/base.html:123 msgid "Processing..." msgstr "" -#: templates/base.html:121 +#: templates/base.html:124 msgid "This can be long." msgstr "" -#: templates/base.html:122 +#: templates/base.html:125 msgid "Time to take a coffee?" msgstr "" -#: templates/base.html:123 +#: templates/base.html:126 msgid "Time to take another coffee?" msgstr "" diff --git a/ishtar_common/management/commands/regenerate_permissions.py b/ishtar_common/management/commands/regenerate_permissions.py index c2af8b353..599e64d64 100644 --- a/ishtar_common/management/commands/regenerate_permissions.py +++ b/ishtar_common/management/commands/regenerate_permissions.py @@ -1,6 +1,6 @@ #!/usr/bin/env python # -*- coding: utf-8 -*- -# Copyright (C) 2013 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> +# Copyright (C) 2013-2017 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as @@ -17,14 +17,13 @@ # See the file COPYING for details. -import sys -from django.db import models -from django.core.management.base import BaseCommand, CommandError +from django.core.management.base import BaseCommand from django.contrib.contenttypes.models import ContentType from django.contrib.auth.models import Permission + class Command(BaseCommand): args = '' help = 'Regenerate permissions' @@ -35,6 +34,8 @@ class Command(BaseCommand): if not model: continue for perm_slug, perm_label in model._meta.permissions: - Permission.objects.get_or_create(content_type=ct, - codename=perm_slug, - defaults={'name':perm_label}) + perm, c = Permission.objects.get_or_create( + content_type=ct, codename=perm_slug, + defaults={'name': perm_label}) + if c: + print('Permission {} created.'.format(perm_label)) diff --git a/ishtar_common/menu_base.py b/ishtar_common/menu_base.py index 0117b375d..c6d02daa5 100644 --- a/ishtar_common/menu_base.py +++ b/ishtar_common/menu_base.py @@ -87,18 +87,22 @@ class MenuItem: return False if not self.access_controls: return True + if not hasattr(user, 'ishtaruser'): + return False + # manage by specific idx - person type + if user.ishtaruser.has_right(self.idx, session=session): + return True prefix = (self.model._meta.app_label + '.') if self.model else '' for access_control in self.access_controls: + # check by person type + if user.ishtaruser.has_right(access_control, session=session): + return True access_control = prefix + access_control - if hasattr(user, 'ishtaruser') and \ - user.ishtaruser.has_perm(access_control, self.model, - session=session) or \ + # check by specific access control + if user.ishtaruser.has_perm(access_control, self.model, + session=session) or \ access_control in user.get_group_permissions(): return True - # manage by person type - if hasattr(user, 'ishtaruser'): - if user.ishtaruser.has_right(self.idx, session=session): - return True return False def is_available(self, user, obj=None, session=None): diff --git a/ishtar_common/models.py b/ishtar_common/models.py index 35608abdf..988254359 100644 --- a/ishtar_common/models.py +++ b/ishtar_common/models.py @@ -191,6 +191,8 @@ def valid_ids(cls): def func(value): if "," in value: value = value.split(",") + if type(value) not in (list, tuple): + value = [value] for v in value: try: cls.objects.get(pk=v) @@ -411,7 +413,7 @@ class GeneralType(Cached, models.Model): if item: return item item, created = cls.objects.get_or_create( - txt_idx=slug, defaults={'label': label}) + txt_idx=slug, defaults={'label': label}) return item @classmethod @@ -769,6 +771,10 @@ class ImageModel(models.Model): return SimpleUploadedFile('temp', temp.read()) def save(self, *args, **kwargs): + if 'force_copy' in kwargs: + kwargs.pop('force_copy') + super(ImageModel, self).save(*args, **kwargs) + return # manage images if self.has_changed('image') and self.image: # convert to jpg @@ -1300,6 +1306,19 @@ class UserDashboard: class DashboardFormItem(object): + """ + Provide methods to manage statistics + """ + + def _get_or_set_stats(self, funcname, update, + timeout=settings.CACHE_TIMEOUT): + key, val = get_cache(self.__class__, [funcname, self.pk]) + if not update and val is not None: + return val + val = getattr(self, funcname)() + cache.set(key, val, timeout) + return val + @classmethod def get_periods(cls, slice='month', fltr={}, date_source='creation'): date_var = date_source + '_date' @@ -1951,7 +1970,8 @@ class ImporterColumn(models.Model): """ Import file column description """ - label = models.CharField(_(u"Label"), blank=True, null=True, max_length=200) + label = models.CharField(_(u"Label"), blank=True, null=True, + max_length=200) importer_type = models.ForeignKey(ImporterType, related_name='columns') col_number = models.IntegerField(_(u"Column number"), default=1) description = models.TextField(_("Description"), blank=True, null=True) @@ -2141,7 +2161,8 @@ TARGET_MODELS = [ ('archaeological_operations.models.ReportState', _(u"Report state")), ('archaeological_operations.models.RemainType', _(u"Remain type")), ('archaeological_context_records.models.Unit', _(u"Unit")), - ('archaeological_context_records.models.ActivityType', _(u"Activity type")), + ('archaeological_context_records.models.ActivityType', + _(u"Activity type")), ('archaeological_finds.models.MaterialType', _(u"Material")), ('archaeological_finds.models.ConservatoryState', _(u"Conservatory state")), @@ -2149,7 +2170,8 @@ TARGET_MODELS = [ ('archaeological_finds.models.PreservationType', _(u"Preservation type")), ('archaeological_finds.models.ObjectType', _(u"Object type")), ('archaeological_finds.models.IntegrityType', _(u"Integrity type")), - ('archaeological_finds.models.RemarkabilityType', _(u"Remarkability type")), + ('archaeological_finds.models.RemarkabilityType', + _(u"Remarkability type")), ('archaeological_finds.models.BatchType', _(u"Batch type")), ('archaeological_context_records.models.IdentificationType', _("Identification type")), @@ -2301,14 +2323,12 @@ class Import(models.Model): conservative_import = models.BooleanField( _(u"Conservative import"), default=False, help_text='If set to true, do not overload existing values') - creation_date = models.DateTimeField(_(u"Creation date"), - auto_now_add=True, blank=True, - null=True) + creation_date = models.DateTimeField( + _(u"Creation date"), auto_now_add=True, blank=True, null=True) end_date = models.DateTimeField(_(u"End date"), blank=True, null=True, editable=False) - seconds_remaining = models.IntegerField(_(u"Remaining seconds"), - blank=True, null=True, - editable=False) + seconds_remaining = models.IntegerField( + _(u"Remaining seconds"), blank=True, null=True, editable=False) class Meta: verbose_name = _(u"Import") @@ -2770,6 +2790,18 @@ class Person(Address, Merge, OwnPerms, ValueGetter): for fle in self.general_contractor.all(): fle.save() # force update of raw_general_contractor + @classmethod + def get_query_owns(cls, user): + return \ + Q(operation_scientist_responsability__collaborators__ishtaruser + =user.ishtaruser) | \ + Q(operation_scientist_responsability__scientist__ishtaruser + =user.ishtaruser) | \ + Q(operation_collaborator__collaborators__ishtaruser + =user.ishtaruser) | \ + Q(operation_collaborator__scientist__ishtaruser + =user.ishtaruser) + class IshtarUser(User): TABLE_COLS = ('username', 'person__name', 'person__surname', @@ -2803,17 +2835,13 @@ class IshtarUser(User): surname = user.first_name or default name = user.last_name or default email = user.email - if user.is_superuser: - ADMINISTRATOR, created = PersonType.objects.get_or_create( - txt_idx='administrator') - person_type = ADMINISTRATOR - else: - person_type, created = PersonType.objects.get_or_create( - txt_idx='public_access') person = Person.objects.create(surname=surname, name=name, email=email, history_modifier=user) - person.person_types.add(person_type) + if user.is_superuser: + person_type, created = PersonType.objects.get_or_create( + txt_idx='administrator') + person.person_types.add(person_type) password = user.password isht_user = IshtarUser.objects.create( user_ptr=user, username=default, person=person, password=password) @@ -2844,6 +2872,7 @@ IshtarUser._meta.get_field('password').help_text = _( class AuthorType(GeneralType): order = models.IntegerField(_(u"Order"), default=1) + class Meta: verbose_name = _(u"Author type") verbose_name_plural = _(u"Author types") @@ -2861,6 +2890,18 @@ class Author(models.Model): verbose_name = _(u"Author") verbose_name_plural = _(u"Authors") ordering = ('author_type__order', 'person__name') + permissions = ( + ("view_author", + ugettext(u"Can view all Authors")), + ("view_own_author", + ugettext(u"Can view own Author")), + ("add_own_author", + ugettext(u"Can add own Author")), + ("change_own_author", + ugettext(u"Can change own Author")), + ("delete_own_author", + ugettext(u"Can delete own Author")), + ) def __unicode__(self): return unicode(self.person) + settings.JOINT + \ @@ -2903,7 +2944,7 @@ post_save.connect(post_save_cache, sender=Format) post_delete.connect(post_save_cache, sender=Format) -class Source(ImageModel, models.Model): +class Source(OwnPerms, ImageModel, models.Model): title = models.CharField(_(u"Title"), max_length=300) external_id = models.CharField(_(u"External ID"), max_length=12, null=True, blank=True) diff --git a/ishtar_common/static/js/ishtar.js b/ishtar_common/static/js/ishtar.js index b5f4f1a79..318c17315 100644 --- a/ishtar_common/static/js/ishtar.js +++ b/ishtar_common/static/js/ishtar.js @@ -38,11 +38,13 @@ function get_previous_table_id(){} var shortcut_url = ''; var advanced_menu = false; +var shortcut_menu_hide = false; var activate_all_search_url = '/activate-all-search/'; var activate_own_search_url = '/activate-own-search/'; var activate_advanced_url = '/activate-advanced-menu/'; var activate_simple_url = '/activate-simple-menu/'; - +var shortcut_menu_hide_url = '/hide-shortcut-menu/' +var shortcut_menu_show_url = '/show-shortcut-menu/' function init_shortcut_menu(html){ $("#progress").hide(); @@ -68,13 +70,21 @@ function init_shortcut_menu(html){ $('#shortcut-menu table').hide(); $(".short-menu-close").hide(); $(".short-menu-open").show(); + $.get(shortcut_menu_hide_url); }); $(".short-menu-open").click(function(){ $('#shortcut-menu div').show(); $('#shortcut-menu table').show(); $(".short-menu-open").hide(); $(".short-menu-close").show(); + $.get(shortcut_menu_show_url); }); + if (shortcut_menu_hide){ + $('#shortcut-menu div').hide(); + $('#shortcut-menu table').hide(); + $(".short-menu-close").hide(); + $(".short-menu-open").show(); + } } function init_shortcut_fields(){ @@ -213,9 +223,8 @@ $(document).on("click", '.check-all', function(){ ).attr('checked', $(this).is(':checked')); }); -$(document).on("click", '#main_menu ul li', function(){ +$(document).on("click", '#main_menu > ul > li', function(){ var current_id = $(this).attr('id'); - console.log(current_id); $("#main_menu ul ul").not($(this).parents('ul')).not($(this).find('ul') ).hide('slow'); $(this).find('ul').show('slow'); diff --git a/ishtar_common/static/media/style.css b/ishtar_common/static/media/style.css index adaf94200..011db3652 100644 --- a/ishtar_common/static/media/style.css +++ b/ishtar_common/static/media/style.css @@ -92,6 +92,15 @@ div.form { border-bottom:1px solid #D14; } +.form .select2-container--default .select2-selection--multiple { + border: 1px solid #FFF; +} + +.form .select2-container--default.select2-container--focus +.select2-selection--multiple { + border:1px solid #D14; +} + hr.spacer{ clear:both; border:0; @@ -315,6 +324,12 @@ ul.list{ line-height:16px; } +.centered{ + text-align: center; + width: 100%; + display: inline-block; +} + div.nav-button{ cursor:pointer; width:15px; diff --git a/ishtar_common/static/select2/LICENSE b/ishtar_common/static/select2/LICENSE deleted file mode 100644 index 0247cc762..000000000 --- a/ishtar_common/static/select2/LICENSE +++ /dev/null @@ -1,18 +0,0 @@ -Copyright 2014 Igor Vaynberg - -Version: @@ver@@ Timestamp: @@timestamp@@ - -This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU -General Public License version 2 (the "GPL License"). You may choose either license to govern your -use of this software only upon the condition that you accept all of the terms of either the Apache -License or the GPL License. - -You may obtain a copy of the Apache License and the GPL License at: - -http://www.apache.org/licenses/LICENSE-2.0 -http://www.gnu.org/licenses/gpl-2.0.html - -Unless required by applicable law or agreed to in writing, software distributed under the Apache License -or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, -either express or implied. See the Apache License and the GPL License for the specific language governing -permissions and limitations under the Apache License and the GPL License. diff --git a/ishtar_common/static/select2/LICENSE.md b/ishtar_common/static/select2/LICENSE.md new file mode 100644 index 000000000..86c7c291a --- /dev/null +++ b/ishtar_common/static/select2/LICENSE.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2012-2015 Kevin Brown, Igor Vaynberg, and Select2 contributors + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/ishtar_common/static/select2/css/select2-bootstrap.css b/ishtar_common/static/select2/css/select2-bootstrap.css deleted file mode 100644 index 3b83f0a22..000000000 --- a/ishtar_common/static/select2/css/select2-bootstrap.css +++ /dev/null @@ -1,87 +0,0 @@ -.form-control .select2-choice { - border: 0; - border-radius: 2px; -} - -.form-control .select2-choice .select2-arrow { - border-radius: 0 2px 2px 0; -} - -.form-control.select2-container { - height: auto !important; - padding: 0; -} - -.form-control.select2-container.select2-dropdown-open { - border-color: #5897FB; - border-radius: 3px 3px 0 0; -} - -.form-control .select2-container.select2-dropdown-open .select2-choices { - border-radius: 3px 3px 0 0; -} - -.form-control.select2-container .select2-choices { - border: 0 !important; - border-radius: 3px; -} - -.control-group.warning .select2-container .select2-choice, -.control-group.warning .select2-container .select2-choices, -.control-group.warning .select2-container-active .select2-choice, -.control-group.warning .select2-container-active .select2-choices, -.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice, -.control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices, -.control-group.warning .select2-container-multi.select2-container-active .select2-choices { - border: 1px solid #C09853 !important; -} - -.control-group.warning .select2-container .select2-choice div { - border-left: 1px solid #C09853 !important; - background: #FCF8E3 !important; -} - -.control-group.error .select2-container .select2-choice, -.control-group.error .select2-container .select2-choices, -.control-group.error .select2-container-active .select2-choice, -.control-group.error .select2-container-active .select2-choices, -.control-group.error .select2-dropdown-open.select2-drop-above .select2-choice, -.control-group.error .select2-dropdown-open.select2-drop-above .select2-choices, -.control-group.error .select2-container-multi.select2-container-active .select2-choices { - border: 1px solid #B94A48 !important; -} - -.control-group.error .select2-container .select2-choice div { - border-left: 1px solid #B94A48 !important; - background: #F2DEDE !important; -} - -.control-group.info .select2-container .select2-choice, -.control-group.info .select2-container .select2-choices, -.control-group.info .select2-container-active .select2-choice, -.control-group.info .select2-container-active .select2-choices, -.control-group.info .select2-dropdown-open.select2-drop-above .select2-choice, -.control-group.info .select2-dropdown-open.select2-drop-above .select2-choices, -.control-group.info .select2-container-multi.select2-container-active .select2-choices { - border: 1px solid #3A87AD !important; -} - -.control-group.info .select2-container .select2-choice div { - border-left: 1px solid #3A87AD !important; - background: #D9EDF7 !important; -} - -.control-group.success .select2-container .select2-choice, -.control-group.success .select2-container .select2-choices, -.control-group.success .select2-container-active .select2-choice, -.control-group.success .select2-container-active .select2-choices, -.control-group.success .select2-dropdown-open.select2-drop-above .select2-choice, -.control-group.success .select2-dropdown-open.select2-drop-above .select2-choices, -.control-group.success .select2-container-multi.select2-container-active .select2-choices { - border: 1px solid #468847 !important; -} - -.control-group.success .select2-container .select2-choice div { - border-left: 1px solid #468847 !important; - background: #DFF0D8 !important; -} diff --git a/ishtar_common/static/select2/css/select2-spinner.gif b/ishtar_common/static/select2/css/select2-spinner.gif Binary files differdeleted file mode 100644 index 5b33f7e54..000000000 --- a/ishtar_common/static/select2/css/select2-spinner.gif +++ /dev/null diff --git a/ishtar_common/static/select2/css/select2.css b/ishtar_common/static/select2/css/select2.css index 2d07a0343..447b2b86c 100644 --- a/ishtar_common/static/select2/css/select2.css +++ b/ishtar_common/static/select2/css/select2.css @@ -1,704 +1,484 @@ -/* -Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014 -*/ .select2-container { - margin: 0; - position: relative; - display: inline-block; - /* inline-block for ie7 */ - zoom: 1; - *display: inline; - vertical-align: middle; -} - -.select2-container, -.select2-drop, -.select2-search, -.select2-search input { - /* - Force border-box so that % widths fit the parent - container without overlap because of margin/padding. - More Info : http://www.quirksmode.org/css/box.html - */ - -webkit-box-sizing: border-box; /* webkit */ - -moz-box-sizing: border-box; /* firefox */ - box-sizing: border-box; /* css3 */ -} - -.select2-container .select2-choice { - display: block; - height: 26px; - padding: 0 0 0 8px; - overflow: hidden; - position: relative; - - border: 1px solid #aaa; - white-space: nowrap; - line-height: 26px; - color: #444; - text-decoration: none; - - border-radius: 4px; - - background-clip: padding-box; - - -webkit-touch-callout: none; - -webkit-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; - - background-color: #fff; - background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff)); - background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%); - background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0); - background-image: linear-gradient(to top, #eee 0%, #fff 50%); -} - -html[dir="rtl"] .select2-container .select2-choice { - padding: 0 8px 0 0; -} - -.select2-container.select2-drop-above .select2-choice { - border-bottom-color: #aaa; - - border-radius: 0 0 4px 4px; - - background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff)); - background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%); - background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0); - background-image: linear-gradient(to bottom, #eee 0%, #fff 90%); -} - -.select2-container.select2-allowclear .select2-choice .select2-chosen { - margin-right: 42px; -} - -.select2-container .select2-choice > .select2-chosen { - margin-right: 26px; - display: block; - overflow: hidden; - - white-space: nowrap; - - text-overflow: ellipsis; - float: none; - width: auto; -} - -html[dir="rtl"] .select2-container .select2-choice > .select2-chosen { - margin-left: 26px; - margin-right: 0; -} - -.select2-container .select2-choice abbr { - display: none; - width: 12px; - height: 12px; - position: absolute; - right: 24px; - top: 8px; - - font-size: 1px; - text-decoration: none; - - border: 0; - background: url('select2.png') right top no-repeat; + box-sizing: border-box; + display: inline-block; + margin: 0; + position: relative; + vertical-align: middle; } + .select2-container .select2-selection--single { + box-sizing: border-box; cursor: pointer; - outline: 0; -} - -.select2-container.select2-allowclear .select2-choice abbr { - display: inline-block; -} - -.select2-container .select2-choice abbr:hover { - background-position: right -11px; + display: block; + height: 28px; + user-select: none; + -webkit-user-select: none; } + .select2-container .select2-selection--single .select2-selection__rendered { + display: block; + padding-left: 8px; + padding-right: 20px; + overflow: hidden; + text-overflow: ellipsis; + white-space: nowrap; } + .select2-container .select2-selection--single .select2-selection__clear { + position: relative; } + .select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered { + padding-right: 8px; + padding-left: 20px; } + .select2-container .select2-selection--multiple { + box-sizing: border-box; cursor: pointer; -} - -.select2-drop-mask { - border: 0; - margin: 0; - padding: 0; - position: fixed; - left: 0; - top: 0; - min-height: 100%; - min-width: 100%; - height: auto; - width: auto; - opacity: 0; - z-index: 9998; - /* styles required for IE to work */ - background-color: #fff; - filter: alpha(opacity=0); -} - -.select2-drop { - width: 100%; - margin-top: -1px; - position: absolute; - z-index: 9999; - top: 100%; - - background: #fff; - color: #000; - border: 1px solid #aaa; - border-top: 0; - - border-radius: 0 0 4px 4px; - - -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15); - box-shadow: 0 4px 5px rgba(0, 0, 0, .15); -} - -.select2-drop.select2-drop-above { - margin-top: 1px; - border-top: 1px solid #aaa; - border-bottom: 0; - - border-radius: 4px 4px 0 0; - - -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15); - box-shadow: 0 -4px 5px rgba(0, 0, 0, .15); -} - -.select2-drop-active { - border: 1px solid #5897fb; - border-top: none; -} - -.select2-drop.select2-drop-above.select2-drop-active { - border-top: 1px solid #5897fb; -} - -.select2-drop-auto-width { - border-top: 1px solid #aaa; - width: auto; -} - -.select2-drop-auto-width .select2-search { - padding-top: 4px; -} - -.select2-container .select2-choice .select2-arrow { - display: inline-block; - width: 18px; - height: 100%; - position: absolute; - right: 0; - top: 0; - - border-left: 1px solid #aaa; - border-radius: 0 4px 4px 0; - - background-clip: padding-box; - - background: #ccc; - background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee)); - background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%); - background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0); - background-image: linear-gradient(to top, #ccc 0%, #eee 60%); -} - -html[dir="rtl"] .select2-container .select2-choice .select2-arrow { - left: 0; - right: auto; - - border-left: none; - border-right: 1px solid #aaa; - border-radius: 4px 0 0 4px; -} - -.select2-container .select2-choice .select2-arrow b { display: block; - width: 100%; - height: 100%; - background: url('select2.png') no-repeat 0 1px; -} + min-height: 32px; + user-select: none; + -webkit-user-select: none; } + .select2-container .select2-selection--multiple .select2-selection__rendered { + display: inline-block; + overflow: hidden; + padding-left: 8px; + text-overflow: ellipsis; + white-space: nowrap; } + .select2-container .select2-search--inline { + float: left; } + .select2-container .select2-search--inline .select2-search__field { + box-sizing: border-box; + border: none; + font-size: 100%; + margin-top: 5px; + padding: 0; } + .select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button { + -webkit-appearance: none; } + +.select2-dropdown { + background-color: white; + border: 1px solid #aaa; + border-radius: 4px; + box-sizing: border-box; + display: block; + position: absolute; + left: -100000px; + width: 100%; + z-index: 1051; } -html[dir="rtl"] .select2-container .select2-choice .select2-arrow b { - background-position: 2px 1px; -} - -.select2-search { - display: inline-block; +.select2-results { + display: block; } + +.select2-results__options { + list-style: none; + margin: 0; + padding: 0; } + +.select2-results__option { + padding: 6px; + user-select: none; + -webkit-user-select: none; } + .select2-results__option[aria-selected] { + cursor: pointer; } + +.select2-container--open .select2-dropdown { + left: 0; } + +.select2-container--open .select2-dropdown--above { + border-bottom: none; + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; } + +.select2-container--open .select2-dropdown--below { + border-top: none; + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.select2-search--dropdown { + display: block; + padding: 4px; } + .select2-search--dropdown .select2-search__field { + padding: 4px; width: 100%; - min-height: 26px; - margin: 0; - padding-left: 4px; - padding-right: 4px; - - position: relative; - z-index: 10000; - - white-space: nowrap; -} - -.select2-search input { - width: 100%; - height: auto !important; - min-height: 26px; - padding: 4px 20px 4px 5px; - margin: 0; - - outline: 0; - font-family: sans-serif; - font-size: 1em; - - border: 1px solid #aaa; - border-radius: 0; - - -webkit-box-shadow: none; - box-shadow: none; - - background: #fff url('select2.png') no-repeat 100% -22px; - background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); - background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); - background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); - background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; -} - -html[dir="rtl"] .select2-search input { - padding: 4px 5px 4px 20px; - - background: #fff url('select2.png') no-repeat -37px -22px; - background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); - background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); - background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); - background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; -} - -.select2-drop.select2-drop-above .select2-search input { - margin-top: 4px; -} - -.select2-search input.select2-active { - background: #fff url('select2-spinner.gif') no-repeat 100%; - background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); - background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); - background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); - background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; -} - -.select2-container-active .select2-choice, -.select2-container-active .select2-choices { - border: 1px solid #5897fb; - outline: none; - - -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3); - box-shadow: 0 0 5px rgba(0, 0, 0, .3); -} - -.select2-dropdown-open .select2-choice { - border-bottom-color: transparent; - -webkit-box-shadow: 0 1px 0 #fff inset; - box-shadow: 0 1px 0 #fff inset; - - border-bottom-left-radius: 0; - border-bottom-right-radius: 0; - - background-color: #eee; - background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee)); - background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%); - background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0); - background-image: linear-gradient(to top, #fff 0%, #eee 50%); -} - -.select2-dropdown-open.select2-drop-above .select2-choice, -.select2-dropdown-open.select2-drop-above .select2-choices { - border: 1px solid #5897fb; - border-top-color: transparent; - - background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee)); - background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%); - background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%); - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0); - background-image: linear-gradient(to bottom, #fff 0%, #eee 50%); -} - -.select2-dropdown-open .select2-choice .select2-arrow { - background: transparent; - border-left: none; - filter: none; -} -html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow { - border-right: none; -} - -.select2-dropdown-open .select2-choice .select2-arrow b { - background-position: -18px 1px; -} - -html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b { - background-position: -16px 1px; -} + box-sizing: border-box; } + .select2-search--dropdown .select2-search__field::-webkit-search-cancel-button { + -webkit-appearance: none; } + .select2-search--dropdown.select2-search--hide { + display: none; } + +.select2-close-mask { + border: 0; + margin: 0; + padding: 0; + display: block; + position: fixed; + left: 0; + top: 0; + min-height: 100%; + min-width: 100%; + height: auto; + width: auto; + opacity: 0; + z-index: 99; + background-color: #fff; + filter: alpha(opacity=0); } .select2-hidden-accessible { - border: 0; - clip: rect(0 0 0 0); - height: 1px; - margin: -1px; - overflow: hidden; - padding: 0; + border: 0 !important; + clip: rect(0 0 0 0) !important; + height: 1px !important; + margin: -1px !important; + overflow: hidden !important; + padding: 0 !important; + position: absolute !important; + width: 1px !important; } + +.select2-container--default .select2-selection--single { + background-color: #fff; + border: 1px solid #aaa; + border-radius: 4px; } + .select2-container--default .select2-selection--single .select2-selection__rendered { + color: #444; + line-height: 28px; } + .select2-container--default .select2-selection--single .select2-selection__clear { + cursor: pointer; + float: right; + font-weight: bold; } + .select2-container--default .select2-selection--single .select2-selection__placeholder { + color: #999; } + .select2-container--default .select2-selection--single .select2-selection__arrow { + height: 26px; position: absolute; - width: 1px; -} - -/* results */ -.select2-results { - max-height: 200px; - padding: 0 0 0 4px; - margin: 4px 4px 4px 0; - position: relative; - overflow-x: hidden; - overflow-y: auto; - -webkit-tap-highlight-color: rgba(0, 0, 0, 0); -} - -html[dir="rtl"] .select2-results { - padding: 0 4px 0 0; - margin: 4px 0 4px 4px; -} - -.select2-results ul.select2-result-sub { - margin: 0; - padding-left: 0; -} - -.select2-results li { + top: 1px; + right: 1px; + width: 20px; } + .select2-container--default .select2-selection--single .select2-selection__arrow b { + border-color: #888 transparent transparent transparent; + border-style: solid; + border-width: 5px 4px 0 4px; + height: 0; + left: 50%; + margin-left: -4px; + margin-top: -2px; + position: absolute; + top: 50%; + width: 0; } + +.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear { + float: left; } + +.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow { + left: 1px; + right: auto; } + +.select2-container--default.select2-container--disabled .select2-selection--single { + background-color: #eee; + cursor: default; } + .select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear { + display: none; } + +.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b { + border-color: transparent transparent #888 transparent; + border-width: 0 4px 5px 4px; } + +.select2-container--default .select2-selection--multiple { + background-color: white; + border: 1px solid #aaa; + border-radius: 4px; + cursor: text; } + .select2-container--default .select2-selection--multiple .select2-selection__rendered { + box-sizing: border-box; list-style: none; - display: list-item; - background-image: none; -} - -.select2-results li.select2-result-with-children > .select2-result-label { - font-weight: bold; -} - -.select2-results .select2-result-label { - padding: 3px 7px 4px; margin: 0; + padding: 0 5px; + width: 100%; } + .select2-container--default .select2-selection--multiple .select2-selection__rendered li { + list-style: none; } + .select2-container--default .select2-selection--multiple .select2-selection__placeholder { + color: #999; + margin-top: 5px; + float: left; } + .select2-container--default .select2-selection--multiple .select2-selection__clear { cursor: pointer; - - min-height: 1em; - - -webkit-touch-callout: none; - -webkit-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; -} - -.select2-results-dept-1 .select2-result-label { padding-left: 20px } -.select2-results-dept-2 .select2-result-label { padding-left: 40px } -.select2-results-dept-3 .select2-result-label { padding-left: 60px } -.select2-results-dept-4 .select2-result-label { padding-left: 80px } -.select2-results-dept-5 .select2-result-label { padding-left: 100px } -.select2-results-dept-6 .select2-result-label { padding-left: 110px } -.select2-results-dept-7 .select2-result-label { padding-left: 120px } - -.select2-results .select2-highlighted { - background: #3875d7; - color: #fff; -} - -.select2-results li em { - background: #feffde; - font-style: normal; -} - -.select2-results .select2-highlighted em { - background: transparent; -} - -.select2-results .select2-highlighted ul { - background: #fff; - color: #000; -} - -.select2-results .select2-no-results, -.select2-results .select2-searching, -.select2-results .select2-ajax-error, -.select2-results .select2-selection-limit { - background: #f4f4f4; - display: list-item; - padding-left: 5px; -} - -/* -disabled look for disabled choices in the results dropdown -*/ -.select2-results .select2-disabled.select2-highlighted { - color: #666; - background: #f4f4f4; - display: list-item; + float: right; + font-weight: bold; + margin-top: 5px; + margin-right: 10px; } + .select2-container--default .select2-selection--multiple .select2-selection__choice { + background-color: #e4e4e4; + border: 1px solid #aaa; + border-radius: 4px; cursor: default; -} -.select2-results .select2-disabled { - background: #f4f4f4; - display: list-item; + float: left; + margin-right: 5px; + margin-top: 5px; + padding: 0 5px; } + .select2-container--default .select2-selection--multiple .select2-selection__choice__remove { + color: #999; + cursor: pointer; + display: inline-block; + font-weight: bold; + margin-right: 2px; } + .select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover { + color: #333; } + +.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice, .select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__placeholder, .select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline { + float: right; } + +.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice { + margin-left: 5px; + margin-right: auto; } + +.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove { + margin-left: 2px; + margin-right: auto; } + +.select2-container--default.select2-container--focus .select2-selection--multiple { + border: solid black 1px; + outline: 0; } + +.select2-container--default.select2-container--disabled .select2-selection--multiple { + background-color: #eee; + cursor: default; } + +.select2-container--default.select2-container--disabled .select2-selection__choice__remove { + display: none; } + +.select2-container--default.select2-container--open.select2-container--above .select2-selection--single, .select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple { + border-top-left-radius: 0; + border-top-right-radius: 0; } + +.select2-container--default.select2-container--open.select2-container--below .select2-selection--single, .select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple { + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; } + +.select2-container--default .select2-search--dropdown .select2-search__field { + border: 1px solid #aaa; } + +.select2-container--default .select2-search--inline .select2-search__field { + background: transparent; + border: none; + outline: 0; + box-shadow: none; + -webkit-appearance: textfield; } + +.select2-container--default .select2-results > .select2-results__options { + max-height: 200px; + overflow-y: auto; } + +.select2-container--default .select2-results__option[role=group] { + padding: 0; } + +.select2-container--default .select2-results__option[aria-disabled=true] { + color: #999; } + +.select2-container--default .select2-results__option[aria-selected=true] { + background-color: #ddd; } + +.select2-container--default .select2-results__option .select2-results__option { + padding-left: 1em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__group { + padding-left: 0; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option { + margin-left: -1em; + padding-left: 2em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -2em; + padding-left: 3em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -3em; + padding-left: 4em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -4em; + padding-left: 5em; } + .select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option { + margin-left: -5em; + padding-left: 6em; } + +.select2-container--default .select2-results__option--highlighted[aria-selected] { + background-color: #5897fb; + color: white; } + +.select2-container--default .select2-results__group { cursor: default; -} - -.select2-results .select2-selected { - display: none; -} + display: block; + padding: 6px; } + +.select2-container--classic .select2-selection--single { + background-color: #f7f7f7; + border: 1px solid #aaa; + border-radius: 4px; + outline: 0; + background-image: -webkit-linear-gradient(top, white 50%, #eeeeee 100%); + background-image: -o-linear-gradient(top, white 50%, #eeeeee 100%); + background-image: linear-gradient(to bottom, white 50%, #eeeeee 100%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0); } + .select2-container--classic .select2-selection--single:focus { + border: 1px solid #5897fb; } + .select2-container--classic .select2-selection--single .select2-selection__rendered { + color: #444; + line-height: 28px; } + .select2-container--classic .select2-selection--single .select2-selection__clear { + cursor: pointer; + float: right; + font-weight: bold; + margin-right: 10px; } + .select2-container--classic .select2-selection--single .select2-selection__placeholder { + color: #999; } + .select2-container--classic .select2-selection--single .select2-selection__arrow { + background-color: #ddd; + border: none; + border-left: 1px solid #aaa; + border-top-right-radius: 4px; + border-bottom-right-radius: 4px; + height: 26px; + position: absolute; + top: 1px; + right: 1px; + width: 20px; + background-image: -webkit-linear-gradient(top, #eeeeee 50%, #cccccc 100%); + background-image: -o-linear-gradient(top, #eeeeee 50%, #cccccc 100%); + background-image: linear-gradient(to bottom, #eeeeee 50%, #cccccc 100%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0); } + .select2-container--classic .select2-selection--single .select2-selection__arrow b { + border-color: #888 transparent transparent transparent; + border-style: solid; + border-width: 5px 4px 0 4px; + height: 0; + left: 50%; + margin-left: -4px; + margin-top: -2px; + position: absolute; + top: 50%; + width: 0; } + +.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear { + float: left; } + +.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow { + border: none; + border-right: 1px solid #aaa; + border-radius: 0; + border-top-left-radius: 4px; + border-bottom-left-radius: 4px; + left: 1px; + right: auto; } + +.select2-container--classic.select2-container--open .select2-selection--single { + border: 1px solid #5897fb; } + .select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow { + background: transparent; + border: none; } + .select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b { + border-color: transparent transparent #888 transparent; + border-width: 0 4px 5px 4px; } + +.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single { + border-top: none; + border-top-left-radius: 0; + border-top-right-radius: 0; + background-image: -webkit-linear-gradient(top, white 0%, #eeeeee 50%); + background-image: -o-linear-gradient(top, white 0%, #eeeeee 50%); + background-image: linear-gradient(to bottom, white 0%, #eeeeee 50%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0); } + +.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single { + border-bottom: none; + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; + background-image: -webkit-linear-gradient(top, #eeeeee 50%, white 100%); + background-image: -o-linear-gradient(top, #eeeeee 50%, white 100%); + background-image: linear-gradient(to bottom, #eeeeee 50%, white 100%); + background-repeat: repeat-x; + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0); } + +.select2-container--classic .select2-selection--multiple { + background-color: white; + border: 1px solid #aaa; + border-radius: 4px; + cursor: text; + outline: 0; } + .select2-container--classic .select2-selection--multiple:focus { + border: 1px solid #5897fb; } + .select2-container--classic .select2-selection--multiple .select2-selection__rendered { + list-style: none; + margin: 0; + padding: 0 5px; } + .select2-container--classic .select2-selection--multiple .select2-selection__clear { + display: none; } + .select2-container--classic .select2-selection--multiple .select2-selection__choice { + background-color: #e4e4e4; + border: 1px solid #aaa; + border-radius: 4px; + cursor: default; + float: left; + margin-right: 5px; + margin-top: 5px; + padding: 0 5px; } + .select2-container--classic .select2-selection--multiple .select2-selection__choice__remove { + color: #888; + cursor: pointer; + display: inline-block; + font-weight: bold; + margin-right: 2px; } + .select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover { + color: #555; } -.select2-more-results.select2-active { - background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%; -} +.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice { + float: right; } -.select2-results .select2-ajax-error { - background: rgba(255, 50, 50, .2); -} +.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice { + margin-left: 5px; + margin-right: auto; } -.select2-more-results { - background: #f4f4f4; - display: list-item; -} +.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove { + margin-left: 2px; + margin-right: auto; } -/* disabled styles */ +.select2-container--classic.select2-container--open .select2-selection--multiple { + border: 1px solid #5897fb; } -.select2-container.select2-container-disabled .select2-choice { - background-color: #f4f4f4; - background-image: none; - border: 1px solid #ddd; - cursor: default; -} +.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple { + border-top: none; + border-top-left-radius: 0; + border-top-right-radius: 0; } -.select2-container.select2-container-disabled .select2-choice .select2-arrow { - background-color: #f4f4f4; - background-image: none; - border-left: 0; -} +.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple { + border-bottom: none; + border-bottom-left-radius: 0; + border-bottom-right-radius: 0; } -.select2-container.select2-container-disabled .select2-choice abbr { - display: none; -} +.select2-container--classic .select2-search--dropdown .select2-search__field { + border: 1px solid #aaa; + outline: 0; } +.select2-container--classic .select2-search--inline .select2-search__field { + outline: 0; + box-shadow: none; } -/* multiselect */ +.select2-container--classic .select2-dropdown { + background-color: white; + border: 1px solid transparent; } -.select2-container-multi .select2-choices { - height: auto !important; - height: 1%; - margin: 0; - padding: 0 5px 0 0; - position: relative; +.select2-container--classic .select2-dropdown--above { + border-bottom: none; } - border: 1px solid #aaa; - cursor: text; - overflow: hidden; - - background-color: #fff; - background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff)); - background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%); - background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%); - background-image: linear-gradient(to bottom, #eee 1%, #fff 15%); -} - -html[dir="rtl"] .select2-container-multi .select2-choices { - padding: 0 0 0 5px; -} - -.select2-locked { - padding: 3px 5px 3px 5px !important; -} - -.select2-container-multi .select2-choices { - min-height: 26px; -} - -.select2-container-multi.select2-container-active .select2-choices { - border: 1px solid #5897fb; - outline: none; - - -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3); - box-shadow: 0 0 5px rgba(0, 0, 0, .3); -} -.select2-container-multi .select2-choices li { - float: left; - list-style: none; -} -html[dir="rtl"] .select2-container-multi .select2-choices li -{ - float: right; -} -.select2-container-multi .select2-choices .select2-search-field { - margin: 0; - padding: 0; - white-space: nowrap; -} - -.select2-container-multi .select2-choices .select2-search-field input { - padding: 5px; - margin: 1px 0; - - font-family: sans-serif; - font-size: 100%; - color: #666; - outline: 0; - border: 0; - -webkit-box-shadow: none; - box-shadow: none; - background: transparent !important; -} - -.select2-container-multi .select2-choices .select2-search-field input.select2-active { - background: #fff url('select2-spinner.gif') no-repeat 100% !important; -} - -.select2-default { - color: #999 !important; -} - -.select2-container-multi .select2-choices .select2-search-choice { - padding: 3px 5px 3px 18px; - margin: 3px 0 3px 5px; - position: relative; - - line-height: 13px; - color: #333; - cursor: default; - border: 1px solid #aaaaaa; +.select2-container--classic .select2-dropdown--below { + border-top: none; } - border-radius: 3px; +.select2-container--classic .select2-results > .select2-results__options { + max-height: 200px; + overflow-y: auto; } - -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05); - box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05); +.select2-container--classic .select2-results__option[role=group] { + padding: 0; } - background-clip: padding-box; +.select2-container--classic .select2-results__option[aria-disabled=true] { + color: grey; } - -webkit-touch-callout: none; - -webkit-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; +.select2-container--classic .select2-results__option--highlighted[aria-selected] { + background-color: #3875d7; + color: white; } - background-color: #e4e4e4; - filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0); - background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee)); - background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); - background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); - background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); -} -html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice -{ - margin: 3px 5px 3px 0; - padding: 3px 18px 3px 5px; -} -.select2-container-multi .select2-choices .select2-search-choice .select2-chosen { - cursor: default; -} -.select2-container-multi .select2-choices .select2-search-choice-focus { - background: #d4d4d4; -} +.select2-container--classic .select2-results__group { + cursor: default; + display: block; + padding: 6px; } -.select2-search-choice-close { - display: block; - width: 12px; - height: 13px; - position: absolute; - right: 3px; - top: 4px; - - font-size: 1px; - outline: none; - background: url('select2.png') right top no-repeat; -} -html[dir="rtl"] .select2-search-choice-close { - right: auto; - left: 3px; -} - -.select2-container-multi .select2-search-choice-close { - left: 3px; -} - -html[dir="rtl"] .select2-container-multi .select2-search-choice-close { - left: auto; - right: 2px; -} - -.select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover { - background-position: right -11px; -} -.select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close { - background-position: right -11px; -} - -/* disabled styles */ -.select2-container-multi.select2-container-disabled .select2-choices { - background-color: #f4f4f4; - background-image: none; - border: 1px solid #ddd; - cursor: default; -} - -.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice { - padding: 3px 5px 3px 5px; - border: 1px solid #ddd; - background-image: none; - background-color: #f4f4f4; -} - -.select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none; - background: none; -} -/* end multiselect */ - - -.select2-result-selectable .select2-match, -.select2-result-unselectable .select2-match { - text-decoration: underline; -} - -.select2-offscreen, .select2-offscreen:focus { - clip: rect(0 0 0 0) !important; - width: 1px !important; - height: 1px !important; - border: 0 !important; - margin: 0 !important; - padding: 0 !important; - overflow: hidden !important; - position: absolute !important; - outline: 0 !important; - left: 0px !important; - top: 0px !important; -} - -.select2-display-none { - display: none; -} - -.select2-measure-scrollbar { - position: absolute; - top: -10000px; - left: -10000px; - width: 100px; - height: 100px; - overflow: scroll; -} - -/* Retina-ize icons */ - -@media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) { - .select2-search input, - .select2-search-choice-close, - .select2-container .select2-choice abbr, - .select2-container .select2-choice .select2-arrow b { - background-image: url('select2x2.png') !important; - background-repeat: no-repeat !important; - background-size: 60px 40px !important; - } - - .select2-search input { - background-position: 100% -21px !important; - } -} +.select2-container--classic.select2-container--open .select2-dropdown { + border-color: #5897fb; } diff --git a/ishtar_common/static/select2/css/select2.min.css b/ishtar_common/static/select2/css/select2.min.css new file mode 100644 index 000000000..76de04d92 --- /dev/null +++ b/ishtar_common/static/select2/css/select2.min.css @@ -0,0 +1 @@ +.select2-container{box-sizing:border-box;display:inline-block;margin:0;position:relative;vertical-align:middle}.select2-container .select2-selection--single{box-sizing:border-box;cursor:pointer;display:block;height:28px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--single .select2-selection__rendered{display:block;padding-left:8px;padding-right:20px;overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-selection--single .select2-selection__clear{position:relative}.select2-container[dir="rtl"] .select2-selection--single .select2-selection__rendered{padding-right:8px;padding-left:20px}.select2-container .select2-selection--multiple{box-sizing:border-box;cursor:pointer;display:block;min-height:32px;user-select:none;-webkit-user-select:none}.select2-container .select2-selection--multiple .select2-selection__rendered{display:inline-block;overflow:hidden;padding-left:8px;text-overflow:ellipsis;white-space:nowrap}.select2-container .select2-search--inline{float:left}.select2-container .select2-search--inline .select2-search__field{box-sizing:border-box;border:none;font-size:100%;margin-top:5px;padding:0}.select2-container .select2-search--inline .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-dropdown{background-color:white;border:1px solid #aaa;border-radius:4px;box-sizing:border-box;display:block;position:absolute;left:-100000px;width:100%;z-index:1051}.select2-results{display:block}.select2-results__options{list-style:none;margin:0;padding:0}.select2-results__option{padding:6px;user-select:none;-webkit-user-select:none}.select2-results__option[aria-selected]{cursor:pointer}.select2-container--open .select2-dropdown{left:0}.select2-container--open .select2-dropdown--above{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--open .select2-dropdown--below{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-search--dropdown{display:block;padding:4px}.select2-search--dropdown .select2-search__field{padding:4px;width:100%;box-sizing:border-box}.select2-search--dropdown .select2-search__field::-webkit-search-cancel-button{-webkit-appearance:none}.select2-search--dropdown.select2-search--hide{display:none}.select2-close-mask{border:0;margin:0;padding:0;display:block;position:fixed;left:0;top:0;min-height:100%;min-width:100%;height:auto;width:auto;opacity:0;z-index:99;background-color:#fff;filter:alpha(opacity=0)}.select2-hidden-accessible{border:0 !important;clip:rect(0 0 0 0) !important;height:1px !important;margin:-1px !important;overflow:hidden !important;padding:0 !important;position:absolute !important;width:1px !important}.select2-container--default .select2-selection--single{background-color:#fff;border:1px solid #aaa;border-radius:4px}.select2-container--default .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--default .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold}.select2-container--default .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--default .select2-selection--single .select2-selection__arrow{height:26px;position:absolute;top:1px;right:1px;width:20px}.select2-container--default .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--default[dir="rtl"] .select2-selection--single .select2-selection__arrow{left:1px;right:auto}.select2-container--default.select2-container--disabled .select2-selection--single{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection--single .select2-selection__clear{display:none}.select2-container--default.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--default .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text}.select2-container--default .select2-selection--multiple .select2-selection__rendered{box-sizing:border-box;list-style:none;margin:0;padding:0 5px;width:100%}.select2-container--default .select2-selection--multiple .select2-selection__rendered li{list-style:none}.select2-container--default .select2-selection--multiple .select2-selection__placeholder{color:#999;margin-top:5px;float:left}.select2-container--default .select2-selection--multiple .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-top:5px;margin-right:10px}.select2-container--default .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove{color:#999;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--default .select2-selection--multiple .select2-selection__choice__remove:hover{color:#333}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__placeholder,.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-search--inline{float:right}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--default[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--default.select2-container--focus .select2-selection--multiple{border:solid black 1px;outline:0}.select2-container--default.select2-container--disabled .select2-selection--multiple{background-color:#eee;cursor:default}.select2-container--default.select2-container--disabled .select2-selection__choice__remove{display:none}.select2-container--default.select2-container--open.select2-container--above .select2-selection--single,.select2-container--default.select2-container--open.select2-container--above .select2-selection--multiple{border-top-left-radius:0;border-top-right-radius:0}.select2-container--default.select2-container--open.select2-container--below .select2-selection--single,.select2-container--default.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--default .select2-search--dropdown .select2-search__field{border:1px solid #aaa}.select2-container--default .select2-search--inline .select2-search__field{background:transparent;border:none;outline:0;box-shadow:none;-webkit-appearance:textfield}.select2-container--default .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--default .select2-results__option[role=group]{padding:0}.select2-container--default .select2-results__option[aria-disabled=true]{color:#999}.select2-container--default .select2-results__option[aria-selected=true]{background-color:#ddd}.select2-container--default .select2-results__option .select2-results__option{padding-left:1em}.select2-container--default .select2-results__option .select2-results__option .select2-results__group{padding-left:0}.select2-container--default .select2-results__option .select2-results__option .select2-results__option{margin-left:-1em;padding-left:2em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-2em;padding-left:3em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-3em;padding-left:4em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-4em;padding-left:5em}.select2-container--default .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option .select2-results__option{margin-left:-5em;padding-left:6em}.select2-container--default .select2-results__option--highlighted[aria-selected]{background-color:#5897fb;color:white}.select2-container--default .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic .select2-selection--single{background-color:#f7f7f7;border:1px solid #aaa;border-radius:4px;outline:0;background-image:-webkit-linear-gradient(top, #fff 50%, #eee 100%);background-image:-o-linear-gradient(top, #fff 50%, #eee 100%);background-image:linear-gradient(to bottom, #fff 50%, #eee 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic .select2-selection--single:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--single .select2-selection__rendered{color:#444;line-height:28px}.select2-container--classic .select2-selection--single .select2-selection__clear{cursor:pointer;float:right;font-weight:bold;margin-right:10px}.select2-container--classic .select2-selection--single .select2-selection__placeholder{color:#999}.select2-container--classic .select2-selection--single .select2-selection__arrow{background-color:#ddd;border:none;border-left:1px solid #aaa;border-top-right-radius:4px;border-bottom-right-radius:4px;height:26px;position:absolute;top:1px;right:1px;width:20px;background-image:-webkit-linear-gradient(top, #eee 50%, #ccc 100%);background-image:-o-linear-gradient(top, #eee 50%, #ccc 100%);background-image:linear-gradient(to bottom, #eee 50%, #ccc 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFCCCCCC', GradientType=0)}.select2-container--classic .select2-selection--single .select2-selection__arrow b{border-color:#888 transparent transparent transparent;border-style:solid;border-width:5px 4px 0 4px;height:0;left:50%;margin-left:-4px;margin-top:-2px;position:absolute;top:50%;width:0}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__clear{float:left}.select2-container--classic[dir="rtl"] .select2-selection--single .select2-selection__arrow{border:none;border-right:1px solid #aaa;border-radius:0;border-top-left-radius:4px;border-bottom-left-radius:4px;left:1px;right:auto}.select2-container--classic.select2-container--open .select2-selection--single{border:1px solid #5897fb}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow{background:transparent;border:none}.select2-container--classic.select2-container--open .select2-selection--single .select2-selection__arrow b{border-color:transparent transparent #888 transparent;border-width:0 4px 5px 4px}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--single{border-top:none;border-top-left-radius:0;border-top-right-radius:0;background-image:-webkit-linear-gradient(top, #fff 0%, #eee 50%);background-image:-o-linear-gradient(top, #fff 0%, #eee 50%);background-image:linear-gradient(to bottom, #fff 0%, #eee 50%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFFFFFFF', endColorstr='#FFEEEEEE', GradientType=0)}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--single{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0;background-image:-webkit-linear-gradient(top, #eee 50%, #fff 100%);background-image:-o-linear-gradient(top, #eee 50%, #fff 100%);background-image:linear-gradient(to bottom, #eee 50%, #fff 100%);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#FFEEEEEE', endColorstr='#FFFFFFFF', GradientType=0)}.select2-container--classic .select2-selection--multiple{background-color:white;border:1px solid #aaa;border-radius:4px;cursor:text;outline:0}.select2-container--classic .select2-selection--multiple:focus{border:1px solid #5897fb}.select2-container--classic .select2-selection--multiple .select2-selection__rendered{list-style:none;margin:0;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__clear{display:none}.select2-container--classic .select2-selection--multiple .select2-selection__choice{background-color:#e4e4e4;border:1px solid #aaa;border-radius:4px;cursor:default;float:left;margin-right:5px;margin-top:5px;padding:0 5px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove{color:#888;cursor:pointer;display:inline-block;font-weight:bold;margin-right:2px}.select2-container--classic .select2-selection--multiple .select2-selection__choice__remove:hover{color:#555}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{float:right}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice{margin-left:5px;margin-right:auto}.select2-container--classic[dir="rtl"] .select2-selection--multiple .select2-selection__choice__remove{margin-left:2px;margin-right:auto}.select2-container--classic.select2-container--open .select2-selection--multiple{border:1px solid #5897fb}.select2-container--classic.select2-container--open.select2-container--above .select2-selection--multiple{border-top:none;border-top-left-radius:0;border-top-right-radius:0}.select2-container--classic.select2-container--open.select2-container--below .select2-selection--multiple{border-bottom:none;border-bottom-left-radius:0;border-bottom-right-radius:0}.select2-container--classic .select2-search--dropdown .select2-search__field{border:1px solid #aaa;outline:0}.select2-container--classic .select2-search--inline .select2-search__field{outline:0;box-shadow:none}.select2-container--classic .select2-dropdown{background-color:#fff;border:1px solid transparent}.select2-container--classic .select2-dropdown--above{border-bottom:none}.select2-container--classic .select2-dropdown--below{border-top:none}.select2-container--classic .select2-results>.select2-results__options{max-height:200px;overflow-y:auto}.select2-container--classic .select2-results__option[role=group]{padding:0}.select2-container--classic .select2-results__option[aria-disabled=true]{color:grey}.select2-container--classic .select2-results__option--highlighted[aria-selected]{background-color:#3875d7;color:#fff}.select2-container--classic .select2-results__group{cursor:default;display:block;padding:6px}.select2-container--classic.select2-container--open .select2-dropdown{border-color:#5897fb} diff --git a/ishtar_common/static/select2/css/select2.png b/ishtar_common/static/select2/css/select2.png Binary files differdeleted file mode 100644 index 1d804ffb9..000000000 --- a/ishtar_common/static/select2/css/select2.png +++ /dev/null diff --git a/ishtar_common/static/select2/css/select2x2.png b/ishtar_common/static/select2/css/select2x2.png Binary files differdeleted file mode 100644 index 4bdd5c961..000000000 --- a/ishtar_common/static/select2/css/select2x2.png +++ /dev/null diff --git a/ishtar_common/static/select2/js/i18n/ar.js b/ishtar_common/static/select2/js/i18n/ar.js new file mode 100644 index 000000000..01a688294 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/ar.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/ar",[],function(){return{errorLoading:function(){return"لا يمكن تحميل النتائج"},inputTooLong:function(e){var t=e.input.length-e.maximum,n="الرجاء حذف "+t+" عناصر";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="الرجاء إضافة "+t+" عناصر";return n},loadingMore:function(){return"جاري تحميل نتائج إضافية..."},maximumSelected:function(e){var t="تستطيع إختيار "+e.maximum+" بنود فقط";return t},noResults:function(){return"لم يتم العثور على أي نتائج"},searching:function(){return"جاري البحث…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/az.js b/ishtar_common/static/select2/js/i18n/az.js new file mode 100644 index 000000000..2accb973f --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/az.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/az",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum;return t+" simvol silin"},inputTooShort:function(e){var t=e.minimum-e.input.length;return t+" simvol daxil edin"},loadingMore:function(){return"Daha çox nəticə yüklənir…"},maximumSelected:function(e){return"Sadəcə "+e.maximum+" element seçə bilərsiniz"},noResults:function(){return"Nəticə tapılmadı"},searching:function(){return"Axtarılır…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/bg.js b/ishtar_common/static/select2/js/i18n/bg.js new file mode 100644 index 000000000..35ae98944 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/bg.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/bg",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="Моля въведете с "+t+" по-малко символ";return t>1&&(n+="a"),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Моля въведете още "+t+" символ";return t>1&&(n+="a"),n},loadingMore:function(){return"Зареждат се още…"},maximumSelected:function(e){var t="Можете да направите до "+e.maximum+" ";return e.maximum>1?t+="избора":t+="избор",t},noResults:function(){return"Няма намерени съвпадения"},searching:function(){return"Търсене…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/ca.js b/ishtar_common/static/select2/js/i18n/ca.js new file mode 100644 index 000000000..fdb5f3d2a --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/ca.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/ca",[],function(){return{errorLoading:function(){return"La càrrega ha fallat"},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Si us plau, elimina "+t+" car";return t==1?n+="àcter":n+="àcters",n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Si us plau, introdueix "+t+" car";return t==1?n+="àcter":n+="àcters",n},loadingMore:function(){return"Carregant més resultats…"},maximumSelected:function(e){var t="Només es pot seleccionar "+e.maximum+" element";return e.maximum!=1&&(t+="s"),t},noResults:function(){return"No s'han trobat resultats"},searching:function(){return"Cercant…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/cs.js b/ishtar_common/static/select2/js/i18n/cs.js new file mode 100644 index 000000000..9651378a6 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/cs.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/cs",[],function(){function e(e,t){switch(e){case 2:return t?"dva":"dvě";case 3:return"tři";case 4:return"čtyři"}return""}return{errorLoading:function(){return"Výsledky nemohly být načteny."},inputTooLong:function(t){var n=t.input.length-t.maximum;return n==1?"Prosím zadejte o jeden znak méně":n<=4?"Prosím zadejte o "+e(n,!0)+" znaky méně":"Prosím zadejte o "+n+" znaků méně"},inputTooShort:function(t){var n=t.minimum-t.input.length;return n==1?"Prosím zadejte ještě jeden znak":n<=4?"Prosím zadejte ještě další "+e(n,!0)+" znaky":"Prosím zadejte ještě dalších "+n+" znaků"},loadingMore:function(){return"Načítají se další výsledky…"},maximumSelected:function(t){var n=t.maximum;return n==1?"Můžete zvolit jen jednu položku":n<=4?"Můžete zvolit maximálně "+e(n,!1)+" položky":"Můžete zvolit maximálně "+n+" položek"},noResults:function(){return"Nenalezeny žádné položky"},searching:function(){return"Vyhledávání…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/da.js b/ishtar_common/static/select2/js/i18n/da.js new file mode 100644 index 000000000..501c51e93 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/da.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/da",[],function(){return{errorLoading:function(){return"Resultaterne kunne ikke indlæses."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Angiv venligst "+t+" tegn mindre";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Angiv venligst "+t+" tegn mere";return n},loadingMore:function(){return"Indlæser flere resultater…"},maximumSelected:function(e){var t="Du kan kun vælge "+e.maximum+" emne";return e.maximum!=1&&(t+="r"),t},noResults:function(){return"Ingen resultater fundet"},searching:function(){return"Søger…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/de.js b/ishtar_common/static/select2/js/i18n/de.js new file mode 100644 index 000000000..9a6d55366 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/de.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/de",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum;return"Bitte "+t+" Zeichen weniger eingeben"},inputTooShort:function(e){var t=e.minimum-e.input.length;return"Bitte "+t+" Zeichen mehr eingeben"},loadingMore:function(){return"Lade mehr Ergebnisse…"},maximumSelected:function(e){var t="Sie können nur "+e.maximum+" Eintr";return e.maximum===1?t+="ag":t+="äge",t+=" auswählen",t},noResults:function(){return"Keine Übereinstimmungen gefunden"},searching:function(){return"Suche…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/el.js b/ishtar_common/static/select2/js/i18n/el.js new file mode 100644 index 000000000..4735d1405 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/el.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/el",[],function(){return{errorLoading:function(){return"Τα αποτελέσματα δεν μπόρεσαν να φορτώσουν."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Παρακαλώ διαγράψτε "+t+" χαρακτήρ";return t==1&&(n+="α"),t!=1&&(n+="ες"),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Παρακαλώ συμπληρώστε "+t+" ή περισσότερους χαρακτήρες";return n},loadingMore:function(){return"Φόρτωση περισσότερων αποτελεσμάτων…"},maximumSelected:function(e){var t="Μπορείτε να επιλέξετε μόνο "+e.maximum+" επιλογ";return e.maximum==1&&(t+="ή"),e.maximum!=1&&(t+="ές"),t},noResults:function(){return"Δεν βρέθηκαν αποτελέσματα"},searching:function(){return"Αναζήτηση…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/en.js b/ishtar_common/static/select2/js/i18n/en.js new file mode 100644 index 000000000..8e80ede8d --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/en.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/en",[],function(){return{errorLoading:function(){return"The results could not be loaded."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Please delete "+t+" character";return t!=1&&(n+="s"),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Please enter "+t+" or more characters";return n},loadingMore:function(){return"Loading more results…"},maximumSelected:function(e){var t="You can only select "+e.maximum+" item";return e.maximum!=1&&(t+="s"),t},noResults:function(){return"No results found"},searching:function(){return"Searching…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/es.js b/ishtar_common/static/select2/js/i18n/es.js new file mode 100644 index 000000000..0a096502d --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/es.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/es",[],function(){return{errorLoading:function(){return"La carga falló"},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Por favor, elimine "+t+" car";return t==1?n+="ácter":n+="acteres",n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Por favor, introduzca "+t+" car";return t==1?n+="ácter":n+="acteres",n},loadingMore:function(){return"Cargando más resultados…"},maximumSelected:function(e){var t="Sólo puede seleccionar "+e.maximum+" elemento";return e.maximum!=1&&(t+="s"),t},noResults:function(){return"No se encontraron resultados"},searching:function(){return"Buscando…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/et.js b/ishtar_common/static/select2/js/i18n/et.js new file mode 100644 index 000000000..c70f4a5b3 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/et.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/et",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="Sisesta "+t+" täht";return t!=1&&(n+="e"),n+=" vähem",n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Sisesta "+t+" täht";return t!=1&&(n+="e"),n+=" rohkem",n},loadingMore:function(){return"Laen tulemusi…"},maximumSelected:function(e){var t="Saad vaid "+e.maximum+" tulemus";return e.maximum==1?t+="e":t+="t",t+=" valida",t},noResults:function(){return"Tulemused puuduvad"},searching:function(){return"Otsin…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/eu.js b/ishtar_common/static/select2/js/i18n/eu.js new file mode 100644 index 000000000..9336053a7 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/eu.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/eu",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="Idatzi ";return t==1?n+="karaktere bat":n+=t+" karaktere",n+=" gutxiago",n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Idatzi ";return t==1?n+="karaktere bat":n+=t+" karaktere",n+=" gehiago",n},loadingMore:function(){return"Emaitza gehiago kargatzen…"},maximumSelected:function(e){return e.maximum===1?"Elementu bakarra hauta dezakezu":e.maximum+" elementu hauta ditzakezu soilik"},noResults:function(){return"Ez da bat datorrenik aurkitu"},searching:function(){return"Bilatzen…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/fa.js b/ishtar_common/static/select2/js/i18n/fa.js new file mode 100644 index 000000000..5118cd28f --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/fa.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/fa",[],function(){return{errorLoading:function(){return"امکان بارگذاری نتایج وجود ندارد."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="لطفاً "+t+" کاراکتر را حذف نمایید";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="لطفاً تعداد "+t+" کاراکتر یا بیشتر وارد نمایید";return n},loadingMore:function(){return"در حال بارگذاری نتایج بیشتر..."},maximumSelected:function(e){var t="شما تنها میتوانید "+e.maximum+" آیتم را انتخاب نمایید";return t},noResults:function(){return"هیچ نتیجهای یافت نشد"},searching:function(){return"در حال جستجو..."}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/fi.js b/ishtar_common/static/select2/js/i18n/fi.js new file mode 100644 index 000000000..9e60f26a0 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/fi.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/fi",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum;return"Ole hyvä ja anna "+t+" merkkiä vähemmän"},inputTooShort:function(e){var t=e.minimum-e.input.length;return"Ole hyvä ja anna "+t+" merkkiä lisää"},loadingMore:function(){return"Ladataan lisää tuloksia…"},maximumSelected:function(e){return"Voit valita ainoastaan "+e.maximum+" kpl"},noResults:function(){return"Ei tuloksia"},searching:function(){}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/fr.js b/ishtar_common/static/select2/js/i18n/fr.js new file mode 100644 index 000000000..e4a665009 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/fr.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/fr",[],function(){return{errorLoading:function(){return"Les résultats ne peuvent pas être chargés."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Supprimez "+t+" caractère";return t!==1&&(n+="s"),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Saisissez "+t+" caractère";return t!==1&&(n+="s"),n},loadingMore:function(){return"Chargement de résultats supplémentaires…"},maximumSelected:function(e){var t="Vous pouvez seulement sélectionner "+e.maximum+" élément";return e.maximum!==1&&(t+="s"),t},noResults:function(){return"Aucun résultat trouvé"},searching:function(){return"Recherche en cours…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/gl.js b/ishtar_common/static/select2/js/i18n/gl.js new file mode 100644 index 000000000..02f258f92 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/gl.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/gl",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="Elimine ";return t===1?n+="un carácter":n+=t+" caracteres",n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Engada ";return t===1?n+="un carácter":n+=t+" caracteres",n},loadingMore:function(){return"Cargando máis resultados…"},maximumSelected:function(e){var t="Só pode ";return e.maximum===1?t+="un elemento":t+=e.maximum+" elementos",t},noResults:function(){return"Non se atoparon resultados"},searching:function(){return"Buscando…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/he.js b/ishtar_common/static/select2/js/i18n/he.js new file mode 100644 index 000000000..881f8d389 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/he.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/he",[],function(){return{errorLoading:function(){return"שגיאה בטעינת התוצאות"},inputTooLong:function(e){var t=e.input.length-e.maximum,n="נא למחוק ";return t===1?n+="תו אחד":n+=t+" תווים",n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="נא להכניס ";return t===1?n+="תו אחד":n+=t+" תווים",n+=" או יותר",n},loadingMore:function(){return"טוען תוצאות נוספות…"},maximumSelected:function(e){var t="באפשרותך לבחור עד ";return e.maximum===1?t+="פריט אחד":t+=e.maximum+" פריטים",t},noResults:function(){return"לא נמצאו תוצאות"},searching:function(){return"מחפש…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/hi.js b/ishtar_common/static/select2/js/i18n/hi.js new file mode 100644 index 000000000..e82968426 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/hi.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/hi",[],function(){return{errorLoading:function(){return"परिणामों को लोड नहीं किया जा सका।"},inputTooLong:function(e){var t=e.input.length-e.maximum,n=t+" अक्षर को हटा दें";return t>1&&(n=t+" अक्षरों को हटा दें "),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="कृपया "+t+" या अधिक अक्षर दर्ज करें";return n},loadingMore:function(){return"अधिक परिणाम लोड हो रहे है..."},maximumSelected:function(e){var t="आप केवल "+e.maximum+" आइटम का चयन कर सकते हैं";return t},noResults:function(){return"कोई परिणाम नहीं मिला"},searching:function(){return"खोज रहा है..."}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/hr.js b/ishtar_common/static/select2/js/i18n/hr.js new file mode 100644 index 000000000..89f7b12bf --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/hr.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/hr",[],function(){function e(e){var t=" "+e+" znak";return e%10<5&&e%10>0&&(e%100<5||e%100>19)?e%10>1&&(t+="a"):t+="ova",t}return{errorLoading:function(){return"Preuzimanje nije uspjelo."},inputTooLong:function(t){var n=t.input.length-t.maximum;return"Unesite "+e(n)},inputTooShort:function(t){var n=t.minimum-t.input.length;return"Unesite još "+e(n)},loadingMore:function(){return"Učitavanje rezultata…"},maximumSelected:function(e){return"Maksimalan broj odabranih stavki je "+e.maximum},noResults:function(){return"Nema rezultata"},searching:function(){return"Pretraga…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/hu.js b/ishtar_common/static/select2/js/i18n/hu.js new file mode 100644 index 000000000..74c8a90de --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/hu.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/hu",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum;return"Túl hosszú. "+t+" karakterrel több, mint kellene."},inputTooShort:function(e){var t=e.minimum-e.input.length;return"Túl rövid. Még "+t+" karakter hiányzik."},loadingMore:function(){return"Töltés…"},maximumSelected:function(e){return"Csak "+e.maximum+" elemet lehet kiválasztani."},noResults:function(){return"Nincs találat."},searching:function(){return"Keresés…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/id.js b/ishtar_common/static/select2/js/i18n/id.js new file mode 100644 index 000000000..958678261 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/id.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/id",[],function(){return{errorLoading:function(){return"Data tidak boleh diambil."},inputTooLong:function(e){var t=e.input.length-e.maximum;return"Hapuskan "+t+" huruf"},inputTooShort:function(e){var t=e.minimum-e.input.length;return"Masukkan "+t+" huruf lagi"},loadingMore:function(){return"Mengambil data…"},maximumSelected:function(e){return"Anda hanya dapat memilih "+e.maximum+" pilihan"},noResults:function(){return"Tidak ada data yang sesuai"},searching:function(){return"Mencari…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/is.js b/ishtar_common/static/select2/js/i18n/is.js new file mode 100644 index 000000000..ab97a14d1 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/is.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/is",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="Vinsamlegast styttið texta um "+t+" staf";return t<=1?n:n+"i"},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Vinsamlegast skrifið "+t+" staf";return t>1&&(n+="i"),n+=" í viðbót",n},loadingMore:function(){return"Sæki fleiri niðurstöður…"},maximumSelected:function(e){return"Þú getur aðeins valið "+e.maximum+" atriði"},noResults:function(){return"Ekkert fannst"},searching:function(){return"Leita…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/it.js b/ishtar_common/static/select2/js/i18n/it.js new file mode 100644 index 000000000..7796b9f76 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/it.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/it",[],function(){return{errorLoading:function(){return"I risultati non possono essere caricati."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Per favore cancella "+t+" caratter";return t!==1?n+="i":n+="e",n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Per favore inserisci "+t+" o più caratteri";return n},loadingMore:function(){return"Caricando più risultati…"},maximumSelected:function(e){var t="Puoi selezionare solo "+e.maximum+" element";return e.maximum!==1?t+="i":t+="o",t},noResults:function(){return"Nessun risultato trovato"},searching:function(){return"Sto cercando…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/ja.js b/ishtar_common/static/select2/js/i18n/ja.js new file mode 100644 index 000000000..9f4fff6cb --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/ja.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/ja",[],function(){return{errorLoading:function(){return"結果が読み込まれませんでした"},inputTooLong:function(e){var t=e.input.length-e.maximum,n=t+" 文字を削除してください";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="少なくとも "+t+" 文字を入力してください";return n},loadingMore:function(){return"読み込み中…"},maximumSelected:function(e){var t=e.maximum+" 件しか選択できません";return t},noResults:function(){return"対象が見つかりません"},searching:function(){return"検索しています…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/km.js b/ishtar_common/static/select2/js/i18n/km.js new file mode 100644 index 000000000..8e94adcf3 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/km.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/km",[],function(){return{errorLoading:function(){return"មិនអាចទាញយកទិន្នន័យ"},inputTooLong:function(e){var t=e.input.length-e.maximum,n="សូមលុបចេញ "+t+" អក្សរ";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="សូមបញ្ចូល"+t+" អក្សរ រឺ ច្រើនជាងនេះ";return n},loadingMore:function(){return"កំពុងទាញយកទិន្នន័យបន្ថែម..."},maximumSelected:function(e){var t="អ្នកអាចជ្រើសរើសបានតែ "+e.maximum+" ជម្រើសប៉ុណ្ណោះ";return t},noResults:function(){return"មិនមានលទ្ធផល"},searching:function(){return"កំពុងស្វែងរក..."}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/ko.js b/ishtar_common/static/select2/js/i18n/ko.js new file mode 100644 index 000000000..4ed03215f --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/ko.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/ko",[],function(){return{errorLoading:function(){return"결과를 불러올 수 없습니다."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="너무 깁니다. "+t+" 글자 지워주세요.";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="너무 짧습니다. "+t+" 글자 더 입력해주세요.";return n},loadingMore:function(){return"불러오는 중…"},maximumSelected:function(e){var t="최대 "+e.maximum+"개까지만 선택 가능합니다.";return t},noResults:function(){return"결과가 없습니다."},searching:function(){return"검색 중…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/lt.js b/ishtar_common/static/select2/js/i18n/lt.js new file mode 100644 index 000000000..05f3a6e5e --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/lt.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/lt",[],function(){function e(e,t,n,r){return e%10===1&&(e%100<11||e%100>19)?t:e%10>=2&&e%10<=9&&(e%100<11||e%100>19)?n:r}return{inputTooLong:function(t){var n=t.input.length-t.maximum,r="Pašalinkite "+n+" simbol";return r+=e(n,"į","ius","ių"),r},inputTooShort:function(t){var n=t.minimum-t.input.length,r="Įrašykite dar "+n+" simbol";return r+=e(n,"į","ius","ių"),r},loadingMore:function(){return"Kraunama daugiau rezultatų…"},maximumSelected:function(t){var n="Jūs galite pasirinkti tik "+t.maximum+" element";return n+=e(t.maximum,"ą","us","ų"),n},noResults:function(){return"Atitikmenų nerasta"},searching:function(){return"Ieškoma…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/lv.js b/ishtar_common/static/select2/js/i18n/lv.js new file mode 100644 index 000000000..df8ee9423 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/lv.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/lv",[],function(){function e(e,t,n,r){return e===11?t:e%10===1?n:r}return{inputTooLong:function(t){var n=t.input.length-t.maximum,r="Lūdzu ievadiet par "+n;return r+=" simbol"+e(n,"iem","u","iem"),r+" mazāk"},inputTooShort:function(t){var n=t.minimum-t.input.length,r="Lūdzu ievadiet vēl "+n;return r+=" simbol"+e(n,"us","u","us"),r},loadingMore:function(){return"Datu ielāde…"},maximumSelected:function(t){var n="Jūs varat izvēlēties ne vairāk kā "+t.maximum;return n+=" element"+e(t.maximum,"us","u","us"),n},noResults:function(){return"Sakritību nav"},searching:function(){return"Meklēšana…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/mk.js b/ishtar_common/static/select2/js/i18n/mk.js new file mode 100644 index 000000000..319ecca14 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/mk.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/mk",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="Ве молиме внесете "+e.maximum+" помалку карактер";return e.maximum!==1&&(n+="и"),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Ве молиме внесете уште "+e.maximum+" карактер";return e.maximum!==1&&(n+="и"),n},loadingMore:function(){return"Вчитување резултати…"},maximumSelected:function(e){var t="Можете да изберете само "+e.maximum+" ставк";return e.maximum===1?t+="а":t+="и",t},noResults:function(){return"Нема пронајдено совпаѓања"},searching:function(){return"Пребарување…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/ms.js b/ishtar_common/static/select2/js/i18n/ms.js new file mode 100644 index 000000000..4258f125b --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/ms.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/ms",[],function(){return{errorLoading:function(){return"Keputusan tidak berjaya dimuatkan."},inputTooLong:function(e){var t=e.input.length-e.maximum;return"Sila hapuskan "+t+" aksara"},inputTooShort:function(e){var t=e.minimum-e.input.length;return"Sila masukkan "+t+" atau lebih aksara"},loadingMore:function(){return"Sedang memuatkan keputusan…"},maximumSelected:function(e){return"Anda hanya boleh memilih "+e.maximum+" pilihan"},noResults:function(){return"Tiada padanan yang ditemui"},searching:function(){return"Mencari…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/nb.js b/ishtar_common/static/select2/js/i18n/nb.js new file mode 100644 index 000000000..6770087ce --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/nb.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/nb",[],function(){return{errorLoading:function(){return"Kunne ikke hente resultater."},inputTooLong:function(e){var t=e.input.length-e.maximum;return"Vennligst fjern "+t+" tegn"},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Vennligst skriv inn ";return t>1?n+=" flere tegn":n+=" tegn til",n},loadingMore:function(){return"Laster flere resultater…"},maximumSelected:function(e){return"Du kan velge maks "+e.maximum+" elementer"},noResults:function(){return"Ingen treff"},searching:function(){return"Søker…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/nl.js b/ishtar_common/static/select2/js/i18n/nl.js new file mode 100644 index 000000000..8bd5e3cf4 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/nl.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/nl",[],function(){return{errorLoading:function(){return"De resultaten konden niet worden geladen."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Gelieve "+t+" karakters te verwijderen";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Gelieve "+t+" of meer karakters in te voeren";return n},loadingMore:function(){return"Meer resultaten laden…"},maximumSelected:function(e){var t=e.maximum==1?"kan":"kunnen",n="Er "+t+" maar "+e.maximum+" item";return e.maximum!=1&&(n+="s"),n+=" worden geselecteerd",n},noResults:function(){return"Geen resultaten gevonden…"},searching:function(){return"Zoeken…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/pl.js b/ishtar_common/static/select2/js/i18n/pl.js new file mode 100644 index 000000000..54ba28e9b --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/pl.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/pl",[],function(){var e=["znak","znaki","znaków"],t=["element","elementy","elementów"],n=function(t,n){if(t===1)return n[0];if(t>1&&t<=4)return n[1];if(t>=5)return n[2]};return{errorLoading:function(){return"Nie można załadować wyników."},inputTooLong:function(t){var r=t.input.length-t.maximum;return"Usuń "+r+" "+n(r,e)},inputTooShort:function(t){var r=t.minimum-t.input.length;return"Podaj przynajmniej "+r+" "+n(r,e)},loadingMore:function(){return"Trwa ładowanie…"},maximumSelected:function(e){return"Możesz zaznaczyć tylko "+e.maximum+" "+n(e.maximum,t)},noResults:function(){return"Brak wyników"},searching:function(){return"Trwa wyszukiwanie…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/pt-BR.js b/ishtar_common/static/select2/js/i18n/pt-BR.js new file mode 100644 index 000000000..a6629c8ae --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/pt-BR.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/pt-BR",[],function(){return{errorLoading:function(){return"Os resultados não puderam ser carregados."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Apague "+t+" caracter";return t!=1&&(n+="es"),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Digite "+t+" ou mais caracteres";return n},loadingMore:function(){return"Carregando mais resultados…"},maximumSelected:function(e){var t="Você só pode selecionar "+e.maximum+" ite";return e.maximum==1?t+="m":t+="ns",t},noResults:function(){return"Nenhum resultado encontrado"},searching:function(){return"Buscando…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/pt.js b/ishtar_common/static/select2/js/i18n/pt.js new file mode 100644 index 000000000..0cbda561b --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/pt.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/pt",[],function(){return{errorLoading:function(){return"Os resultados não puderam ser carregados."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Por favor apague "+t+" ";return n+=t!=1?"caracteres":"carácter",n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Introduza "+t+" ou mais caracteres";return n},loadingMore:function(){return"A carregar mais resultados…"},maximumSelected:function(e){var t="Apenas pode seleccionar "+e.maximum+" ";return t+=e.maximum!=1?"itens":"item",t},noResults:function(){return"Sem resultados"},searching:function(){return"A procurar…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/ro.js b/ishtar_common/static/select2/js/i18n/ro.js new file mode 100644 index 000000000..788a26376 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/ro.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/ro",[],function(){return{errorLoading:function(){return"Rezultatele nu au putut fi incărcate."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Vă rugăm să ștergeți"+t+" caracter";return t!==1&&(n+="e"),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Vă rugăm să introduceți "+t+"sau mai multe caractere";return n},loadingMore:function(){return"Se încarcă mai multe rezultate…"},maximumSelected:function(e){var t="Aveți voie să selectați cel mult "+e.maximum;return t+=" element",e.maximum!==1&&(t+="e"),t},noResults:function(){return"Nu au fost găsite rezultate"},searching:function(){return"Căutare…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/ru.js b/ishtar_common/static/select2/js/i18n/ru.js new file mode 100644 index 000000000..9ecab8091 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/ru.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/ru",[],function(){function e(e,t,n,r){return e%10<5&&e%10>0&&e%100<5||e%100>20?e%10>1?n:t:r}return{errorLoading:function(){return"Невозможно загрузить результаты"},inputTooLong:function(t){var n=t.input.length-t.maximum,r="Пожалуйста, введите на "+n+" символ";return r+=e(n,"","a","ов"),r+=" меньше",r},inputTooShort:function(t){var n=t.minimum-t.input.length,r="Пожалуйста, введите еще хотя бы "+n+" символ";return r+=e(n,"","a","ов"),r},loadingMore:function(){return"Загрузка данных…"},maximumSelected:function(t){var n="Вы можете выбрать не более "+t.maximum+" элемент";return n+=e(t.maximum,"","a","ов"),n},noResults:function(){return"Совпадений не найдено"},searching:function(){return"Поиск…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/sk.js b/ishtar_common/static/select2/js/i18n/sk.js new file mode 100644 index 000000000..82f294138 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/sk.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/sk",[],function(){var e={2:function(e){return e?"dva":"dve"},3:function(){return"tri"},4:function(){return"štyri"}};return{inputTooLong:function(t){var n=t.input.length-t.maximum;return n==1?"Prosím, zadajte o jeden znak menej":n>=2&&n<=4?"Prosím, zadajte o "+e[n](!0)+" znaky menej":"Prosím, zadajte o "+n+" znakov menej"},inputTooShort:function(t){var n=t.minimum-t.input.length;return n==1?"Prosím, zadajte ešte jeden znak":n<=4?"Prosím, zadajte ešte ďalšie "+e[n](!0)+" znaky":"Prosím, zadajte ešte ďalších "+n+" znakov"},loadingMore:function(){return"Loading more results…"},maximumSelected:function(t){return t.maximum==1?"Môžete zvoliť len jednu položku":t.maximum>=2&&t.maximum<=4?"Môžete zvoliť najviac "+e[t.maximum](!1)+" položky":"Môžete zvoliť najviac "+t.maximum+" položiek"},noResults:function(){return"Nenašli sa žiadne položky"},searching:function(){return"Vyhľadávanie…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/sr-Cyrl.js b/ishtar_common/static/select2/js/i18n/sr-Cyrl.js new file mode 100644 index 000000000..e9453940c --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/sr-Cyrl.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/sr-Cyrl",[],function(){function e(e,t,n,r){return e%10==1&&e%100!=11?t:e%10>=2&&e%10<=4&&(e%100<12||e%100>14)?n:r}return{errorLoading:function(){return"Преузимање није успело."},inputTooLong:function(t){var n=t.input.length-t.maximum,r="Обришите "+n+" симбол";return r+=e(n,"","а","а"),r},inputTooShort:function(t){var n=t.minimum-t.input.length,r="Укуцајте бар још "+n+" симбол";return r+=e(n,"","а","а"),r},loadingMore:function(){return"Преузимање још резултата…"},maximumSelected:function(t){var n="Можете изабрати само "+t.maximum+" ставк";return n+=e(t.maximum,"у","е","и"),n},noResults:function(){return"Ништа није пронађено"},searching:function(){return"Претрага…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/sr.js b/ishtar_common/static/select2/js/i18n/sr.js new file mode 100644 index 000000000..ac0cc721f --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/sr.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/sr",[],function(){function e(e,t,n,r){return e%10==1&&e%100!=11?t:e%10>=2&&e%10<=4&&(e%100<12||e%100>14)?n:r}return{errorLoading:function(){return"Preuzimanje nije uspelo."},inputTooLong:function(t){var n=t.input.length-t.maximum,r="Obrišite "+n+" simbol";return r+=e(n,"","a","a"),r},inputTooShort:function(t){var n=t.minimum-t.input.length,r="Ukucajte bar još "+n+" simbol";return r+=e(n,"","a","a"),r},loadingMore:function(){return"Preuzimanje još rezultata…"},maximumSelected:function(t){var n="Možete izabrati samo "+t.maximum+" stavk";return n+=e(t.maximum,"u","e","i"),n},noResults:function(){return"Ništa nije pronađeno"},searching:function(){return"Pretraga…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/sv.js b/ishtar_common/static/select2/js/i18n/sv.js new file mode 100644 index 000000000..bedac08c4 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/sv.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/sv",[],function(){return{errorLoading:function(){return"Resultat kunde inte laddas."},inputTooLong:function(e){var t=e.input.length-e.maximum,n="Vänligen sudda ut "+t+" tecken";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Vänligen skriv in "+t+" eller fler tecken";return n},loadingMore:function(){return"Laddar fler resultat…"},maximumSelected:function(e){var t="Du kan max välja "+e.maximum+" element";return t},noResults:function(){return"Inga träffar"},searching:function(){return"Söker…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/th.js b/ishtar_common/static/select2/js/i18n/th.js new file mode 100644 index 000000000..097a86c69 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/th.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/th",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="โปรดลบออก "+t+" ตัวอักษร";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="โปรดพิมพ์เพิ่มอีก "+t+" ตัวอักษร";return n},loadingMore:function(){return"กำลังค้นข้อมูลเพิ่ม…"},maximumSelected:function(e){var t="คุณสามารถเลือกได้ไม่เกิน "+e.maximum+" รายการ";return t},noResults:function(){return"ไม่พบข้อมูล"},searching:function(){return"กำลังค้นข้อมูล…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/tr.js b/ishtar_common/static/select2/js/i18n/tr.js new file mode 100644 index 000000000..25d27a877 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/tr.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/tr",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n=t+" karakter daha girmelisiniz";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="En az "+t+" karakter daha girmelisiniz";return n},loadingMore:function(){return"Daha fazla…"},maximumSelected:function(e){var t="Sadece "+e.maximum+" seçim yapabilirsiniz";return t},noResults:function(){return"Sonuç bulunamadı"},searching:function(){return"Aranıyor…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/uk.js b/ishtar_common/static/select2/js/i18n/uk.js new file mode 100644 index 000000000..eb3ca8903 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/uk.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/uk",[],function(){function e(e,t,n,r){return e%100>10&&e%100<15?r:e%10===1?t:e%10>1&&e%10<5?n:r}return{errorLoading:function(){return"Неможливо завантажити результати"},inputTooLong:function(t){var n=t.input.length-t.maximum;return"Будь ласка, видаліть "+n+" "+e(t.maximum,"літеру","літери","літер")},inputTooShort:function(e){var t=e.minimum-e.input.length;return"Будь ласка, введіть "+t+" або більше літер"},loadingMore:function(){return"Завантаження інших результатів…"},maximumSelected:function(t){return"Ви можете вибрати лише "+t.maximum+" "+e(t.maximum,"пункт","пункти","пунктів")},noResults:function(){return"Нічого не знайдено"},searching:function(){return"Пошук…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/vi.js b/ishtar_common/static/select2/js/i18n/vi.js new file mode 100644 index 000000000..8975b8ac6 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/vi.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/vi",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="Vui lòng nhập ít hơn "+t+" ký tự";return t!=1&&(n+="s"),n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="Vui lòng nhập nhiều hơn "+t+' ký tự"';return n},loadingMore:function(){return"Đang lấy thêm kết quả…"},maximumSelected:function(e){var t="Chỉ có thể chọn được "+e.maximum+" lựa chọn";return t},noResults:function(){return"Không tìm thấy kết quả"},searching:function(){return"Đang tìm…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/zh-CN.js b/ishtar_common/static/select2/js/i18n/zh-CN.js new file mode 100644 index 000000000..2ed959723 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/zh-CN.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/zh-CN",[],function(){return{errorLoading:function(){return"无法载入结果。"},inputTooLong:function(e){var t=e.input.length-e.maximum,n="请删除"+t+"个字符";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="请再输入至少"+t+"个字符";return n},loadingMore:function(){return"载入更多结果…"},maximumSelected:function(e){var t="最多只能选择"+e.maximum+"个项目";return t},noResults:function(){return"未找到结果"},searching:function(){return"搜索中…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/i18n/zh-TW.js b/ishtar_common/static/select2/js/i18n/zh-TW.js new file mode 100644 index 000000000..ea0812ee0 --- /dev/null +++ b/ishtar_common/static/select2/js/i18n/zh-TW.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */ + +(function(){if(jQuery&&jQuery.fn&&jQuery.fn.select2&&jQuery.fn.select2.amd)var e=jQuery.fn.select2.amd;return e.define("select2/i18n/zh-TW",[],function(){return{inputTooLong:function(e){var t=e.input.length-e.maximum,n="請刪掉"+t+"個字元";return n},inputTooShort:function(e){var t=e.minimum-e.input.length,n="請再輸入"+t+"個字元";return n},loadingMore:function(){return"載入中…"},maximumSelected:function(e){var t="你只能選擇最多"+e.maximum+"項";return t},noResults:function(){return"沒有找到相符的項目"},searching:function(){return"搜尋中…"}}}),{define:e.define,require:e.require}})();
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/init.js b/ishtar_common/static/select2/js/init.js deleted file mode 100644 index c62ee3325..000000000 --- a/ishtar_common/static/select2/js/init.js +++ /dev/null @@ -1,3 +0,0 @@ -$(document).ready(function() { - $(".js-select2").select2(); -}); diff --git a/ishtar_common/static/select2/js/select2.full.js b/ishtar_common/static/select2/js/select2.full.js new file mode 100644 index 000000000..e750834ef --- /dev/null +++ b/ishtar_common/static/select2/js/select2.full.js @@ -0,0 +1,6436 @@ +/*! + * Select2 4.0.3 + * https://select2.github.io + * + * Released under the MIT license + * https://github.com/select2/select2/blob/master/LICENSE.md + */ +(function (factory) { + if (typeof define === 'function' && define.amd) { + // AMD. Register as an anonymous module. + define(['jquery'], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS + factory(require('jquery')); + } else { + // Browser globals + factory(jQuery); + } +}(function (jQuery) { + // This is needed so we can catch the AMD loader configuration and use it + // The inner file should be wrapped (by `banner.start.js`) in a function that + // returns the AMD loader references. + var S2 = +(function () { + // Restore the Select2 AMD loader so it can be used + // Needed mostly in the language files, where the loader is not inserted + if (jQuery && jQuery.fn && jQuery.fn.select2 && jQuery.fn.select2.amd) { + var S2 = jQuery.fn.select2.amd; + } +var S2;(function () { if (!S2 || !S2.requirejs) { +if (!S2) { S2 = {}; } else { require = S2; } +/** + * @license almond 0.3.1 Copyright (c) 2011-2014, The Dojo Foundation All Rights Reserved. + * Available via the MIT or new BSD license. + * see: http://github.com/jrburke/almond for details + */ +//Going sloppy to avoid 'use strict' string cost, but strict practices should +//be followed. +/*jslint sloppy: true */ +/*global setTimeout: false */ + +var requirejs, require, define; +(function (undef) { + var main, req, makeMap, handlers, + defined = {}, + waiting = {}, + config = {}, + defining = {}, + hasOwn = Object.prototype.hasOwnProperty, + aps = [].slice, + jsSuffixRegExp = /\.js$/; + + function hasProp(obj, prop) { + return hasOwn.call(obj, prop); + } + + /** + * Given a relative module name, like ./something, normalize it to + * a real name that can be mapped to a path. + * @param {String} name the relative name + * @param {String} baseName a real name that the name arg is relative + * to. + * @returns {String} normalized name + */ + function normalize(name, baseName) { + var nameParts, nameSegment, mapValue, foundMap, lastIndex, + foundI, foundStarMap, starI, i, j, part, + baseParts = baseName && baseName.split("/"), + map = config.map, + starMap = (map && map['*']) || {}; + + //Adjust any relative paths. + if (name && name.charAt(0) === ".") { + //If have a base name, try to normalize against it, + //otherwise, assume it is a top-level require that will + //be relative to baseUrl in the end. + if (baseName) { + name = name.split('/'); + lastIndex = name.length - 1; + + // Node .js allowance: + if (config.nodeIdCompat && jsSuffixRegExp.test(name[lastIndex])) { + name[lastIndex] = name[lastIndex].replace(jsSuffixRegExp, ''); + } + + //Lop off the last part of baseParts, so that . matches the + //"directory" and not name of the baseName's module. For instance, + //baseName of "one/two/three", maps to "one/two/three.js", but we + //want the directory, "one/two" for this normalization. + name = baseParts.slice(0, baseParts.length - 1).concat(name); + + //start trimDots + for (i = 0; i < name.length; i += 1) { + part = name[i]; + if (part === ".") { + name.splice(i, 1); + i -= 1; + } else if (part === "..") { + if (i === 1 && (name[2] === '..' || name[0] === '..')) { + //End of the line. Keep at least one non-dot + //path segment at the front so it can be mapped + //correctly to disk. Otherwise, there is likely + //no path mapping for a path starting with '..'. + //This can still fail, but catches the most reasonable + //uses of .. + break; + } else if (i > 0) { + name.splice(i - 1, 2); + i -= 2; + } + } + } + //end trimDots + + name = name.join("/"); + } else if (name.indexOf('./') === 0) { + // No baseName, so this is ID is resolved relative + // to baseUrl, pull off the leading dot. + name = name.substring(2); + } + } + + //Apply map config if available. + if ((baseParts || starMap) && map) { + nameParts = name.split('/'); + + for (i = nameParts.length; i > 0; i -= 1) { + nameSegment = nameParts.slice(0, i).join("/"); + + if (baseParts) { + //Find the longest baseName segment match in the config. + //So, do joins on the biggest to smallest lengths of baseParts. + for (j = baseParts.length; j > 0; j -= 1) { + mapValue = map[baseParts.slice(0, j).join('/')]; + + //baseName segment has config, find if it has one for + //this name. + if (mapValue) { + mapValue = mapValue[nameSegment]; + if (mapValue) { + //Match, update name to the new value. + foundMap = mapValue; + foundI = i; + break; + } + } + } + } + + if (foundMap) { + break; + } + + //Check for a star map match, but just hold on to it, + //if there is a shorter segment match later in a matching + //config, then favor over this star map. + if (!foundStarMap && starMap && starMap[nameSegment]) { + foundStarMap = starMap[nameSegment]; + starI = i; + } + } + + if (!foundMap && foundStarMap) { + foundMap = foundStarMap; + foundI = starI; + } + + if (foundMap) { + nameParts.splice(0, foundI, foundMap); + name = nameParts.join('/'); + } + } + + return name; + } + + function makeRequire(relName, forceSync) { + return function () { + //A version of a require function that passes a moduleName + //value for items that may need to + //look up paths relative to the moduleName + var args = aps.call(arguments, 0); + + //If first arg is not require('string'), and there is only + //one arg, it is the array form without a callback. Insert + //a null so that the following concat is correct. + if (typeof args[0] !== 'string' && args.length === 1) { + args.push(null); + } + return req.apply(undef, args.concat([relName, forceSync])); + }; + } + + function makeNormalize(relName) { + return function (name) { + return normalize(name, relName); + }; + } + + function makeLoad(depName) { + return function (value) { + defined[depName] = value; + }; + } + + function callDep(name) { + if (hasProp(waiting, name)) { + var args = waiting[name]; + delete waiting[name]; + defining[name] = true; + main.apply(undef, args); + } + + if (!hasProp(defined, name) && !hasProp(defining, name)) { + throw new Error('No ' + name); + } + return defined[name]; + } + + //Turns a plugin!resource to [plugin, resource] + //with the plugin being undefined if the name + //did not have a plugin prefix. + function splitPrefix(name) { + var prefix, + index = name ? name.indexOf('!') : -1; + if (index > -1) { + prefix = name.substring(0, index); + name = name.substring(index + 1, name.length); + } + return [prefix, name]; + } + + /** + * Makes a name map, normalizing the name, and using a plugin + * for normalization if necessary. Grabs a ref to plugin + * too, as an optimization. + */ + makeMap = function (name, relName) { + var plugin, + parts = splitPrefix(name), + prefix = parts[0]; + + name = parts[1]; + + if (prefix) { + prefix = normalize(prefix, relName); + plugin = callDep(prefix); + } + + //Normalize according + if (prefix) { + if (plugin && plugin.normalize) { + name = plugin.normalize(name, makeNormalize(relName)); + } else { + name = normalize(name, relName); + } + } else { + name = normalize(name, relName); + parts = splitPrefix(name); + prefix = parts[0]; + name = parts[1]; + if (prefix) { + plugin = callDep(prefix); + } + } + + //Using ridiculous property names for space reasons + return { + f: prefix ? prefix + '!' + name : name, //fullName + n: name, + pr: prefix, + p: plugin + }; + }; + + function makeConfig(name) { + return function () { + return (config && config.config && config.config[name]) || {}; + }; + } + + handlers = { + require: function (name) { + return makeRequire(name); + }, + exports: function (name) { + var e = defined[name]; + if (typeof e !== 'undefined') { + return e; + } else { + return (defined[name] = {}); + } + }, + module: function (name) { + return { + id: name, + uri: '', + exports: defined[name], + config: makeConfig(name) + }; + } + }; + + main = function (name, deps, callback, relName) { + var cjsModule, depName, ret, map, i, + args = [], + callbackType = typeof callback, + usingExports; + + //Use name if no relName + relName = relName || name; + + //Call the callback to define the module, if necessary. + if (callbackType === 'undefined' || callbackType === 'function') { + //Pull out the defined dependencies and pass the ordered + //values to the callback. + //Default to [require, exports, module] if no deps + deps = !deps.length && callback.length ? ['require', 'exports', 'module'] : deps; + for (i = 0; i < deps.length; i += 1) { + map = makeMap(deps[i], relName); + depName = map.f; + + //Fast path CommonJS standard dependencies. + if (depName === "require") { + args[i] = handlers.require(name); + } else if (depName === "exports") { + //CommonJS module spec 1.1 + args[i] = handlers.exports(name); + usingExports = true; + } else if (depName === "module") { + //CommonJS module spec 1.1 + cjsModule = args[i] = handlers.module(name); + } else if (hasProp(defined, depName) || + hasProp(waiting, depName) || + hasProp(defining, depName)) { + args[i] = callDep(depName); + } else if (map.p) { + map.p.load(map.n, makeRequire(relName, true), makeLoad(depName), {}); + args[i] = defined[depName]; + } else { + throw new Error(name + ' missing ' + depName); + } + } + + ret = callback ? callback.apply(defined[name], args) : undefined; + + if (name) { + //If setting exports via "module" is in play, + //favor that over return value and exports. After that, + //favor a non-undefined return value over exports use. + if (cjsModule && cjsModule.exports !== undef && + cjsModule.exports !== defined[name]) { + defined[name] = cjsModule.exports; + } else if (ret !== undef || !usingExports) { + //Use the return value from the function. + defined[name] = ret; + } + } + } else if (name) { + //May just be an object definition for the module. Only + //worry about defining if have a module name. + defined[name] = callback; + } + }; + + requirejs = require = req = function (deps, callback, relName, forceSync, alt) { + if (typeof deps === "string") { + if (handlers[deps]) { + //callback in this case is really relName + return handlers[deps](callback); + } + //Just return the module wanted. In this scenario, the + //deps arg is the module name, and second arg (if passed) + //is just the relName. + //Normalize module name, if it contains . or .. + return callDep(makeMap(deps, callback).f); + } else if (!deps.splice) { + //deps is a config object, not an array. + config = deps; + if (config.deps) { + req(config.deps, config.callback); + } + if (!callback) { + return; + } + + if (callback.splice) { + //callback is an array, which means it is a dependency list. + //Adjust args if there are dependencies + deps = callback; + callback = relName; + relName = null; + } else { + deps = undef; + } + } + + //Support require(['a']) + callback = callback || function () {}; + + //If relName is a function, it is an errback handler, + //so remove it. + if (typeof relName === 'function') { + relName = forceSync; + forceSync = alt; + } + + //Simulate async callback; + if (forceSync) { + main(undef, deps, callback, relName); + } else { + //Using a non-zero value because of concern for what old browsers + //do, and latest browsers "upgrade" to 4 if lower value is used: + //http://www.whatwg.org/specs/web-apps/current-work/multipage/timers.html#dom-windowtimers-settimeout: + //If want a value immediately, use require('id') instead -- something + //that works in almond on the global level, but not guaranteed and + //unlikely to work in other AMD implementations. + setTimeout(function () { + main(undef, deps, callback, relName); + }, 4); + } + + return req; + }; + + /** + * Just drops the config on the floor, but returns req in case + * the config return value is used. + */ + req.config = function (cfg) { + return req(cfg); + }; + + /** + * Expose module registry for debugging and tooling + */ + requirejs._defined = defined; + + define = function (name, deps, callback) { + if (typeof name !== 'string') { + throw new Error('See almond README: incorrect module build, no module name'); + } + + //This module may not have dependencies + if (!deps.splice) { + //deps is not an array, so probably means + //an object literal or factory function for + //the value. Adjust args. + callback = deps; + deps = []; + } + + if (!hasProp(defined, name) && !hasProp(waiting, name)) { + waiting[name] = [name, deps, callback]; + } + }; + + define.amd = { + jQuery: true + }; +}()); + +S2.requirejs = requirejs;S2.require = require;S2.define = define; +} +}()); +S2.define("almond", function(){}); + +/* global jQuery:false, $:false */ +S2.define('jquery',[],function () { + var _$ = jQuery || $; + + if (_$ == null && console && console.error) { + console.error( + 'Select2: An instance of jQuery or a jQuery-compatible library was not ' + + 'found. Make sure that you are including jQuery before Select2 on your ' + + 'web page.' + ); + } + + return _$; +}); + +S2.define('select2/utils',[ + 'jquery' +], function ($) { + var Utils = {}; + + Utils.Extend = function (ChildClass, SuperClass) { + var __hasProp = {}.hasOwnProperty; + + function BaseConstructor () { + this.constructor = ChildClass; + } + + for (var key in SuperClass) { + if (__hasProp.call(SuperClass, key)) { + ChildClass[key] = SuperClass[key]; + } + } + + BaseConstructor.prototype = SuperClass.prototype; + ChildClass.prototype = new BaseConstructor(); + ChildClass.__super__ = SuperClass.prototype; + + return ChildClass; + }; + + function getMethods (theClass) { + var proto = theClass.prototype; + + var methods = []; + + for (var methodName in proto) { + var m = proto[methodName]; + + if (typeof m !== 'function') { + continue; + } + + if (methodName === 'constructor') { + continue; + } + + methods.push(methodName); + } + + return methods; + } + + Utils.Decorate = function (SuperClass, DecoratorClass) { + var decoratedMethods = getMethods(DecoratorClass); + var superMethods = getMethods(SuperClass); + + function DecoratedClass () { + var unshift = Array.prototype.unshift; + + var argCount = DecoratorClass.prototype.constructor.length; + + var calledConstructor = SuperClass.prototype.constructor; + + if (argCount > 0) { + unshift.call(arguments, SuperClass.prototype.constructor); + + calledConstructor = DecoratorClass.prototype.constructor; + } + + calledConstructor.apply(this, arguments); + } + + DecoratorClass.displayName = SuperClass.displayName; + + function ctr () { + this.constructor = DecoratedClass; + } + + DecoratedClass.prototype = new ctr(); + + for (var m = 0; m < superMethods.length; m++) { + var superMethod = superMethods[m]; + + DecoratedClass.prototype[superMethod] = + SuperClass.prototype[superMethod]; + } + + var calledMethod = function (methodName) { + // Stub out the original method if it's not decorating an actual method + var originalMethod = function () {}; + + if (methodName in DecoratedClass.prototype) { + originalMethod = DecoratedClass.prototype[methodName]; + } + + var decoratedMethod = DecoratorClass.prototype[methodName]; + + return function () { + var unshift = Array.prototype.unshift; + + unshift.call(arguments, originalMethod); + + return decoratedMethod.apply(this, arguments); + }; + }; + + for (var d = 0; d < decoratedMethods.length; d++) { + var decoratedMethod = decoratedMethods[d]; + + DecoratedClass.prototype[decoratedMethod] = calledMethod(decoratedMethod); + } + + return DecoratedClass; + }; + + var Observable = function () { + this.listeners = {}; + }; + + Observable.prototype.on = function (event, callback) { + this.listeners = this.listeners || {}; + + if (event in this.listeners) { + this.listeners[event].push(callback); + } else { + this.listeners[event] = [callback]; + } + }; + + Observable.prototype.trigger = function (event) { + var slice = Array.prototype.slice; + var params = slice.call(arguments, 1); + + this.listeners = this.listeners || {}; + + // Params should always come in as an array + if (params == null) { + params = []; + } + + // If there are no arguments to the event, use a temporary object + if (params.length === 0) { + params.push({}); + } + + // Set the `_type` of the first object to the event + params[0]._type = event; + + if (event in this.listeners) { + this.invoke(this.listeners[event], slice.call(arguments, 1)); + } + + if ('*' in this.listeners) { + this.invoke(this.listeners['*'], arguments); + } + }; + + Observable.prototype.invoke = function (listeners, params) { + for (var i = 0, len = listeners.length; i < len; i++) { + listeners[i].apply(this, params); + } + }; + + Utils.Observable = Observable; + + Utils.generateChars = function (length) { + var chars = ''; + + for (var i = 0; i < length; i++) { + var randomChar = Math.floor(Math.random() * 36); + chars += randomChar.toString(36); + } + + return chars; + }; + + Utils.bind = function (func, context) { + return function () { + func.apply(context, arguments); + }; + }; + + Utils._convertData = function (data) { + for (var originalKey in data) { + var keys = originalKey.split('-'); + + var dataLevel = data; + + if (keys.length === 1) { + continue; + } + + for (var k = 0; k < keys.length; k++) { + var key = keys[k]; + + // Lowercase the first letter + // By default, dash-separated becomes camelCase + key = key.substring(0, 1).toLowerCase() + key.substring(1); + + if (!(key in dataLevel)) { + dataLevel[key] = {}; + } + + if (k == keys.length - 1) { + dataLevel[key] = data[originalKey]; + } + + dataLevel = dataLevel[key]; + } + + delete data[originalKey]; + } + + return data; + }; + + Utils.hasScroll = function (index, el) { + // Adapted from the function created by @ShadowScripter + // and adapted by @BillBarry on the Stack Exchange Code Review website. + // The original code can be found at + // http://codereview.stackexchange.com/q/13338 + // and was designed to be used with the Sizzle selector engine. + + var $el = $(el); + var overflowX = el.style.overflowX; + var overflowY = el.style.overflowY; + + //Check both x and y declarations + if (overflowX === overflowY && + (overflowY === 'hidden' || overflowY === 'visible')) { + return false; + } + + if (overflowX === 'scroll' || overflowY === 'scroll') { + return true; + } + + return ($el.innerHeight() < el.scrollHeight || + $el.innerWidth() < el.scrollWidth); + }; + + Utils.escapeMarkup = function (markup) { + var replaceMap = { + '\\': '\', + '&': '&', + '<': '<', + '>': '>', + '"': '"', + '\'': ''', + '/': '/' + }; + + // Do not try to escape the markup if it's not a string + if (typeof markup !== 'string') { + return markup; + } + + return String(markup).replace(/[&<>"'\/\\]/g, function (match) { + return replaceMap[match]; + }); + }; + + // Append an array of jQuery nodes to a given element. + Utils.appendMany = function ($element, $nodes) { + // jQuery 1.7.x does not support $.fn.append() with an array + // Fall back to a jQuery object collection using $.fn.add() + if ($.fn.jquery.substr(0, 3) === '1.7') { + var $jqNodes = $(); + + $.map($nodes, function (node) { + $jqNodes = $jqNodes.add(node); + }); + + $nodes = $jqNodes; + } + + $element.append($nodes); + }; + + return Utils; +}); + +S2.define('select2/results',[ + 'jquery', + './utils' +], function ($, Utils) { + function Results ($element, options, dataAdapter) { + this.$element = $element; + this.data = dataAdapter; + this.options = options; + + Results.__super__.constructor.call(this); + } + + Utils.Extend(Results, Utils.Observable); + + Results.prototype.render = function () { + var $results = $( + '<ul class="select2-results__options" role="tree"></ul>' + ); + + if (this.options.get('multiple')) { + $results.attr('aria-multiselectable', 'true'); + } + + this.$results = $results; + + return $results; + }; + + Results.prototype.clear = function () { + this.$results.empty(); + }; + + Results.prototype.displayMessage = function (params) { + var escapeMarkup = this.options.get('escapeMarkup'); + + this.clear(); + this.hideLoading(); + + var $message = $( + '<li role="treeitem" aria-live="assertive"' + + ' class="select2-results__option"></li>' + ); + + var message = this.options.get('translations').get(params.message); + + $message.append( + escapeMarkup( + message(params.args) + ) + ); + + $message[0].className += ' select2-results__message'; + + this.$results.append($message); + }; + + Results.prototype.hideMessages = function () { + this.$results.find('.select2-results__message').remove(); + }; + + Results.prototype.append = function (data) { + this.hideLoading(); + + var $options = []; + + if (data.results == null || data.results.length === 0) { + if (this.$results.children().length === 0) { + this.trigger('results:message', { + message: 'noResults' + }); + } + + return; + } + + data.results = this.sort(data.results); + + for (var d = 0; d < data.results.length; d++) { + var item = data.results[d]; + + var $option = this.option(item); + + $options.push($option); + } + + this.$results.append($options); + }; + + Results.prototype.position = function ($results, $dropdown) { + var $resultsContainer = $dropdown.find('.select2-results'); + $resultsContainer.append($results); + }; + + Results.prototype.sort = function (data) { + var sorter = this.options.get('sorter'); + + return sorter(data); + }; + + Results.prototype.highlightFirstItem = function () { + var $options = this.$results + .find('.select2-results__option[aria-selected]'); + + var $selected = $options.filter('[aria-selected=true]'); + + // Check if there are any selected options + if ($selected.length > 0) { + // If there are selected options, highlight the first + $selected.first().trigger('mouseenter'); + } else { + // If there are no selected options, highlight the first option + // in the dropdown + $options.first().trigger('mouseenter'); + } + + this.ensureHighlightVisible(); + }; + + Results.prototype.setClasses = function () { + var self = this; + + this.data.current(function (selected) { + var selectedIds = $.map(selected, function (s) { + return s.id.toString(); + }); + + var $options = self.$results + .find('.select2-results__option[aria-selected]'); + + $options.each(function () { + var $option = $(this); + + var item = $.data(this, 'data'); + + // id needs to be converted to a string when comparing + var id = '' + item.id; + + if ((item.element != null && item.element.selected) || + (item.element == null && $.inArray(id, selectedIds) > -1)) { + $option.attr('aria-selected', 'true'); + } else { + $option.attr('aria-selected', 'false'); + } + }); + + }); + }; + + Results.prototype.showLoading = function (params) { + this.hideLoading(); + + var loadingMore = this.options.get('translations').get('searching'); + + var loading = { + disabled: true, + loading: true, + text: loadingMore(params) + }; + var $loading = this.option(loading); + $loading.className += ' loading-results'; + + this.$results.prepend($loading); + }; + + Results.prototype.hideLoading = function () { + this.$results.find('.loading-results').remove(); + }; + + Results.prototype.option = function (data) { + var option = document.createElement('li'); + option.className = 'select2-results__option'; + + var attrs = { + 'role': 'treeitem', + 'aria-selected': 'false' + }; + + if (data.disabled) { + delete attrs['aria-selected']; + attrs['aria-disabled'] = 'true'; + } + + if (data.id == null) { + delete attrs['aria-selected']; + } + + if (data._resultId != null) { + option.id = data._resultId; + } + + if (data.title) { + option.title = data.title; + } + + if (data.children) { + attrs.role = 'group'; + attrs['aria-label'] = data.text; + delete attrs['aria-selected']; + } + + for (var attr in attrs) { + var val = attrs[attr]; + + option.setAttribute(attr, val); + } + + if (data.children) { + var $option = $(option); + + var label = document.createElement('strong'); + label.className = 'select2-results__group'; + + var $label = $(label); + this.template(data, label); + + var $children = []; + + for (var c = 0; c < data.children.length; c++) { + var child = data.children[c]; + + var $child = this.option(child); + + $children.push($child); + } + + var $childrenContainer = $('<ul></ul>', { + 'class': 'select2-results__options select2-results__options--nested' + }); + + $childrenContainer.append($children); + + $option.append(label); + $option.append($childrenContainer); + } else { + this.template(data, option); + } + + $.data(option, 'data', data); + + return option; + }; + + Results.prototype.bind = function (container, $container) { + var self = this; + + var id = container.id + '-results'; + + this.$results.attr('id', id); + + container.on('results:all', function (params) { + self.clear(); + self.append(params.data); + + if (container.isOpen()) { + self.setClasses(); + self.highlightFirstItem(); + } + }); + + container.on('results:append', function (params) { + self.append(params.data); + + if (container.isOpen()) { + self.setClasses(); + } + }); + + container.on('query', function (params) { + self.hideMessages(); + self.showLoading(params); + }); + + container.on('select', function () { + if (!container.isOpen()) { + return; + } + + self.setClasses(); + self.highlightFirstItem(); + }); + + container.on('unselect', function () { + if (!container.isOpen()) { + return; + } + + self.setClasses(); + self.highlightFirstItem(); + }); + + container.on('open', function () { + // When the dropdown is open, aria-expended="true" + self.$results.attr('aria-expanded', 'true'); + self.$results.attr('aria-hidden', 'false'); + + self.setClasses(); + self.ensureHighlightVisible(); + }); + + container.on('close', function () { + // When the dropdown is closed, aria-expended="false" + self.$results.attr('aria-expanded', 'false'); + self.$results.attr('aria-hidden', 'true'); + self.$results.removeAttr('aria-activedescendant'); + }); + + container.on('results:toggle', function () { + var $highlighted = self.getHighlightedResults(); + + if ($highlighted.length === 0) { + return; + } + + $highlighted.trigger('mouseup'); + }); + + container.on('results:select', function () { + var $highlighted = self.getHighlightedResults(); + + if ($highlighted.length === 0) { + return; + } + + var data = $highlighted.data('data'); + + if ($highlighted.attr('aria-selected') == 'true') { + self.trigger('close', {}); + } else { + self.trigger('select', { + data: data + }); + } + }); + + container.on('results:previous', function () { + var $highlighted = self.getHighlightedResults(); + + var $options = self.$results.find('[aria-selected]'); + + var currentIndex = $options.index($highlighted); + + // If we are already at te top, don't move further + if (currentIndex === 0) { + return; + } + + var nextIndex = currentIndex - 1; + + // If none are highlighted, highlight the first + if ($highlighted.length === 0) { + nextIndex = 0; + } + + var $next = $options.eq(nextIndex); + + $next.trigger('mouseenter'); + + var currentOffset = self.$results.offset().top; + var nextTop = $next.offset().top; + var nextOffset = self.$results.scrollTop() + (nextTop - currentOffset); + + if (nextIndex === 0) { + self.$results.scrollTop(0); + } else if (nextTop - currentOffset < 0) { + self.$results.scrollTop(nextOffset); + } + }); + + container.on('results:next', function () { + var $highlighted = self.getHighlightedResults(); + + var $options = self.$results.find('[aria-selected]'); + + var currentIndex = $options.index($highlighted); + + var nextIndex = currentIndex + 1; + + // If we are at the last option, stay there + if (nextIndex >= $options.length) { + return; + } + + var $next = $options.eq(nextIndex); + + $next.trigger('mouseenter'); + + var currentOffset = self.$results.offset().top + + self.$results.outerHeight(false); + var nextBottom = $next.offset().top + $next.outerHeight(false); + var nextOffset = self.$results.scrollTop() + nextBottom - currentOffset; + + if (nextIndex === 0) { + self.$results.scrollTop(0); + } else if (nextBottom > currentOffset) { + self.$results.scrollTop(nextOffset); + } + }); + + container.on('results:focus', function (params) { + params.element.addClass('select2-results__option--highlighted'); + }); + + container.on('results:message', function (params) { + self.displayMessage(params); + }); + + if ($.fn.mousewheel) { + this.$results.on('mousewheel', function (e) { + var top = self.$results.scrollTop(); + + var bottom = self.$results.get(0).scrollHeight - top + e.deltaY; + + var isAtTop = e.deltaY > 0 && top - e.deltaY <= 0; + var isAtBottom = e.deltaY < 0 && bottom <= self.$results.height(); + + if (isAtTop) { + self.$results.scrollTop(0); + + e.preventDefault(); + e.stopPropagation(); + } else if (isAtBottom) { + self.$results.scrollTop( + self.$results.get(0).scrollHeight - self.$results.height() + ); + + e.preventDefault(); + e.stopPropagation(); + } + }); + } + + this.$results.on('mouseup', '.select2-results__option[aria-selected]', + function (evt) { + var $this = $(this); + + var data = $this.data('data'); + + if ($this.attr('aria-selected') === 'true') { + if (self.options.get('multiple')) { + self.trigger('unselect', { + originalEvent: evt, + data: data + }); + } else { + self.trigger('close', {}); + } + + return; + } + + self.trigger('select', { + originalEvent: evt, + data: data + }); + }); + + this.$results.on('mouseenter', '.select2-results__option[aria-selected]', + function (evt) { + var data = $(this).data('data'); + + self.getHighlightedResults() + .removeClass('select2-results__option--highlighted'); + + self.trigger('results:focus', { + data: data, + element: $(this) + }); + }); + }; + + Results.prototype.getHighlightedResults = function () { + var $highlighted = this.$results + .find('.select2-results__option--highlighted'); + + return $highlighted; + }; + + Results.prototype.destroy = function () { + this.$results.remove(); + }; + + Results.prototype.ensureHighlightVisible = function () { + var $highlighted = this.getHighlightedResults(); + + if ($highlighted.length === 0) { + return; + } + + var $options = this.$results.find('[aria-selected]'); + + var currentIndex = $options.index($highlighted); + + var currentOffset = this.$results.offset().top; + var nextTop = $highlighted.offset().top; + var nextOffset = this.$results.scrollTop() + (nextTop - currentOffset); + + var offsetDelta = nextTop - currentOffset; + nextOffset -= $highlighted.outerHeight(false) * 2; + + if (currentIndex <= 2) { + this.$results.scrollTop(0); + } else if (offsetDelta > this.$results.outerHeight() || offsetDelta < 0) { + this.$results.scrollTop(nextOffset); + } + }; + + Results.prototype.template = function (result, container) { + var template = this.options.get('templateResult'); + var escapeMarkup = this.options.get('escapeMarkup'); + + var content = template(result, container); + + if (content == null) { + container.style.display = 'none'; + } else if (typeof content === 'string') { + container.innerHTML = escapeMarkup(content); + } else { + $(container).append(content); + } + }; + + return Results; +}); + +S2.define('select2/keys',[ + +], function () { + var KEYS = { + BACKSPACE: 8, + TAB: 9, + ENTER: 13, + SHIFT: 16, + CTRL: 17, + ALT: 18, + ESC: 27, + SPACE: 32, + PAGE_UP: 33, + PAGE_DOWN: 34, + END: 35, + HOME: 36, + LEFT: 37, + UP: 38, + RIGHT: 39, + DOWN: 40, + DELETE: 46 + }; + + return KEYS; +}); + +S2.define('select2/selection/base',[ + 'jquery', + '../utils', + '../keys' +], function ($, Utils, KEYS) { + function BaseSelection ($element, options) { + this.$element = $element; + this.options = options; + + BaseSelection.__super__.constructor.call(this); + } + + Utils.Extend(BaseSelection, Utils.Observable); + + BaseSelection.prototype.render = function () { + var $selection = $( + '<span class="select2-selection" role="combobox" ' + + ' aria-haspopup="true" aria-expanded="false">' + + '</span>' + ); + + this._tabindex = 0; + + if (this.$element.data('old-tabindex') != null) { + this._tabindex = this.$element.data('old-tabindex'); + } else if (this.$element.attr('tabindex') != null) { + this._tabindex = this.$element.attr('tabindex'); + } + + $selection.attr('title', this.$element.attr('title')); + $selection.attr('tabindex', this._tabindex); + + this.$selection = $selection; + + return $selection; + }; + + BaseSelection.prototype.bind = function (container, $container) { + var self = this; + + var id = container.id + '-container'; + var resultsId = container.id + '-results'; + + this.container = container; + + this.$selection.on('focus', function (evt) { + self.trigger('focus', evt); + }); + + this.$selection.on('blur', function (evt) { + self._handleBlur(evt); + }); + + this.$selection.on('keydown', function (evt) { + self.trigger('keypress', evt); + + if (evt.which === KEYS.SPACE) { + evt.preventDefault(); + } + }); + + container.on('results:focus', function (params) { + self.$selection.attr('aria-activedescendant', params.data._resultId); + }); + + container.on('selection:update', function (params) { + self.update(params.data); + }); + + container.on('open', function () { + // When the dropdown is open, aria-expanded="true" + self.$selection.attr('aria-expanded', 'true'); + self.$selection.attr('aria-owns', resultsId); + + self._attachCloseHandler(container); + }); + + container.on('close', function () { + // When the dropdown is closed, aria-expanded="false" + self.$selection.attr('aria-expanded', 'false'); + self.$selection.removeAttr('aria-activedescendant'); + self.$selection.removeAttr('aria-owns'); + + self.$selection.focus(); + + self._detachCloseHandler(container); + }); + + container.on('enable', function () { + self.$selection.attr('tabindex', self._tabindex); + }); + + container.on('disable', function () { + self.$selection.attr('tabindex', '-1'); + }); + }; + + BaseSelection.prototype._handleBlur = function (evt) { + var self = this; + + // This needs to be delayed as the active element is the body when the tab + // key is pressed, possibly along with others. + window.setTimeout(function () { + // Don't trigger `blur` if the focus is still in the selection + if ( + (document.activeElement == self.$selection[0]) || + ($.contains(self.$selection[0], document.activeElement)) + ) { + return; + } + + self.trigger('blur', evt); + }, 1); + }; + + BaseSelection.prototype._attachCloseHandler = function (container) { + var self = this; + + $(document.body).on('mousedown.select2.' + container.id, function (e) { + var $target = $(e.target); + + var $select = $target.closest('.select2'); + + var $all = $('.select2.select2-container--open'); + + $all.each(function () { + var $this = $(this); + + if (this == $select[0]) { + return; + } + + var $element = $this.data('element'); + + $element.select2('close'); + }); + }); + }; + + BaseSelection.prototype._detachCloseHandler = function (container) { + $(document.body).off('mousedown.select2.' + container.id); + }; + + BaseSelection.prototype.position = function ($selection, $container) { + var $selectionContainer = $container.find('.selection'); + $selectionContainer.append($selection); + }; + + BaseSelection.prototype.destroy = function () { + this._detachCloseHandler(this.container); + }; + + BaseSelection.prototype.update = function (data) { + throw new Error('The `update` method must be defined in child classes.'); + }; + + return BaseSelection; +}); + +S2.define('select2/selection/single',[ + 'jquery', + './base', + '../utils', + '../keys' +], function ($, BaseSelection, Utils, KEYS) { + function SingleSelection () { + SingleSelection.__super__.constructor.apply(this, arguments); + } + + Utils.Extend(SingleSelection, BaseSelection); + + SingleSelection.prototype.render = function () { + var $selection = SingleSelection.__super__.render.call(this); + + $selection.addClass('select2-selection--single'); + + $selection.html( + '<span class="select2-selection__rendered"></span>' + + '<span class="select2-selection__arrow" role="presentation">' + + '<b role="presentation"></b>' + + '</span>' + ); + + return $selection; + }; + + SingleSelection.prototype.bind = function (container, $container) { + var self = this; + + SingleSelection.__super__.bind.apply(this, arguments); + + var id = container.id + '-container'; + + this.$selection.find('.select2-selection__rendered').attr('id', id); + this.$selection.attr('aria-labelledby', id); + + this.$selection.on('mousedown', function (evt) { + // Only respond to left clicks + if (evt.which !== 1) { + return; + } + + self.trigger('toggle', { + originalEvent: evt + }); + }); + + this.$selection.on('focus', function (evt) { + // User focuses on the container + }); + + this.$selection.on('blur', function (evt) { + // User exits the container + }); + + container.on('focus', function (evt) { + if (!container.isOpen()) { + self.$selection.focus(); + } + }); + + container.on('selection:update', function (params) { + self.update(params.data); + }); + }; + + SingleSelection.prototype.clear = function () { + this.$selection.find('.select2-selection__rendered').empty(); + }; + + SingleSelection.prototype.display = function (data, container) { + var template = this.options.get('templateSelection'); + var escapeMarkup = this.options.get('escapeMarkup'); + + return escapeMarkup(template(data, container)); + }; + + SingleSelection.prototype.selectionContainer = function () { + return $('<span></span>'); + }; + + SingleSelection.prototype.update = function (data) { + if (data.length === 0) { + this.clear(); + return; + } + + var selection = data[0]; + + var $rendered = this.$selection.find('.select2-selection__rendered'); + var formatted = this.display(selection, $rendered); + + $rendered.empty().append(formatted); + $rendered.prop('title', selection.title || selection.text); + }; + + return SingleSelection; +}); + +S2.define('select2/selection/multiple',[ + 'jquery', + './base', + '../utils' +], function ($, BaseSelection, Utils) { + function MultipleSelection ($element, options) { + MultipleSelection.__super__.constructor.apply(this, arguments); + } + + Utils.Extend(MultipleSelection, BaseSelection); + + MultipleSelection.prototype.render = function () { + var $selection = MultipleSelection.__super__.render.call(this); + + $selection.addClass('select2-selection--multiple'); + + $selection.html( + '<ul class="select2-selection__rendered"></ul>' + ); + + return $selection; + }; + + MultipleSelection.prototype.bind = function (container, $container) { + var self = this; + + MultipleSelection.__super__.bind.apply(this, arguments); + + this.$selection.on('click', function (evt) { + self.trigger('toggle', { + originalEvent: evt + }); + }); + + this.$selection.on( + 'click', + '.select2-selection__choice__remove', + function (evt) { + // Ignore the event if it is disabled + if (self.options.get('disabled')) { + return; + } + + var $remove = $(this); + var $selection = $remove.parent(); + + var data = $selection.data('data'); + + self.trigger('unselect', { + originalEvent: evt, + data: data + }); + } + ); + }; + + MultipleSelection.prototype.clear = function () { + this.$selection.find('.select2-selection__rendered').empty(); + }; + + MultipleSelection.prototype.display = function (data, container) { + var template = this.options.get('templateSelection'); + var escapeMarkup = this.options.get('escapeMarkup'); + + return escapeMarkup(template(data, container)); + }; + + MultipleSelection.prototype.selectionContainer = function () { + var $container = $( + '<li class="select2-selection__choice">' + + '<span class="select2-selection__choice__remove" role="presentation">' + + '×' + + '</span>' + + '</li>' + ); + + return $container; + }; + + MultipleSelection.prototype.update = function (data) { + this.clear(); + + if (data.length === 0) { + return; + } + + var $selections = []; + + for (var d = 0; d < data.length; d++) { + var selection = data[d]; + + var $selection = this.selectionContainer(); + var formatted = this.display(selection, $selection); + + $selection.append(formatted); + $selection.prop('title', selection.title || selection.text); + + $selection.data('data', selection); + + $selections.push($selection); + } + + var $rendered = this.$selection.find('.select2-selection__rendered'); + + Utils.appendMany($rendered, $selections); + }; + + return MultipleSelection; +}); + +S2.define('select2/selection/placeholder',[ + '../utils' +], function (Utils) { + function Placeholder (decorated, $element, options) { + this.placeholder = this.normalizePlaceholder(options.get('placeholder')); + + decorated.call(this, $element, options); + } + + Placeholder.prototype.normalizePlaceholder = function (_, placeholder) { + if (typeof placeholder === 'string') { + placeholder = { + id: '', + text: placeholder + }; + } + + return placeholder; + }; + + Placeholder.prototype.createPlaceholder = function (decorated, placeholder) { + var $placeholder = this.selectionContainer(); + + $placeholder.html(this.display(placeholder)); + $placeholder.addClass('select2-selection__placeholder') + .removeClass('select2-selection__choice'); + + return $placeholder; + }; + + Placeholder.prototype.update = function (decorated, data) { + var singlePlaceholder = ( + data.length == 1 && data[0].id != this.placeholder.id + ); + var multipleSelections = data.length > 1; + + if (multipleSelections || singlePlaceholder) { + return decorated.call(this, data); + } + + this.clear(); + + var $placeholder = this.createPlaceholder(this.placeholder); + + this.$selection.find('.select2-selection__rendered').append($placeholder); + }; + + return Placeholder; +}); + +S2.define('select2/selection/allowClear',[ + 'jquery', + '../keys' +], function ($, KEYS) { + function AllowClear () { } + + AllowClear.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + if (this.placeholder == null) { + if (this.options.get('debug') && window.console && console.error) { + console.error( + 'Select2: The `allowClear` option should be used in combination ' + + 'with the `placeholder` option.' + ); + } + } + + this.$selection.on('mousedown', '.select2-selection__clear', + function (evt) { + self._handleClear(evt); + }); + + container.on('keypress', function (evt) { + self._handleKeyboardClear(evt, container); + }); + }; + + AllowClear.prototype._handleClear = function (_, evt) { + // Ignore the event if it is disabled + if (this.options.get('disabled')) { + return; + } + + var $clear = this.$selection.find('.select2-selection__clear'); + + // Ignore the event if nothing has been selected + if ($clear.length === 0) { + return; + } + + evt.stopPropagation(); + + var data = $clear.data('data'); + + for (var d = 0; d < data.length; d++) { + var unselectData = { + data: data[d] + }; + + // Trigger the `unselect` event, so people can prevent it from being + // cleared. + this.trigger('unselect', unselectData); + + // If the event was prevented, don't clear it out. + if (unselectData.prevented) { + return; + } + } + + this.$element.val(this.placeholder.id).trigger('change'); + + this.trigger('toggle', {}); + }; + + AllowClear.prototype._handleKeyboardClear = function (_, evt, container) { + if (container.isOpen()) { + return; + } + + if (evt.which == KEYS.DELETE || evt.which == KEYS.BACKSPACE) { + this._handleClear(evt); + } + }; + + AllowClear.prototype.update = function (decorated, data) { + decorated.call(this, data); + + if (this.$selection.find('.select2-selection__placeholder').length > 0 || + data.length === 0) { + return; + } + + var $remove = $( + '<span class="select2-selection__clear">' + + '×' + + '</span>' + ); + $remove.data('data', data); + + this.$selection.find('.select2-selection__rendered').prepend($remove); + }; + + return AllowClear; +}); + +S2.define('select2/selection/search',[ + 'jquery', + '../utils', + '../keys' +], function ($, Utils, KEYS) { + function Search (decorated, $element, options) { + decorated.call(this, $element, options); + } + + Search.prototype.render = function (decorated) { + var $search = $( + '<li class="select2-search select2-search--inline">' + + '<input class="select2-search__field" type="search" tabindex="-1"' + + ' autocomplete="off" autocorrect="off" autocapitalize="off"' + + ' spellcheck="false" role="textbox" aria-autocomplete="list" />' + + '</li>' + ); + + this.$searchContainer = $search; + this.$search = $search.find('input'); + + var $rendered = decorated.call(this); + + this._transferTabIndex(); + + return $rendered; + }; + + Search.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + container.on('open', function () { + self.$search.trigger('focus'); + }); + + container.on('close', function () { + self.$search.val(''); + self.$search.removeAttr('aria-activedescendant'); + self.$search.trigger('focus'); + }); + + container.on('enable', function () { + self.$search.prop('disabled', false); + + self._transferTabIndex(); + }); + + container.on('disable', function () { + self.$search.prop('disabled', true); + }); + + container.on('focus', function (evt) { + self.$search.trigger('focus'); + }); + + container.on('results:focus', function (params) { + self.$search.attr('aria-activedescendant', params.id); + }); + + this.$selection.on('focusin', '.select2-search--inline', function (evt) { + self.trigger('focus', evt); + }); + + this.$selection.on('focusout', '.select2-search--inline', function (evt) { + self._handleBlur(evt); + }); + + this.$selection.on('keydown', '.select2-search--inline', function (evt) { + evt.stopPropagation(); + + self.trigger('keypress', evt); + + self._keyUpPrevented = evt.isDefaultPrevented(); + + var key = evt.which; + + if (key === KEYS.BACKSPACE && self.$search.val() === '') { + var $previousChoice = self.$searchContainer + .prev('.select2-selection__choice'); + + if ($previousChoice.length > 0) { + var item = $previousChoice.data('data'); + + self.searchRemoveChoice(item); + + evt.preventDefault(); + } + } + }); + + // Try to detect the IE version should the `documentMode` property that + // is stored on the document. This is only implemented in IE and is + // slightly cleaner than doing a user agent check. + // This property is not available in Edge, but Edge also doesn't have + // this bug. + var msie = document.documentMode; + var disableInputEvents = msie && msie <= 11; + + // Workaround for browsers which do not support the `input` event + // This will prevent double-triggering of events for browsers which support + // both the `keyup` and `input` events. + this.$selection.on( + 'input.searchcheck', + '.select2-search--inline', + function (evt) { + // IE will trigger the `input` event when a placeholder is used on a + // search box. To get around this issue, we are forced to ignore all + // `input` events in IE and keep using `keyup`. + if (disableInputEvents) { + self.$selection.off('input.search input.searchcheck'); + return; + } + + // Unbind the duplicated `keyup` event + self.$selection.off('keyup.search'); + } + ); + + this.$selection.on( + 'keyup.search input.search', + '.select2-search--inline', + function (evt) { + // IE will trigger the `input` event when a placeholder is used on a + // search box. To get around this issue, we are forced to ignore all + // `input` events in IE and keep using `keyup`. + if (disableInputEvents && evt.type === 'input') { + self.$selection.off('input.search input.searchcheck'); + return; + } + + var key = evt.which; + + // We can freely ignore events from modifier keys + if (key == KEYS.SHIFT || key == KEYS.CTRL || key == KEYS.ALT) { + return; + } + + // Tabbing will be handled during the `keydown` phase + if (key == KEYS.TAB) { + return; + } + + self.handleSearch(evt); + } + ); + }; + + /** + * This method will transfer the tabindex attribute from the rendered + * selection to the search box. This allows for the search box to be used as + * the primary focus instead of the selection container. + * + * @private + */ + Search.prototype._transferTabIndex = function (decorated) { + this.$search.attr('tabindex', this.$selection.attr('tabindex')); + this.$selection.attr('tabindex', '-1'); + }; + + Search.prototype.createPlaceholder = function (decorated, placeholder) { + this.$search.attr('placeholder', placeholder.text); + }; + + Search.prototype.update = function (decorated, data) { + var searchHadFocus = this.$search[0] == document.activeElement; + + this.$search.attr('placeholder', ''); + + decorated.call(this, data); + + this.$selection.find('.select2-selection__rendered') + .append(this.$searchContainer); + + this.resizeSearch(); + if (searchHadFocus) { + this.$search.focus(); + } + }; + + Search.prototype.handleSearch = function () { + this.resizeSearch(); + + if (!this._keyUpPrevented) { + var input = this.$search.val(); + + this.trigger('query', { + term: input + }); + } + + this._keyUpPrevented = false; + }; + + Search.prototype.searchRemoveChoice = function (decorated, item) { + this.trigger('unselect', { + data: item + }); + + this.$search.val(item.text); + this.handleSearch(); + }; + + Search.prototype.resizeSearch = function () { + this.$search.css('width', '25px'); + + var width = ''; + + if (this.$search.attr('placeholder') !== '') { + width = this.$selection.find('.select2-selection__rendered').innerWidth(); + } else { + var minimumWidth = this.$search.val().length + 1; + + width = (minimumWidth * 0.75) + 'em'; + } + + this.$search.css('width', width); + }; + + return Search; +}); + +S2.define('select2/selection/eventRelay',[ + 'jquery' +], function ($) { + function EventRelay () { } + + EventRelay.prototype.bind = function (decorated, container, $container) { + var self = this; + var relayEvents = [ + 'open', 'opening', + 'close', 'closing', + 'select', 'selecting', + 'unselect', 'unselecting' + ]; + + var preventableEvents = ['opening', 'closing', 'selecting', 'unselecting']; + + decorated.call(this, container, $container); + + container.on('*', function (name, params) { + // Ignore events that should not be relayed + if ($.inArray(name, relayEvents) === -1) { + return; + } + + // The parameters should always be an object + params = params || {}; + + // Generate the jQuery event for the Select2 event + var evt = $.Event('select2:' + name, { + params: params + }); + + self.$element.trigger(evt); + + // Only handle preventable events if it was one + if ($.inArray(name, preventableEvents) === -1) { + return; + } + + params.prevented = evt.isDefaultPrevented(); + }); + }; + + return EventRelay; +}); + +S2.define('select2/translation',[ + 'jquery', + 'require' +], function ($, require) { + function Translation (dict) { + this.dict = dict || {}; + } + + Translation.prototype.all = function () { + return this.dict; + }; + + Translation.prototype.get = function (key) { + return this.dict[key]; + }; + + Translation.prototype.extend = function (translation) { + this.dict = $.extend({}, translation.all(), this.dict); + }; + + // Static functions + + Translation._cache = {}; + + Translation.loadPath = function (path) { + if (!(path in Translation._cache)) { + var translations = require(path); + + Translation._cache[path] = translations; + } + + return new Translation(Translation._cache[path]); + }; + + return Translation; +}); + +S2.define('select2/diacritics',[ + +], function () { + var diacritics = { + '\u24B6': 'A', + '\uFF21': 'A', + '\u00C0': 'A', + '\u00C1': 'A', + '\u00C2': 'A', + '\u1EA6': 'A', + '\u1EA4': 'A', + '\u1EAA': 'A', + '\u1EA8': 'A', + '\u00C3': 'A', + '\u0100': 'A', + '\u0102': 'A', + '\u1EB0': 'A', + '\u1EAE': 'A', + '\u1EB4': 'A', + '\u1EB2': 'A', + '\u0226': 'A', + '\u01E0': 'A', + '\u00C4': 'A', + '\u01DE': 'A', + '\u1EA2': 'A', + '\u00C5': 'A', + '\u01FA': 'A', + '\u01CD': 'A', + '\u0200': 'A', + '\u0202': 'A', + '\u1EA0': 'A', + '\u1EAC': 'A', + '\u1EB6': 'A', + '\u1E00': 'A', + '\u0104': 'A', + '\u023A': 'A', + '\u2C6F': 'A', + '\uA732': 'AA', + '\u00C6': 'AE', + '\u01FC': 'AE', + '\u01E2': 'AE', + '\uA734': 'AO', + '\uA736': 'AU', + '\uA738': 'AV', + '\uA73A': 'AV', + '\uA73C': 'AY', + '\u24B7': 'B', + '\uFF22': 'B', + '\u1E02': 'B', + '\u1E04': 'B', + '\u1E06': 'B', + '\u0243': 'B', + '\u0182': 'B', + '\u0181': 'B', + '\u24B8': 'C', + '\uFF23': 'C', + '\u0106': 'C', + '\u0108': 'C', + '\u010A': 'C', + '\u010C': 'C', + '\u00C7': 'C', + '\u1E08': 'C', + '\u0187': 'C', + '\u023B': 'C', + '\uA73E': 'C', + '\u24B9': 'D', + '\uFF24': 'D', + '\u1E0A': 'D', + '\u010E': 'D', + '\u1E0C': 'D', + '\u1E10': 'D', + '\u1E12': 'D', + '\u1E0E': 'D', + '\u0110': 'D', + '\u018B': 'D', + '\u018A': 'D', + '\u0189': 'D', + '\uA779': 'D', + '\u01F1': 'DZ', + '\u01C4': 'DZ', + '\u01F2': 'Dz', + '\u01C5': 'Dz', + '\u24BA': 'E', + '\uFF25': 'E', + '\u00C8': 'E', + '\u00C9': 'E', + '\u00CA': 'E', + '\u1EC0': 'E', + '\u1EBE': 'E', + '\u1EC4': 'E', + '\u1EC2': 'E', + '\u1EBC': 'E', + '\u0112': 'E', + '\u1E14': 'E', + '\u1E16': 'E', + '\u0114': 'E', + '\u0116': 'E', + '\u00CB': 'E', + '\u1EBA': 'E', + '\u011A': 'E', + '\u0204': 'E', + '\u0206': 'E', + '\u1EB8': 'E', + '\u1EC6': 'E', + '\u0228': 'E', + '\u1E1C': 'E', + '\u0118': 'E', + '\u1E18': 'E', + '\u1E1A': 'E', + '\u0190': 'E', + '\u018E': 'E', + '\u24BB': 'F', + '\uFF26': 'F', + '\u1E1E': 'F', + '\u0191': 'F', + '\uA77B': 'F', + '\u24BC': 'G', + '\uFF27': 'G', + '\u01F4': 'G', + '\u011C': 'G', + '\u1E20': 'G', + '\u011E': 'G', + '\u0120': 'G', + '\u01E6': 'G', + '\u0122': 'G', + '\u01E4': 'G', + '\u0193': 'G', + '\uA7A0': 'G', + '\uA77D': 'G', + '\uA77E': 'G', + '\u24BD': 'H', + '\uFF28': 'H', + '\u0124': 'H', + '\u1E22': 'H', + '\u1E26': 'H', + '\u021E': 'H', + '\u1E24': 'H', + '\u1E28': 'H', + '\u1E2A': 'H', + '\u0126': 'H', + '\u2C67': 'H', + '\u2C75': 'H', + '\uA78D': 'H', + '\u24BE': 'I', + '\uFF29': 'I', + '\u00CC': 'I', + '\u00CD': 'I', + '\u00CE': 'I', + '\u0128': 'I', + '\u012A': 'I', + '\u012C': 'I', + '\u0130': 'I', + '\u00CF': 'I', + '\u1E2E': 'I', + '\u1EC8': 'I', + '\u01CF': 'I', + '\u0208': 'I', + '\u020A': 'I', + '\u1ECA': 'I', + '\u012E': 'I', + '\u1E2C': 'I', + '\u0197': 'I', + '\u24BF': 'J', + '\uFF2A': 'J', + '\u0134': 'J', + '\u0248': 'J', + '\u24C0': 'K', + '\uFF2B': 'K', + '\u1E30': 'K', + '\u01E8': 'K', + '\u1E32': 'K', + '\u0136': 'K', + '\u1E34': 'K', + '\u0198': 'K', + '\u2C69': 'K', + '\uA740': 'K', + '\uA742': 'K', + '\uA744': 'K', + '\uA7A2': 'K', + '\u24C1': 'L', + '\uFF2C': 'L', + '\u013F': 'L', + '\u0139': 'L', + '\u013D': 'L', + '\u1E36': 'L', + '\u1E38': 'L', + '\u013B': 'L', + '\u1E3C': 'L', + '\u1E3A': 'L', + '\u0141': 'L', + '\u023D': 'L', + '\u2C62': 'L', + '\u2C60': 'L', + '\uA748': 'L', + '\uA746': 'L', + '\uA780': 'L', + '\u01C7': 'LJ', + '\u01C8': 'Lj', + '\u24C2': 'M', + '\uFF2D': 'M', + '\u1E3E': 'M', + '\u1E40': 'M', + '\u1E42': 'M', + '\u2C6E': 'M', + '\u019C': 'M', + '\u24C3': 'N', + '\uFF2E': 'N', + '\u01F8': 'N', + '\u0143': 'N', + '\u00D1': 'N', + '\u1E44': 'N', + '\u0147': 'N', + '\u1E46': 'N', + '\u0145': 'N', + '\u1E4A': 'N', + '\u1E48': 'N', + '\u0220': 'N', + '\u019D': 'N', + '\uA790': 'N', + '\uA7A4': 'N', + '\u01CA': 'NJ', + '\u01CB': 'Nj', + '\u24C4': 'O', + '\uFF2F': 'O', + '\u00D2': 'O', + '\u00D3': 'O', + '\u00D4': 'O', + '\u1ED2': 'O', + '\u1ED0': 'O', + '\u1ED6': 'O', + '\u1ED4': 'O', + '\u00D5': 'O', + '\u1E4C': 'O', + '\u022C': 'O', + '\u1E4E': 'O', + '\u014C': 'O', + '\u1E50': 'O', + '\u1E52': 'O', + '\u014E': 'O', + '\u022E': 'O', + '\u0230': 'O', + '\u00D6': 'O', + '\u022A': 'O', + '\u1ECE': 'O', + '\u0150': 'O', + '\u01D1': 'O', + '\u020C': 'O', + '\u020E': 'O', + '\u01A0': 'O', + '\u1EDC': 'O', + '\u1EDA': 'O', + '\u1EE0': 'O', + '\u1EDE': 'O', + '\u1EE2': 'O', + '\u1ECC': 'O', + '\u1ED8': 'O', + '\u01EA': 'O', + '\u01EC': 'O', + '\u00D8': 'O', + '\u01FE': 'O', + '\u0186': 'O', + '\u019F': 'O', + '\uA74A': 'O', + '\uA74C': 'O', + '\u01A2': 'OI', + '\uA74E': 'OO', + '\u0222': 'OU', + '\u24C5': 'P', + '\uFF30': 'P', + '\u1E54': 'P', + '\u1E56': 'P', + '\u01A4': 'P', + '\u2C63': 'P', + '\uA750': 'P', + '\uA752': 'P', + '\uA754': 'P', + '\u24C6': 'Q', + '\uFF31': 'Q', + '\uA756': 'Q', + '\uA758': 'Q', + '\u024A': 'Q', + '\u24C7': 'R', + '\uFF32': 'R', + '\u0154': 'R', + '\u1E58': 'R', + '\u0158': 'R', + '\u0210': 'R', + '\u0212': 'R', + '\u1E5A': 'R', + '\u1E5C': 'R', + '\u0156': 'R', + '\u1E5E': 'R', + '\u024C': 'R', + '\u2C64': 'R', + '\uA75A': 'R', + '\uA7A6': 'R', + '\uA782': 'R', + '\u24C8': 'S', + '\uFF33': 'S', + '\u1E9E': 'S', + '\u015A': 'S', + '\u1E64': 'S', + '\u015C': 'S', + '\u1E60': 'S', + '\u0160': 'S', + '\u1E66': 'S', + '\u1E62': 'S', + '\u1E68': 'S', + '\u0218': 'S', + '\u015E': 'S', + '\u2C7E': 'S', + '\uA7A8': 'S', + '\uA784': 'S', + '\u24C9': 'T', + '\uFF34': 'T', + '\u1E6A': 'T', + '\u0164': 'T', + '\u1E6C': 'T', + '\u021A': 'T', + '\u0162': 'T', + '\u1E70': 'T', + '\u1E6E': 'T', + '\u0166': 'T', + '\u01AC': 'T', + '\u01AE': 'T', + '\u023E': 'T', + '\uA786': 'T', + '\uA728': 'TZ', + '\u24CA': 'U', + '\uFF35': 'U', + '\u00D9': 'U', + '\u00DA': 'U', + '\u00DB': 'U', + '\u0168': 'U', + '\u1E78': 'U', + '\u016A': 'U', + '\u1E7A': 'U', + '\u016C': 'U', + '\u00DC': 'U', + '\u01DB': 'U', + '\u01D7': 'U', + '\u01D5': 'U', + '\u01D9': 'U', + '\u1EE6': 'U', + '\u016E': 'U', + '\u0170': 'U', + '\u01D3': 'U', + '\u0214': 'U', + '\u0216': 'U', + '\u01AF': 'U', + '\u1EEA': 'U', + '\u1EE8': 'U', + '\u1EEE': 'U', + '\u1EEC': 'U', + '\u1EF0': 'U', + '\u1EE4': 'U', + '\u1E72': 'U', + '\u0172': 'U', + '\u1E76': 'U', + '\u1E74': 'U', + '\u0244': 'U', + '\u24CB': 'V', + '\uFF36': 'V', + '\u1E7C': 'V', + '\u1E7E': 'V', + '\u01B2': 'V', + '\uA75E': 'V', + '\u0245': 'V', + '\uA760': 'VY', + '\u24CC': 'W', + '\uFF37': 'W', + '\u1E80': 'W', + '\u1E82': 'W', + '\u0174': 'W', + '\u1E86': 'W', + '\u1E84': 'W', + '\u1E88': 'W', + '\u2C72': 'W', + '\u24CD': 'X', + '\uFF38': 'X', + '\u1E8A': 'X', + '\u1E8C': 'X', + '\u24CE': 'Y', + '\uFF39': 'Y', + '\u1EF2': 'Y', + '\u00DD': 'Y', + '\u0176': 'Y', + '\u1EF8': 'Y', + '\u0232': 'Y', + '\u1E8E': 'Y', + '\u0178': 'Y', + '\u1EF6': 'Y', + '\u1EF4': 'Y', + '\u01B3': 'Y', + '\u024E': 'Y', + '\u1EFE': 'Y', + '\u24CF': 'Z', + '\uFF3A': 'Z', + '\u0179': 'Z', + '\u1E90': 'Z', + '\u017B': 'Z', + '\u017D': 'Z', + '\u1E92': 'Z', + '\u1E94': 'Z', + '\u01B5': 'Z', + '\u0224': 'Z', + '\u2C7F': 'Z', + '\u2C6B': 'Z', + '\uA762': 'Z', + '\u24D0': 'a', + '\uFF41': 'a', + '\u1E9A': 'a', + '\u00E0': 'a', + '\u00E1': 'a', + '\u00E2': 'a', + '\u1EA7': 'a', + '\u1EA5': 'a', + '\u1EAB': 'a', + '\u1EA9': 'a', + '\u00E3': 'a', + '\u0101': 'a', + '\u0103': 'a', + '\u1EB1': 'a', + '\u1EAF': 'a', + '\u1EB5': 'a', + '\u1EB3': 'a', + '\u0227': 'a', + '\u01E1': 'a', + '\u00E4': 'a', + '\u01DF': 'a', + '\u1EA3': 'a', + '\u00E5': 'a', + '\u01FB': 'a', + '\u01CE': 'a', + '\u0201': 'a', + '\u0203': 'a', + '\u1EA1': 'a', + '\u1EAD': 'a', + '\u1EB7': 'a', + '\u1E01': 'a', + '\u0105': 'a', + '\u2C65': 'a', + '\u0250': 'a', + '\uA733': 'aa', + '\u00E6': 'ae', + '\u01FD': 'ae', + '\u01E3': 'ae', + '\uA735': 'ao', + '\uA737': 'au', + '\uA739': 'av', + '\uA73B': 'av', + '\uA73D': 'ay', + '\u24D1': 'b', + '\uFF42': 'b', + '\u1E03': 'b', + '\u1E05': 'b', + '\u1E07': 'b', + '\u0180': 'b', + '\u0183': 'b', + '\u0253': 'b', + '\u24D2': 'c', + '\uFF43': 'c', + '\u0107': 'c', + '\u0109': 'c', + '\u010B': 'c', + '\u010D': 'c', + '\u00E7': 'c', + '\u1E09': 'c', + '\u0188': 'c', + '\u023C': 'c', + '\uA73F': 'c', + '\u2184': 'c', + '\u24D3': 'd', + '\uFF44': 'd', + '\u1E0B': 'd', + '\u010F': 'd', + '\u1E0D': 'd', + '\u1E11': 'd', + '\u1E13': 'd', + '\u1E0F': 'd', + '\u0111': 'd', + '\u018C': 'd', + '\u0256': 'd', + '\u0257': 'd', + '\uA77A': 'd', + '\u01F3': 'dz', + '\u01C6': 'dz', + '\u24D4': 'e', + '\uFF45': 'e', + '\u00E8': 'e', + '\u00E9': 'e', + '\u00EA': 'e', + '\u1EC1': 'e', + '\u1EBF': 'e', + '\u1EC5': 'e', + '\u1EC3': 'e', + '\u1EBD': 'e', + '\u0113': 'e', + '\u1E15': 'e', + '\u1E17': 'e', + '\u0115': 'e', + '\u0117': 'e', + '\u00EB': 'e', + '\u1EBB': 'e', + '\u011B': 'e', + '\u0205': 'e', + '\u0207': 'e', + '\u1EB9': 'e', + '\u1EC7': 'e', + '\u0229': 'e', + '\u1E1D': 'e', + '\u0119': 'e', + '\u1E19': 'e', + '\u1E1B': 'e', + '\u0247': 'e', + '\u025B': 'e', + '\u01DD': 'e', + '\u24D5': 'f', + '\uFF46': 'f', + '\u1E1F': 'f', + '\u0192': 'f', + '\uA77C': 'f', + '\u24D6': 'g', + '\uFF47': 'g', + '\u01F5': 'g', + '\u011D': 'g', + '\u1E21': 'g', + '\u011F': 'g', + '\u0121': 'g', + '\u01E7': 'g', + '\u0123': 'g', + '\u01E5': 'g', + '\u0260': 'g', + '\uA7A1': 'g', + '\u1D79': 'g', + '\uA77F': 'g', + '\u24D7': 'h', + '\uFF48': 'h', + '\u0125': 'h', + '\u1E23': 'h', + '\u1E27': 'h', + '\u021F': 'h', + '\u1E25': 'h', + '\u1E29': 'h', + '\u1E2B': 'h', + '\u1E96': 'h', + '\u0127': 'h', + '\u2C68': 'h', + '\u2C76': 'h', + '\u0265': 'h', + '\u0195': 'hv', + '\u24D8': 'i', + '\uFF49': 'i', + '\u00EC': 'i', + '\u00ED': 'i', + '\u00EE': 'i', + '\u0129': 'i', + '\u012B': 'i', + '\u012D': 'i', + '\u00EF': 'i', + '\u1E2F': 'i', + '\u1EC9': 'i', + '\u01D0': 'i', + '\u0209': 'i', + '\u020B': 'i', + '\u1ECB': 'i', + '\u012F': 'i', + '\u1E2D': 'i', + '\u0268': 'i', + '\u0131': 'i', + '\u24D9': 'j', + '\uFF4A': 'j', + '\u0135': 'j', + '\u01F0': 'j', + '\u0249': 'j', + '\u24DA': 'k', + '\uFF4B': 'k', + '\u1E31': 'k', + '\u01E9': 'k', + '\u1E33': 'k', + '\u0137': 'k', + '\u1E35': 'k', + '\u0199': 'k', + '\u2C6A': 'k', + '\uA741': 'k', + '\uA743': 'k', + '\uA745': 'k', + '\uA7A3': 'k', + '\u24DB': 'l', + '\uFF4C': 'l', + '\u0140': 'l', + '\u013A': 'l', + '\u013E': 'l', + '\u1E37': 'l', + '\u1E39': 'l', + '\u013C': 'l', + '\u1E3D': 'l', + '\u1E3B': 'l', + '\u017F': 'l', + '\u0142': 'l', + '\u019A': 'l', + '\u026B': 'l', + '\u2C61': 'l', + '\uA749': 'l', + '\uA781': 'l', + '\uA747': 'l', + '\u01C9': 'lj', + '\u24DC': 'm', + '\uFF4D': 'm', + '\u1E3F': 'm', + '\u1E41': 'm', + '\u1E43': 'm', + '\u0271': 'm', + '\u026F': 'm', + '\u24DD': 'n', + '\uFF4E': 'n', + '\u01F9': 'n', + '\u0144': 'n', + '\u00F1': 'n', + '\u1E45': 'n', + '\u0148': 'n', + '\u1E47': 'n', + '\u0146': 'n', + '\u1E4B': 'n', + '\u1E49': 'n', + '\u019E': 'n', + '\u0272': 'n', + '\u0149': 'n', + '\uA791': 'n', + '\uA7A5': 'n', + '\u01CC': 'nj', + '\u24DE': 'o', + '\uFF4F': 'o', + '\u00F2': 'o', + '\u00F3': 'o', + '\u00F4': 'o', + '\u1ED3': 'o', + '\u1ED1': 'o', + '\u1ED7': 'o', + '\u1ED5': 'o', + '\u00F5': 'o', + '\u1E4D': 'o', + '\u022D': 'o', + '\u1E4F': 'o', + '\u014D': 'o', + '\u1E51': 'o', + '\u1E53': 'o', + '\u014F': 'o', + '\u022F': 'o', + '\u0231': 'o', + '\u00F6': 'o', + '\u022B': 'o', + '\u1ECF': 'o', + '\u0151': 'o', + '\u01D2': 'o', + '\u020D': 'o', + '\u020F': 'o', + '\u01A1': 'o', + '\u1EDD': 'o', + '\u1EDB': 'o', + '\u1EE1': 'o', + '\u1EDF': 'o', + '\u1EE3': 'o', + '\u1ECD': 'o', + '\u1ED9': 'o', + '\u01EB': 'o', + '\u01ED': 'o', + '\u00F8': 'o', + '\u01FF': 'o', + '\u0254': 'o', + '\uA74B': 'o', + '\uA74D': 'o', + '\u0275': 'o', + '\u01A3': 'oi', + '\u0223': 'ou', + '\uA74F': 'oo', + '\u24DF': 'p', + '\uFF50': 'p', + '\u1E55': 'p', + '\u1E57': 'p', + '\u01A5': 'p', + '\u1D7D': 'p', + '\uA751': 'p', + '\uA753': 'p', + '\uA755': 'p', + '\u24E0': 'q', + '\uFF51': 'q', + '\u024B': 'q', + '\uA757': 'q', + '\uA759': 'q', + '\u24E1': 'r', + '\uFF52': 'r', + '\u0155': 'r', + '\u1E59': 'r', + '\u0159': 'r', + '\u0211': 'r', + '\u0213': 'r', + '\u1E5B': 'r', + '\u1E5D': 'r', + '\u0157': 'r', + '\u1E5F': 'r', + '\u024D': 'r', + '\u027D': 'r', + '\uA75B': 'r', + '\uA7A7': 'r', + '\uA783': 'r', + '\u24E2': 's', + '\uFF53': 's', + '\u00DF': 's', + '\u015B': 's', + '\u1E65': 's', + '\u015D': 's', + '\u1E61': 's', + '\u0161': 's', + '\u1E67': 's', + '\u1E63': 's', + '\u1E69': 's', + '\u0219': 's', + '\u015F': 's', + '\u023F': 's', + '\uA7A9': 's', + '\uA785': 's', + '\u1E9B': 's', + '\u24E3': 't', + '\uFF54': 't', + '\u1E6B': 't', + '\u1E97': 't', + '\u0165': 't', + '\u1E6D': 't', + '\u021B': 't', + '\u0163': 't', + '\u1E71': 't', + '\u1E6F': 't', + '\u0167': 't', + '\u01AD': 't', + '\u0288': 't', + '\u2C66': 't', + '\uA787': 't', + '\uA729': 'tz', + '\u24E4': 'u', + '\uFF55': 'u', + '\u00F9': 'u', + '\u00FA': 'u', + '\u00FB': 'u', + '\u0169': 'u', + '\u1E79': 'u', + '\u016B': 'u', + '\u1E7B': 'u', + '\u016D': 'u', + '\u00FC': 'u', + '\u01DC': 'u', + '\u01D8': 'u', + '\u01D6': 'u', + '\u01DA': 'u', + '\u1EE7': 'u', + '\u016F': 'u', + '\u0171': 'u', + '\u01D4': 'u', + '\u0215': 'u', + '\u0217': 'u', + '\u01B0': 'u', + '\u1EEB': 'u', + '\u1EE9': 'u', + '\u1EEF': 'u', + '\u1EED': 'u', + '\u1EF1': 'u', + '\u1EE5': 'u', + '\u1E73': 'u', + '\u0173': 'u', + '\u1E77': 'u', + '\u1E75': 'u', + '\u0289': 'u', + '\u24E5': 'v', + '\uFF56': 'v', + '\u1E7D': 'v', + '\u1E7F': 'v', + '\u028B': 'v', + '\uA75F': 'v', + '\u028C': 'v', + '\uA761': 'vy', + '\u24E6': 'w', + '\uFF57': 'w', + '\u1E81': 'w', + '\u1E83': 'w', + '\u0175': 'w', + '\u1E87': 'w', + '\u1E85': 'w', + '\u1E98': 'w', + '\u1E89': 'w', + '\u2C73': 'w', + '\u24E7': 'x', + '\uFF58': 'x', + '\u1E8B': 'x', + '\u1E8D': 'x', + '\u24E8': 'y', + '\uFF59': 'y', + '\u1EF3': 'y', + '\u00FD': 'y', + '\u0177': 'y', + '\u1EF9': 'y', + '\u0233': 'y', + '\u1E8F': 'y', + '\u00FF': 'y', + '\u1EF7': 'y', + '\u1E99': 'y', + '\u1EF5': 'y', + '\u01B4': 'y', + '\u024F': 'y', + '\u1EFF': 'y', + '\u24E9': 'z', + '\uFF5A': 'z', + '\u017A': 'z', + '\u1E91': 'z', + '\u017C': 'z', + '\u017E': 'z', + '\u1E93': 'z', + '\u1E95': 'z', + '\u01B6': 'z', + '\u0225': 'z', + '\u0240': 'z', + '\u2C6C': 'z', + '\uA763': 'z', + '\u0386': '\u0391', + '\u0388': '\u0395', + '\u0389': '\u0397', + '\u038A': '\u0399', + '\u03AA': '\u0399', + '\u038C': '\u039F', + '\u038E': '\u03A5', + '\u03AB': '\u03A5', + '\u038F': '\u03A9', + '\u03AC': '\u03B1', + '\u03AD': '\u03B5', + '\u03AE': '\u03B7', + '\u03AF': '\u03B9', + '\u03CA': '\u03B9', + '\u0390': '\u03B9', + '\u03CC': '\u03BF', + '\u03CD': '\u03C5', + '\u03CB': '\u03C5', + '\u03B0': '\u03C5', + '\u03C9': '\u03C9', + '\u03C2': '\u03C3' + }; + + return diacritics; +}); + +S2.define('select2/data/base',[ + '../utils' +], function (Utils) { + function BaseAdapter ($element, options) { + BaseAdapter.__super__.constructor.call(this); + } + + Utils.Extend(BaseAdapter, Utils.Observable); + + BaseAdapter.prototype.current = function (callback) { + throw new Error('The `current` method must be defined in child classes.'); + }; + + BaseAdapter.prototype.query = function (params, callback) { + throw new Error('The `query` method must be defined in child classes.'); + }; + + BaseAdapter.prototype.bind = function (container, $container) { + // Can be implemented in subclasses + }; + + BaseAdapter.prototype.destroy = function () { + // Can be implemented in subclasses + }; + + BaseAdapter.prototype.generateResultId = function (container, data) { + var id = container.id + '-result-'; + + id += Utils.generateChars(4); + + if (data.id != null) { + id += '-' + data.id.toString(); + } else { + id += '-' + Utils.generateChars(4); + } + return id; + }; + + return BaseAdapter; +}); + +S2.define('select2/data/select',[ + './base', + '../utils', + 'jquery' +], function (BaseAdapter, Utils, $) { + function SelectAdapter ($element, options) { + this.$element = $element; + this.options = options; + + SelectAdapter.__super__.constructor.call(this); + } + + Utils.Extend(SelectAdapter, BaseAdapter); + + SelectAdapter.prototype.current = function (callback) { + var data = []; + var self = this; + + this.$element.find(':selected').each(function () { + var $option = $(this); + + var option = self.item($option); + + data.push(option); + }); + + callback(data); + }; + + SelectAdapter.prototype.select = function (data) { + var self = this; + + data.selected = true; + + // If data.element is a DOM node, use it instead + if ($(data.element).is('option')) { + data.element.selected = true; + + this.$element.trigger('change'); + + return; + } + + if (this.$element.prop('multiple')) { + this.current(function (currentData) { + var val = []; + + data = [data]; + data.push.apply(data, currentData); + + for (var d = 0; d < data.length; d++) { + var id = data[d].id; + + if ($.inArray(id, val) === -1) { + val.push(id); + } + } + + self.$element.val(val); + self.$element.trigger('change'); + }); + } else { + var val = data.id; + + this.$element.val(val); + this.$element.trigger('change'); + } + }; + + SelectAdapter.prototype.unselect = function (data) { + var self = this; + + if (!this.$element.prop('multiple')) { + return; + } + + data.selected = false; + + if ($(data.element).is('option')) { + data.element.selected = false; + + this.$element.trigger('change'); + + return; + } + + this.current(function (currentData) { + var val = []; + + for (var d = 0; d < currentData.length; d++) { + var id = currentData[d].id; + + if (id !== data.id && $.inArray(id, val) === -1) { + val.push(id); + } + } + + self.$element.val(val); + + self.$element.trigger('change'); + }); + }; + + SelectAdapter.prototype.bind = function (container, $container) { + var self = this; + + this.container = container; + + container.on('select', function (params) { + self.select(params.data); + }); + + container.on('unselect', function (params) { + self.unselect(params.data); + }); + }; + + SelectAdapter.prototype.destroy = function () { + // Remove anything added to child elements + this.$element.find('*').each(function () { + // Remove any custom data set by Select2 + $.removeData(this, 'data'); + }); + }; + + SelectAdapter.prototype.query = function (params, callback) { + var data = []; + var self = this; + + var $options = this.$element.children(); + + $options.each(function () { + var $option = $(this); + + if (!$option.is('option') && !$option.is('optgroup')) { + return; + } + + var option = self.item($option); + + var matches = self.matches(params, option); + + if (matches !== null) { + data.push(matches); + } + }); + + callback({ + results: data + }); + }; + + SelectAdapter.prototype.addOptions = function ($options) { + Utils.appendMany(this.$element, $options); + }; + + SelectAdapter.prototype.option = function (data) { + var option; + + if (data.children) { + option = document.createElement('optgroup'); + option.label = data.text; + } else { + option = document.createElement('option'); + + if (option.textContent !== undefined) { + option.textContent = data.text; + } else { + option.innerText = data.text; + } + } + + if (data.id) { + option.value = data.id; + } + + if (data.disabled) { + option.disabled = true; + } + + if (data.selected) { + option.selected = true; + } + + if (data.title) { + option.title = data.title; + } + + var $option = $(option); + + var normalizedData = this._normalizeItem(data); + normalizedData.element = option; + + // Override the option's data with the combined data + $.data(option, 'data', normalizedData); + + return $option; + }; + + SelectAdapter.prototype.item = function ($option) { + var data = {}; + + data = $.data($option[0], 'data'); + + if (data != null) { + return data; + } + + if ($option.is('option')) { + data = { + id: $option.val(), + text: $option.text(), + disabled: $option.prop('disabled'), + selected: $option.prop('selected'), + title: $option.prop('title') + }; + } else if ($option.is('optgroup')) { + data = { + text: $option.prop('label'), + children: [], + title: $option.prop('title') + }; + + var $children = $option.children('option'); + var children = []; + + for (var c = 0; c < $children.length; c++) { + var $child = $($children[c]); + + var child = this.item($child); + + children.push(child); + } + + data.children = children; + } + + data = this._normalizeItem(data); + data.element = $option[0]; + + $.data($option[0], 'data', data); + + return data; + }; + + SelectAdapter.prototype._normalizeItem = function (item) { + if (!$.isPlainObject(item)) { + item = { + id: item, + text: item + }; + } + + item = $.extend({}, { + text: '' + }, item); + + var defaults = { + selected: false, + disabled: false + }; + + if (item.id != null) { + item.id = item.id.toString(); + } + + if (item.text != null) { + item.text = item.text.toString(); + } + + if (item._resultId == null && item.id && this.container != null) { + item._resultId = this.generateResultId(this.container, item); + } + + return $.extend({}, defaults, item); + }; + + SelectAdapter.prototype.matches = function (params, data) { + var matcher = this.options.get('matcher'); + + return matcher(params, data); + }; + + return SelectAdapter; +}); + +S2.define('select2/data/array',[ + './select', + '../utils', + 'jquery' +], function (SelectAdapter, Utils, $) { + function ArrayAdapter ($element, options) { + var data = options.get('data') || []; + + ArrayAdapter.__super__.constructor.call(this, $element, options); + + this.addOptions(this.convertToOptions(data)); + } + + Utils.Extend(ArrayAdapter, SelectAdapter); + + ArrayAdapter.prototype.select = function (data) { + var $option = this.$element.find('option').filter(function (i, elm) { + return elm.value == data.id.toString(); + }); + + if ($option.length === 0) { + $option = this.option(data); + + this.addOptions($option); + } + + ArrayAdapter.__super__.select.call(this, data); + }; + + ArrayAdapter.prototype.convertToOptions = function (data) { + var self = this; + + var $existing = this.$element.find('option'); + var existingIds = $existing.map(function () { + return self.item($(this)).id; + }).get(); + + var $options = []; + + // Filter out all items except for the one passed in the argument + function onlyItem (item) { + return function () { + return $(this).val() == item.id; + }; + } + + for (var d = 0; d < data.length; d++) { + var item = this._normalizeItem(data[d]); + + // Skip items which were pre-loaded, only merge the data + if ($.inArray(item.id, existingIds) >= 0) { + var $existingOption = $existing.filter(onlyItem(item)); + + var existingData = this.item($existingOption); + var newData = $.extend(true, {}, item, existingData); + + var $newOption = this.option(newData); + + $existingOption.replaceWith($newOption); + + continue; + } + + var $option = this.option(item); + + if (item.children) { + var $children = this.convertToOptions(item.children); + + Utils.appendMany($option, $children); + } + + $options.push($option); + } + + return $options; + }; + + return ArrayAdapter; +}); + +S2.define('select2/data/ajax',[ + './array', + '../utils', + 'jquery' +], function (ArrayAdapter, Utils, $) { + function AjaxAdapter ($element, options) { + this.ajaxOptions = this._applyDefaults(options.get('ajax')); + + if (this.ajaxOptions.processResults != null) { + this.processResults = this.ajaxOptions.processResults; + } + + AjaxAdapter.__super__.constructor.call(this, $element, options); + } + + Utils.Extend(AjaxAdapter, ArrayAdapter); + + AjaxAdapter.prototype._applyDefaults = function (options) { + var defaults = { + data: function (params) { + return $.extend({}, params, { + q: params.term + }); + }, + transport: function (params, success, failure) { + var $request = $.ajax(params); + + $request.then(success); + $request.fail(failure); + + return $request; + } + }; + + return $.extend({}, defaults, options, true); + }; + + AjaxAdapter.prototype.processResults = function (results) { + return results; + }; + + AjaxAdapter.prototype.query = function (params, callback) { + var matches = []; + var self = this; + + if (this._request != null) { + // JSONP requests cannot always be aborted + if ($.isFunction(this._request.abort)) { + this._request.abort(); + } + + this._request = null; + } + + var options = $.extend({ + type: 'GET' + }, this.ajaxOptions); + + if (typeof options.url === 'function') { + options.url = options.url.call(this.$element, params); + } + + if (typeof options.data === 'function') { + options.data = options.data.call(this.$element, params); + } + + function request () { + var $request = options.transport(options, function (data) { + var results = self.processResults(data, params); + + if (self.options.get('debug') && window.console && console.error) { + // Check to make sure that the response included a `results` key. + if (!results || !results.results || !$.isArray(results.results)) { + console.error( + 'Select2: The AJAX results did not return an array in the ' + + '`results` key of the response.' + ); + } + } + + callback(results); + }, function () { + // Attempt to detect if a request was aborted + // Only works if the transport exposes a status property + if ($request.status && $request.status === '0') { + return; + } + + self.trigger('results:message', { + message: 'errorLoading' + }); + }); + + self._request = $request; + } + + if (this.ajaxOptions.delay && params.term != null) { + if (this._queryTimeout) { + window.clearTimeout(this._queryTimeout); + } + + this._queryTimeout = window.setTimeout(request, this.ajaxOptions.delay); + } else { + request(); + } + }; + + return AjaxAdapter; +}); + +S2.define('select2/data/tags',[ + 'jquery' +], function ($) { + function Tags (decorated, $element, options) { + var tags = options.get('tags'); + + var createTag = options.get('createTag'); + + if (createTag !== undefined) { + this.createTag = createTag; + } + + var insertTag = options.get('insertTag'); + + if (insertTag !== undefined) { + this.insertTag = insertTag; + } + + decorated.call(this, $element, options); + + if ($.isArray(tags)) { + for (var t = 0; t < tags.length; t++) { + var tag = tags[t]; + var item = this._normalizeItem(tag); + + var $option = this.option(item); + + this.$element.append($option); + } + } + } + + Tags.prototype.query = function (decorated, params, callback) { + var self = this; + + this._removeOldTags(); + + if (params.term == null || params.page != null) { + decorated.call(this, params, callback); + return; + } + + function wrapper (obj, child) { + var data = obj.results; + + for (var i = 0; i < data.length; i++) { + var option = data[i]; + + var checkChildren = ( + option.children != null && + !wrapper({ + results: option.children + }, true) + ); + + var checkText = option.text === params.term; + + if (checkText || checkChildren) { + if (child) { + return false; + } + + obj.data = data; + callback(obj); + + return; + } + } + + if (child) { + return true; + } + + var tag = self.createTag(params); + + if (tag != null) { + var $option = self.option(tag); + $option.attr('data-select2-tag', true); + + self.addOptions([$option]); + + self.insertTag(data, tag); + } + + obj.results = data; + + callback(obj); + } + + decorated.call(this, params, wrapper); + }; + + Tags.prototype.createTag = function (decorated, params) { + var term = $.trim(params.term); + + if (term === '') { + return null; + } + + return { + id: term, + text: term + }; + }; + + Tags.prototype.insertTag = function (_, data, tag) { + data.unshift(tag); + }; + + Tags.prototype._removeOldTags = function (_) { + var tag = this._lastTag; + + var $options = this.$element.find('option[data-select2-tag]'); + + $options.each(function () { + if (this.selected) { + return; + } + + $(this).remove(); + }); + }; + + return Tags; +}); + +S2.define('select2/data/tokenizer',[ + 'jquery' +], function ($) { + function Tokenizer (decorated, $element, options) { + var tokenizer = options.get('tokenizer'); + + if (tokenizer !== undefined) { + this.tokenizer = tokenizer; + } + + decorated.call(this, $element, options); + } + + Tokenizer.prototype.bind = function (decorated, container, $container) { + decorated.call(this, container, $container); + + this.$search = container.dropdown.$search || container.selection.$search || + $container.find('.select2-search__field'); + }; + + Tokenizer.prototype.query = function (decorated, params, callback) { + var self = this; + + function createAndSelect (data) { + // Normalize the data object so we can use it for checks + var item = self._normalizeItem(data); + + // Check if the data object already exists as a tag + // Select it if it doesn't + var $existingOptions = self.$element.find('option').filter(function () { + return $(this).val() === item.id; + }); + + // If an existing option wasn't found for it, create the option + if (!$existingOptions.length) { + var $option = self.option(item); + $option.attr('data-select2-tag', true); + + self._removeOldTags(); + self.addOptions([$option]); + } + + // Select the item, now that we know there is an option for it + select(item); + } + + function select (data) { + self.trigger('select', { + data: data + }); + } + + params.term = params.term || ''; + + var tokenData = this.tokenizer(params, this.options, createAndSelect); + + if (tokenData.term !== params.term) { + // Replace the search term if we have the search box + if (this.$search.length) { + this.$search.val(tokenData.term); + this.$search.focus(); + } + + params.term = tokenData.term; + } + + decorated.call(this, params, callback); + }; + + Tokenizer.prototype.tokenizer = function (_, params, options, callback) { + var separators = options.get('tokenSeparators') || []; + var term = params.term; + var i = 0; + + var createTag = this.createTag || function (params) { + return { + id: params.term, + text: params.term + }; + }; + + while (i < term.length) { + var termChar = term[i]; + + if ($.inArray(termChar, separators) === -1) { + i++; + + continue; + } + + var part = term.substr(0, i); + var partParams = $.extend({}, params, { + term: part + }); + + var data = createTag(partParams); + + if (data == null) { + i++; + continue; + } + + callback(data); + + // Reset the term to not include the tokenized portion + term = term.substr(i + 1) || ''; + i = 0; + } + + return { + term: term + }; + }; + + return Tokenizer; +}); + +S2.define('select2/data/minimumInputLength',[ + +], function () { + function MinimumInputLength (decorated, $e, options) { + this.minimumInputLength = options.get('minimumInputLength'); + + decorated.call(this, $e, options); + } + + MinimumInputLength.prototype.query = function (decorated, params, callback) { + params.term = params.term || ''; + + if (params.term.length < this.minimumInputLength) { + this.trigger('results:message', { + message: 'inputTooShort', + args: { + minimum: this.minimumInputLength, + input: params.term, + params: params + } + }); + + return; + } + + decorated.call(this, params, callback); + }; + + return MinimumInputLength; +}); + +S2.define('select2/data/maximumInputLength',[ + +], function () { + function MaximumInputLength (decorated, $e, options) { + this.maximumInputLength = options.get('maximumInputLength'); + + decorated.call(this, $e, options); + } + + MaximumInputLength.prototype.query = function (decorated, params, callback) { + params.term = params.term || ''; + + if (this.maximumInputLength > 0 && + params.term.length > this.maximumInputLength) { + this.trigger('results:message', { + message: 'inputTooLong', + args: { + maximum: this.maximumInputLength, + input: params.term, + params: params + } + }); + + return; + } + + decorated.call(this, params, callback); + }; + + return MaximumInputLength; +}); + +S2.define('select2/data/maximumSelectionLength',[ + +], function (){ + function MaximumSelectionLength (decorated, $e, options) { + this.maximumSelectionLength = options.get('maximumSelectionLength'); + + decorated.call(this, $e, options); + } + + MaximumSelectionLength.prototype.query = + function (decorated, params, callback) { + var self = this; + + this.current(function (currentData) { + var count = currentData != null ? currentData.length : 0; + if (self.maximumSelectionLength > 0 && + count >= self.maximumSelectionLength) { + self.trigger('results:message', { + message: 'maximumSelected', + args: { + maximum: self.maximumSelectionLength + } + }); + return; + } + decorated.call(self, params, callback); + }); + }; + + return MaximumSelectionLength; +}); + +S2.define('select2/dropdown',[ + 'jquery', + './utils' +], function ($, Utils) { + function Dropdown ($element, options) { + this.$element = $element; + this.options = options; + + Dropdown.__super__.constructor.call(this); + } + + Utils.Extend(Dropdown, Utils.Observable); + + Dropdown.prototype.render = function () { + var $dropdown = $( + '<span class="select2-dropdown">' + + '<span class="select2-results"></span>' + + '</span>' + ); + + $dropdown.attr('dir', this.options.get('dir')); + + this.$dropdown = $dropdown; + + return $dropdown; + }; + + Dropdown.prototype.bind = function () { + // Should be implemented in subclasses + }; + + Dropdown.prototype.position = function ($dropdown, $container) { + // Should be implmented in subclasses + }; + + Dropdown.prototype.destroy = function () { + // Remove the dropdown from the DOM + this.$dropdown.remove(); + }; + + return Dropdown; +}); + +S2.define('select2/dropdown/search',[ + 'jquery', + '../utils' +], function ($, Utils) { + function Search () { } + + Search.prototype.render = function (decorated) { + var $rendered = decorated.call(this); + + var $search = $( + '<span class="select2-search select2-search--dropdown">' + + '<input class="select2-search__field" type="search" tabindex="-1"' + + ' autocomplete="off" autocorrect="off" autocapitalize="off"' + + ' spellcheck="false" role="textbox" />' + + '</span>' + ); + + this.$searchContainer = $search; + this.$search = $search.find('input'); + + $rendered.prepend($search); + + return $rendered; + }; + + Search.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + this.$search.on('keydown', function (evt) { + self.trigger('keypress', evt); + + self._keyUpPrevented = evt.isDefaultPrevented(); + }); + + // Workaround for browsers which do not support the `input` event + // This will prevent double-triggering of events for browsers which support + // both the `keyup` and `input` events. + this.$search.on('input', function (evt) { + // Unbind the duplicated `keyup` event + $(this).off('keyup'); + }); + + this.$search.on('keyup input', function (evt) { + self.handleSearch(evt); + }); + + container.on('open', function () { + self.$search.attr('tabindex', 0); + + self.$search.focus(); + + window.setTimeout(function () { + self.$search.focus(); + }, 0); + }); + + container.on('close', function () { + self.$search.attr('tabindex', -1); + + self.$search.val(''); + }); + + container.on('focus', function () { + if (container.isOpen()) { + self.$search.focus(); + } + }); + + container.on('results:all', function (params) { + if (params.query.term == null || params.query.term === '') { + var showSearch = self.showSearch(params); + + if (showSearch) { + self.$searchContainer.removeClass('select2-search--hide'); + } else { + self.$searchContainer.addClass('select2-search--hide'); + } + } + }); + }; + + Search.prototype.handleSearch = function (evt) { + if (!this._keyUpPrevented) { + var input = this.$search.val(); + + this.trigger('query', { + term: input + }); + } + + this._keyUpPrevented = false; + }; + + Search.prototype.showSearch = function (_, params) { + return true; + }; + + return Search; +}); + +S2.define('select2/dropdown/hidePlaceholder',[ + +], function () { + function HidePlaceholder (decorated, $element, options, dataAdapter) { + this.placeholder = this.normalizePlaceholder(options.get('placeholder')); + + decorated.call(this, $element, options, dataAdapter); + } + + HidePlaceholder.prototype.append = function (decorated, data) { + data.results = this.removePlaceholder(data.results); + + decorated.call(this, data); + }; + + HidePlaceholder.prototype.normalizePlaceholder = function (_, placeholder) { + if (typeof placeholder === 'string') { + placeholder = { + id: '', + text: placeholder + }; + } + + return placeholder; + }; + + HidePlaceholder.prototype.removePlaceholder = function (_, data) { + var modifiedData = data.slice(0); + + for (var d = data.length - 1; d >= 0; d--) { + var item = data[d]; + + if (this.placeholder.id === item.id) { + modifiedData.splice(d, 1); + } + } + + return modifiedData; + }; + + return HidePlaceholder; +}); + +S2.define('select2/dropdown/infiniteScroll',[ + 'jquery' +], function ($) { + function InfiniteScroll (decorated, $element, options, dataAdapter) { + this.lastParams = {}; + + decorated.call(this, $element, options, dataAdapter); + + this.$loadingMore = this.createLoadingMore(); + this.loading = false; + } + + InfiniteScroll.prototype.append = function (decorated, data) { + this.$loadingMore.remove(); + this.loading = false; + + decorated.call(this, data); + + if (this.showLoadingMore(data)) { + this.$results.append(this.$loadingMore); + } + }; + + InfiniteScroll.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + container.on('query', function (params) { + self.lastParams = params; + self.loading = true; + }); + + container.on('query:append', function (params) { + self.lastParams = params; + self.loading = true; + }); + + this.$results.on('scroll', function () { + var isLoadMoreVisible = $.contains( + document.documentElement, + self.$loadingMore[0] + ); + + if (self.loading || !isLoadMoreVisible) { + return; + } + + var currentOffset = self.$results.offset().top + + self.$results.outerHeight(false); + var loadingMoreOffset = self.$loadingMore.offset().top + + self.$loadingMore.outerHeight(false); + + if (currentOffset + 50 >= loadingMoreOffset) { + self.loadMore(); + } + }); + }; + + InfiniteScroll.prototype.loadMore = function () { + this.loading = true; + + var params = $.extend({}, {page: 1}, this.lastParams); + + params.page++; + + this.trigger('query:append', params); + }; + + InfiniteScroll.prototype.showLoadingMore = function (_, data) { + return data.pagination && data.pagination.more; + }; + + InfiniteScroll.prototype.createLoadingMore = function () { + var $option = $( + '<li ' + + 'class="select2-results__option select2-results__option--load-more"' + + 'role="treeitem" aria-disabled="true"></li>' + ); + + var message = this.options.get('translations').get('loadingMore'); + + $option.html(message(this.lastParams)); + + return $option; + }; + + return InfiniteScroll; +}); + +S2.define('select2/dropdown/attachBody',[ + 'jquery', + '../utils' +], function ($, Utils) { + function AttachBody (decorated, $element, options) { + this.$dropdownParent = options.get('dropdownParent') || $(document.body); + + decorated.call(this, $element, options); + } + + AttachBody.prototype.bind = function (decorated, container, $container) { + var self = this; + + var setupResultsEvents = false; + + decorated.call(this, container, $container); + + container.on('open', function () { + self._showDropdown(); + self._attachPositioningHandler(container); + + if (!setupResultsEvents) { + setupResultsEvents = true; + + container.on('results:all', function () { + self._positionDropdown(); + self._resizeDropdown(); + }); + + container.on('results:append', function () { + self._positionDropdown(); + self._resizeDropdown(); + }); + } + }); + + container.on('close', function () { + self._hideDropdown(); + self._detachPositioningHandler(container); + }); + + this.$dropdownContainer.on('mousedown', function (evt) { + evt.stopPropagation(); + }); + }; + + AttachBody.prototype.destroy = function (decorated) { + decorated.call(this); + + this.$dropdownContainer.remove(); + }; + + AttachBody.prototype.position = function (decorated, $dropdown, $container) { + // Clone all of the container classes + $dropdown.attr('class', $container.attr('class')); + + $dropdown.removeClass('select2'); + $dropdown.addClass('select2-container--open'); + + $dropdown.css({ + position: 'absolute', + top: -999999 + }); + + this.$container = $container; + }; + + AttachBody.prototype.render = function (decorated) { + var $container = $('<span></span>'); + + var $dropdown = decorated.call(this); + $container.append($dropdown); + + this.$dropdownContainer = $container; + + return $container; + }; + + AttachBody.prototype._hideDropdown = function (decorated) { + this.$dropdownContainer.detach(); + }; + + AttachBody.prototype._attachPositioningHandler = + function (decorated, container) { + var self = this; + + var scrollEvent = 'scroll.select2.' + container.id; + var resizeEvent = 'resize.select2.' + container.id; + var orientationEvent = 'orientationchange.select2.' + container.id; + + var $watchers = this.$container.parents().filter(Utils.hasScroll); + $watchers.each(function () { + $(this).data('select2-scroll-position', { + x: $(this).scrollLeft(), + y: $(this).scrollTop() + }); + }); + + $watchers.on(scrollEvent, function (ev) { + var position = $(this).data('select2-scroll-position'); + $(this).scrollTop(position.y); + }); + + $(window).on(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent, + function (e) { + self._positionDropdown(); + self._resizeDropdown(); + }); + }; + + AttachBody.prototype._detachPositioningHandler = + function (decorated, container) { + var scrollEvent = 'scroll.select2.' + container.id; + var resizeEvent = 'resize.select2.' + container.id; + var orientationEvent = 'orientationchange.select2.' + container.id; + + var $watchers = this.$container.parents().filter(Utils.hasScroll); + $watchers.off(scrollEvent); + + $(window).off(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent); + }; + + AttachBody.prototype._positionDropdown = function () { + var $window = $(window); + + var isCurrentlyAbove = this.$dropdown.hasClass('select2-dropdown--above'); + var isCurrentlyBelow = this.$dropdown.hasClass('select2-dropdown--below'); + + var newDirection = null; + + var offset = this.$container.offset(); + + offset.bottom = offset.top + this.$container.outerHeight(false); + + var container = { + height: this.$container.outerHeight(false) + }; + + container.top = offset.top; + container.bottom = offset.top + container.height; + + var dropdown = { + height: this.$dropdown.outerHeight(false) + }; + + var viewport = { + top: $window.scrollTop(), + bottom: $window.scrollTop() + $window.height() + }; + + var enoughRoomAbove = viewport.top < (offset.top - dropdown.height); + var enoughRoomBelow = viewport.bottom > (offset.bottom + dropdown.height); + + var css = { + left: offset.left, + top: container.bottom + }; + + // Determine what the parent element is to use for calciulating the offset + var $offsetParent = this.$dropdownParent; + + // For statically positoned elements, we need to get the element + // that is determining the offset + if ($offsetParent.css('position') === 'static') { + $offsetParent = $offsetParent.offsetParent(); + } + + var parentOffset = $offsetParent.offset(); + + css.top -= parentOffset.top; + css.left -= parentOffset.left; + + if (!isCurrentlyAbove && !isCurrentlyBelow) { + newDirection = 'below'; + } + + if (!enoughRoomBelow && enoughRoomAbove && !isCurrentlyAbove) { + newDirection = 'above'; + } else if (!enoughRoomAbove && enoughRoomBelow && isCurrentlyAbove) { + newDirection = 'below'; + } + + if (newDirection == 'above' || + (isCurrentlyAbove && newDirection !== 'below')) { + css.top = container.top - parentOffset.top - dropdown.height; + } + + if (newDirection != null) { + this.$dropdown + .removeClass('select2-dropdown--below select2-dropdown--above') + .addClass('select2-dropdown--' + newDirection); + this.$container + .removeClass('select2-container--below select2-container--above') + .addClass('select2-container--' + newDirection); + } + + this.$dropdownContainer.css(css); + }; + + AttachBody.prototype._resizeDropdown = function () { + var css = { + width: this.$container.outerWidth(false) + 'px' + }; + + if (this.options.get('dropdownAutoWidth')) { + css.minWidth = css.width; + css.position = 'relative'; + css.width = 'auto'; + } + + this.$dropdown.css(css); + }; + + AttachBody.prototype._showDropdown = function (decorated) { + this.$dropdownContainer.appendTo(this.$dropdownParent); + + this._positionDropdown(); + this._resizeDropdown(); + }; + + return AttachBody; +}); + +S2.define('select2/dropdown/minimumResultsForSearch',[ + +], function () { + function countResults (data) { + var count = 0; + + for (var d = 0; d < data.length; d++) { + var item = data[d]; + + if (item.children) { + count += countResults(item.children); + } else { + count++; + } + } + + return count; + } + + function MinimumResultsForSearch (decorated, $element, options, dataAdapter) { + this.minimumResultsForSearch = options.get('minimumResultsForSearch'); + + if (this.minimumResultsForSearch < 0) { + this.minimumResultsForSearch = Infinity; + } + + decorated.call(this, $element, options, dataAdapter); + } + + MinimumResultsForSearch.prototype.showSearch = function (decorated, params) { + if (countResults(params.data.results) < this.minimumResultsForSearch) { + return false; + } + + return decorated.call(this, params); + }; + + return MinimumResultsForSearch; +}); + +S2.define('select2/dropdown/selectOnClose',[ + +], function () { + function SelectOnClose () { } + + SelectOnClose.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + container.on('close', function (params) { + self._handleSelectOnClose(params); + }); + }; + + SelectOnClose.prototype._handleSelectOnClose = function (_, params) { + if (params && params.originalSelect2Event != null) { + var event = params.originalSelect2Event; + + // Don't select an item if the close event was triggered from a select or + // unselect event + if (event._type === 'select' || event._type === 'unselect') { + return; + } + } + + var $highlightedResults = this.getHighlightedResults(); + + // Only select highlighted results + if ($highlightedResults.length < 1) { + return; + } + + var data = $highlightedResults.data('data'); + + // Don't re-select already selected resulte + if ( + (data.element != null && data.element.selected) || + (data.element == null && data.selected) + ) { + return; + } + + this.trigger('select', { + data: data + }); + }; + + return SelectOnClose; +}); + +S2.define('select2/dropdown/closeOnSelect',[ + +], function () { + function CloseOnSelect () { } + + CloseOnSelect.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + container.on('select', function (evt) { + self._selectTriggered(evt); + }); + + container.on('unselect', function (evt) { + self._selectTriggered(evt); + }); + }; + + CloseOnSelect.prototype._selectTriggered = function (_, evt) { + var originalEvent = evt.originalEvent; + + // Don't close if the control key is being held + if (originalEvent && originalEvent.ctrlKey) { + return; + } + + this.trigger('close', { + originalEvent: originalEvent, + originalSelect2Event: evt + }); + }; + + return CloseOnSelect; +}); + +S2.define('select2/i18n/en',[],function () { + // English + return { + errorLoading: function () { + return 'The results could not be loaded.'; + }, + inputTooLong: function (args) { + var overChars = args.input.length - args.maximum; + + var message = 'Please delete ' + overChars + ' character'; + + if (overChars != 1) { + message += 's'; + } + + return message; + }, + inputTooShort: function (args) { + var remainingChars = args.minimum - args.input.length; + + var message = 'Please enter ' + remainingChars + ' or more characters'; + + return message; + }, + loadingMore: function () { + return 'Loading more results…'; + }, + maximumSelected: function (args) { + var message = 'You can only select ' + args.maximum + ' item'; + + if (args.maximum != 1) { + message += 's'; + } + + return message; + }, + noResults: function () { + return 'No results found'; + }, + searching: function () { + return 'Searching…'; + } + }; +}); + +S2.define('select2/defaults',[ + 'jquery', + 'require', + + './results', + + './selection/single', + './selection/multiple', + './selection/placeholder', + './selection/allowClear', + './selection/search', + './selection/eventRelay', + + './utils', + './translation', + './diacritics', + + './data/select', + './data/array', + './data/ajax', + './data/tags', + './data/tokenizer', + './data/minimumInputLength', + './data/maximumInputLength', + './data/maximumSelectionLength', + + './dropdown', + './dropdown/search', + './dropdown/hidePlaceholder', + './dropdown/infiniteScroll', + './dropdown/attachBody', + './dropdown/minimumResultsForSearch', + './dropdown/selectOnClose', + './dropdown/closeOnSelect', + + './i18n/en' +], function ($, require, + + ResultsList, + + SingleSelection, MultipleSelection, Placeholder, AllowClear, + SelectionSearch, EventRelay, + + Utils, Translation, DIACRITICS, + + SelectData, ArrayData, AjaxData, Tags, Tokenizer, + MinimumInputLength, MaximumInputLength, MaximumSelectionLength, + + Dropdown, DropdownSearch, HidePlaceholder, InfiniteScroll, + AttachBody, MinimumResultsForSearch, SelectOnClose, CloseOnSelect, + + EnglishTranslation) { + function Defaults () { + this.reset(); + } + + Defaults.prototype.apply = function (options) { + options = $.extend(true, {}, this.defaults, options); + + if (options.dataAdapter == null) { + if (options.ajax != null) { + options.dataAdapter = AjaxData; + } else if (options.data != null) { + options.dataAdapter = ArrayData; + } else { + options.dataAdapter = SelectData; + } + + if (options.minimumInputLength > 0) { + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + MinimumInputLength + ); + } + + if (options.maximumInputLength > 0) { + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + MaximumInputLength + ); + } + + if (options.maximumSelectionLength > 0) { + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + MaximumSelectionLength + ); + } + + if (options.tags) { + options.dataAdapter = Utils.Decorate(options.dataAdapter, Tags); + } + + if (options.tokenSeparators != null || options.tokenizer != null) { + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + Tokenizer + ); + } + + if (options.query != null) { + var Query = require(options.amdBase + 'compat/query'); + + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + Query + ); + } + + if (options.initSelection != null) { + var InitSelection = require(options.amdBase + 'compat/initSelection'); + + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + InitSelection + ); + } + } + + if (options.resultsAdapter == null) { + options.resultsAdapter = ResultsList; + + if (options.ajax != null) { + options.resultsAdapter = Utils.Decorate( + options.resultsAdapter, + InfiniteScroll + ); + } + + if (options.placeholder != null) { + options.resultsAdapter = Utils.Decorate( + options.resultsAdapter, + HidePlaceholder + ); + } + + if (options.selectOnClose) { + options.resultsAdapter = Utils.Decorate( + options.resultsAdapter, + SelectOnClose + ); + } + } + + if (options.dropdownAdapter == null) { + if (options.multiple) { + options.dropdownAdapter = Dropdown; + } else { + var SearchableDropdown = Utils.Decorate(Dropdown, DropdownSearch); + + options.dropdownAdapter = SearchableDropdown; + } + + if (options.minimumResultsForSearch !== 0) { + options.dropdownAdapter = Utils.Decorate( + options.dropdownAdapter, + MinimumResultsForSearch + ); + } + + if (options.closeOnSelect) { + options.dropdownAdapter = Utils.Decorate( + options.dropdownAdapter, + CloseOnSelect + ); + } + + if ( + options.dropdownCssClass != null || + options.dropdownCss != null || + options.adaptDropdownCssClass != null + ) { + var DropdownCSS = require(options.amdBase + 'compat/dropdownCss'); + + options.dropdownAdapter = Utils.Decorate( + options.dropdownAdapter, + DropdownCSS + ); + } + + options.dropdownAdapter = Utils.Decorate( + options.dropdownAdapter, + AttachBody + ); + } + + if (options.selectionAdapter == null) { + if (options.multiple) { + options.selectionAdapter = MultipleSelection; + } else { + options.selectionAdapter = SingleSelection; + } + + // Add the placeholder mixin if a placeholder was specified + if (options.placeholder != null) { + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + Placeholder + ); + } + + if (options.allowClear) { + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + AllowClear + ); + } + + if (options.multiple) { + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + SelectionSearch + ); + } + + if ( + options.containerCssClass != null || + options.containerCss != null || + options.adaptContainerCssClass != null + ) { + var ContainerCSS = require(options.amdBase + 'compat/containerCss'); + + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + ContainerCSS + ); + } + + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + EventRelay + ); + } + + if (typeof options.language === 'string') { + // Check if the language is specified with a region + if (options.language.indexOf('-') > 0) { + // Extract the region information if it is included + var languageParts = options.language.split('-'); + var baseLanguage = languageParts[0]; + + options.language = [options.language, baseLanguage]; + } else { + options.language = [options.language]; + } + } + + if ($.isArray(options.language)) { + var languages = new Translation(); + options.language.push('en'); + + var languageNames = options.language; + + for (var l = 0; l < languageNames.length; l++) { + var name = languageNames[l]; + var language = {}; + + try { + // Try to load it with the original name + language = Translation.loadPath(name); + } catch (e) { + try { + // If we couldn't load it, check if it wasn't the full path + name = this.defaults.amdLanguageBase + name; + language = Translation.loadPath(name); + } catch (ex) { + // The translation could not be loaded at all. Sometimes this is + // because of a configuration problem, other times this can be + // because of how Select2 helps load all possible translation files. + if (options.debug && window.console && console.warn) { + console.warn( + 'Select2: The language file for "' + name + '" could not be ' + + 'automatically loaded. A fallback will be used instead.' + ); + } + + continue; + } + } + + languages.extend(language); + } + + options.translations = languages; + } else { + var baseTranslation = Translation.loadPath( + this.defaults.amdLanguageBase + 'en' + ); + var customTranslation = new Translation(options.language); + + customTranslation.extend(baseTranslation); + + options.translations = customTranslation; + } + + return options; + }; + + Defaults.prototype.reset = function () { + function stripDiacritics (text) { + // Used 'uni range + named function' from http://jsperf.com/diacritics/18 + function match(a) { + return DIACRITICS[a] || a; + } + + return text.replace(/[^\u0000-\u007E]/g, match); + } + + function matcher (params, data) { + // Always return the object if there is nothing to compare + if ($.trim(params.term) === '') { + return data; + } + + // Do a recursive check for options with children + if (data.children && data.children.length > 0) { + // Clone the data object if there are children + // This is required as we modify the object to remove any non-matches + var match = $.extend(true, {}, data); + + // Check each child of the option + for (var c = data.children.length - 1; c >= 0; c--) { + var child = data.children[c]; + + var matches = matcher(params, child); + + // If there wasn't a match, remove the object in the array + if (matches == null) { + match.children.splice(c, 1); + } + } + + // If any children matched, return the new object + if (match.children.length > 0) { + return match; + } + + // If there were no matching children, check just the plain object + return matcher(params, match); + } + + var original = stripDiacritics(data.text).toUpperCase(); + var term = stripDiacritics(params.term).toUpperCase(); + + // Check if the text contains the term + if (original.indexOf(term) > -1) { + return data; + } + + // If it doesn't contain the term, don't return anything + return null; + } + + this.defaults = { + amdBase: './', + amdLanguageBase: './i18n/', + closeOnSelect: true, + debug: false, + dropdownAutoWidth: false, + escapeMarkup: Utils.escapeMarkup, + language: EnglishTranslation, + matcher: matcher, + minimumInputLength: 0, + maximumInputLength: 0, + maximumSelectionLength: 0, + minimumResultsForSearch: 0, + selectOnClose: false, + sorter: function (data) { + return data; + }, + templateResult: function (result) { + return result.text; + }, + templateSelection: function (selection) { + return selection.text; + }, + theme: 'default', + width: 'resolve' + }; + }; + + Defaults.prototype.set = function (key, value) { + var camelKey = $.camelCase(key); + + var data = {}; + data[camelKey] = value; + + var convertedData = Utils._convertData(data); + + $.extend(this.defaults, convertedData); + }; + + var defaults = new Defaults(); + + return defaults; +}); + +S2.define('select2/options',[ + 'require', + 'jquery', + './defaults', + './utils' +], function (require, $, Defaults, Utils) { + function Options (options, $element) { + this.options = options; + + if ($element != null) { + this.fromElement($element); + } + + this.options = Defaults.apply(this.options); + + if ($element && $element.is('input')) { + var InputCompat = require(this.get('amdBase') + 'compat/inputData'); + + this.options.dataAdapter = Utils.Decorate( + this.options.dataAdapter, + InputCompat + ); + } + } + + Options.prototype.fromElement = function ($e) { + var excludedData = ['select2']; + + if (this.options.multiple == null) { + this.options.multiple = $e.prop('multiple'); + } + + if (this.options.disabled == null) { + this.options.disabled = $e.prop('disabled'); + } + + if (this.options.language == null) { + if ($e.prop('lang')) { + this.options.language = $e.prop('lang').toLowerCase(); + } else if ($e.closest('[lang]').prop('lang')) { + this.options.language = $e.closest('[lang]').prop('lang'); + } + } + + if (this.options.dir == null) { + if ($e.prop('dir')) { + this.options.dir = $e.prop('dir'); + } else if ($e.closest('[dir]').prop('dir')) { + this.options.dir = $e.closest('[dir]').prop('dir'); + } else { + this.options.dir = 'ltr'; + } + } + + $e.prop('disabled', this.options.disabled); + $e.prop('multiple', this.options.multiple); + + if ($e.data('select2Tags')) { + if (this.options.debug && window.console && console.warn) { + console.warn( + 'Select2: The `data-select2-tags` attribute has been changed to ' + + 'use the `data-data` and `data-tags="true"` attributes and will be ' + + 'removed in future versions of Select2.' + ); + } + + $e.data('data', $e.data('select2Tags')); + $e.data('tags', true); + } + + if ($e.data('ajaxUrl')) { + if (this.options.debug && window.console && console.warn) { + console.warn( + 'Select2: The `data-ajax-url` attribute has been changed to ' + + '`data-ajax--url` and support for the old attribute will be removed' + + ' in future versions of Select2.' + ); + } + + $e.attr('ajax--url', $e.data('ajaxUrl')); + $e.data('ajax--url', $e.data('ajaxUrl')); + } + + var dataset = {}; + + // Prefer the element's `dataset` attribute if it exists + // jQuery 1.x does not correctly handle data attributes with multiple dashes + if ($.fn.jquery && $.fn.jquery.substr(0, 2) == '1.' && $e[0].dataset) { + dataset = $.extend(true, {}, $e[0].dataset, $e.data()); + } else { + dataset = $e.data(); + } + + var data = $.extend(true, {}, dataset); + + data = Utils._convertData(data); + + for (var key in data) { + if ($.inArray(key, excludedData) > -1) { + continue; + } + + if ($.isPlainObject(this.options[key])) { + $.extend(this.options[key], data[key]); + } else { + this.options[key] = data[key]; + } + } + + return this; + }; + + Options.prototype.get = function (key) { + return this.options[key]; + }; + + Options.prototype.set = function (key, val) { + this.options[key] = val; + }; + + return Options; +}); + +S2.define('select2/core',[ + 'jquery', + './options', + './utils', + './keys' +], function ($, Options, Utils, KEYS) { + var Select2 = function ($element, options) { + if ($element.data('select2') != null) { + $element.data('select2').destroy(); + } + + this.$element = $element; + + this.id = this._generateId($element); + + options = options || {}; + + this.options = new Options(options, $element); + + Select2.__super__.constructor.call(this); + + // Set up the tabindex + + var tabindex = $element.attr('tabindex') || 0; + $element.data('old-tabindex', tabindex); + $element.attr('tabindex', '-1'); + + // Set up containers and adapters + + var DataAdapter = this.options.get('dataAdapter'); + this.dataAdapter = new DataAdapter($element, this.options); + + var $container = this.render(); + + this._placeContainer($container); + + var SelectionAdapter = this.options.get('selectionAdapter'); + this.selection = new SelectionAdapter($element, this.options); + this.$selection = this.selection.render(); + + this.selection.position(this.$selection, $container); + + var DropdownAdapter = this.options.get('dropdownAdapter'); + this.dropdown = new DropdownAdapter($element, this.options); + this.$dropdown = this.dropdown.render(); + + this.dropdown.position(this.$dropdown, $container); + + var ResultsAdapter = this.options.get('resultsAdapter'); + this.results = new ResultsAdapter($element, this.options, this.dataAdapter); + this.$results = this.results.render(); + + this.results.position(this.$results, this.$dropdown); + + // Bind events + + var self = this; + + // Bind the container to all of the adapters + this._bindAdapters(); + + // Register any DOM event handlers + this._registerDomEvents(); + + // Register any internal event handlers + this._registerDataEvents(); + this._registerSelectionEvents(); + this._registerDropdownEvents(); + this._registerResultsEvents(); + this._registerEvents(); + + // Set the initial state + this.dataAdapter.current(function (initialData) { + self.trigger('selection:update', { + data: initialData + }); + }); + + // Hide the original select + $element.addClass('select2-hidden-accessible'); + $element.attr('aria-hidden', 'true'); + + // Synchronize any monitored attributes + this._syncAttributes(); + + $element.data('select2', this); + }; + + Utils.Extend(Select2, Utils.Observable); + + Select2.prototype._generateId = function ($element) { + var id = ''; + + if ($element.attr('id') != null) { + id = $element.attr('id'); + } else if ($element.attr('name') != null) { + id = $element.attr('name') + '-' + Utils.generateChars(2); + } else { + id = Utils.generateChars(4); + } + + id = id.replace(/(:|\.|\[|\]|,)/g, ''); + id = 'select2-' + id; + + return id; + }; + + Select2.prototype._placeContainer = function ($container) { + $container.insertAfter(this.$element); + + var width = this._resolveWidth(this.$element, this.options.get('width')); + + if (width != null) { + $container.css('width', width); + } + }; + + Select2.prototype._resolveWidth = function ($element, method) { + var WIDTH = /^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i; + + if (method == 'resolve') { + var styleWidth = this._resolveWidth($element, 'style'); + + if (styleWidth != null) { + return styleWidth; + } + + return this._resolveWidth($element, 'element'); + } + + if (method == 'element') { + var elementWidth = $element.outerWidth(false); + + if (elementWidth <= 0) { + return 'auto'; + } + + return elementWidth + 'px'; + } + + if (method == 'style') { + var style = $element.attr('style'); + + if (typeof(style) !== 'string') { + return null; + } + + var attrs = style.split(';'); + + for (var i = 0, l = attrs.length; i < l; i = i + 1) { + var attr = attrs[i].replace(/\s/g, ''); + var matches = attr.match(WIDTH); + + if (matches !== null && matches.length >= 1) { + return matches[1]; + } + } + + return null; + } + + return method; + }; + + Select2.prototype._bindAdapters = function () { + this.dataAdapter.bind(this, this.$container); + this.selection.bind(this, this.$container); + + this.dropdown.bind(this, this.$container); + this.results.bind(this, this.$container); + }; + + Select2.prototype._registerDomEvents = function () { + var self = this; + + this.$element.on('change.select2', function () { + self.dataAdapter.current(function (data) { + self.trigger('selection:update', { + data: data + }); + }); + }); + + this.$element.on('focus.select2', function (evt) { + self.trigger('focus', evt); + }); + + this._syncA = Utils.bind(this._syncAttributes, this); + this._syncS = Utils.bind(this._syncSubtree, this); + + if (this.$element[0].attachEvent) { + this.$element[0].attachEvent('onpropertychange', this._syncA); + } + + var observer = window.MutationObserver || + window.WebKitMutationObserver || + window.MozMutationObserver + ; + + if (observer != null) { + this._observer = new observer(function (mutations) { + $.each(mutations, self._syncA); + $.each(mutations, self._syncS); + }); + this._observer.observe(this.$element[0], { + attributes: true, + childList: true, + subtree: false + }); + } else if (this.$element[0].addEventListener) { + this.$element[0].addEventListener( + 'DOMAttrModified', + self._syncA, + false + ); + this.$element[0].addEventListener( + 'DOMNodeInserted', + self._syncS, + false + ); + this.$element[0].addEventListener( + 'DOMNodeRemoved', + self._syncS, + false + ); + } + }; + + Select2.prototype._registerDataEvents = function () { + var self = this; + + this.dataAdapter.on('*', function (name, params) { + self.trigger(name, params); + }); + }; + + Select2.prototype._registerSelectionEvents = function () { + var self = this; + var nonRelayEvents = ['toggle', 'focus']; + + this.selection.on('toggle', function () { + self.toggleDropdown(); + }); + + this.selection.on('focus', function (params) { + self.focus(params); + }); + + this.selection.on('*', function (name, params) { + if ($.inArray(name, nonRelayEvents) !== -1) { + return; + } + + self.trigger(name, params); + }); + }; + + Select2.prototype._registerDropdownEvents = function () { + var self = this; + + this.dropdown.on('*', function (name, params) { + self.trigger(name, params); + }); + }; + + Select2.prototype._registerResultsEvents = function () { + var self = this; + + this.results.on('*', function (name, params) { + self.trigger(name, params); + }); + }; + + Select2.prototype._registerEvents = function () { + var self = this; + + this.on('open', function () { + self.$container.addClass('select2-container--open'); + }); + + this.on('close', function () { + self.$container.removeClass('select2-container--open'); + }); + + this.on('enable', function () { + self.$container.removeClass('select2-container--disabled'); + }); + + this.on('disable', function () { + self.$container.addClass('select2-container--disabled'); + }); + + this.on('blur', function () { + self.$container.removeClass('select2-container--focus'); + }); + + this.on('query', function (params) { + if (!self.isOpen()) { + self.trigger('open', {}); + } + + this.dataAdapter.query(params, function (data) { + self.trigger('results:all', { + data: data, + query: params + }); + }); + }); + + this.on('query:append', function (params) { + this.dataAdapter.query(params, function (data) { + self.trigger('results:append', { + data: data, + query: params + }); + }); + }); + + this.on('keypress', function (evt) { + var key = evt.which; + + if (self.isOpen()) { + if (key === KEYS.ESC || key === KEYS.TAB || + (key === KEYS.UP && evt.altKey)) { + self.close(); + + evt.preventDefault(); + } else if (key === KEYS.ENTER) { + self.trigger('results:select', {}); + + evt.preventDefault(); + } else if ((key === KEYS.SPACE && evt.ctrlKey)) { + self.trigger('results:toggle', {}); + + evt.preventDefault(); + } else if (key === KEYS.UP) { + self.trigger('results:previous', {}); + + evt.preventDefault(); + } else if (key === KEYS.DOWN) { + self.trigger('results:next', {}); + + evt.preventDefault(); + } + } else { + if (key === KEYS.ENTER || key === KEYS.SPACE || + (key === KEYS.DOWN && evt.altKey)) { + self.open(); + + evt.preventDefault(); + } + } + }); + }; + + Select2.prototype._syncAttributes = function () { + this.options.set('disabled', this.$element.prop('disabled')); + + if (this.options.get('disabled')) { + if (this.isOpen()) { + this.close(); + } + + this.trigger('disable', {}); + } else { + this.trigger('enable', {}); + } + }; + + Select2.prototype._syncSubtree = function (evt, mutations) { + var changed = false; + var self = this; + + // Ignore any mutation events raised for elements that aren't options or + // optgroups. This handles the case when the select element is destroyed + if ( + evt && evt.target && ( + evt.target.nodeName !== 'OPTION' && evt.target.nodeName !== 'OPTGROUP' + ) + ) { + return; + } + + if (!mutations) { + // If mutation events aren't supported, then we can only assume that the + // change affected the selections + changed = true; + } else if (mutations.addedNodes && mutations.addedNodes.length > 0) { + for (var n = 0; n < mutations.addedNodes.length; n++) { + var node = mutations.addedNodes[n]; + + if (node.selected) { + changed = true; + } + } + } else if (mutations.removedNodes && mutations.removedNodes.length > 0) { + changed = true; + } + + // Only re-pull the data if we think there is a change + if (changed) { + this.dataAdapter.current(function (currentData) { + self.trigger('selection:update', { + data: currentData + }); + }); + } + }; + + /** + * Override the trigger method to automatically trigger pre-events when + * there are events that can be prevented. + */ + Select2.prototype.trigger = function (name, args) { + var actualTrigger = Select2.__super__.trigger; + var preTriggerMap = { + 'open': 'opening', + 'close': 'closing', + 'select': 'selecting', + 'unselect': 'unselecting' + }; + + if (args === undefined) { + args = {}; + } + + if (name in preTriggerMap) { + var preTriggerName = preTriggerMap[name]; + var preTriggerArgs = { + prevented: false, + name: name, + args: args + }; + + actualTrigger.call(this, preTriggerName, preTriggerArgs); + + if (preTriggerArgs.prevented) { + args.prevented = true; + + return; + } + } + + actualTrigger.call(this, name, args); + }; + + Select2.prototype.toggleDropdown = function () { + if (this.options.get('disabled')) { + return; + } + + if (this.isOpen()) { + this.close(); + } else { + this.open(); + } + }; + + Select2.prototype.open = function () { + if (this.isOpen()) { + return; + } + + this.trigger('query', {}); + }; + + Select2.prototype.close = function () { + if (!this.isOpen()) { + return; + } + + this.trigger('close', {}); + }; + + Select2.prototype.isOpen = function () { + return this.$container.hasClass('select2-container--open'); + }; + + Select2.prototype.hasFocus = function () { + return this.$container.hasClass('select2-container--focus'); + }; + + Select2.prototype.focus = function (data) { + // No need to re-trigger focus events if we are already focused + if (this.hasFocus()) { + return; + } + + this.$container.addClass('select2-container--focus'); + this.trigger('focus', {}); + }; + + Select2.prototype.enable = function (args) { + if (this.options.get('debug') && window.console && console.warn) { + console.warn( + 'Select2: The `select2("enable")` method has been deprecated and will' + + ' be removed in later Select2 versions. Use $element.prop("disabled")' + + ' instead.' + ); + } + + if (args == null || args.length === 0) { + args = [true]; + } + + var disabled = !args[0]; + + this.$element.prop('disabled', disabled); + }; + + Select2.prototype.data = function () { + if (this.options.get('debug') && + arguments.length > 0 && window.console && console.warn) { + console.warn( + 'Select2: Data can no longer be set using `select2("data")`. You ' + + 'should consider setting the value instead using `$element.val()`.' + ); + } + + var data = []; + + this.dataAdapter.current(function (currentData) { + data = currentData; + }); + + return data; + }; + + Select2.prototype.val = function (args) { + if (this.options.get('debug') && window.console && console.warn) { + console.warn( + 'Select2: The `select2("val")` method has been deprecated and will be' + + ' removed in later Select2 versions. Use $element.val() instead.' + ); + } + + if (args == null || args.length === 0) { + return this.$element.val(); + } + + var newVal = args[0]; + + if ($.isArray(newVal)) { + newVal = $.map(newVal, function (obj) { + return obj.toString(); + }); + } + + this.$element.val(newVal).trigger('change'); + }; + + Select2.prototype.destroy = function () { + this.$container.remove(); + + if (this.$element[0].detachEvent) { + this.$element[0].detachEvent('onpropertychange', this._syncA); + } + + if (this._observer != null) { + this._observer.disconnect(); + this._observer = null; + } else if (this.$element[0].removeEventListener) { + this.$element[0] + .removeEventListener('DOMAttrModified', this._syncA, false); + this.$element[0] + .removeEventListener('DOMNodeInserted', this._syncS, false); + this.$element[0] + .removeEventListener('DOMNodeRemoved', this._syncS, false); + } + + this._syncA = null; + this._syncS = null; + + this.$element.off('.select2'); + this.$element.attr('tabindex', this.$element.data('old-tabindex')); + + this.$element.removeClass('select2-hidden-accessible'); + this.$element.attr('aria-hidden', 'false'); + this.$element.removeData('select2'); + + this.dataAdapter.destroy(); + this.selection.destroy(); + this.dropdown.destroy(); + this.results.destroy(); + + this.dataAdapter = null; + this.selection = null; + this.dropdown = null; + this.results = null; + }; + + Select2.prototype.render = function () { + var $container = $( + '<span class="select2 select2-container">' + + '<span class="selection"></span>' + + '<span class="dropdown-wrapper" aria-hidden="true"></span>' + + '</span>' + ); + + $container.attr('dir', this.options.get('dir')); + + this.$container = $container; + + this.$container.addClass('select2-container--' + this.options.get('theme')); + + $container.data('element', this.$element); + + return $container; + }; + + return Select2; +}); + +S2.define('select2/compat/utils',[ + 'jquery' +], function ($) { + function syncCssClasses ($dest, $src, adapter) { + var classes, replacements = [], adapted; + + classes = $.trim($dest.attr('class')); + + if (classes) { + classes = '' + classes; // for IE which returns object + + $(classes.split(/\s+/)).each(function () { + // Save all Select2 classes + if (this.indexOf('select2-') === 0) { + replacements.push(this); + } + }); + } + + classes = $.trim($src.attr('class')); + + if (classes) { + classes = '' + classes; // for IE which returns object + + $(classes.split(/\s+/)).each(function () { + // Only adapt non-Select2 classes + if (this.indexOf('select2-') !== 0) { + adapted = adapter(this); + + if (adapted != null) { + replacements.push(adapted); + } + } + }); + } + + $dest.attr('class', replacements.join(' ')); + } + + return { + syncCssClasses: syncCssClasses + }; +}); + +S2.define('select2/compat/containerCss',[ + 'jquery', + './utils' +], function ($, CompatUtils) { + // No-op CSS adapter that discards all classes by default + function _containerAdapter (clazz) { + return null; + } + + function ContainerCSS () { } + + ContainerCSS.prototype.render = function (decorated) { + var $container = decorated.call(this); + + var containerCssClass = this.options.get('containerCssClass') || ''; + + if ($.isFunction(containerCssClass)) { + containerCssClass = containerCssClass(this.$element); + } + + var containerCssAdapter = this.options.get('adaptContainerCssClass'); + containerCssAdapter = containerCssAdapter || _containerAdapter; + + if (containerCssClass.indexOf(':all:') !== -1) { + containerCssClass = containerCssClass.replace(':all:', ''); + + var _cssAdapter = containerCssAdapter; + + containerCssAdapter = function (clazz) { + var adapted = _cssAdapter(clazz); + + if (adapted != null) { + // Append the old one along with the adapted one + return adapted + ' ' + clazz; + } + + return clazz; + }; + } + + var containerCss = this.options.get('containerCss') || {}; + + if ($.isFunction(containerCss)) { + containerCss = containerCss(this.$element); + } + + CompatUtils.syncCssClasses($container, this.$element, containerCssAdapter); + + $container.css(containerCss); + $container.addClass(containerCssClass); + + return $container; + }; + + return ContainerCSS; +}); + +S2.define('select2/compat/dropdownCss',[ + 'jquery', + './utils' +], function ($, CompatUtils) { + // No-op CSS adapter that discards all classes by default + function _dropdownAdapter (clazz) { + return null; + } + + function DropdownCSS () { } + + DropdownCSS.prototype.render = function (decorated) { + var $dropdown = decorated.call(this); + + var dropdownCssClass = this.options.get('dropdownCssClass') || ''; + + if ($.isFunction(dropdownCssClass)) { + dropdownCssClass = dropdownCssClass(this.$element); + } + + var dropdownCssAdapter = this.options.get('adaptDropdownCssClass'); + dropdownCssAdapter = dropdownCssAdapter || _dropdownAdapter; + + if (dropdownCssClass.indexOf(':all:') !== -1) { + dropdownCssClass = dropdownCssClass.replace(':all:', ''); + + var _cssAdapter = dropdownCssAdapter; + + dropdownCssAdapter = function (clazz) { + var adapted = _cssAdapter(clazz); + + if (adapted != null) { + // Append the old one along with the adapted one + return adapted + ' ' + clazz; + } + + return clazz; + }; + } + + var dropdownCss = this.options.get('dropdownCss') || {}; + + if ($.isFunction(dropdownCss)) { + dropdownCss = dropdownCss(this.$element); + } + + CompatUtils.syncCssClasses($dropdown, this.$element, dropdownCssAdapter); + + $dropdown.css(dropdownCss); + $dropdown.addClass(dropdownCssClass); + + return $dropdown; + }; + + return DropdownCSS; +}); + +S2.define('select2/compat/initSelection',[ + 'jquery' +], function ($) { + function InitSelection (decorated, $element, options) { + if (options.get('debug') && window.console && console.warn) { + console.warn( + 'Select2: The `initSelection` option has been deprecated in favor' + + ' of a custom data adapter that overrides the `current` method. ' + + 'This method is now called multiple times instead of a single ' + + 'time when the instance is initialized. Support will be removed ' + + 'for the `initSelection` option in future versions of Select2' + ); + } + + this.initSelection = options.get('initSelection'); + this._isInitialized = false; + + decorated.call(this, $element, options); + } + + InitSelection.prototype.current = function (decorated, callback) { + var self = this; + + if (this._isInitialized) { + decorated.call(this, callback); + + return; + } + + this.initSelection.call(null, this.$element, function (data) { + self._isInitialized = true; + + if (!$.isArray(data)) { + data = [data]; + } + + callback(data); + }); + }; + + return InitSelection; +}); + +S2.define('select2/compat/inputData',[ + 'jquery' +], function ($) { + function InputData (decorated, $element, options) { + this._currentData = []; + this._valueSeparator = options.get('valueSeparator') || ','; + + if ($element.prop('type') === 'hidden') { + if (options.get('debug') && console && console.warn) { + console.warn( + 'Select2: Using a hidden input with Select2 is no longer ' + + 'supported and may stop working in the future. It is recommended ' + + 'to use a `<select>` element instead.' + ); + } + } + + decorated.call(this, $element, options); + } + + InputData.prototype.current = function (_, callback) { + function getSelected (data, selectedIds) { + var selected = []; + + if (data.selected || $.inArray(data.id, selectedIds) !== -1) { + data.selected = true; + selected.push(data); + } else { + data.selected = false; + } + + if (data.children) { + selected.push.apply(selected, getSelected(data.children, selectedIds)); + } + + return selected; + } + + var selected = []; + + for (var d = 0; d < this._currentData.length; d++) { + var data = this._currentData[d]; + + selected.push.apply( + selected, + getSelected( + data, + this.$element.val().split( + this._valueSeparator + ) + ) + ); + } + + callback(selected); + }; + + InputData.prototype.select = function (_, data) { + if (!this.options.get('multiple')) { + this.current(function (allData) { + $.map(allData, function (data) { + data.selected = false; + }); + }); + + this.$element.val(data.id); + this.$element.trigger('change'); + } else { + var value = this.$element.val(); + value += this._valueSeparator + data.id; + + this.$element.val(value); + this.$element.trigger('change'); + } + }; + + InputData.prototype.unselect = function (_, data) { + var self = this; + + data.selected = false; + + this.current(function (allData) { + var values = []; + + for (var d = 0; d < allData.length; d++) { + var item = allData[d]; + + if (data.id == item.id) { + continue; + } + + values.push(item.id); + } + + self.$element.val(values.join(self._valueSeparator)); + self.$element.trigger('change'); + }); + }; + + InputData.prototype.query = function (_, params, callback) { + var results = []; + + for (var d = 0; d < this._currentData.length; d++) { + var data = this._currentData[d]; + + var matches = this.matches(params, data); + + if (matches !== null) { + results.push(matches); + } + } + + callback({ + results: results + }); + }; + + InputData.prototype.addOptions = function (_, $options) { + var options = $.map($options, function ($option) { + return $.data($option[0], 'data'); + }); + + this._currentData.push.apply(this._currentData, options); + }; + + return InputData; +}); + +S2.define('select2/compat/matcher',[ + 'jquery' +], function ($) { + function oldMatcher (matcher) { + function wrappedMatcher (params, data) { + var match = $.extend(true, {}, data); + + if (params.term == null || $.trim(params.term) === '') { + return match; + } + + if (data.children) { + for (var c = data.children.length - 1; c >= 0; c--) { + var child = data.children[c]; + + // Check if the child object matches + // The old matcher returned a boolean true or false + var doesMatch = matcher(params.term, child.text, child); + + // If the child didn't match, pop it off + if (!doesMatch) { + match.children.splice(c, 1); + } + } + + if (match.children.length > 0) { + return match; + } + } + + if (matcher(params.term, data.text, data)) { + return match; + } + + return null; + } + + return wrappedMatcher; + } + + return oldMatcher; +}); + +S2.define('select2/compat/query',[ + +], function () { + function Query (decorated, $element, options) { + if (options.get('debug') && window.console && console.warn) { + console.warn( + 'Select2: The `query` option has been deprecated in favor of a ' + + 'custom data adapter that overrides the `query` method. Support ' + + 'will be removed for the `query` option in future versions of ' + + 'Select2.' + ); + } + + decorated.call(this, $element, options); + } + + Query.prototype.query = function (_, params, callback) { + params.callback = callback; + + var query = this.options.get('query'); + + query.call(null, params); + }; + + return Query; +}); + +S2.define('select2/dropdown/attachContainer',[ + +], function () { + function AttachContainer (decorated, $element, options) { + decorated.call(this, $element, options); + } + + AttachContainer.prototype.position = + function (decorated, $dropdown, $container) { + var $dropdownContainer = $container.find('.dropdown-wrapper'); + $dropdownContainer.append($dropdown); + + $dropdown.addClass('select2-dropdown--below'); + $container.addClass('select2-container--below'); + }; + + return AttachContainer; +}); + +S2.define('select2/dropdown/stopPropagation',[ + +], function () { + function StopPropagation () { } + + StopPropagation.prototype.bind = function (decorated, container, $container) { + decorated.call(this, container, $container); + + var stoppedEvents = [ + 'blur', + 'change', + 'click', + 'dblclick', + 'focus', + 'focusin', + 'focusout', + 'input', + 'keydown', + 'keyup', + 'keypress', + 'mousedown', + 'mouseenter', + 'mouseleave', + 'mousemove', + 'mouseover', + 'mouseup', + 'search', + 'touchend', + 'touchstart' + ]; + + this.$dropdown.on(stoppedEvents.join(' '), function (evt) { + evt.stopPropagation(); + }); + }; + + return StopPropagation; +}); + +S2.define('select2/selection/stopPropagation',[ + +], function () { + function StopPropagation () { } + + StopPropagation.prototype.bind = function (decorated, container, $container) { + decorated.call(this, container, $container); + + var stoppedEvents = [ + 'blur', + 'change', + 'click', + 'dblclick', + 'focus', + 'focusin', + 'focusout', + 'input', + 'keydown', + 'keyup', + 'keypress', + 'mousedown', + 'mouseenter', + 'mouseleave', + 'mousemove', + 'mouseover', + 'mouseup', + 'search', + 'touchend', + 'touchstart' + ]; + + this.$selection.on(stoppedEvents.join(' '), function (evt) { + evt.stopPropagation(); + }); + }; + + return StopPropagation; +}); + +/*! + * jQuery Mousewheel 3.1.13 + * + * Copyright jQuery Foundation and other contributors + * Released under the MIT license + * http://jquery.org/license + */ + +(function (factory) { + if ( typeof S2.define === 'function' && S2.define.amd ) { + // AMD. Register as an anonymous module. + S2.define('jquery-mousewheel',['jquery'], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS style for Browserify + module.exports = factory; + } else { + // Browser globals + factory(jQuery); + } +}(function ($) { + + var toFix = ['wheel', 'mousewheel', 'DOMMouseScroll', 'MozMousePixelScroll'], + toBind = ( 'onwheel' in document || document.documentMode >= 9 ) ? + ['wheel'] : ['mousewheel', 'DomMouseScroll', 'MozMousePixelScroll'], + slice = Array.prototype.slice, + nullLowestDeltaTimeout, lowestDelta; + + if ( $.event.fixHooks ) { + for ( var i = toFix.length; i; ) { + $.event.fixHooks[ toFix[--i] ] = $.event.mouseHooks; + } + } + + var special = $.event.special.mousewheel = { + version: '3.1.12', + + setup: function() { + if ( this.addEventListener ) { + for ( var i = toBind.length; i; ) { + this.addEventListener( toBind[--i], handler, false ); + } + } else { + this.onmousewheel = handler; + } + // Store the line height and page height for this particular element + $.data(this, 'mousewheel-line-height', special.getLineHeight(this)); + $.data(this, 'mousewheel-page-height', special.getPageHeight(this)); + }, + + teardown: function() { + if ( this.removeEventListener ) { + for ( var i = toBind.length; i; ) { + this.removeEventListener( toBind[--i], handler, false ); + } + } else { + this.onmousewheel = null; + } + // Clean up the data we added to the element + $.removeData(this, 'mousewheel-line-height'); + $.removeData(this, 'mousewheel-page-height'); + }, + + getLineHeight: function(elem) { + var $elem = $(elem), + $parent = $elem['offsetParent' in $.fn ? 'offsetParent' : 'parent'](); + if (!$parent.length) { + $parent = $('body'); + } + return parseInt($parent.css('fontSize'), 10) || parseInt($elem.css('fontSize'), 10) || 16; + }, + + getPageHeight: function(elem) { + return $(elem).height(); + }, + + settings: { + adjustOldDeltas: true, // see shouldAdjustOldDeltas() below + normalizeOffset: true // calls getBoundingClientRect for each event + } + }; + + $.fn.extend({ + mousewheel: function(fn) { + return fn ? this.bind('mousewheel', fn) : this.trigger('mousewheel'); + }, + + unmousewheel: function(fn) { + return this.unbind('mousewheel', fn); + } + }); + + + function handler(event) { + var orgEvent = event || window.event, + args = slice.call(arguments, 1), + delta = 0, + deltaX = 0, + deltaY = 0, + absDelta = 0, + offsetX = 0, + offsetY = 0; + event = $.event.fix(orgEvent); + event.type = 'mousewheel'; + + // Old school scrollwheel delta + if ( 'detail' in orgEvent ) { deltaY = orgEvent.detail * -1; } + if ( 'wheelDelta' in orgEvent ) { deltaY = orgEvent.wheelDelta; } + if ( 'wheelDeltaY' in orgEvent ) { deltaY = orgEvent.wheelDeltaY; } + if ( 'wheelDeltaX' in orgEvent ) { deltaX = orgEvent.wheelDeltaX * -1; } + + // Firefox < 17 horizontal scrolling related to DOMMouseScroll event + if ( 'axis' in orgEvent && orgEvent.axis === orgEvent.HORIZONTAL_AXIS ) { + deltaX = deltaY * -1; + deltaY = 0; + } + + // Set delta to be deltaY or deltaX if deltaY is 0 for backwards compatabilitiy + delta = deltaY === 0 ? deltaX : deltaY; + + // New school wheel delta (wheel event) + if ( 'deltaY' in orgEvent ) { + deltaY = orgEvent.deltaY * -1; + delta = deltaY; + } + if ( 'deltaX' in orgEvent ) { + deltaX = orgEvent.deltaX; + if ( deltaY === 0 ) { delta = deltaX * -1; } + } + + // No change actually happened, no reason to go any further + if ( deltaY === 0 && deltaX === 0 ) { return; } + + // Need to convert lines and pages to pixels if we aren't already in pixels + // There are three delta modes: + // * deltaMode 0 is by pixels, nothing to do + // * deltaMode 1 is by lines + // * deltaMode 2 is by pages + if ( orgEvent.deltaMode === 1 ) { + var lineHeight = $.data(this, 'mousewheel-line-height'); + delta *= lineHeight; + deltaY *= lineHeight; + deltaX *= lineHeight; + } else if ( orgEvent.deltaMode === 2 ) { + var pageHeight = $.data(this, 'mousewheel-page-height'); + delta *= pageHeight; + deltaY *= pageHeight; + deltaX *= pageHeight; + } + + // Store lowest absolute delta to normalize the delta values + absDelta = Math.max( Math.abs(deltaY), Math.abs(deltaX) ); + + if ( !lowestDelta || absDelta < lowestDelta ) { + lowestDelta = absDelta; + + // Adjust older deltas if necessary + if ( shouldAdjustOldDeltas(orgEvent, absDelta) ) { + lowestDelta /= 40; + } + } + + // Adjust older deltas if necessary + if ( shouldAdjustOldDeltas(orgEvent, absDelta) ) { + // Divide all the things by 40! + delta /= 40; + deltaX /= 40; + deltaY /= 40; + } + + // Get a whole, normalized value for the deltas + delta = Math[ delta >= 1 ? 'floor' : 'ceil' ](delta / lowestDelta); + deltaX = Math[ deltaX >= 1 ? 'floor' : 'ceil' ](deltaX / lowestDelta); + deltaY = Math[ deltaY >= 1 ? 'floor' : 'ceil' ](deltaY / lowestDelta); + + // Normalise offsetX and offsetY properties + if ( special.settings.normalizeOffset && this.getBoundingClientRect ) { + var boundingRect = this.getBoundingClientRect(); + offsetX = event.clientX - boundingRect.left; + offsetY = event.clientY - boundingRect.top; + } + + // Add information to the event object + event.deltaX = deltaX; + event.deltaY = deltaY; + event.deltaFactor = lowestDelta; + event.offsetX = offsetX; + event.offsetY = offsetY; + // Go ahead and set deltaMode to 0 since we converted to pixels + // Although this is a little odd since we overwrite the deltaX/Y + // properties with normalized deltas. + event.deltaMode = 0; + + // Add event and delta to the front of the arguments + args.unshift(event, delta, deltaX, deltaY); + + // Clearout lowestDelta after sometime to better + // handle multiple device types that give different + // a different lowestDelta + // Ex: trackpad = 3 and mouse wheel = 120 + if (nullLowestDeltaTimeout) { clearTimeout(nullLowestDeltaTimeout); } + nullLowestDeltaTimeout = setTimeout(nullLowestDelta, 200); + + return ($.event.dispatch || $.event.handle).apply(this, args); + } + + function nullLowestDelta() { + lowestDelta = null; + } + + function shouldAdjustOldDeltas(orgEvent, absDelta) { + // If this is an older event and the delta is divisable by 120, + // then we are assuming that the browser is treating this as an + // older mouse wheel event and that we should divide the deltas + // by 40 to try and get a more usable deltaFactor. + // Side note, this actually impacts the reported scroll distance + // in older browsers and can cause scrolling to be slower than native. + // Turn this off by setting $.event.special.mousewheel.settings.adjustOldDeltas to false. + return special.settings.adjustOldDeltas && orgEvent.type === 'mousewheel' && absDelta % 120 === 0; + } + +})); + +S2.define('jquery.select2',[ + 'jquery', + 'jquery-mousewheel', + + './select2/core', + './select2/defaults' +], function ($, _, Select2, Defaults) { + if ($.fn.select2 == null) { + // All methods that should return the element + var thisMethods = ['open', 'close', 'destroy']; + + $.fn.select2 = function (options) { + options = options || {}; + + if (typeof options === 'object') { + this.each(function () { + var instanceOptions = $.extend(true, {}, options); + + var instance = new Select2($(this), instanceOptions); + }); + + return this; + } else if (typeof options === 'string') { + var ret; + var args = Array.prototype.slice.call(arguments, 1); + + this.each(function () { + var instance = $(this).data('select2'); + + if (instance == null && window.console && console.error) { + console.error( + 'The select2(\'' + options + '\') method was called on an ' + + 'element that is not using Select2.' + ); + } + + ret = instance[options].apply(instance, args); + }); + + // Check if we should be returning `this` + if ($.inArray(options, thisMethods) > -1) { + return this; + } + + return ret; + } else { + throw new Error('Invalid arguments for Select2: ' + options); + } + }; + } + + if ($.fn.select2.defaults == null) { + $.fn.select2.defaults = Defaults; + } + + return Select2; +}); + + // Return the AMD loader configuration so it can be used outside of this file + return { + define: S2.define, + require: S2.require + }; +}()); + + // Autoload the jQuery bindings + // We know that all of the modules exist above this, so we're safe + var select2 = S2.require('jquery.select2'); + + // Hold the AMD module references on the jQuery function that was just loaded + // This allows Select2 to use the internal loader outside of this file, such + // as in the language files. + jQuery.fn.select2.amd = S2; + + // Return the Select2 instance for anyone who is importing it. + return select2; +})); diff --git a/ishtar_common/static/select2/js/select2.full.min.js b/ishtar_common/static/select2/js/select2.full.min.js new file mode 100644 index 000000000..684edf323 --- /dev/null +++ b/ishtar_common/static/select2/js/select2.full.min.js @@ -0,0 +1,3 @@ +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */!function(a){"function"==typeof define&&define.amd?define(["jquery"],a):a("object"==typeof exports?require("jquery"):jQuery)}(function(a){var b=function(){if(a&&a.fn&&a.fn.select2&&a.fn.select2.amd)var b=a.fn.select2.amd;var b;return function(){if(!b||!b.requirejs){b?c=b:b={};var a,c,d;!function(b){function e(a,b){return u.call(a,b)}function f(a,b){var c,d,e,f,g,h,i,j,k,l,m,n=b&&b.split("/"),o=s.map,p=o&&o["*"]||{};if(a&&"."===a.charAt(0))if(b){for(a=a.split("/"),g=a.length-1,s.nodeIdCompat&&w.test(a[g])&&(a[g]=a[g].replace(w,"")),a=n.slice(0,n.length-1).concat(a),k=0;k<a.length;k+=1)if(m=a[k],"."===m)a.splice(k,1),k-=1;else if(".."===m){if(1===k&&(".."===a[2]||".."===a[0]))break;k>0&&(a.splice(k-1,2),k-=2)}a=a.join("/")}else 0===a.indexOf("./")&&(a=a.substring(2));if((n||p)&&o){for(c=a.split("/"),k=c.length;k>0;k-=1){if(d=c.slice(0,k).join("/"),n)for(l=n.length;l>0;l-=1)if(e=o[n.slice(0,l).join("/")],e&&(e=e[d])){f=e,h=k;break}if(f)break;!i&&p&&p[d]&&(i=p[d],j=k)}!f&&i&&(f=i,h=j),f&&(c.splice(0,h,f),a=c.join("/"))}return a}function g(a,c){return function(){var d=v.call(arguments,0);return"string"!=typeof d[0]&&1===d.length&&d.push(null),n.apply(b,d.concat([a,c]))}}function h(a){return function(b){return f(b,a)}}function i(a){return function(b){q[a]=b}}function j(a){if(e(r,a)){var c=r[a];delete r[a],t[a]=!0,m.apply(b,c)}if(!e(q,a)&&!e(t,a))throw new Error("No "+a);return q[a]}function k(a){var b,c=a?a.indexOf("!"):-1;return c>-1&&(b=a.substring(0,c),a=a.substring(c+1,a.length)),[b,a]}function l(a){return function(){return s&&s.config&&s.config[a]||{}}}var m,n,o,p,q={},r={},s={},t={},u=Object.prototype.hasOwnProperty,v=[].slice,w=/\.js$/;o=function(a,b){var c,d=k(a),e=d[0];return a=d[1],e&&(e=f(e,b),c=j(e)),e?a=c&&c.normalize?c.normalize(a,h(b)):f(a,b):(a=f(a,b),d=k(a),e=d[0],a=d[1],e&&(c=j(e))),{f:e?e+"!"+a:a,n:a,pr:e,p:c}},p={require:function(a){return g(a)},exports:function(a){var b=q[a];return"undefined"!=typeof b?b:q[a]={}},module:function(a){return{id:a,uri:"",exports:q[a],config:l(a)}}},m=function(a,c,d,f){var h,k,l,m,n,s,u=[],v=typeof d;if(f=f||a,"undefined"===v||"function"===v){for(c=!c.length&&d.length?["require","exports","module"]:c,n=0;n<c.length;n+=1)if(m=o(c[n],f),k=m.f,"require"===k)u[n]=p.require(a);else if("exports"===k)u[n]=p.exports(a),s=!0;else if("module"===k)h=u[n]=p.module(a);else if(e(q,k)||e(r,k)||e(t,k))u[n]=j(k);else{if(!m.p)throw new Error(a+" missing "+k);m.p.load(m.n,g(f,!0),i(k),{}),u[n]=q[k]}l=d?d.apply(q[a],u):void 0,a&&(h&&h.exports!==b&&h.exports!==q[a]?q[a]=h.exports:l===b&&s||(q[a]=l))}else a&&(q[a]=d)},a=c=n=function(a,c,d,e,f){if("string"==typeof a)return p[a]?p[a](c):j(o(a,c).f);if(!a.splice){if(s=a,s.deps&&n(s.deps,s.callback),!c)return;c.splice?(a=c,c=d,d=null):a=b}return c=c||function(){},"function"==typeof d&&(d=e,e=f),e?m(b,a,c,d):setTimeout(function(){m(b,a,c,d)},4),n},n.config=function(a){return n(a)},a._defined=q,d=function(a,b,c){if("string"!=typeof a)throw new Error("See almond README: incorrect module build, no module name");b.splice||(c=b,b=[]),e(q,a)||e(r,a)||(r[a]=[a,b,c])},d.amd={jQuery:!0}}(),b.requirejs=a,b.require=c,b.define=d}}(),b.define("almond",function(){}),b.define("jquery",[],function(){var b=a||$;return null==b&&console&&console.error&&console.error("Select2: An instance of jQuery or a jQuery-compatible library was not found. Make sure that you are including jQuery before Select2 on your web page."),b}),b.define("select2/utils",["jquery"],function(a){function b(a){var b=a.prototype,c=[];for(var d in b){var e=b[d];"function"==typeof e&&"constructor"!==d&&c.push(d)}return c}var c={};c.Extend=function(a,b){function c(){this.constructor=a}var d={}.hasOwnProperty;for(var e in b)d.call(b,e)&&(a[e]=b[e]);return c.prototype=b.prototype,a.prototype=new c,a.__super__=b.prototype,a},c.Decorate=function(a,c){function d(){var b=Array.prototype.unshift,d=c.prototype.constructor.length,e=a.prototype.constructor;d>0&&(b.call(arguments,a.prototype.constructor),e=c.prototype.constructor),e.apply(this,arguments)}function e(){this.constructor=d}var f=b(c),g=b(a);c.displayName=a.displayName,d.prototype=new e;for(var h=0;h<g.length;h++){var i=g[h];d.prototype[i]=a.prototype[i]}for(var j=(function(a){var b=function(){};a in d.prototype&&(b=d.prototype[a]);var e=c.prototype[a];return function(){var a=Array.prototype.unshift;return a.call(arguments,b),e.apply(this,arguments)}}),k=0;k<f.length;k++){var l=f[k];d.prototype[l]=j(l)}return d};var d=function(){this.listeners={}};return d.prototype.on=function(a,b){this.listeners=this.listeners||{},a in this.listeners?this.listeners[a].push(b):this.listeners[a]=[b]},d.prototype.trigger=function(a){var b=Array.prototype.slice,c=b.call(arguments,1);this.listeners=this.listeners||{},null==c&&(c=[]),0===c.length&&c.push({}),c[0]._type=a,a in this.listeners&&this.invoke(this.listeners[a],b.call(arguments,1)),"*"in this.listeners&&this.invoke(this.listeners["*"],arguments)},d.prototype.invoke=function(a,b){for(var c=0,d=a.length;d>c;c++)a[c].apply(this,b)},c.Observable=d,c.generateChars=function(a){for(var b="",c=0;a>c;c++){var d=Math.floor(36*Math.random());b+=d.toString(36)}return b},c.bind=function(a,b){return function(){a.apply(b,arguments)}},c._convertData=function(a){for(var b in a){var c=b.split("-"),d=a;if(1!==c.length){for(var e=0;e<c.length;e++){var f=c[e];f=f.substring(0,1).toLowerCase()+f.substring(1),f in d||(d[f]={}),e==c.length-1&&(d[f]=a[b]),d=d[f]}delete a[b]}}return a},c.hasScroll=function(b,c){var d=a(c),e=c.style.overflowX,f=c.style.overflowY;return e!==f||"hidden"!==f&&"visible"!==f?"scroll"===e||"scroll"===f?!0:d.innerHeight()<c.scrollHeight||d.innerWidth()<c.scrollWidth:!1},c.escapeMarkup=function(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return"string"!=typeof a?a:String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})},c.appendMany=function(b,c){if("1.7"===a.fn.jquery.substr(0,3)){var d=a();a.map(c,function(a){d=d.add(a)}),c=d}b.append(c)},c}),b.define("select2/results",["jquery","./utils"],function(a,b){function c(a,b,d){this.$element=a,this.data=d,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<ul class="select2-results__options" role="tree"></ul>');return this.options.get("multiple")&&b.attr("aria-multiselectable","true"),this.$results=b,b},c.prototype.clear=function(){this.$results.empty()},c.prototype.displayMessage=function(b){var c=this.options.get("escapeMarkup");this.clear(),this.hideLoading();var d=a('<li role="treeitem" aria-live="assertive" class="select2-results__option"></li>'),e=this.options.get("translations").get(b.message);d.append(c(e(b.args))),d[0].className+=" select2-results__message",this.$results.append(d)},c.prototype.hideMessages=function(){this.$results.find(".select2-results__message").remove()},c.prototype.append=function(a){this.hideLoading();var b=[];if(null==a.results||0===a.results.length)return void(0===this.$results.children().length&&this.trigger("results:message",{message:"noResults"}));a.results=this.sort(a.results);for(var c=0;c<a.results.length;c++){var d=a.results[c],e=this.option(d);b.push(e)}this.$results.append(b)},c.prototype.position=function(a,b){var c=b.find(".select2-results");c.append(a)},c.prototype.sort=function(a){var b=this.options.get("sorter");return b(a)},c.prototype.highlightFirstItem=function(){var a=this.$results.find(".select2-results__option[aria-selected]"),b=a.filter("[aria-selected=true]");b.length>0?b.first().trigger("mouseenter"):a.first().trigger("mouseenter"),this.ensureHighlightVisible()},c.prototype.setClasses=function(){var b=this;this.data.current(function(c){var d=a.map(c,function(a){return a.id.toString()}),e=b.$results.find(".select2-results__option[aria-selected]");e.each(function(){var b=a(this),c=a.data(this,"data"),e=""+c.id;null!=c.element&&c.element.selected||null==c.element&&a.inArray(e,d)>-1?b.attr("aria-selected","true"):b.attr("aria-selected","false")})})},c.prototype.showLoading=function(a){this.hideLoading();var b=this.options.get("translations").get("searching"),c={disabled:!0,loading:!0,text:b(a)},d=this.option(c);d.className+=" loading-results",this.$results.prepend(d)},c.prototype.hideLoading=function(){this.$results.find(".loading-results").remove()},c.prototype.option=function(b){var c=document.createElement("li");c.className="select2-results__option";var d={role:"treeitem","aria-selected":"false"};b.disabled&&(delete d["aria-selected"],d["aria-disabled"]="true"),null==b.id&&delete d["aria-selected"],null!=b._resultId&&(c.id=b._resultId),b.title&&(c.title=b.title),b.children&&(d.role="group",d["aria-label"]=b.text,delete d["aria-selected"]);for(var e in d){var f=d[e];c.setAttribute(e,f)}if(b.children){var g=a(c),h=document.createElement("strong");h.className="select2-results__group";a(h);this.template(b,h);for(var i=[],j=0;j<b.children.length;j++){var k=b.children[j],l=this.option(k);i.push(l)}var m=a("<ul></ul>",{"class":"select2-results__options select2-results__options--nested"});m.append(i),g.append(h),g.append(m)}else this.template(b,c);return a.data(c,"data",b),c},c.prototype.bind=function(b,c){var d=this,e=b.id+"-results";this.$results.attr("id",e),b.on("results:all",function(a){d.clear(),d.append(a.data),b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("results:append",function(a){d.append(a.data),b.isOpen()&&d.setClasses()}),b.on("query",function(a){d.hideMessages(),d.showLoading(a)}),b.on("select",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("unselect",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("open",function(){d.$results.attr("aria-expanded","true"),d.$results.attr("aria-hidden","false"),d.setClasses(),d.ensureHighlightVisible()}),b.on("close",function(){d.$results.attr("aria-expanded","false"),d.$results.attr("aria-hidden","true"),d.$results.removeAttr("aria-activedescendant")}),b.on("results:toggle",function(){var a=d.getHighlightedResults();0!==a.length&&a.trigger("mouseup")}),b.on("results:select",function(){var a=d.getHighlightedResults();if(0!==a.length){var b=a.data("data");"true"==a.attr("aria-selected")?d.trigger("close",{}):d.trigger("select",{data:b})}}),b.on("results:previous",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a);if(0!==c){var e=c-1;0===a.length&&(e=0);var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top,h=f.offset().top,i=d.$results.scrollTop()+(h-g);0===e?d.$results.scrollTop(0):0>h-g&&d.$results.scrollTop(i)}}),b.on("results:next",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a),e=c+1;if(!(e>=b.length)){var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top+d.$results.outerHeight(!1),h=f.offset().top+f.outerHeight(!1),i=d.$results.scrollTop()+h-g;0===e?d.$results.scrollTop(0):h>g&&d.$results.scrollTop(i)}}),b.on("results:focus",function(a){a.element.addClass("select2-results__option--highlighted")}),b.on("results:message",function(a){d.displayMessage(a)}),a.fn.mousewheel&&this.$results.on("mousewheel",function(a){var b=d.$results.scrollTop(),c=d.$results.get(0).scrollHeight-b+a.deltaY,e=a.deltaY>0&&b-a.deltaY<=0,f=a.deltaY<0&&c<=d.$results.height();e?(d.$results.scrollTop(0),a.preventDefault(),a.stopPropagation()):f&&(d.$results.scrollTop(d.$results.get(0).scrollHeight-d.$results.height()),a.preventDefault(),a.stopPropagation())}),this.$results.on("mouseup",".select2-results__option[aria-selected]",function(b){var c=a(this),e=c.data("data");return"true"===c.attr("aria-selected")?void(d.options.get("multiple")?d.trigger("unselect",{originalEvent:b,data:e}):d.trigger("close",{})):void d.trigger("select",{originalEvent:b,data:e})}),this.$results.on("mouseenter",".select2-results__option[aria-selected]",function(b){var c=a(this).data("data");d.getHighlightedResults().removeClass("select2-results__option--highlighted"),d.trigger("results:focus",{data:c,element:a(this)})})},c.prototype.getHighlightedResults=function(){var a=this.$results.find(".select2-results__option--highlighted");return a},c.prototype.destroy=function(){this.$results.remove()},c.prototype.ensureHighlightVisible=function(){var a=this.getHighlightedResults();if(0!==a.length){var b=this.$results.find("[aria-selected]"),c=b.index(a),d=this.$results.offset().top,e=a.offset().top,f=this.$results.scrollTop()+(e-d),g=e-d;f-=2*a.outerHeight(!1),2>=c?this.$results.scrollTop(0):(g>this.$results.outerHeight()||0>g)&&this.$results.scrollTop(f)}},c.prototype.template=function(b,c){var d=this.options.get("templateResult"),e=this.options.get("escapeMarkup"),f=d(b,c);null==f?c.style.display="none":"string"==typeof f?c.innerHTML=e(f):a(c).append(f)},c}),b.define("select2/keys",[],function(){var a={BACKSPACE:8,TAB:9,ENTER:13,SHIFT:16,CTRL:17,ALT:18,ESC:27,SPACE:32,PAGE_UP:33,PAGE_DOWN:34,END:35,HOME:36,LEFT:37,UP:38,RIGHT:39,DOWN:40,DELETE:46};return a}),b.define("select2/selection/base",["jquery","../utils","../keys"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,b.Observable),d.prototype.render=function(){var b=a('<span class="select2-selection" role="combobox" aria-haspopup="true" aria-expanded="false"></span>');return this._tabindex=0,null!=this.$element.data("old-tabindex")?this._tabindex=this.$element.data("old-tabindex"):null!=this.$element.attr("tabindex")&&(this._tabindex=this.$element.attr("tabindex")),b.attr("title",this.$element.attr("title")),b.attr("tabindex",this._tabindex),this.$selection=b,b},d.prototype.bind=function(a,b){var d=this,e=(a.id+"-container",a.id+"-results");this.container=a,this.$selection.on("focus",function(a){d.trigger("focus",a)}),this.$selection.on("blur",function(a){d._handleBlur(a)}),this.$selection.on("keydown",function(a){d.trigger("keypress",a),a.which===c.SPACE&&a.preventDefault()}),a.on("results:focus",function(a){d.$selection.attr("aria-activedescendant",a.data._resultId)}),a.on("selection:update",function(a){d.update(a.data)}),a.on("open",function(){d.$selection.attr("aria-expanded","true"),d.$selection.attr("aria-owns",e),d._attachCloseHandler(a)}),a.on("close",function(){d.$selection.attr("aria-expanded","false"),d.$selection.removeAttr("aria-activedescendant"),d.$selection.removeAttr("aria-owns"),d.$selection.focus(),d._detachCloseHandler(a)}),a.on("enable",function(){d.$selection.attr("tabindex",d._tabindex)}),a.on("disable",function(){d.$selection.attr("tabindex","-1")})},d.prototype._handleBlur=function(b){var c=this;window.setTimeout(function(){document.activeElement==c.$selection[0]||a.contains(c.$selection[0],document.activeElement)||c.trigger("blur",b)},1)},d.prototype._attachCloseHandler=function(b){a(document.body).on("mousedown.select2."+b.id,function(b){var c=a(b.target),d=c.closest(".select2"),e=a(".select2.select2-container--open");e.each(function(){var b=a(this);if(this!=d[0]){var c=b.data("element");c.select2("close")}})})},d.prototype._detachCloseHandler=function(b){a(document.body).off("mousedown.select2."+b.id)},d.prototype.position=function(a,b){var c=b.find(".selection");c.append(a)},d.prototype.destroy=function(){this._detachCloseHandler(this.container)},d.prototype.update=function(a){throw new Error("The `update` method must be defined in child classes.")},d}),b.define("select2/selection/single",["jquery","./base","../utils","../keys"],function(a,b,c,d){function e(){e.__super__.constructor.apply(this,arguments)}return c.Extend(e,b),e.prototype.render=function(){var a=e.__super__.render.call(this);return a.addClass("select2-selection--single"),a.html('<span class="select2-selection__rendered"></span><span class="select2-selection__arrow" role="presentation"><b role="presentation"></b></span>'),a},e.prototype.bind=function(a,b){var c=this;e.__super__.bind.apply(this,arguments);var d=a.id+"-container";this.$selection.find(".select2-selection__rendered").attr("id",d),this.$selection.attr("aria-labelledby",d),this.$selection.on("mousedown",function(a){1===a.which&&c.trigger("toggle",{originalEvent:a})}),this.$selection.on("focus",function(a){}),this.$selection.on("blur",function(a){}),a.on("focus",function(b){a.isOpen()||c.$selection.focus()}),a.on("selection:update",function(a){c.update(a.data)})},e.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},e.prototype.display=function(a,b){var c=this.options.get("templateSelection"),d=this.options.get("escapeMarkup");return d(c(a,b))},e.prototype.selectionContainer=function(){return a("<span></span>")},e.prototype.update=function(a){if(0===a.length)return void this.clear();var b=a[0],c=this.$selection.find(".select2-selection__rendered"),d=this.display(b,c);c.empty().append(d),c.prop("title",b.title||b.text)},e}),b.define("select2/selection/multiple",["jquery","./base","../utils"],function(a,b,c){function d(a,b){d.__super__.constructor.apply(this,arguments)}return c.Extend(d,b),d.prototype.render=function(){var a=d.__super__.render.call(this);return a.addClass("select2-selection--multiple"),a.html('<ul class="select2-selection__rendered"></ul>'),a},d.prototype.bind=function(b,c){var e=this;d.__super__.bind.apply(this,arguments),this.$selection.on("click",function(a){e.trigger("toggle",{originalEvent:a})}),this.$selection.on("click",".select2-selection__choice__remove",function(b){if(!e.options.get("disabled")){var c=a(this),d=c.parent(),f=d.data("data");e.trigger("unselect",{originalEvent:b,data:f})}})},d.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},d.prototype.display=function(a,b){var c=this.options.get("templateSelection"),d=this.options.get("escapeMarkup");return d(c(a,b))},d.prototype.selectionContainer=function(){var b=a('<li class="select2-selection__choice"><span class="select2-selection__choice__remove" role="presentation">×</span></li>');return b},d.prototype.update=function(a){if(this.clear(),0!==a.length){for(var b=[],d=0;d<a.length;d++){var e=a[d],f=this.selectionContainer(),g=this.display(e,f);f.append(g),f.prop("title",e.title||e.text),f.data("data",e),b.push(f)}var h=this.$selection.find(".select2-selection__rendered");c.appendMany(h,b)}},d}),b.define("select2/selection/placeholder",["../utils"],function(a){function b(a,b,c){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c)}return b.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},b.prototype.createPlaceholder=function(a,b){var c=this.selectionContainer();return c.html(this.display(b)),c.addClass("select2-selection__placeholder").removeClass("select2-selection__choice"),c},b.prototype.update=function(a,b){var c=1==b.length&&b[0].id!=this.placeholder.id,d=b.length>1;if(d||c)return a.call(this,b);this.clear();var e=this.createPlaceholder(this.placeholder);this.$selection.find(".select2-selection__rendered").append(e)},b}),b.define("select2/selection/allowClear",["jquery","../keys"],function(a,b){function c(){}return c.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),null==this.placeholder&&this.options.get("debug")&&window.console&&console.error&&console.error("Select2: The `allowClear` option should be used in combination with the `placeholder` option."),this.$selection.on("mousedown",".select2-selection__clear",function(a){d._handleClear(a)}),b.on("keypress",function(a){d._handleKeyboardClear(a,b)})},c.prototype._handleClear=function(a,b){if(!this.options.get("disabled")){var c=this.$selection.find(".select2-selection__clear");if(0!==c.length){b.stopPropagation();for(var d=c.data("data"),e=0;e<d.length;e++){var f={data:d[e]};if(this.trigger("unselect",f),f.prevented)return}this.$element.val(this.placeholder.id).trigger("change"),this.trigger("toggle",{})}}},c.prototype._handleKeyboardClear=function(a,c,d){d.isOpen()||(c.which==b.DELETE||c.which==b.BACKSPACE)&&this._handleClear(c)},c.prototype.update=function(b,c){if(b.call(this,c),!(this.$selection.find(".select2-selection__placeholder").length>0||0===c.length)){var d=a('<span class="select2-selection__clear">×</span>');d.data("data",c),this.$selection.find(".select2-selection__rendered").prepend(d)}},c}),b.define("select2/selection/search",["jquery","../utils","../keys"],function(a,b,c){function d(a,b,c){a.call(this,b,c)}return d.prototype.render=function(b){var c=a('<li class="select2-search select2-search--inline"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" aria-autocomplete="list" /></li>');this.$searchContainer=c,this.$search=c.find("input");var d=b.call(this);return this._transferTabIndex(),d},d.prototype.bind=function(a,b,d){var e=this;a.call(this,b,d),b.on("open",function(){e.$search.trigger("focus")}),b.on("close",function(){e.$search.val(""),e.$search.removeAttr("aria-activedescendant"),e.$search.trigger("focus")}),b.on("enable",function(){e.$search.prop("disabled",!1),e._transferTabIndex()}),b.on("disable",function(){e.$search.prop("disabled",!0)}),b.on("focus",function(a){e.$search.trigger("focus")}),b.on("results:focus",function(a){e.$search.attr("aria-activedescendant",a.id)}),this.$selection.on("focusin",".select2-search--inline",function(a){e.trigger("focus",a)}),this.$selection.on("focusout",".select2-search--inline",function(a){e._handleBlur(a)}),this.$selection.on("keydown",".select2-search--inline",function(a){a.stopPropagation(),e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented();var b=a.which;if(b===c.BACKSPACE&&""===e.$search.val()){var d=e.$searchContainer.prev(".select2-selection__choice");if(d.length>0){var f=d.data("data");e.searchRemoveChoice(f),a.preventDefault()}}});var f=document.documentMode,g=f&&11>=f;this.$selection.on("input.searchcheck",".select2-search--inline",function(a){return g?void e.$selection.off("input.search input.searchcheck"):void e.$selection.off("keyup.search")}),this.$selection.on("keyup.search input.search",".select2-search--inline",function(a){if(g&&"input"===a.type)return void e.$selection.off("input.search input.searchcheck");var b=a.which;b!=c.SHIFT&&b!=c.CTRL&&b!=c.ALT&&b!=c.TAB&&e.handleSearch(a)})},d.prototype._transferTabIndex=function(a){this.$search.attr("tabindex",this.$selection.attr("tabindex")),this.$selection.attr("tabindex","-1")},d.prototype.createPlaceholder=function(a,b){this.$search.attr("placeholder",b.text)},d.prototype.update=function(a,b){var c=this.$search[0]==document.activeElement;this.$search.attr("placeholder",""),a.call(this,b),this.$selection.find(".select2-selection__rendered").append(this.$searchContainer),this.resizeSearch(),c&&this.$search.focus()},d.prototype.handleSearch=function(){if(this.resizeSearch(),!this._keyUpPrevented){var a=this.$search.val();this.trigger("query",{term:a})}this._keyUpPrevented=!1},d.prototype.searchRemoveChoice=function(a,b){this.trigger("unselect",{data:b}),this.$search.val(b.text),this.handleSearch()},d.prototype.resizeSearch=function(){this.$search.css("width","25px");var a="";if(""!==this.$search.attr("placeholder"))a=this.$selection.find(".select2-selection__rendered").innerWidth();else{var b=this.$search.val().length+1;a=.75*b+"em"}this.$search.css("width",a)},d}),b.define("select2/selection/eventRelay",["jquery"],function(a){function b(){}return b.prototype.bind=function(b,c,d){var e=this,f=["open","opening","close","closing","select","selecting","unselect","unselecting"],g=["opening","closing","selecting","unselecting"];b.call(this,c,d),c.on("*",function(b,c){if(-1!==a.inArray(b,f)){c=c||{};var d=a.Event("select2:"+b,{params:c});e.$element.trigger(d),-1!==a.inArray(b,g)&&(c.prevented=d.isDefaultPrevented())}})},b}),b.define("select2/translation",["jquery","require"],function(a,b){function c(a){this.dict=a||{}}return c.prototype.all=function(){return this.dict},c.prototype.get=function(a){return this.dict[a]},c.prototype.extend=function(b){this.dict=a.extend({},b.all(),this.dict)},c._cache={},c.loadPath=function(a){if(!(a in c._cache)){var d=b(a);c._cache[a]=d}return new c(c._cache[a])},c}),b.define("select2/diacritics",[],function(){var a={"Ⓐ":"A","Ａ":"A","À":"A","Á":"A","Â":"A","Ầ":"A","Ấ":"A","Ẫ":"A","Ẩ":"A","Ã":"A","Ā":"A","Ă":"A","Ằ":"A","Ắ":"A","Ẵ":"A","Ẳ":"A","Ȧ":"A","Ǡ":"A","Ä":"A","Ǟ":"A","Ả":"A","Å":"A","Ǻ":"A","Ǎ":"A","Ȁ":"A","Ȃ":"A","Ạ":"A","Ậ":"A","Ặ":"A","Ḁ":"A","Ą":"A","Ⱥ":"A","Ɐ":"A","Ꜳ":"AA","Æ":"AE","Ǽ":"AE","Ǣ":"AE","Ꜵ":"AO","Ꜷ":"AU","Ꜹ":"AV","Ꜻ":"AV","Ꜽ":"AY","Ⓑ":"B","Ｂ":"B","Ḃ":"B","Ḅ":"B","Ḇ":"B","Ƀ":"B","Ƃ":"B","Ɓ":"B","Ⓒ":"C","Ｃ":"C","Ć":"C","Ĉ":"C","Ċ":"C","Č":"C","Ç":"C","Ḉ":"C","Ƈ":"C","Ȼ":"C","Ꜿ":"C","Ⓓ":"D","Ｄ":"D","Ḋ":"D","Ď":"D","Ḍ":"D","Ḑ":"D","Ḓ":"D","Ḏ":"D","Đ":"D","Ƌ":"D","Ɗ":"D","Ɖ":"D","Ꝺ":"D","DZ":"DZ","DŽ":"DZ","Dz":"Dz","Dž":"Dz","Ⓔ":"E","Ｅ":"E","È":"E","É":"E","Ê":"E","Ề":"E","Ế":"E","Ễ":"E","Ể":"E","Ẽ":"E","Ē":"E","Ḕ":"E","Ḗ":"E","Ĕ":"E","Ė":"E","Ë":"E","Ẻ":"E","Ě":"E","Ȅ":"E","Ȇ":"E","Ẹ":"E","Ệ":"E","Ȩ":"E","Ḝ":"E","Ę":"E","Ḙ":"E","Ḛ":"E","Ɛ":"E","Ǝ":"E","Ⓕ":"F","Ｆ":"F","Ḟ":"F","Ƒ":"F","Ꝼ":"F","Ⓖ":"G","Ｇ":"G","Ǵ":"G","Ĝ":"G","Ḡ":"G","Ğ":"G","Ġ":"G","Ǧ":"G","Ģ":"G","Ǥ":"G","Ɠ":"G","Ꞡ":"G","Ᵹ":"G","Ꝿ":"G","Ⓗ":"H","Ｈ":"H","Ĥ":"H","Ḣ":"H","Ḧ":"H","Ȟ":"H","Ḥ":"H","Ḩ":"H","Ḫ":"H","Ħ":"H","Ⱨ":"H","Ⱶ":"H","Ɥ":"H","Ⓘ":"I","Ｉ":"I","Ì":"I","Í":"I","Î":"I","Ĩ":"I","Ī":"I","Ĭ":"I","İ":"I","Ï":"I","Ḯ":"I","Ỉ":"I","Ǐ":"I","Ȉ":"I","Ȋ":"I","Ị":"I","Į":"I","Ḭ":"I","Ɨ":"I","Ⓙ":"J","Ｊ":"J","Ĵ":"J","Ɉ":"J","Ⓚ":"K","Ｋ":"K","Ḱ":"K","Ǩ":"K","Ḳ":"K","Ķ":"K","Ḵ":"K","Ƙ":"K","Ⱪ":"K","Ꝁ":"K","Ꝃ":"K","Ꝅ":"K","Ꞣ":"K","Ⓛ":"L","Ｌ":"L","Ŀ":"L","Ĺ":"L","Ľ":"L","Ḷ":"L","Ḹ":"L","Ļ":"L","Ḽ":"L","Ḻ":"L","Ł":"L","Ƚ":"L","Ɫ":"L","Ⱡ":"L","Ꝉ":"L","Ꝇ":"L","Ꞁ":"L","LJ":"LJ","Lj":"Lj","Ⓜ":"M","Ｍ":"M","Ḿ":"M","Ṁ":"M","Ṃ":"M","Ɱ":"M","Ɯ":"M","Ⓝ":"N","Ｎ":"N","Ǹ":"N","Ń":"N","Ñ":"N","Ṅ":"N","Ň":"N","Ṇ":"N","Ņ":"N","Ṋ":"N","Ṉ":"N","Ƞ":"N","Ɲ":"N","Ꞑ":"N","Ꞥ":"N","NJ":"NJ","Nj":"Nj","Ⓞ":"O","Ｏ":"O","Ò":"O","Ó":"O","Ô":"O","Ồ":"O","Ố":"O","Ỗ":"O","Ổ":"O","Õ":"O","Ṍ":"O","Ȭ":"O","Ṏ":"O","Ō":"O","Ṑ":"O","Ṓ":"O","Ŏ":"O","Ȯ":"O","Ȱ":"O","Ö":"O","Ȫ":"O","Ỏ":"O","Ő":"O","Ǒ":"O","Ȍ":"O","Ȏ":"O","Ơ":"O","Ờ":"O","Ớ":"O","Ỡ":"O","Ở":"O","Ợ":"O","Ọ":"O","Ộ":"O","Ǫ":"O","Ǭ":"O","Ø":"O","Ǿ":"O","Ɔ":"O","Ɵ":"O","Ꝋ":"O","Ꝍ":"O","Ƣ":"OI","Ꝏ":"OO","Ȣ":"OU","Ⓟ":"P","Ｐ":"P","Ṕ":"P","Ṗ":"P","Ƥ":"P","Ᵽ":"P","Ꝑ":"P","Ꝓ":"P","Ꝕ":"P","Ⓠ":"Q","Ｑ":"Q","Ꝗ":"Q","Ꝙ":"Q","Ɋ":"Q","Ⓡ":"R","Ｒ":"R","Ŕ":"R","Ṙ":"R","Ř":"R","Ȑ":"R","Ȓ":"R","Ṛ":"R","Ṝ":"R","Ŗ":"R","Ṟ":"R","Ɍ":"R","Ɽ":"R","Ꝛ":"R","Ꞧ":"R","Ꞃ":"R","Ⓢ":"S","Ｓ":"S","ẞ":"S","Ś":"S","Ṥ":"S","Ŝ":"S","Ṡ":"S","Š":"S","Ṧ":"S","Ṣ":"S","Ṩ":"S","Ș":"S","Ş":"S","Ȿ":"S","Ꞩ":"S","Ꞅ":"S","Ⓣ":"T","Ｔ":"T","Ṫ":"T","Ť":"T","Ṭ":"T","Ț":"T","Ţ":"T","Ṱ":"T","Ṯ":"T","Ŧ":"T","Ƭ":"T","Ʈ":"T","Ⱦ":"T","Ꞇ":"T","Ꜩ":"TZ","Ⓤ":"U","Ｕ":"U","Ù":"U","Ú":"U","Û":"U","Ũ":"U","Ṹ":"U","Ū":"U","Ṻ":"U","Ŭ":"U","Ü":"U","Ǜ":"U","Ǘ":"U","Ǖ":"U","Ǚ":"U","Ủ":"U","Ů":"U","Ű":"U","Ǔ":"U","Ȕ":"U","Ȗ":"U","Ư":"U","Ừ":"U","Ứ":"U","Ữ":"U","Ử":"U","Ự":"U","Ụ":"U","Ṳ":"U","Ų":"U","Ṷ":"U","Ṵ":"U","Ʉ":"U","Ⓥ":"V","Ｖ":"V","Ṽ":"V","Ṿ":"V","Ʋ":"V","Ꝟ":"V","Ʌ":"V","Ꝡ":"VY","Ⓦ":"W","Ｗ":"W","Ẁ":"W","Ẃ":"W","Ŵ":"W","Ẇ":"W","Ẅ":"W","Ẉ":"W","Ⱳ":"W","Ⓧ":"X","Ｘ":"X","Ẋ":"X","Ẍ":"X","Ⓨ":"Y","Ｙ":"Y","Ỳ":"Y","Ý":"Y","Ŷ":"Y","Ỹ":"Y","Ȳ":"Y","Ẏ":"Y","Ÿ":"Y","Ỷ":"Y","Ỵ":"Y","Ƴ":"Y","Ɏ":"Y","Ỿ":"Y","Ⓩ":"Z","Ｚ":"Z","Ź":"Z","Ẑ":"Z","Ż":"Z","Ž":"Z","Ẓ":"Z","Ẕ":"Z","Ƶ":"Z","Ȥ":"Z","Ɀ":"Z","Ⱬ":"Z","Ꝣ":"Z","ⓐ":"a","ａ":"a","ẚ":"a","à":"a","á":"a","â":"a","ầ":"a","ấ":"a","ẫ":"a","ẩ":"a","ã":"a","ā":"a","ă":"a","ằ":"a","ắ":"a","ẵ":"a","ẳ":"a","ȧ":"a","ǡ":"a","ä":"a","ǟ":"a","ả":"a","å":"a","ǻ":"a","ǎ":"a","ȁ":"a","ȃ":"a","ạ":"a","ậ":"a","ặ":"a","ḁ":"a","ą":"a","ⱥ":"a","ɐ":"a","ꜳ":"aa","æ":"ae","ǽ":"ae","ǣ":"ae","ꜵ":"ao","ꜷ":"au","ꜹ":"av","ꜻ":"av","ꜽ":"ay","ⓑ":"b","ｂ":"b","ḃ":"b","ḅ":"b","ḇ":"b","ƀ":"b","ƃ":"b","ɓ":"b","ⓒ":"c","ｃ":"c","ć":"c","ĉ":"c","ċ":"c","č":"c","ç":"c","ḉ":"c","ƈ":"c","ȼ":"c","ꜿ":"c","ↄ":"c","ⓓ":"d","ｄ":"d","ḋ":"d","ď":"d","ḍ":"d","ḑ":"d","ḓ":"d","ḏ":"d","đ":"d","ƌ":"d","ɖ":"d","ɗ":"d","ꝺ":"d","dz":"dz","dž":"dz","ⓔ":"e","ｅ":"e","è":"e","é":"e","ê":"e","ề":"e","ế":"e","ễ":"e","ể":"e","ẽ":"e","ē":"e","ḕ":"e","ḗ":"e","ĕ":"e","ė":"e","ë":"e","ẻ":"e","ě":"e","ȅ":"e","ȇ":"e","ẹ":"e","ệ":"e","ȩ":"e","ḝ":"e","ę":"e","ḙ":"e","ḛ":"e","ɇ":"e","ɛ":"e","ǝ":"e","ⓕ":"f","ｆ":"f","ḟ":"f","ƒ":"f","ꝼ":"f","ⓖ":"g","ｇ":"g","ǵ":"g","ĝ":"g","ḡ":"g","ğ":"g","ġ":"g","ǧ":"g","ģ":"g","ǥ":"g","ɠ":"g","ꞡ":"g","ᵹ":"g","ꝿ":"g","ⓗ":"h","ｈ":"h","ĥ":"h","ḣ":"h","ḧ":"h","ȟ":"h","ḥ":"h","ḩ":"h","ḫ":"h","ẖ":"h","ħ":"h","ⱨ":"h","ⱶ":"h","ɥ":"h","ƕ":"hv","ⓘ":"i","ｉ":"i","ì":"i","í":"i","î":"i","ĩ":"i","ī":"i","ĭ":"i","ï":"i","ḯ":"i","ỉ":"i","ǐ":"i","ȉ":"i","ȋ":"i","ị":"i","į":"i","ḭ":"i","ɨ":"i","ı":"i","ⓙ":"j","ｊ":"j","ĵ":"j","ǰ":"j","ɉ":"j","ⓚ":"k","ｋ":"k","ḱ":"k","ǩ":"k","ḳ":"k","ķ":"k","ḵ":"k","ƙ":"k","ⱪ":"k","ꝁ":"k","ꝃ":"k","ꝅ":"k","ꞣ":"k","ⓛ":"l","ｌ":"l","ŀ":"l","ĺ":"l","ľ":"l","ḷ":"l","ḹ":"l","ļ":"l","ḽ":"l","ḻ":"l","ſ":"l","ł":"l","ƚ":"l","ɫ":"l","ⱡ":"l","ꝉ":"l","ꞁ":"l","ꝇ":"l","lj":"lj","ⓜ":"m","ｍ":"m","ḿ":"m","ṁ":"m","ṃ":"m","ɱ":"m","ɯ":"m","ⓝ":"n","ｎ":"n","ǹ":"n","ń":"n","ñ":"n","ṅ":"n","ň":"n","ṇ":"n","ņ":"n","ṋ":"n","ṉ":"n","ƞ":"n","ɲ":"n","ʼn":"n","ꞑ":"n","ꞥ":"n","nj":"nj","ⓞ":"o","ｏ":"o","ò":"o","ó":"o","ô":"o","ồ":"o","ố":"o","ỗ":"o","ổ":"o","õ":"o","ṍ":"o","ȭ":"o","ṏ":"o","ō":"o","ṑ":"o","ṓ":"o","ŏ":"o","ȯ":"o","ȱ":"o","ö":"o","ȫ":"o","ỏ":"o","ő":"o","ǒ":"o","ȍ":"o","ȏ":"o","ơ":"o","ờ":"o","ớ":"o","ỡ":"o","ở":"o","ợ":"o","ọ":"o","ộ":"o","ǫ":"o","ǭ":"o","ø":"o","ǿ":"o","ɔ":"o","ꝋ":"o","ꝍ":"o","ɵ":"o","ƣ":"oi","ȣ":"ou","ꝏ":"oo","ⓟ":"p","ｐ":"p","ṕ":"p","ṗ":"p","ƥ":"p","ᵽ":"p","ꝑ":"p","ꝓ":"p","ꝕ":"p","ⓠ":"q","ｑ":"q","ɋ":"q","ꝗ":"q","ꝙ":"q","ⓡ":"r","ｒ":"r","ŕ":"r","ṙ":"r","ř":"r","ȑ":"r","ȓ":"r","ṛ":"r","ṝ":"r","ŗ":"r","ṟ":"r","ɍ":"r","ɽ":"r","ꝛ":"r","ꞧ":"r","ꞃ":"r","ⓢ":"s","ｓ":"s","ß":"s","ś":"s","ṥ":"s","ŝ":"s","ṡ":"s","š":"s","ṧ":"s","ṣ":"s","ṩ":"s","ș":"s","ş":"s","ȿ":"s","ꞩ":"s","ꞅ":"s","ẛ":"s","ⓣ":"t","ｔ":"t","ṫ":"t","ẗ":"t","ť":"t","ṭ":"t","ț":"t","ţ":"t","ṱ":"t","ṯ":"t","ŧ":"t","ƭ":"t","ʈ":"t","ⱦ":"t","ꞇ":"t","ꜩ":"tz","ⓤ":"u","ｕ":"u","ù":"u","ú":"u","û":"u","ũ":"u","ṹ":"u","ū":"u","ṻ":"u","ŭ":"u","ü":"u","ǜ":"u","ǘ":"u","ǖ":"u","ǚ":"u","ủ":"u","ů":"u","ű":"u","ǔ":"u","ȕ":"u","ȗ":"u","ư":"u","ừ":"u","ứ":"u","ữ":"u","ử":"u","ự":"u","ụ":"u","ṳ":"u","ų":"u","ṷ":"u","ṵ":"u","ʉ":"u","ⓥ":"v","ｖ":"v","ṽ":"v","ṿ":"v","ʋ":"v","ꝟ":"v","ʌ":"v","ꝡ":"vy","ⓦ":"w","ｗ":"w","ẁ":"w","ẃ":"w","ŵ":"w","ẇ":"w","ẅ":"w","ẘ":"w","ẉ":"w","ⱳ":"w","ⓧ":"x","ｘ":"x","ẋ":"x","ẍ":"x","ⓨ":"y","ｙ":"y","ỳ":"y","ý":"y","ŷ":"y","ỹ":"y","ȳ":"y","ẏ":"y","ÿ":"y","ỷ":"y","ẙ":"y","ỵ":"y","ƴ":"y","ɏ":"y","ỿ":"y","ⓩ":"z","ｚ":"z","ź":"z","ẑ":"z","ż":"z","ž":"z","ẓ":"z","ẕ":"z","ƶ":"z","ȥ":"z","ɀ":"z","ⱬ":"z","ꝣ":"z","Ά":"Α","Έ":"Ε","Ή":"Η","Ί":"Ι","Ϊ":"Ι","Ό":"Ο","Ύ":"Υ","Ϋ":"Υ","Ώ":"Ω","ά":"α","έ":"ε","ή":"η","ί":"ι","ϊ":"ι","ΐ":"ι","ό":"ο","ύ":"υ","ϋ":"υ","ΰ":"υ","ω":"ω","ς":"σ"};return a}),b.define("select2/data/base",["../utils"],function(a){function b(a,c){b.__super__.constructor.call(this)}return a.Extend(b,a.Observable),b.prototype.current=function(a){throw new Error("The `current` method must be defined in child classes.")},b.prototype.query=function(a,b){throw new Error("The `query` method must be defined in child classes.")},b.prototype.bind=function(a,b){},b.prototype.destroy=function(){},b.prototype.generateResultId=function(b,c){var d=b.id+"-result-";return d+=a.generateChars(4),d+=null!=c.id?"-"+c.id.toString():"-"+a.generateChars(4)},b}),b.define("select2/data/select",["./base","../utils","jquery"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,a),d.prototype.current=function(a){var b=[],d=this;this.$element.find(":selected").each(function(){var a=c(this),e=d.item(a);b.push(e)}),a(b)},d.prototype.select=function(a){var b=this;if(a.selected=!0,c(a.element).is("option"))return a.element.selected=!0,void this.$element.trigger("change"); +if(this.$element.prop("multiple"))this.current(function(d){var e=[];a=[a],a.push.apply(a,d);for(var f=0;f<a.length;f++){var g=a[f].id;-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")});else{var d=a.id;this.$element.val(d),this.$element.trigger("change")}},d.prototype.unselect=function(a){var b=this;if(this.$element.prop("multiple"))return a.selected=!1,c(a.element).is("option")?(a.element.selected=!1,void this.$element.trigger("change")):void this.current(function(d){for(var e=[],f=0;f<d.length;f++){var g=d[f].id;g!==a.id&&-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")})},d.prototype.bind=function(a,b){var c=this;this.container=a,a.on("select",function(a){c.select(a.data)}),a.on("unselect",function(a){c.unselect(a.data)})},d.prototype.destroy=function(){this.$element.find("*").each(function(){c.removeData(this,"data")})},d.prototype.query=function(a,b){var d=[],e=this,f=this.$element.children();f.each(function(){var b=c(this);if(b.is("option")||b.is("optgroup")){var f=e.item(b),g=e.matches(a,f);null!==g&&d.push(g)}}),b({results:d})},d.prototype.addOptions=function(a){b.appendMany(this.$element,a)},d.prototype.option=function(a){var b;a.children?(b=document.createElement("optgroup"),b.label=a.text):(b=document.createElement("option"),void 0!==b.textContent?b.textContent=a.text:b.innerText=a.text),a.id&&(b.value=a.id),a.disabled&&(b.disabled=!0),a.selected&&(b.selected=!0),a.title&&(b.title=a.title);var d=c(b),e=this._normalizeItem(a);return e.element=b,c.data(b,"data",e),d},d.prototype.item=function(a){var b={};if(b=c.data(a[0],"data"),null!=b)return b;if(a.is("option"))b={id:a.val(),text:a.text(),disabled:a.prop("disabled"),selected:a.prop("selected"),title:a.prop("title")};else if(a.is("optgroup")){b={text:a.prop("label"),children:[],title:a.prop("title")};for(var d=a.children("option"),e=[],f=0;f<d.length;f++){var g=c(d[f]),h=this.item(g);e.push(h)}b.children=e}return b=this._normalizeItem(b),b.element=a[0],c.data(a[0],"data",b),b},d.prototype._normalizeItem=function(a){c.isPlainObject(a)||(a={id:a,text:a}),a=c.extend({},{text:""},a);var b={selected:!1,disabled:!1};return null!=a.id&&(a.id=a.id.toString()),null!=a.text&&(a.text=a.text.toString()),null==a._resultId&&a.id&&null!=this.container&&(a._resultId=this.generateResultId(this.container,a)),c.extend({},b,a)},d.prototype.matches=function(a,b){var c=this.options.get("matcher");return c(a,b)},d}),b.define("select2/data/array",["./select","../utils","jquery"],function(a,b,c){function d(a,b){var c=b.get("data")||[];d.__super__.constructor.call(this,a,b),this.addOptions(this.convertToOptions(c))}return b.Extend(d,a),d.prototype.select=function(a){var b=this.$element.find("option").filter(function(b,c){return c.value==a.id.toString()});0===b.length&&(b=this.option(a),this.addOptions(b)),d.__super__.select.call(this,a)},d.prototype.convertToOptions=function(a){function d(a){return function(){return c(this).val()==a.id}}for(var e=this,f=this.$element.find("option"),g=f.map(function(){return e.item(c(this)).id}).get(),h=[],i=0;i<a.length;i++){var j=this._normalizeItem(a[i]);if(c.inArray(j.id,g)>=0){var k=f.filter(d(j)),l=this.item(k),m=c.extend(!0,{},j,l),n=this.option(m);k.replaceWith(n)}else{var o=this.option(j);if(j.children){var p=this.convertToOptions(j.children);b.appendMany(o,p)}h.push(o)}}return h},d}),b.define("select2/data/ajax",["./array","../utils","jquery"],function(a,b,c){function d(a,b){this.ajaxOptions=this._applyDefaults(b.get("ajax")),null!=this.ajaxOptions.processResults&&(this.processResults=this.ajaxOptions.processResults),d.__super__.constructor.call(this,a,b)}return b.Extend(d,a),d.prototype._applyDefaults=function(a){var b={data:function(a){return c.extend({},a,{q:a.term})},transport:function(a,b,d){var e=c.ajax(a);return e.then(b),e.fail(d),e}};return c.extend({},b,a,!0)},d.prototype.processResults=function(a){return a},d.prototype.query=function(a,b){function d(){var d=f.transport(f,function(d){var f=e.processResults(d,a);e.options.get("debug")&&window.console&&console.error&&(f&&f.results&&c.isArray(f.results)||console.error("Select2: The AJAX results did not return an array in the `results` key of the response.")),b(f)},function(){d.status&&"0"===d.status||e.trigger("results:message",{message:"errorLoading"})});e._request=d}var e=this;null!=this._request&&(c.isFunction(this._request.abort)&&this._request.abort(),this._request=null);var f=c.extend({type:"GET"},this.ajaxOptions);"function"==typeof f.url&&(f.url=f.url.call(this.$element,a)),"function"==typeof f.data&&(f.data=f.data.call(this.$element,a)),this.ajaxOptions.delay&&null!=a.term?(this._queryTimeout&&window.clearTimeout(this._queryTimeout),this._queryTimeout=window.setTimeout(d,this.ajaxOptions.delay)):d()},d}),b.define("select2/data/tags",["jquery"],function(a){function b(b,c,d){var e=d.get("tags"),f=d.get("createTag");void 0!==f&&(this.createTag=f);var g=d.get("insertTag");if(void 0!==g&&(this.insertTag=g),b.call(this,c,d),a.isArray(e))for(var h=0;h<e.length;h++){var i=e[h],j=this._normalizeItem(i),k=this.option(j);this.$element.append(k)}}return b.prototype.query=function(a,b,c){function d(a,f){for(var g=a.results,h=0;h<g.length;h++){var i=g[h],j=null!=i.children&&!d({results:i.children},!0),k=i.text===b.term;if(k||j)return f?!1:(a.data=g,void c(a))}if(f)return!0;var l=e.createTag(b);if(null!=l){var m=e.option(l);m.attr("data-select2-tag",!0),e.addOptions([m]),e.insertTag(g,l)}a.results=g,c(a)}var e=this;return this._removeOldTags(),null==b.term||null!=b.page?void a.call(this,b,c):void a.call(this,b,d)},b.prototype.createTag=function(b,c){var d=a.trim(c.term);return""===d?null:{id:d,text:d}},b.prototype.insertTag=function(a,b,c){b.unshift(c)},b.prototype._removeOldTags=function(b){var c=(this._lastTag,this.$element.find("option[data-select2-tag]"));c.each(function(){this.selected||a(this).remove()})},b}),b.define("select2/data/tokenizer",["jquery"],function(a){function b(a,b,c){var d=c.get("tokenizer");void 0!==d&&(this.tokenizer=d),a.call(this,b,c)}return b.prototype.bind=function(a,b,c){a.call(this,b,c),this.$search=b.dropdown.$search||b.selection.$search||c.find(".select2-search__field")},b.prototype.query=function(b,c,d){function e(b){var c=g._normalizeItem(b),d=g.$element.find("option").filter(function(){return a(this).val()===c.id});if(!d.length){var e=g.option(c);e.attr("data-select2-tag",!0),g._removeOldTags(),g.addOptions([e])}f(c)}function f(a){g.trigger("select",{data:a})}var g=this;c.term=c.term||"";var h=this.tokenizer(c,this.options,e);h.term!==c.term&&(this.$search.length&&(this.$search.val(h.term),this.$search.focus()),c.term=h.term),b.call(this,c,d)},b.prototype.tokenizer=function(b,c,d,e){for(var f=d.get("tokenSeparators")||[],g=c.term,h=0,i=this.createTag||function(a){return{id:a.term,text:a.term}};h<g.length;){var j=g[h];if(-1!==a.inArray(j,f)){var k=g.substr(0,h),l=a.extend({},c,{term:k}),m=i(l);null!=m?(e(m),g=g.substr(h+1)||"",h=0):h++}else h++}return{term:g}},b}),b.define("select2/data/minimumInputLength",[],function(){function a(a,b,c){this.minimumInputLength=c.get("minimumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){return b.term=b.term||"",b.term.length<this.minimumInputLength?void this.trigger("results:message",{message:"inputTooShort",args:{minimum:this.minimumInputLength,input:b.term,params:b}}):void a.call(this,b,c)},a}),b.define("select2/data/maximumInputLength",[],function(){function a(a,b,c){this.maximumInputLength=c.get("maximumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){return b.term=b.term||"",this.maximumInputLength>0&&b.term.length>this.maximumInputLength?void this.trigger("results:message",{message:"inputTooLong",args:{maximum:this.maximumInputLength,input:b.term,params:b}}):void a.call(this,b,c)},a}),b.define("select2/data/maximumSelectionLength",[],function(){function a(a,b,c){this.maximumSelectionLength=c.get("maximumSelectionLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){var d=this;this.current(function(e){var f=null!=e?e.length:0;return d.maximumSelectionLength>0&&f>=d.maximumSelectionLength?void d.trigger("results:message",{message:"maximumSelected",args:{maximum:d.maximumSelectionLength}}):void a.call(d,b,c)})},a}),b.define("select2/dropdown",["jquery","./utils"],function(a,b){function c(a,b){this.$element=a,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<span class="select2-dropdown"><span class="select2-results"></span></span>');return b.attr("dir",this.options.get("dir")),this.$dropdown=b,b},c.prototype.bind=function(){},c.prototype.position=function(a,b){},c.prototype.destroy=function(){this.$dropdown.remove()},c}),b.define("select2/dropdown/search",["jquery","../utils"],function(a,b){function c(){}return c.prototype.render=function(b){var c=b.call(this),d=a('<span class="select2-search select2-search--dropdown"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" /></span>');return this.$searchContainer=d,this.$search=d.find("input"),c.prepend(d),c},c.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),this.$search.on("keydown",function(a){e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented()}),this.$search.on("input",function(b){a(this).off("keyup")}),this.$search.on("keyup input",function(a){e.handleSearch(a)}),c.on("open",function(){e.$search.attr("tabindex",0),e.$search.focus(),window.setTimeout(function(){e.$search.focus()},0)}),c.on("close",function(){e.$search.attr("tabindex",-1),e.$search.val("")}),c.on("focus",function(){c.isOpen()&&e.$search.focus()}),c.on("results:all",function(a){if(null==a.query.term||""===a.query.term){var b=e.showSearch(a);b?e.$searchContainer.removeClass("select2-search--hide"):e.$searchContainer.addClass("select2-search--hide")}})},c.prototype.handleSearch=function(a){if(!this._keyUpPrevented){var b=this.$search.val();this.trigger("query",{term:b})}this._keyUpPrevented=!1},c.prototype.showSearch=function(a,b){return!0},c}),b.define("select2/dropdown/hidePlaceholder",[],function(){function a(a,b,c,d){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c,d)}return a.prototype.append=function(a,b){b.results=this.removePlaceholder(b.results),a.call(this,b)},a.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},a.prototype.removePlaceholder=function(a,b){for(var c=b.slice(0),d=b.length-1;d>=0;d--){var e=b[d];this.placeholder.id===e.id&&c.splice(d,1)}return c},a}),b.define("select2/dropdown/infiniteScroll",["jquery"],function(a){function b(a,b,c,d){this.lastParams={},a.call(this,b,c,d),this.$loadingMore=this.createLoadingMore(),this.loading=!1}return b.prototype.append=function(a,b){this.$loadingMore.remove(),this.loading=!1,a.call(this,b),this.showLoadingMore(b)&&this.$results.append(this.$loadingMore)},b.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),c.on("query",function(a){e.lastParams=a,e.loading=!0}),c.on("query:append",function(a){e.lastParams=a,e.loading=!0}),this.$results.on("scroll",function(){var b=a.contains(document.documentElement,e.$loadingMore[0]);if(!e.loading&&b){var c=e.$results.offset().top+e.$results.outerHeight(!1),d=e.$loadingMore.offset().top+e.$loadingMore.outerHeight(!1);c+50>=d&&e.loadMore()}})},b.prototype.loadMore=function(){this.loading=!0;var b=a.extend({},{page:1},this.lastParams);b.page++,this.trigger("query:append",b)},b.prototype.showLoadingMore=function(a,b){return b.pagination&&b.pagination.more},b.prototype.createLoadingMore=function(){var b=a('<li class="select2-results__option select2-results__option--load-more"role="treeitem" aria-disabled="true"></li>'),c=this.options.get("translations").get("loadingMore");return b.html(c(this.lastParams)),b},b}),b.define("select2/dropdown/attachBody",["jquery","../utils"],function(a,b){function c(b,c,d){this.$dropdownParent=d.get("dropdownParent")||a(document.body),b.call(this,c,d)}return c.prototype.bind=function(a,b,c){var d=this,e=!1;a.call(this,b,c),b.on("open",function(){d._showDropdown(),d._attachPositioningHandler(b),e||(e=!0,b.on("results:all",function(){d._positionDropdown(),d._resizeDropdown()}),b.on("results:append",function(){d._positionDropdown(),d._resizeDropdown()}))}),b.on("close",function(){d._hideDropdown(),d._detachPositioningHandler(b)}),this.$dropdownContainer.on("mousedown",function(a){a.stopPropagation()})},c.prototype.destroy=function(a){a.call(this),this.$dropdownContainer.remove()},c.prototype.position=function(a,b,c){b.attr("class",c.attr("class")),b.removeClass("select2"),b.addClass("select2-container--open"),b.css({position:"absolute",top:-999999}),this.$container=c},c.prototype.render=function(b){var c=a("<span></span>"),d=b.call(this);return c.append(d),this.$dropdownContainer=c,c},c.prototype._hideDropdown=function(a){this.$dropdownContainer.detach()},c.prototype._attachPositioningHandler=function(c,d){var e=this,f="scroll.select2."+d.id,g="resize.select2."+d.id,h="orientationchange.select2."+d.id,i=this.$container.parents().filter(b.hasScroll);i.each(function(){a(this).data("select2-scroll-position",{x:a(this).scrollLeft(),y:a(this).scrollTop()})}),i.on(f,function(b){var c=a(this).data("select2-scroll-position");a(this).scrollTop(c.y)}),a(window).on(f+" "+g+" "+h,function(a){e._positionDropdown(),e._resizeDropdown()})},c.prototype._detachPositioningHandler=function(c,d){var e="scroll.select2."+d.id,f="resize.select2."+d.id,g="orientationchange.select2."+d.id,h=this.$container.parents().filter(b.hasScroll);h.off(e),a(window).off(e+" "+f+" "+g)},c.prototype._positionDropdown=function(){var b=a(window),c=this.$dropdown.hasClass("select2-dropdown--above"),d=this.$dropdown.hasClass("select2-dropdown--below"),e=null,f=this.$container.offset();f.bottom=f.top+this.$container.outerHeight(!1);var g={height:this.$container.outerHeight(!1)};g.top=f.top,g.bottom=f.top+g.height;var h={height:this.$dropdown.outerHeight(!1)},i={top:b.scrollTop(),bottom:b.scrollTop()+b.height()},j=i.top<f.top-h.height,k=i.bottom>f.bottom+h.height,l={left:f.left,top:g.bottom},m=this.$dropdownParent;"static"===m.css("position")&&(m=m.offsetParent());var n=m.offset();l.top-=n.top,l.left-=n.left,c||d||(e="below"),k||!j||c?!j&&k&&c&&(e="below"):e="above",("above"==e||c&&"below"!==e)&&(l.top=g.top-n.top-h.height),null!=e&&(this.$dropdown.removeClass("select2-dropdown--below select2-dropdown--above").addClass("select2-dropdown--"+e),this.$container.removeClass("select2-container--below select2-container--above").addClass("select2-container--"+e)),this.$dropdownContainer.css(l)},c.prototype._resizeDropdown=function(){var a={width:this.$container.outerWidth(!1)+"px"};this.options.get("dropdownAutoWidth")&&(a.minWidth=a.width,a.position="relative",a.width="auto"),this.$dropdown.css(a)},c.prototype._showDropdown=function(a){this.$dropdownContainer.appendTo(this.$dropdownParent),this._positionDropdown(),this._resizeDropdown()},c}),b.define("select2/dropdown/minimumResultsForSearch",[],function(){function a(b){for(var c=0,d=0;d<b.length;d++){var e=b[d];e.children?c+=a(e.children):c++}return c}function b(a,b,c,d){this.minimumResultsForSearch=c.get("minimumResultsForSearch"),this.minimumResultsForSearch<0&&(this.minimumResultsForSearch=1/0),a.call(this,b,c,d)}return b.prototype.showSearch=function(b,c){return a(c.data.results)<this.minimumResultsForSearch?!1:b.call(this,c)},b}),b.define("select2/dropdown/selectOnClose",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("close",function(a){d._handleSelectOnClose(a)})},a.prototype._handleSelectOnClose=function(a,b){if(b&&null!=b.originalSelect2Event){var c=b.originalSelect2Event;if("select"===c._type||"unselect"===c._type)return}var d=this.getHighlightedResults();if(!(d.length<1)){var e=d.data("data");null!=e.element&&e.element.selected||null==e.element&&e.selected||this.trigger("select",{data:e})}},a}),b.define("select2/dropdown/closeOnSelect",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("select",function(a){d._selectTriggered(a)}),b.on("unselect",function(a){d._selectTriggered(a)})},a.prototype._selectTriggered=function(a,b){var c=b.originalEvent;c&&c.ctrlKey||this.trigger("close",{originalEvent:c,originalSelect2Event:b})},a}),b.define("select2/i18n/en",[],function(){return{errorLoading:function(){return"The results could not be loaded."},inputTooLong:function(a){var b=a.input.length-a.maximum,c="Please delete "+b+" character";return 1!=b&&(c+="s"),c},inputTooShort:function(a){var b=a.minimum-a.input.length,c="Please enter "+b+" or more characters";return c},loadingMore:function(){return"Loading more results…"},maximumSelected:function(a){var b="You can only select "+a.maximum+" item";return 1!=a.maximum&&(b+="s"),b},noResults:function(){return"No results found"},searching:function(){return"Searching…"}}}),b.define("select2/defaults",["jquery","require","./results","./selection/single","./selection/multiple","./selection/placeholder","./selection/allowClear","./selection/search","./selection/eventRelay","./utils","./translation","./diacritics","./data/select","./data/array","./data/ajax","./data/tags","./data/tokenizer","./data/minimumInputLength","./data/maximumInputLength","./data/maximumSelectionLength","./dropdown","./dropdown/search","./dropdown/hidePlaceholder","./dropdown/infiniteScroll","./dropdown/attachBody","./dropdown/minimumResultsForSearch","./dropdown/selectOnClose","./dropdown/closeOnSelect","./i18n/en"],function(a,b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u,v,w,x,y,z,A,B,C){function D(){this.reset()}D.prototype.apply=function(l){if(l=a.extend(!0,{},this.defaults,l),null==l.dataAdapter){if(null!=l.ajax?l.dataAdapter=o:null!=l.data?l.dataAdapter=n:l.dataAdapter=m,l.minimumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,r)),l.maximumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,s)),l.maximumSelectionLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,t)),l.tags&&(l.dataAdapter=j.Decorate(l.dataAdapter,p)),(null!=l.tokenSeparators||null!=l.tokenizer)&&(l.dataAdapter=j.Decorate(l.dataAdapter,q)),null!=l.query){var C=b(l.amdBase+"compat/query");l.dataAdapter=j.Decorate(l.dataAdapter,C)}if(null!=l.initSelection){var D=b(l.amdBase+"compat/initSelection");l.dataAdapter=j.Decorate(l.dataAdapter,D)}}if(null==l.resultsAdapter&&(l.resultsAdapter=c,null!=l.ajax&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,x)),null!=l.placeholder&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,w)),l.selectOnClose&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,A))),null==l.dropdownAdapter){if(l.multiple)l.dropdownAdapter=u;else{var E=j.Decorate(u,v);l.dropdownAdapter=E}if(0!==l.minimumResultsForSearch&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,z)),l.closeOnSelect&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,B)),null!=l.dropdownCssClass||null!=l.dropdownCss||null!=l.adaptDropdownCssClass){var F=b(l.amdBase+"compat/dropdownCss");l.dropdownAdapter=j.Decorate(l.dropdownAdapter,F)}l.dropdownAdapter=j.Decorate(l.dropdownAdapter,y)}if(null==l.selectionAdapter){if(l.multiple?l.selectionAdapter=e:l.selectionAdapter=d,null!=l.placeholder&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,f)),l.allowClear&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,g)),l.multiple&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,h)),null!=l.containerCssClass||null!=l.containerCss||null!=l.adaptContainerCssClass){var G=b(l.amdBase+"compat/containerCss");l.selectionAdapter=j.Decorate(l.selectionAdapter,G)}l.selectionAdapter=j.Decorate(l.selectionAdapter,i)}if("string"==typeof l.language)if(l.language.indexOf("-")>0){var H=l.language.split("-"),I=H[0];l.language=[l.language,I]}else l.language=[l.language];if(a.isArray(l.language)){var J=new k;l.language.push("en");for(var K=l.language,L=0;L<K.length;L++){var M=K[L],N={};try{N=k.loadPath(M)}catch(O){try{M=this.defaults.amdLanguageBase+M,N=k.loadPath(M)}catch(P){l.debug&&window.console&&console.warn&&console.warn('Select2: The language file for "'+M+'" could not be automatically loaded. A fallback will be used instead.');continue}}J.extend(N)}l.translations=J}else{var Q=k.loadPath(this.defaults.amdLanguageBase+"en"),R=new k(l.language);R.extend(Q),l.translations=R}return l},D.prototype.reset=function(){function b(a){function b(a){return l[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function c(d,e){if(""===a.trim(d.term))return e;if(e.children&&e.children.length>0){for(var f=a.extend(!0,{},e),g=e.children.length-1;g>=0;g--){var h=e.children[g],i=c(d,h);null==i&&f.children.splice(g,1)}return f.children.length>0?f:c(d,f)}var j=b(e.text).toUpperCase(),k=b(d.term).toUpperCase();return j.indexOf(k)>-1?e:null}this.defaults={amdBase:"./",amdLanguageBase:"./i18n/",closeOnSelect:!0,debug:!1,dropdownAutoWidth:!1,escapeMarkup:j.escapeMarkup,language:C,matcher:c,minimumInputLength:0,maximumInputLength:0,maximumSelectionLength:0,minimumResultsForSearch:0,selectOnClose:!1,sorter:function(a){return a},templateResult:function(a){return a.text},templateSelection:function(a){return a.text},theme:"default",width:"resolve"}},D.prototype.set=function(b,c){var d=a.camelCase(b),e={};e[d]=c;var f=j._convertData(e);a.extend(this.defaults,f)};var E=new D;return E}),b.define("select2/options",["require","jquery","./defaults","./utils"],function(a,b,c,d){function e(b,e){if(this.options=b,null!=e&&this.fromElement(e),this.options=c.apply(this.options),e&&e.is("input")){var f=a(this.get("amdBase")+"compat/inputData");this.options.dataAdapter=d.Decorate(this.options.dataAdapter,f)}}return e.prototype.fromElement=function(a){var c=["select2"];null==this.options.multiple&&(this.options.multiple=a.prop("multiple")),null==this.options.disabled&&(this.options.disabled=a.prop("disabled")),null==this.options.language&&(a.prop("lang")?this.options.language=a.prop("lang").toLowerCase():a.closest("[lang]").prop("lang")&&(this.options.language=a.closest("[lang]").prop("lang"))),null==this.options.dir&&(a.prop("dir")?this.options.dir=a.prop("dir"):a.closest("[dir]").prop("dir")?this.options.dir=a.closest("[dir]").prop("dir"):this.options.dir="ltr"),a.prop("disabled",this.options.disabled),a.prop("multiple",this.options.multiple),a.data("select2Tags")&&(this.options.debug&&window.console&&console.warn&&console.warn('Select2: The `data-select2-tags` attribute has been changed to use the `data-data` and `data-tags="true"` attributes and will be removed in future versions of Select2.'),a.data("data",a.data("select2Tags")),a.data("tags",!0)),a.data("ajaxUrl")&&(this.options.debug&&window.console&&console.warn&&console.warn("Select2: The `data-ajax-url` attribute has been changed to `data-ajax--url` and support for the old attribute will be removed in future versions of Select2."),a.attr("ajax--url",a.data("ajaxUrl")),a.data("ajax--url",a.data("ajaxUrl")));var e={};e=b.fn.jquery&&"1."==b.fn.jquery.substr(0,2)&&a[0].dataset?b.extend(!0,{},a[0].dataset,a.data()):a.data();var f=b.extend(!0,{},e);f=d._convertData(f);for(var g in f)b.inArray(g,c)>-1||(b.isPlainObject(this.options[g])?b.extend(this.options[g],f[g]):this.options[g]=f[g]);return this},e.prototype.get=function(a){return this.options[a]},e.prototype.set=function(a,b){this.options[a]=b},e}),b.define("select2/core",["jquery","./options","./utils","./keys"],function(a,b,c,d){var e=function(a,c){null!=a.data("select2")&&a.data("select2").destroy(),this.$element=a,this.id=this._generateId(a),c=c||{},this.options=new b(c,a),e.__super__.constructor.call(this);var d=a.attr("tabindex")||0;a.data("old-tabindex",d),a.attr("tabindex","-1");var f=this.options.get("dataAdapter");this.dataAdapter=new f(a,this.options);var g=this.render();this._placeContainer(g);var h=this.options.get("selectionAdapter");this.selection=new h(a,this.options),this.$selection=this.selection.render(),this.selection.position(this.$selection,g);var i=this.options.get("dropdownAdapter");this.dropdown=new i(a,this.options),this.$dropdown=this.dropdown.render(),this.dropdown.position(this.$dropdown,g);var j=this.options.get("resultsAdapter");this.results=new j(a,this.options,this.dataAdapter),this.$results=this.results.render(),this.results.position(this.$results,this.$dropdown);var k=this;this._bindAdapters(),this._registerDomEvents(),this._registerDataEvents(),this._registerSelectionEvents(),this._registerDropdownEvents(),this._registerResultsEvents(),this._registerEvents(),this.dataAdapter.current(function(a){k.trigger("selection:update",{data:a})}),a.addClass("select2-hidden-accessible"),a.attr("aria-hidden","true"),this._syncAttributes(),a.data("select2",this)};return c.Extend(e,c.Observable),e.prototype._generateId=function(a){var b="";return b=null!=a.attr("id")?a.attr("id"):null!=a.attr("name")?a.attr("name")+"-"+c.generateChars(2):c.generateChars(4),b=b.replace(/(:|\.|\[|\]|,)/g,""),b="select2-"+b},e.prototype._placeContainer=function(a){a.insertAfter(this.$element);var b=this._resolveWidth(this.$element,this.options.get("width"));null!=b&&a.css("width",b)},e.prototype._resolveWidth=function(a,b){var c=/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;if("resolve"==b){var d=this._resolveWidth(a,"style");return null!=d?d:this._resolveWidth(a,"element")}if("element"==b){var e=a.outerWidth(!1);return 0>=e?"auto":e+"px"}if("style"==b){var f=a.attr("style");if("string"!=typeof f)return null;for(var g=f.split(";"),h=0,i=g.length;i>h;h+=1){var j=g[h].replace(/\s/g,""),k=j.match(c);if(null!==k&&k.length>=1)return k[1]}return null}return b},e.prototype._bindAdapters=function(){this.dataAdapter.bind(this,this.$container),this.selection.bind(this,this.$container),this.dropdown.bind(this,this.$container),this.results.bind(this,this.$container)},e.prototype._registerDomEvents=function(){var b=this;this.$element.on("change.select2",function(){b.dataAdapter.current(function(a){b.trigger("selection:update",{data:a})})}),this.$element.on("focus.select2",function(a){b.trigger("focus",a)}),this._syncA=c.bind(this._syncAttributes,this),this._syncS=c.bind(this._syncSubtree,this),this.$element[0].attachEvent&&this.$element[0].attachEvent("onpropertychange",this._syncA);var d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver;null!=d?(this._observer=new d(function(c){a.each(c,b._syncA),a.each(c,b._syncS)}),this._observer.observe(this.$element[0],{attributes:!0,childList:!0,subtree:!1})):this.$element[0].addEventListener&&(this.$element[0].addEventListener("DOMAttrModified",b._syncA,!1),this.$element[0].addEventListener("DOMNodeInserted",b._syncS,!1),this.$element[0].addEventListener("DOMNodeRemoved",b._syncS,!1))},e.prototype._registerDataEvents=function(){var a=this;this.dataAdapter.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerSelectionEvents=function(){var b=this,c=["toggle","focus"];this.selection.on("toggle",function(){b.toggleDropdown()}),this.selection.on("focus",function(a){b.focus(a)}),this.selection.on("*",function(d,e){-1===a.inArray(d,c)&&b.trigger(d,e)})},e.prototype._registerDropdownEvents=function(){var a=this;this.dropdown.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerResultsEvents=function(){var a=this;this.results.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerEvents=function(){var a=this;this.on("open",function(){a.$container.addClass("select2-container--open")}),this.on("close",function(){a.$container.removeClass("select2-container--open")}),this.on("enable",function(){a.$container.removeClass("select2-container--disabled")}),this.on("disable",function(){a.$container.addClass("select2-container--disabled")}),this.on("blur",function(){a.$container.removeClass("select2-container--focus")}),this.on("query",function(b){a.isOpen()||a.trigger("open",{}),this.dataAdapter.query(b,function(c){a.trigger("results:all",{data:c,query:b})})}),this.on("query:append",function(b){this.dataAdapter.query(b,function(c){a.trigger("results:append",{data:c,query:b})})}),this.on("keypress",function(b){var c=b.which;a.isOpen()?c===d.ESC||c===d.TAB||c===d.UP&&b.altKey?(a.close(),b.preventDefault()):c===d.ENTER?(a.trigger("results:select",{}),b.preventDefault()):c===d.SPACE&&b.ctrlKey?(a.trigger("results:toggle",{}),b.preventDefault()):c===d.UP?(a.trigger("results:previous",{}),b.preventDefault()):c===d.DOWN&&(a.trigger("results:next",{}),b.preventDefault()):(c===d.ENTER||c===d.SPACE||c===d.DOWN&&b.altKey)&&(a.open(),b.preventDefault())})},e.prototype._syncAttributes=function(){this.options.set("disabled",this.$element.prop("disabled")),this.options.get("disabled")?(this.isOpen()&&this.close(),this.trigger("disable",{})):this.trigger("enable",{})},e.prototype._syncSubtree=function(a,b){var c=!1,d=this;if(!a||!a.target||"OPTION"===a.target.nodeName||"OPTGROUP"===a.target.nodeName){if(b)if(b.addedNodes&&b.addedNodes.length>0)for(var e=0;e<b.addedNodes.length;e++){var f=b.addedNodes[e];f.selected&&(c=!0)}else b.removedNodes&&b.removedNodes.length>0&&(c=!0);else c=!0;c&&this.dataAdapter.current(function(a){d.trigger("selection:update",{data:a})})}},e.prototype.trigger=function(a,b){var c=e.__super__.trigger,d={open:"opening",close:"closing",select:"selecting",unselect:"unselecting"};if(void 0===b&&(b={}),a in d){var f=d[a],g={prevented:!1,name:a,args:b};if(c.call(this,f,g),g.prevented)return void(b.prevented=!0)}c.call(this,a,b)},e.prototype.toggleDropdown=function(){this.options.get("disabled")||(this.isOpen()?this.close():this.open())},e.prototype.open=function(){this.isOpen()||this.trigger("query",{})},e.prototype.close=function(){this.isOpen()&&this.trigger("close",{})},e.prototype.isOpen=function(){return this.$container.hasClass("select2-container--open")},e.prototype.hasFocus=function(){return this.$container.hasClass("select2-container--focus")},e.prototype.focus=function(a){this.hasFocus()||(this.$container.addClass("select2-container--focus"),this.trigger("focus",{}))},e.prototype.enable=function(a){this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("enable")` method has been deprecated and will be removed in later Select2 versions. Use $element.prop("disabled") instead.'),(null==a||0===a.length)&&(a=[!0]);var b=!a[0];this.$element.prop("disabled",b)},e.prototype.data=function(){this.options.get("debug")&&arguments.length>0&&window.console&&console.warn&&console.warn('Select2: Data can no longer be set using `select2("data")`. You should consider setting the value instead using `$element.val()`.');var a=[];return this.dataAdapter.current(function(b){a=b}),a},e.prototype.val=function(b){if(this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("val")` method has been deprecated and will be removed in later Select2 versions. Use $element.val() instead.'),null==b||0===b.length)return this.$element.val();var c=b[0];a.isArray(c)&&(c=a.map(c,function(a){return a.toString()})),this.$element.val(c).trigger("change")},e.prototype.destroy=function(){this.$container.remove(),this.$element[0].detachEvent&&this.$element[0].detachEvent("onpropertychange",this._syncA),null!=this._observer?(this._observer.disconnect(),this._observer=null):this.$element[0].removeEventListener&&(this.$element[0].removeEventListener("DOMAttrModified",this._syncA,!1),this.$element[0].removeEventListener("DOMNodeInserted",this._syncS,!1),this.$element[0].removeEventListener("DOMNodeRemoved",this._syncS,!1)),this._syncA=null,this._syncS=null,this.$element.off(".select2"),this.$element.attr("tabindex",this.$element.data("old-tabindex")),this.$element.removeClass("select2-hidden-accessible"),this.$element.attr("aria-hidden","false"),this.$element.removeData("select2"),this.dataAdapter.destroy(),this.selection.destroy(),this.dropdown.destroy(),this.results.destroy(),this.dataAdapter=null,this.selection=null,this.dropdown=null,this.results=null; +},e.prototype.render=function(){var b=a('<span class="select2 select2-container"><span class="selection"></span><span class="dropdown-wrapper" aria-hidden="true"></span></span>');return b.attr("dir",this.options.get("dir")),this.$container=b,this.$container.addClass("select2-container--"+this.options.get("theme")),b.data("element",this.$element),b},e}),b.define("select2/compat/utils",["jquery"],function(a){function b(b,c,d){var e,f,g=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each(function(){0===this.indexOf("select2-")&&g.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each(function(){0!==this.indexOf("select2-")&&(f=d(this),null!=f&&g.push(f))})),b.attr("class",g.join(" "))}return{syncCssClasses:b}}),b.define("select2/compat/containerCss",["jquery","./utils"],function(a,b){function c(a){return null}function d(){}return d.prototype.render=function(d){var e=d.call(this),f=this.options.get("containerCssClass")||"";a.isFunction(f)&&(f=f(this.$element));var g=this.options.get("adaptContainerCssClass");if(g=g||c,-1!==f.indexOf(":all:")){f=f.replace(":all:","");var h=g;g=function(a){var b=h(a);return null!=b?b+" "+a:a}}var i=this.options.get("containerCss")||{};return a.isFunction(i)&&(i=i(this.$element)),b.syncCssClasses(e,this.$element,g),e.css(i),e.addClass(f),e},d}),b.define("select2/compat/dropdownCss",["jquery","./utils"],function(a,b){function c(a){return null}function d(){}return d.prototype.render=function(d){var e=d.call(this),f=this.options.get("dropdownCssClass")||"";a.isFunction(f)&&(f=f(this.$element));var g=this.options.get("adaptDropdownCssClass");if(g=g||c,-1!==f.indexOf(":all:")){f=f.replace(":all:","");var h=g;g=function(a){var b=h(a);return null!=b?b+" "+a:a}}var i=this.options.get("dropdownCss")||{};return a.isFunction(i)&&(i=i(this.$element)),b.syncCssClasses(e,this.$element,g),e.css(i),e.addClass(f),e},d}),b.define("select2/compat/initSelection",["jquery"],function(a){function b(a,b,c){c.get("debug")&&window.console&&console.warn&&console.warn("Select2: The `initSelection` option has been deprecated in favor of a custom data adapter that overrides the `current` method. This method is now called multiple times instead of a single time when the instance is initialized. Support will be removed for the `initSelection` option in future versions of Select2"),this.initSelection=c.get("initSelection"),this._isInitialized=!1,a.call(this,b,c)}return b.prototype.current=function(b,c){var d=this;return this._isInitialized?void b.call(this,c):void this.initSelection.call(null,this.$element,function(b){d._isInitialized=!0,a.isArray(b)||(b=[b]),c(b)})},b}),b.define("select2/compat/inputData",["jquery"],function(a){function b(a,b,c){this._currentData=[],this._valueSeparator=c.get("valueSeparator")||",","hidden"===b.prop("type")&&c.get("debug")&&console&&console.warn&&console.warn("Select2: Using a hidden input with Select2 is no longer supported and may stop working in the future. It is recommended to use a `<select>` element instead."),a.call(this,b,c)}return b.prototype.current=function(b,c){function d(b,c){var e=[];return b.selected||-1!==a.inArray(b.id,c)?(b.selected=!0,e.push(b)):b.selected=!1,b.children&&e.push.apply(e,d(b.children,c)),e}for(var e=[],f=0;f<this._currentData.length;f++){var g=this._currentData[f];e.push.apply(e,d(g,this.$element.val().split(this._valueSeparator)))}c(e)},b.prototype.select=function(b,c){if(this.options.get("multiple")){var d=this.$element.val();d+=this._valueSeparator+c.id,this.$element.val(d),this.$element.trigger("change")}else this.current(function(b){a.map(b,function(a){a.selected=!1})}),this.$element.val(c.id),this.$element.trigger("change")},b.prototype.unselect=function(a,b){var c=this;b.selected=!1,this.current(function(a){for(var d=[],e=0;e<a.length;e++){var f=a[e];b.id!=f.id&&d.push(f.id)}c.$element.val(d.join(c._valueSeparator)),c.$element.trigger("change")})},b.prototype.query=function(a,b,c){for(var d=[],e=0;e<this._currentData.length;e++){var f=this._currentData[e],g=this.matches(b,f);null!==g&&d.push(g)}c({results:d})},b.prototype.addOptions=function(b,c){var d=a.map(c,function(b){return a.data(b[0],"data")});this._currentData.push.apply(this._currentData,d)},b}),b.define("select2/compat/matcher",["jquery"],function(a){function b(b){function c(c,d){var e=a.extend(!0,{},d);if(null==c.term||""===a.trim(c.term))return e;if(d.children){for(var f=d.children.length-1;f>=0;f--){var g=d.children[f],h=b(c.term,g.text,g);h||e.children.splice(f,1)}if(e.children.length>0)return e}return b(c.term,d.text,d)?e:null}return c}return b}),b.define("select2/compat/query",[],function(){function a(a,b,c){c.get("debug")&&window.console&&console.warn&&console.warn("Select2: The `query` option has been deprecated in favor of a custom data adapter that overrides the `query` method. Support will be removed for the `query` option in future versions of Select2."),a.call(this,b,c)}return a.prototype.query=function(a,b,c){b.callback=c;var d=this.options.get("query");d.call(null,b)},a}),b.define("select2/dropdown/attachContainer",[],function(){function a(a,b,c){a.call(this,b,c)}return a.prototype.position=function(a,b,c){var d=c.find(".dropdown-wrapper");d.append(b),b.addClass("select2-dropdown--below"),c.addClass("select2-container--below")},a}),b.define("select2/dropdown/stopPropagation",[],function(){function a(){}return a.prototype.bind=function(a,b,c){a.call(this,b,c);var d=["blur","change","click","dblclick","focus","focusin","focusout","input","keydown","keyup","keypress","mousedown","mouseenter","mouseleave","mousemove","mouseover","mouseup","search","touchend","touchstart"];this.$dropdown.on(d.join(" "),function(a){a.stopPropagation()})},a}),b.define("select2/selection/stopPropagation",[],function(){function a(){}return a.prototype.bind=function(a,b,c){a.call(this,b,c);var d=["blur","change","click","dblclick","focus","focusin","focusout","input","keydown","keyup","keypress","mousedown","mouseenter","mouseleave","mousemove","mouseover","mouseup","search","touchend","touchstart"];this.$selection.on(d.join(" "),function(a){a.stopPropagation()})},a}),function(c){"function"==typeof b.define&&b.define.amd?b.define("jquery-mousewheel",["jquery"],c):"object"==typeof exports?module.exports=c:c(a)}(function(a){function b(b){var g=b||window.event,h=i.call(arguments,1),j=0,l=0,m=0,n=0,o=0,p=0;if(b=a.event.fix(g),b.type="mousewheel","detail"in g&&(m=-1*g.detail),"wheelDelta"in g&&(m=g.wheelDelta),"wheelDeltaY"in g&&(m=g.wheelDeltaY),"wheelDeltaX"in g&&(l=-1*g.wheelDeltaX),"axis"in g&&g.axis===g.HORIZONTAL_AXIS&&(l=-1*m,m=0),j=0===m?l:m,"deltaY"in g&&(m=-1*g.deltaY,j=m),"deltaX"in g&&(l=g.deltaX,0===m&&(j=-1*l)),0!==m||0!==l){if(1===g.deltaMode){var q=a.data(this,"mousewheel-line-height");j*=q,m*=q,l*=q}else if(2===g.deltaMode){var r=a.data(this,"mousewheel-page-height");j*=r,m*=r,l*=r}if(n=Math.max(Math.abs(m),Math.abs(l)),(!f||f>n)&&(f=n,d(g,n)&&(f/=40)),d(g,n)&&(j/=40,l/=40,m/=40),j=Math[j>=1?"floor":"ceil"](j/f),l=Math[l>=1?"floor":"ceil"](l/f),m=Math[m>=1?"floor":"ceil"](m/f),k.settings.normalizeOffset&&this.getBoundingClientRect){var s=this.getBoundingClientRect();o=b.clientX-s.left,p=b.clientY-s.top}return b.deltaX=l,b.deltaY=m,b.deltaFactor=f,b.offsetX=o,b.offsetY=p,b.deltaMode=0,h.unshift(b,j,l,m),e&&clearTimeout(e),e=setTimeout(c,200),(a.event.dispatch||a.event.handle).apply(this,h)}}function c(){f=null}function d(a,b){return k.settings.adjustOldDeltas&&"mousewheel"===a.type&&b%120===0}var e,f,g=["wheel","mousewheel","DOMMouseScroll","MozMousePixelScroll"],h="onwheel"in document||document.documentMode>=9?["wheel"]:["mousewheel","DomMouseScroll","MozMousePixelScroll"],i=Array.prototype.slice;if(a.event.fixHooks)for(var j=g.length;j;)a.event.fixHooks[g[--j]]=a.event.mouseHooks;var k=a.event.special.mousewheel={version:"3.1.12",setup:function(){if(this.addEventListener)for(var c=h.length;c;)this.addEventListener(h[--c],b,!1);else this.onmousewheel=b;a.data(this,"mousewheel-line-height",k.getLineHeight(this)),a.data(this,"mousewheel-page-height",k.getPageHeight(this))},teardown:function(){if(this.removeEventListener)for(var c=h.length;c;)this.removeEventListener(h[--c],b,!1);else this.onmousewheel=null;a.removeData(this,"mousewheel-line-height"),a.removeData(this,"mousewheel-page-height")},getLineHeight:function(b){var c=a(b),d=c["offsetParent"in a.fn?"offsetParent":"parent"]();return d.length||(d=a("body")),parseInt(d.css("fontSize"),10)||parseInt(c.css("fontSize"),10)||16},getPageHeight:function(b){return a(b).height()},settings:{adjustOldDeltas:!0,normalizeOffset:!0}};a.fn.extend({mousewheel:function(a){return a?this.bind("mousewheel",a):this.trigger("mousewheel")},unmousewheel:function(a){return this.unbind("mousewheel",a)}})}),b.define("jquery.select2",["jquery","jquery-mousewheel","./select2/core","./select2/defaults"],function(a,b,c,d){if(null==a.fn.select2){var e=["open","close","destroy"];a.fn.select2=function(b){if(b=b||{},"object"==typeof b)return this.each(function(){var d=a.extend(!0,{},b);new c(a(this),d)}),this;if("string"==typeof b){var d,f=Array.prototype.slice.call(arguments,1);return this.each(function(){var c=a(this).data("select2");null==c&&window.console&&console.error&&console.error("The select2('"+b+"') method was called on an element that is not using Select2."),d=c[b].apply(c,f)}),a.inArray(b,e)>-1?this:d}throw new Error("Invalid arguments for Select2: "+b)}}return null==a.fn.select2.defaults&&(a.fn.select2.defaults=d),c}),{define:b.define,require:b.require}}(),c=b.require("jquery.select2");return a.fn.select2.amd=b,c});
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/select2.js b/ishtar_common/static/select2/js/select2.js new file mode 100644 index 000000000..13b84fadf --- /dev/null +++ b/ishtar_common/static/select2/js/select2.js @@ -0,0 +1,5725 @@ +/*! + * Select2 4.0.3 + * https://select2.github.io + * + * Released under the MIT license + * https://github.com/select2/select2/blob/master/LICENSE.md + */ +(function (factory) { + if (typeof define === 'function' && define.amd) { + // AMD. Register as an anonymous module. + define(['jquery'], factory); + } else if (typeof exports === 'object') { + // Node/CommonJS + factory(require('jquery')); + } else { + // Browser globals + factory(jQuery); + } +}(function (jQuery) { + // This is needed so we can catch the AMD loader configuration and use it + // The inner file should be wrapped (by `banner.start.js`) in a function that + // returns the AMD loader references. + var S2 = +(function () { + // Restore the Select2 AMD loader so it can be used + // Needed mostly in the language files, where the loader is not inserted + if (jQuery && jQuery.fn && jQuery.fn.select2 && jQuery.fn.select2.amd) { + var S2 = jQuery.fn.select2.amd; + } +var S2;(function () { if (!S2 || !S2.requirejs) { +if (!S2) { S2 = {}; } else { require = S2; } +/** + * @license almond 0.3.1 Copyright (c) 2011-2014, The Dojo Foundation All Rights Reserved. + * Available via the MIT or new BSD license. + * see: http://github.com/jrburke/almond for details + */ +//Going sloppy to avoid 'use strict' string cost, but strict practices should +//be followed. +/*jslint sloppy: true */ +/*global setTimeout: false */ + +var requirejs, require, define; +(function (undef) { + var main, req, makeMap, handlers, + defined = {}, + waiting = {}, + config = {}, + defining = {}, + hasOwn = Object.prototype.hasOwnProperty, + aps = [].slice, + jsSuffixRegExp = /\.js$/; + + function hasProp(obj, prop) { + return hasOwn.call(obj, prop); + } + + /** + * Given a relative module name, like ./something, normalize it to + * a real name that can be mapped to a path. + * @param {String} name the relative name + * @param {String} baseName a real name that the name arg is relative + * to. + * @returns {String} normalized name + */ + function normalize(name, baseName) { + var nameParts, nameSegment, mapValue, foundMap, lastIndex, + foundI, foundStarMap, starI, i, j, part, + baseParts = baseName && baseName.split("/"), + map = config.map, + starMap = (map && map['*']) || {}; + + //Adjust any relative paths. + if (name && name.charAt(0) === ".") { + //If have a base name, try to normalize against it, + //otherwise, assume it is a top-level require that will + //be relative to baseUrl in the end. + if (baseName) { + name = name.split('/'); + lastIndex = name.length - 1; + + // Node .js allowance: + if (config.nodeIdCompat && jsSuffixRegExp.test(name[lastIndex])) { + name[lastIndex] = name[lastIndex].replace(jsSuffixRegExp, ''); + } + + //Lop off the last part of baseParts, so that . matches the + //"directory" and not name of the baseName's module. For instance, + //baseName of "one/two/three", maps to "one/two/three.js", but we + //want the directory, "one/two" for this normalization. + name = baseParts.slice(0, baseParts.length - 1).concat(name); + + //start trimDots + for (i = 0; i < name.length; i += 1) { + part = name[i]; + if (part === ".") { + name.splice(i, 1); + i -= 1; + } else if (part === "..") { + if (i === 1 && (name[2] === '..' || name[0] === '..')) { + //End of the line. Keep at least one non-dot + //path segment at the front so it can be mapped + //correctly to disk. Otherwise, there is likely + //no path mapping for a path starting with '..'. + //This can still fail, but catches the most reasonable + //uses of .. + break; + } else if (i > 0) { + name.splice(i - 1, 2); + i -= 2; + } + } + } + //end trimDots + + name = name.join("/"); + } else if (name.indexOf('./') === 0) { + // No baseName, so this is ID is resolved relative + // to baseUrl, pull off the leading dot. + name = name.substring(2); + } + } + + //Apply map config if available. + if ((baseParts || starMap) && map) { + nameParts = name.split('/'); + + for (i = nameParts.length; i > 0; i -= 1) { + nameSegment = nameParts.slice(0, i).join("/"); + + if (baseParts) { + //Find the longest baseName segment match in the config. + //So, do joins on the biggest to smallest lengths of baseParts. + for (j = baseParts.length; j > 0; j -= 1) { + mapValue = map[baseParts.slice(0, j).join('/')]; + + //baseName segment has config, find if it has one for + //this name. + if (mapValue) { + mapValue = mapValue[nameSegment]; + if (mapValue) { + //Match, update name to the new value. + foundMap = mapValue; + foundI = i; + break; + } + } + } + } + + if (foundMap) { + break; + } + + //Check for a star map match, but just hold on to it, + //if there is a shorter segment match later in a matching + //config, then favor over this star map. + if (!foundStarMap && starMap && starMap[nameSegment]) { + foundStarMap = starMap[nameSegment]; + starI = i; + } + } + + if (!foundMap && foundStarMap) { + foundMap = foundStarMap; + foundI = starI; + } + + if (foundMap) { + nameParts.splice(0, foundI, foundMap); + name = nameParts.join('/'); + } + } + + return name; + } + + function makeRequire(relName, forceSync) { + return function () { + //A version of a require function that passes a moduleName + //value for items that may need to + //look up paths relative to the moduleName + var args = aps.call(arguments, 0); + + //If first arg is not require('string'), and there is only + //one arg, it is the array form without a callback. Insert + //a null so that the following concat is correct. + if (typeof args[0] !== 'string' && args.length === 1) { + args.push(null); + } + return req.apply(undef, args.concat([relName, forceSync])); + }; + } + + function makeNormalize(relName) { + return function (name) { + return normalize(name, relName); + }; + } + + function makeLoad(depName) { + return function (value) { + defined[depName] = value; + }; + } + + function callDep(name) { + if (hasProp(waiting, name)) { + var args = waiting[name]; + delete waiting[name]; + defining[name] = true; + main.apply(undef, args); + } + + if (!hasProp(defined, name) && !hasProp(defining, name)) { + throw new Error('No ' + name); + } + return defined[name]; + } + + //Turns a plugin!resource to [plugin, resource] + //with the plugin being undefined if the name + //did not have a plugin prefix. + function splitPrefix(name) { + var prefix, + index = name ? name.indexOf('!') : -1; + if (index > -1) { + prefix = name.substring(0, index); + name = name.substring(index + 1, name.length); + } + return [prefix, name]; + } + + /** + * Makes a name map, normalizing the name, and using a plugin + * for normalization if necessary. Grabs a ref to plugin + * too, as an optimization. + */ + makeMap = function (name, relName) { + var plugin, + parts = splitPrefix(name), + prefix = parts[0]; + + name = parts[1]; + + if (prefix) { + prefix = normalize(prefix, relName); + plugin = callDep(prefix); + } + + //Normalize according + if (prefix) { + if (plugin && plugin.normalize) { + name = plugin.normalize(name, makeNormalize(relName)); + } else { + name = normalize(name, relName); + } + } else { + name = normalize(name, relName); + parts = splitPrefix(name); + prefix = parts[0]; + name = parts[1]; + if (prefix) { + plugin = callDep(prefix); + } + } + + //Using ridiculous property names for space reasons + return { + f: prefix ? prefix + '!' + name : name, //fullName + n: name, + pr: prefix, + p: plugin + }; + }; + + function makeConfig(name) { + return function () { + return (config && config.config && config.config[name]) || {}; + }; + } + + handlers = { + require: function (name) { + return makeRequire(name); + }, + exports: function (name) { + var e = defined[name]; + if (typeof e !== 'undefined') { + return e; + } else { + return (defined[name] = {}); + } + }, + module: function (name) { + return { + id: name, + uri: '', + exports: defined[name], + config: makeConfig(name) + }; + } + }; + + main = function (name, deps, callback, relName) { + var cjsModule, depName, ret, map, i, + args = [], + callbackType = typeof callback, + usingExports; + + //Use name if no relName + relName = relName || name; + + //Call the callback to define the module, if necessary. + if (callbackType === 'undefined' || callbackType === 'function') { + //Pull out the defined dependencies and pass the ordered + //values to the callback. + //Default to [require, exports, module] if no deps + deps = !deps.length && callback.length ? ['require', 'exports', 'module'] : deps; + for (i = 0; i < deps.length; i += 1) { + map = makeMap(deps[i], relName); + depName = map.f; + + //Fast path CommonJS standard dependencies. + if (depName === "require") { + args[i] = handlers.require(name); + } else if (depName === "exports") { + //CommonJS module spec 1.1 + args[i] = handlers.exports(name); + usingExports = true; + } else if (depName === "module") { + //CommonJS module spec 1.1 + cjsModule = args[i] = handlers.module(name); + } else if (hasProp(defined, depName) || + hasProp(waiting, depName) || + hasProp(defining, depName)) { + args[i] = callDep(depName); + } else if (map.p) { + map.p.load(map.n, makeRequire(relName, true), makeLoad(depName), {}); + args[i] = defined[depName]; + } else { + throw new Error(name + ' missing ' + depName); + } + } + + ret = callback ? callback.apply(defined[name], args) : undefined; + + if (name) { + //If setting exports via "module" is in play, + //favor that over return value and exports. After that, + //favor a non-undefined return value over exports use. + if (cjsModule && cjsModule.exports !== undef && + cjsModule.exports !== defined[name]) { + defined[name] = cjsModule.exports; + } else if (ret !== undef || !usingExports) { + //Use the return value from the function. + defined[name] = ret; + } + } + } else if (name) { + //May just be an object definition for the module. Only + //worry about defining if have a module name. + defined[name] = callback; + } + }; + + requirejs = require = req = function (deps, callback, relName, forceSync, alt) { + if (typeof deps === "string") { + if (handlers[deps]) { + //callback in this case is really relName + return handlers[deps](callback); + } + //Just return the module wanted. In this scenario, the + //deps arg is the module name, and second arg (if passed) + //is just the relName. + //Normalize module name, if it contains . or .. + return callDep(makeMap(deps, callback).f); + } else if (!deps.splice) { + //deps is a config object, not an array. + config = deps; + if (config.deps) { + req(config.deps, config.callback); + } + if (!callback) { + return; + } + + if (callback.splice) { + //callback is an array, which means it is a dependency list. + //Adjust args if there are dependencies + deps = callback; + callback = relName; + relName = null; + } else { + deps = undef; + } + } + + //Support require(['a']) + callback = callback || function () {}; + + //If relName is a function, it is an errback handler, + //so remove it. + if (typeof relName === 'function') { + relName = forceSync; + forceSync = alt; + } + + //Simulate async callback; + if (forceSync) { + main(undef, deps, callback, relName); + } else { + //Using a non-zero value because of concern for what old browsers + //do, and latest browsers "upgrade" to 4 if lower value is used: + //http://www.whatwg.org/specs/web-apps/current-work/multipage/timers.html#dom-windowtimers-settimeout: + //If want a value immediately, use require('id') instead -- something + //that works in almond on the global level, but not guaranteed and + //unlikely to work in other AMD implementations. + setTimeout(function () { + main(undef, deps, callback, relName); + }, 4); + } + + return req; + }; + + /** + * Just drops the config on the floor, but returns req in case + * the config return value is used. + */ + req.config = function (cfg) { + return req(cfg); + }; + + /** + * Expose module registry for debugging and tooling + */ + requirejs._defined = defined; + + define = function (name, deps, callback) { + if (typeof name !== 'string') { + throw new Error('See almond README: incorrect module build, no module name'); + } + + //This module may not have dependencies + if (!deps.splice) { + //deps is not an array, so probably means + //an object literal or factory function for + //the value. Adjust args. + callback = deps; + deps = []; + } + + if (!hasProp(defined, name) && !hasProp(waiting, name)) { + waiting[name] = [name, deps, callback]; + } + }; + + define.amd = { + jQuery: true + }; +}()); + +S2.requirejs = requirejs;S2.require = require;S2.define = define; +} +}()); +S2.define("almond", function(){}); + +/* global jQuery:false, $:false */ +S2.define('jquery',[],function () { + var _$ = jQuery || $; + + if (_$ == null && console && console.error) { + console.error( + 'Select2: An instance of jQuery or a jQuery-compatible library was not ' + + 'found. Make sure that you are including jQuery before Select2 on your ' + + 'web page.' + ); + } + + return _$; +}); + +S2.define('select2/utils',[ + 'jquery' +], function ($) { + var Utils = {}; + + Utils.Extend = function (ChildClass, SuperClass) { + var __hasProp = {}.hasOwnProperty; + + function BaseConstructor () { + this.constructor = ChildClass; + } + + for (var key in SuperClass) { + if (__hasProp.call(SuperClass, key)) { + ChildClass[key] = SuperClass[key]; + } + } + + BaseConstructor.prototype = SuperClass.prototype; + ChildClass.prototype = new BaseConstructor(); + ChildClass.__super__ = SuperClass.prototype; + + return ChildClass; + }; + + function getMethods (theClass) { + var proto = theClass.prototype; + + var methods = []; + + for (var methodName in proto) { + var m = proto[methodName]; + + if (typeof m !== 'function') { + continue; + } + + if (methodName === 'constructor') { + continue; + } + + methods.push(methodName); + } + + return methods; + } + + Utils.Decorate = function (SuperClass, DecoratorClass) { + var decoratedMethods = getMethods(DecoratorClass); + var superMethods = getMethods(SuperClass); + + function DecoratedClass () { + var unshift = Array.prototype.unshift; + + var argCount = DecoratorClass.prototype.constructor.length; + + var calledConstructor = SuperClass.prototype.constructor; + + if (argCount > 0) { + unshift.call(arguments, SuperClass.prototype.constructor); + + calledConstructor = DecoratorClass.prototype.constructor; + } + + calledConstructor.apply(this, arguments); + } + + DecoratorClass.displayName = SuperClass.displayName; + + function ctr () { + this.constructor = DecoratedClass; + } + + DecoratedClass.prototype = new ctr(); + + for (var m = 0; m < superMethods.length; m++) { + var superMethod = superMethods[m]; + + DecoratedClass.prototype[superMethod] = + SuperClass.prototype[superMethod]; + } + + var calledMethod = function (methodName) { + // Stub out the original method if it's not decorating an actual method + var originalMethod = function () {}; + + if (methodName in DecoratedClass.prototype) { + originalMethod = DecoratedClass.prototype[methodName]; + } + + var decoratedMethod = DecoratorClass.prototype[methodName]; + + return function () { + var unshift = Array.prototype.unshift; + + unshift.call(arguments, originalMethod); + + return decoratedMethod.apply(this, arguments); + }; + }; + + for (var d = 0; d < decoratedMethods.length; d++) { + var decoratedMethod = decoratedMethods[d]; + + DecoratedClass.prototype[decoratedMethod] = calledMethod(decoratedMethod); + } + + return DecoratedClass; + }; + + var Observable = function () { + this.listeners = {}; + }; + + Observable.prototype.on = function (event, callback) { + this.listeners = this.listeners || {}; + + if (event in this.listeners) { + this.listeners[event].push(callback); + } else { + this.listeners[event] = [callback]; + } + }; + + Observable.prototype.trigger = function (event) { + var slice = Array.prototype.slice; + var params = slice.call(arguments, 1); + + this.listeners = this.listeners || {}; + + // Params should always come in as an array + if (params == null) { + params = []; + } + + // If there are no arguments to the event, use a temporary object + if (params.length === 0) { + params.push({}); + } + + // Set the `_type` of the first object to the event + params[0]._type = event; + + if (event in this.listeners) { + this.invoke(this.listeners[event], slice.call(arguments, 1)); + } + + if ('*' in this.listeners) { + this.invoke(this.listeners['*'], arguments); + } + }; + + Observable.prototype.invoke = function (listeners, params) { + for (var i = 0, len = listeners.length; i < len; i++) { + listeners[i].apply(this, params); + } + }; + + Utils.Observable = Observable; + + Utils.generateChars = function (length) { + var chars = ''; + + for (var i = 0; i < length; i++) { + var randomChar = Math.floor(Math.random() * 36); + chars += randomChar.toString(36); + } + + return chars; + }; + + Utils.bind = function (func, context) { + return function () { + func.apply(context, arguments); + }; + }; + + Utils._convertData = function (data) { + for (var originalKey in data) { + var keys = originalKey.split('-'); + + var dataLevel = data; + + if (keys.length === 1) { + continue; + } + + for (var k = 0; k < keys.length; k++) { + var key = keys[k]; + + // Lowercase the first letter + // By default, dash-separated becomes camelCase + key = key.substring(0, 1).toLowerCase() + key.substring(1); + + if (!(key in dataLevel)) { + dataLevel[key] = {}; + } + + if (k == keys.length - 1) { + dataLevel[key] = data[originalKey]; + } + + dataLevel = dataLevel[key]; + } + + delete data[originalKey]; + } + + return data; + }; + + Utils.hasScroll = function (index, el) { + // Adapted from the function created by @ShadowScripter + // and adapted by @BillBarry on the Stack Exchange Code Review website. + // The original code can be found at + // http://codereview.stackexchange.com/q/13338 + // and was designed to be used with the Sizzle selector engine. + + var $el = $(el); + var overflowX = el.style.overflowX; + var overflowY = el.style.overflowY; + + //Check both x and y declarations + if (overflowX === overflowY && + (overflowY === 'hidden' || overflowY === 'visible')) { + return false; + } + + if (overflowX === 'scroll' || overflowY === 'scroll') { + return true; + } + + return ($el.innerHeight() < el.scrollHeight || + $el.innerWidth() < el.scrollWidth); + }; + + Utils.escapeMarkup = function (markup) { + var replaceMap = { + '\\': '\', + '&': '&', + '<': '<', + '>': '>', + '"': '"', + '\'': ''', + '/': '/' + }; + + // Do not try to escape the markup if it's not a string + if (typeof markup !== 'string') { + return markup; + } + + return String(markup).replace(/[&<>"'\/\\]/g, function (match) { + return replaceMap[match]; + }); + }; + + // Append an array of jQuery nodes to a given element. + Utils.appendMany = function ($element, $nodes) { + // jQuery 1.7.x does not support $.fn.append() with an array + // Fall back to a jQuery object collection using $.fn.add() + if ($.fn.jquery.substr(0, 3) === '1.7') { + var $jqNodes = $(); + + $.map($nodes, function (node) { + $jqNodes = $jqNodes.add(node); + }); + + $nodes = $jqNodes; + } + + $element.append($nodes); + }; + + return Utils; +}); + +S2.define('select2/results',[ + 'jquery', + './utils' +], function ($, Utils) { + function Results ($element, options, dataAdapter) { + this.$element = $element; + this.data = dataAdapter; + this.options = options; + + Results.__super__.constructor.call(this); + } + + Utils.Extend(Results, Utils.Observable); + + Results.prototype.render = function () { + var $results = $( + '<ul class="select2-results__options" role="tree"></ul>' + ); + + if (this.options.get('multiple')) { + $results.attr('aria-multiselectable', 'true'); + } + + this.$results = $results; + + return $results; + }; + + Results.prototype.clear = function () { + this.$results.empty(); + }; + + Results.prototype.displayMessage = function (params) { + var escapeMarkup = this.options.get('escapeMarkup'); + + this.clear(); + this.hideLoading(); + + var $message = $( + '<li role="treeitem" aria-live="assertive"' + + ' class="select2-results__option"></li>' + ); + + var message = this.options.get('translations').get(params.message); + + $message.append( + escapeMarkup( + message(params.args) + ) + ); + + $message[0].className += ' select2-results__message'; + + this.$results.append($message); + }; + + Results.prototype.hideMessages = function () { + this.$results.find('.select2-results__message').remove(); + }; + + Results.prototype.append = function (data) { + this.hideLoading(); + + var $options = []; + + if (data.results == null || data.results.length === 0) { + if (this.$results.children().length === 0) { + this.trigger('results:message', { + message: 'noResults' + }); + } + + return; + } + + data.results = this.sort(data.results); + + for (var d = 0; d < data.results.length; d++) { + var item = data.results[d]; + + var $option = this.option(item); + + $options.push($option); + } + + this.$results.append($options); + }; + + Results.prototype.position = function ($results, $dropdown) { + var $resultsContainer = $dropdown.find('.select2-results'); + $resultsContainer.append($results); + }; + + Results.prototype.sort = function (data) { + var sorter = this.options.get('sorter'); + + return sorter(data); + }; + + Results.prototype.highlightFirstItem = function () { + var $options = this.$results + .find('.select2-results__option[aria-selected]'); + + var $selected = $options.filter('[aria-selected=true]'); + + // Check if there are any selected options + if ($selected.length > 0) { + // If there are selected options, highlight the first + $selected.first().trigger('mouseenter'); + } else { + // If there are no selected options, highlight the first option + // in the dropdown + $options.first().trigger('mouseenter'); + } + + this.ensureHighlightVisible(); + }; + + Results.prototype.setClasses = function () { + var self = this; + + this.data.current(function (selected) { + var selectedIds = $.map(selected, function (s) { + return s.id.toString(); + }); + + var $options = self.$results + .find('.select2-results__option[aria-selected]'); + + $options.each(function () { + var $option = $(this); + + var item = $.data(this, 'data'); + + // id needs to be converted to a string when comparing + var id = '' + item.id; + + if ((item.element != null && item.element.selected) || + (item.element == null && $.inArray(id, selectedIds) > -1)) { + $option.attr('aria-selected', 'true'); + } else { + $option.attr('aria-selected', 'false'); + } + }); + + }); + }; + + Results.prototype.showLoading = function (params) { + this.hideLoading(); + + var loadingMore = this.options.get('translations').get('searching'); + + var loading = { + disabled: true, + loading: true, + text: loadingMore(params) + }; + var $loading = this.option(loading); + $loading.className += ' loading-results'; + + this.$results.prepend($loading); + }; + + Results.prototype.hideLoading = function () { + this.$results.find('.loading-results').remove(); + }; + + Results.prototype.option = function (data) { + var option = document.createElement('li'); + option.className = 'select2-results__option'; + + var attrs = { + 'role': 'treeitem', + 'aria-selected': 'false' + }; + + if (data.disabled) { + delete attrs['aria-selected']; + attrs['aria-disabled'] = 'true'; + } + + if (data.id == null) { + delete attrs['aria-selected']; + } + + if (data._resultId != null) { + option.id = data._resultId; + } + + if (data.title) { + option.title = data.title; + } + + if (data.children) { + attrs.role = 'group'; + attrs['aria-label'] = data.text; + delete attrs['aria-selected']; + } + + for (var attr in attrs) { + var val = attrs[attr]; + + option.setAttribute(attr, val); + } + + if (data.children) { + var $option = $(option); + + var label = document.createElement('strong'); + label.className = 'select2-results__group'; + + var $label = $(label); + this.template(data, label); + + var $children = []; + + for (var c = 0; c < data.children.length; c++) { + var child = data.children[c]; + + var $child = this.option(child); + + $children.push($child); + } + + var $childrenContainer = $('<ul></ul>', { + 'class': 'select2-results__options select2-results__options--nested' + }); + + $childrenContainer.append($children); + + $option.append(label); + $option.append($childrenContainer); + } else { + this.template(data, option); + } + + $.data(option, 'data', data); + + return option; + }; + + Results.prototype.bind = function (container, $container) { + var self = this; + + var id = container.id + '-results'; + + this.$results.attr('id', id); + + container.on('results:all', function (params) { + self.clear(); + self.append(params.data); + + if (container.isOpen()) { + self.setClasses(); + self.highlightFirstItem(); + } + }); + + container.on('results:append', function (params) { + self.append(params.data); + + if (container.isOpen()) { + self.setClasses(); + } + }); + + container.on('query', function (params) { + self.hideMessages(); + self.showLoading(params); + }); + + container.on('select', function () { + if (!container.isOpen()) { + return; + } + + self.setClasses(); + self.highlightFirstItem(); + }); + + container.on('unselect', function () { + if (!container.isOpen()) { + return; + } + + self.setClasses(); + self.highlightFirstItem(); + }); + + container.on('open', function () { + // When the dropdown is open, aria-expended="true" + self.$results.attr('aria-expanded', 'true'); + self.$results.attr('aria-hidden', 'false'); + + self.setClasses(); + self.ensureHighlightVisible(); + }); + + container.on('close', function () { + // When the dropdown is closed, aria-expended="false" + self.$results.attr('aria-expanded', 'false'); + self.$results.attr('aria-hidden', 'true'); + self.$results.removeAttr('aria-activedescendant'); + }); + + container.on('results:toggle', function () { + var $highlighted = self.getHighlightedResults(); + + if ($highlighted.length === 0) { + return; + } + + $highlighted.trigger('mouseup'); + }); + + container.on('results:select', function () { + var $highlighted = self.getHighlightedResults(); + + if ($highlighted.length === 0) { + return; + } + + var data = $highlighted.data('data'); + + if ($highlighted.attr('aria-selected') == 'true') { + self.trigger('close', {}); + } else { + self.trigger('select', { + data: data + }); + } + }); + + container.on('results:previous', function () { + var $highlighted = self.getHighlightedResults(); + + var $options = self.$results.find('[aria-selected]'); + + var currentIndex = $options.index($highlighted); + + // If we are already at te top, don't move further + if (currentIndex === 0) { + return; + } + + var nextIndex = currentIndex - 1; + + // If none are highlighted, highlight the first + if ($highlighted.length === 0) { + nextIndex = 0; + } + + var $next = $options.eq(nextIndex); + + $next.trigger('mouseenter'); + + var currentOffset = self.$results.offset().top; + var nextTop = $next.offset().top; + var nextOffset = self.$results.scrollTop() + (nextTop - currentOffset); + + if (nextIndex === 0) { + self.$results.scrollTop(0); + } else if (nextTop - currentOffset < 0) { + self.$results.scrollTop(nextOffset); + } + }); + + container.on('results:next', function () { + var $highlighted = self.getHighlightedResults(); + + var $options = self.$results.find('[aria-selected]'); + + var currentIndex = $options.index($highlighted); + + var nextIndex = currentIndex + 1; + + // If we are at the last option, stay there + if (nextIndex >= $options.length) { + return; + } + + var $next = $options.eq(nextIndex); + + $next.trigger('mouseenter'); + + var currentOffset = self.$results.offset().top + + self.$results.outerHeight(false); + var nextBottom = $next.offset().top + $next.outerHeight(false); + var nextOffset = self.$results.scrollTop() + nextBottom - currentOffset; + + if (nextIndex === 0) { + self.$results.scrollTop(0); + } else if (nextBottom > currentOffset) { + self.$results.scrollTop(nextOffset); + } + }); + + container.on('results:focus', function (params) { + params.element.addClass('select2-results__option--highlighted'); + }); + + container.on('results:message', function (params) { + self.displayMessage(params); + }); + + if ($.fn.mousewheel) { + this.$results.on('mousewheel', function (e) { + var top = self.$results.scrollTop(); + + var bottom = self.$results.get(0).scrollHeight - top + e.deltaY; + + var isAtTop = e.deltaY > 0 && top - e.deltaY <= 0; + var isAtBottom = e.deltaY < 0 && bottom <= self.$results.height(); + + if (isAtTop) { + self.$results.scrollTop(0); + + e.preventDefault(); + e.stopPropagation(); + } else if (isAtBottom) { + self.$results.scrollTop( + self.$results.get(0).scrollHeight - self.$results.height() + ); + + e.preventDefault(); + e.stopPropagation(); + } + }); + } + + this.$results.on('mouseup', '.select2-results__option[aria-selected]', + function (evt) { + var $this = $(this); + + var data = $this.data('data'); + + if ($this.attr('aria-selected') === 'true') { + if (self.options.get('multiple')) { + self.trigger('unselect', { + originalEvent: evt, + data: data + }); + } else { + self.trigger('close', {}); + } + + return; + } + + self.trigger('select', { + originalEvent: evt, + data: data + }); + }); + + this.$results.on('mouseenter', '.select2-results__option[aria-selected]', + function (evt) { + var data = $(this).data('data'); + + self.getHighlightedResults() + .removeClass('select2-results__option--highlighted'); + + self.trigger('results:focus', { + data: data, + element: $(this) + }); + }); + }; + + Results.prototype.getHighlightedResults = function () { + var $highlighted = this.$results + .find('.select2-results__option--highlighted'); + + return $highlighted; + }; + + Results.prototype.destroy = function () { + this.$results.remove(); + }; + + Results.prototype.ensureHighlightVisible = function () { + var $highlighted = this.getHighlightedResults(); + + if ($highlighted.length === 0) { + return; + } + + var $options = this.$results.find('[aria-selected]'); + + var currentIndex = $options.index($highlighted); + + var currentOffset = this.$results.offset().top; + var nextTop = $highlighted.offset().top; + var nextOffset = this.$results.scrollTop() + (nextTop - currentOffset); + + var offsetDelta = nextTop - currentOffset; + nextOffset -= $highlighted.outerHeight(false) * 2; + + if (currentIndex <= 2) { + this.$results.scrollTop(0); + } else if (offsetDelta > this.$results.outerHeight() || offsetDelta < 0) { + this.$results.scrollTop(nextOffset); + } + }; + + Results.prototype.template = function (result, container) { + var template = this.options.get('templateResult'); + var escapeMarkup = this.options.get('escapeMarkup'); + + var content = template(result, container); + + if (content == null) { + container.style.display = 'none'; + } else if (typeof content === 'string') { + container.innerHTML = escapeMarkup(content); + } else { + $(container).append(content); + } + }; + + return Results; +}); + +S2.define('select2/keys',[ + +], function () { + var KEYS = { + BACKSPACE: 8, + TAB: 9, + ENTER: 13, + SHIFT: 16, + CTRL: 17, + ALT: 18, + ESC: 27, + SPACE: 32, + PAGE_UP: 33, + PAGE_DOWN: 34, + END: 35, + HOME: 36, + LEFT: 37, + UP: 38, + RIGHT: 39, + DOWN: 40, + DELETE: 46 + }; + + return KEYS; +}); + +S2.define('select2/selection/base',[ + 'jquery', + '../utils', + '../keys' +], function ($, Utils, KEYS) { + function BaseSelection ($element, options) { + this.$element = $element; + this.options = options; + + BaseSelection.__super__.constructor.call(this); + } + + Utils.Extend(BaseSelection, Utils.Observable); + + BaseSelection.prototype.render = function () { + var $selection = $( + '<span class="select2-selection" role="combobox" ' + + ' aria-haspopup="true" aria-expanded="false">' + + '</span>' + ); + + this._tabindex = 0; + + if (this.$element.data('old-tabindex') != null) { + this._tabindex = this.$element.data('old-tabindex'); + } else if (this.$element.attr('tabindex') != null) { + this._tabindex = this.$element.attr('tabindex'); + } + + $selection.attr('title', this.$element.attr('title')); + $selection.attr('tabindex', this._tabindex); + + this.$selection = $selection; + + return $selection; + }; + + BaseSelection.prototype.bind = function (container, $container) { + var self = this; + + var id = container.id + '-container'; + var resultsId = container.id + '-results'; + + this.container = container; + + this.$selection.on('focus', function (evt) { + self.trigger('focus', evt); + }); + + this.$selection.on('blur', function (evt) { + self._handleBlur(evt); + }); + + this.$selection.on('keydown', function (evt) { + self.trigger('keypress', evt); + + if (evt.which === KEYS.SPACE) { + evt.preventDefault(); + } + }); + + container.on('results:focus', function (params) { + self.$selection.attr('aria-activedescendant', params.data._resultId); + }); + + container.on('selection:update', function (params) { + self.update(params.data); + }); + + container.on('open', function () { + // When the dropdown is open, aria-expanded="true" + self.$selection.attr('aria-expanded', 'true'); + self.$selection.attr('aria-owns', resultsId); + + self._attachCloseHandler(container); + }); + + container.on('close', function () { + // When the dropdown is closed, aria-expanded="false" + self.$selection.attr('aria-expanded', 'false'); + self.$selection.removeAttr('aria-activedescendant'); + self.$selection.removeAttr('aria-owns'); + + self.$selection.focus(); + + self._detachCloseHandler(container); + }); + + container.on('enable', function () { + self.$selection.attr('tabindex', self._tabindex); + }); + + container.on('disable', function () { + self.$selection.attr('tabindex', '-1'); + }); + }; + + BaseSelection.prototype._handleBlur = function (evt) { + var self = this; + + // This needs to be delayed as the active element is the body when the tab + // key is pressed, possibly along with others. + window.setTimeout(function () { + // Don't trigger `blur` if the focus is still in the selection + if ( + (document.activeElement == self.$selection[0]) || + ($.contains(self.$selection[0], document.activeElement)) + ) { + return; + } + + self.trigger('blur', evt); + }, 1); + }; + + BaseSelection.prototype._attachCloseHandler = function (container) { + var self = this; + + $(document.body).on('mousedown.select2.' + container.id, function (e) { + var $target = $(e.target); + + var $select = $target.closest('.select2'); + + var $all = $('.select2.select2-container--open'); + + $all.each(function () { + var $this = $(this); + + if (this == $select[0]) { + return; + } + + var $element = $this.data('element'); + + $element.select2('close'); + }); + }); + }; + + BaseSelection.prototype._detachCloseHandler = function (container) { + $(document.body).off('mousedown.select2.' + container.id); + }; + + BaseSelection.prototype.position = function ($selection, $container) { + var $selectionContainer = $container.find('.selection'); + $selectionContainer.append($selection); + }; + + BaseSelection.prototype.destroy = function () { + this._detachCloseHandler(this.container); + }; + + BaseSelection.prototype.update = function (data) { + throw new Error('The `update` method must be defined in child classes.'); + }; + + return BaseSelection; +}); + +S2.define('select2/selection/single',[ + 'jquery', + './base', + '../utils', + '../keys' +], function ($, BaseSelection, Utils, KEYS) { + function SingleSelection () { + SingleSelection.__super__.constructor.apply(this, arguments); + } + + Utils.Extend(SingleSelection, BaseSelection); + + SingleSelection.prototype.render = function () { + var $selection = SingleSelection.__super__.render.call(this); + + $selection.addClass('select2-selection--single'); + + $selection.html( + '<span class="select2-selection__rendered"></span>' + + '<span class="select2-selection__arrow" role="presentation">' + + '<b role="presentation"></b>' + + '</span>' + ); + + return $selection; + }; + + SingleSelection.prototype.bind = function (container, $container) { + var self = this; + + SingleSelection.__super__.bind.apply(this, arguments); + + var id = container.id + '-container'; + + this.$selection.find('.select2-selection__rendered').attr('id', id); + this.$selection.attr('aria-labelledby', id); + + this.$selection.on('mousedown', function (evt) { + // Only respond to left clicks + if (evt.which !== 1) { + return; + } + + self.trigger('toggle', { + originalEvent: evt + }); + }); + + this.$selection.on('focus', function (evt) { + // User focuses on the container + }); + + this.$selection.on('blur', function (evt) { + // User exits the container + }); + + container.on('focus', function (evt) { + if (!container.isOpen()) { + self.$selection.focus(); + } + }); + + container.on('selection:update', function (params) { + self.update(params.data); + }); + }; + + SingleSelection.prototype.clear = function () { + this.$selection.find('.select2-selection__rendered').empty(); + }; + + SingleSelection.prototype.display = function (data, container) { + var template = this.options.get('templateSelection'); + var escapeMarkup = this.options.get('escapeMarkup'); + + return escapeMarkup(template(data, container)); + }; + + SingleSelection.prototype.selectionContainer = function () { + return $('<span></span>'); + }; + + SingleSelection.prototype.update = function (data) { + if (data.length === 0) { + this.clear(); + return; + } + + var selection = data[0]; + + var $rendered = this.$selection.find('.select2-selection__rendered'); + var formatted = this.display(selection, $rendered); + + $rendered.empty().append(formatted); + $rendered.prop('title', selection.title || selection.text); + }; + + return SingleSelection; +}); + +S2.define('select2/selection/multiple',[ + 'jquery', + './base', + '../utils' +], function ($, BaseSelection, Utils) { + function MultipleSelection ($element, options) { + MultipleSelection.__super__.constructor.apply(this, arguments); + } + + Utils.Extend(MultipleSelection, BaseSelection); + + MultipleSelection.prototype.render = function () { + var $selection = MultipleSelection.__super__.render.call(this); + + $selection.addClass('select2-selection--multiple'); + + $selection.html( + '<ul class="select2-selection__rendered"></ul>' + ); + + return $selection; + }; + + MultipleSelection.prototype.bind = function (container, $container) { + var self = this; + + MultipleSelection.__super__.bind.apply(this, arguments); + + this.$selection.on('click', function (evt) { + self.trigger('toggle', { + originalEvent: evt + }); + }); + + this.$selection.on( + 'click', + '.select2-selection__choice__remove', + function (evt) { + // Ignore the event if it is disabled + if (self.options.get('disabled')) { + return; + } + + var $remove = $(this); + var $selection = $remove.parent(); + + var data = $selection.data('data'); + + self.trigger('unselect', { + originalEvent: evt, + data: data + }); + } + ); + }; + + MultipleSelection.prototype.clear = function () { + this.$selection.find('.select2-selection__rendered').empty(); + }; + + MultipleSelection.prototype.display = function (data, container) { + var template = this.options.get('templateSelection'); + var escapeMarkup = this.options.get('escapeMarkup'); + + return escapeMarkup(template(data, container)); + }; + + MultipleSelection.prototype.selectionContainer = function () { + var $container = $( + '<li class="select2-selection__choice">' + + '<span class="select2-selection__choice__remove" role="presentation">' + + '×' + + '</span>' + + '</li>' + ); + + return $container; + }; + + MultipleSelection.prototype.update = function (data) { + this.clear(); + + if (data.length === 0) { + return; + } + + var $selections = []; + + for (var d = 0; d < data.length; d++) { + var selection = data[d]; + + var $selection = this.selectionContainer(); + var formatted = this.display(selection, $selection); + + $selection.append(formatted); + $selection.prop('title', selection.title || selection.text); + + $selection.data('data', selection); + + $selections.push($selection); + } + + var $rendered = this.$selection.find('.select2-selection__rendered'); + + Utils.appendMany($rendered, $selections); + }; + + return MultipleSelection; +}); + +S2.define('select2/selection/placeholder',[ + '../utils' +], function (Utils) { + function Placeholder (decorated, $element, options) { + this.placeholder = this.normalizePlaceholder(options.get('placeholder')); + + decorated.call(this, $element, options); + } + + Placeholder.prototype.normalizePlaceholder = function (_, placeholder) { + if (typeof placeholder === 'string') { + placeholder = { + id: '', + text: placeholder + }; + } + + return placeholder; + }; + + Placeholder.prototype.createPlaceholder = function (decorated, placeholder) { + var $placeholder = this.selectionContainer(); + + $placeholder.html(this.display(placeholder)); + $placeholder.addClass('select2-selection__placeholder') + .removeClass('select2-selection__choice'); + + return $placeholder; + }; + + Placeholder.prototype.update = function (decorated, data) { + var singlePlaceholder = ( + data.length == 1 && data[0].id != this.placeholder.id + ); + var multipleSelections = data.length > 1; + + if (multipleSelections || singlePlaceholder) { + return decorated.call(this, data); + } + + this.clear(); + + var $placeholder = this.createPlaceholder(this.placeholder); + + this.$selection.find('.select2-selection__rendered').append($placeholder); + }; + + return Placeholder; +}); + +S2.define('select2/selection/allowClear',[ + 'jquery', + '../keys' +], function ($, KEYS) { + function AllowClear () { } + + AllowClear.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + if (this.placeholder == null) { + if (this.options.get('debug') && window.console && console.error) { + console.error( + 'Select2: The `allowClear` option should be used in combination ' + + 'with the `placeholder` option.' + ); + } + } + + this.$selection.on('mousedown', '.select2-selection__clear', + function (evt) { + self._handleClear(evt); + }); + + container.on('keypress', function (evt) { + self._handleKeyboardClear(evt, container); + }); + }; + + AllowClear.prototype._handleClear = function (_, evt) { + // Ignore the event if it is disabled + if (this.options.get('disabled')) { + return; + } + + var $clear = this.$selection.find('.select2-selection__clear'); + + // Ignore the event if nothing has been selected + if ($clear.length === 0) { + return; + } + + evt.stopPropagation(); + + var data = $clear.data('data'); + + for (var d = 0; d < data.length; d++) { + var unselectData = { + data: data[d] + }; + + // Trigger the `unselect` event, so people can prevent it from being + // cleared. + this.trigger('unselect', unselectData); + + // If the event was prevented, don't clear it out. + if (unselectData.prevented) { + return; + } + } + + this.$element.val(this.placeholder.id).trigger('change'); + + this.trigger('toggle', {}); + }; + + AllowClear.prototype._handleKeyboardClear = function (_, evt, container) { + if (container.isOpen()) { + return; + } + + if (evt.which == KEYS.DELETE || evt.which == KEYS.BACKSPACE) { + this._handleClear(evt); + } + }; + + AllowClear.prototype.update = function (decorated, data) { + decorated.call(this, data); + + if (this.$selection.find('.select2-selection__placeholder').length > 0 || + data.length === 0) { + return; + } + + var $remove = $( + '<span class="select2-selection__clear">' + + '×' + + '</span>' + ); + $remove.data('data', data); + + this.$selection.find('.select2-selection__rendered').prepend($remove); + }; + + return AllowClear; +}); + +S2.define('select2/selection/search',[ + 'jquery', + '../utils', + '../keys' +], function ($, Utils, KEYS) { + function Search (decorated, $element, options) { + decorated.call(this, $element, options); + } + + Search.prototype.render = function (decorated) { + var $search = $( + '<li class="select2-search select2-search--inline">' + + '<input class="select2-search__field" type="search" tabindex="-1"' + + ' autocomplete="off" autocorrect="off" autocapitalize="off"' + + ' spellcheck="false" role="textbox" aria-autocomplete="list" />' + + '</li>' + ); + + this.$searchContainer = $search; + this.$search = $search.find('input'); + + var $rendered = decorated.call(this); + + this._transferTabIndex(); + + return $rendered; + }; + + Search.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + container.on('open', function () { + self.$search.trigger('focus'); + }); + + container.on('close', function () { + self.$search.val(''); + self.$search.removeAttr('aria-activedescendant'); + self.$search.trigger('focus'); + }); + + container.on('enable', function () { + self.$search.prop('disabled', false); + + self._transferTabIndex(); + }); + + container.on('disable', function () { + self.$search.prop('disabled', true); + }); + + container.on('focus', function (evt) { + self.$search.trigger('focus'); + }); + + container.on('results:focus', function (params) { + self.$search.attr('aria-activedescendant', params.id); + }); + + this.$selection.on('focusin', '.select2-search--inline', function (evt) { + self.trigger('focus', evt); + }); + + this.$selection.on('focusout', '.select2-search--inline', function (evt) { + self._handleBlur(evt); + }); + + this.$selection.on('keydown', '.select2-search--inline', function (evt) { + evt.stopPropagation(); + + self.trigger('keypress', evt); + + self._keyUpPrevented = evt.isDefaultPrevented(); + + var key = evt.which; + + if (key === KEYS.BACKSPACE && self.$search.val() === '') { + var $previousChoice = self.$searchContainer + .prev('.select2-selection__choice'); + + if ($previousChoice.length > 0) { + var item = $previousChoice.data('data'); + + self.searchRemoveChoice(item); + + evt.preventDefault(); + } + } + }); + + // Try to detect the IE version should the `documentMode` property that + // is stored on the document. This is only implemented in IE and is + // slightly cleaner than doing a user agent check. + // This property is not available in Edge, but Edge also doesn't have + // this bug. + var msie = document.documentMode; + var disableInputEvents = msie && msie <= 11; + + // Workaround for browsers which do not support the `input` event + // This will prevent double-triggering of events for browsers which support + // both the `keyup` and `input` events. + this.$selection.on( + 'input.searchcheck', + '.select2-search--inline', + function (evt) { + // IE will trigger the `input` event when a placeholder is used on a + // search box. To get around this issue, we are forced to ignore all + // `input` events in IE and keep using `keyup`. + if (disableInputEvents) { + self.$selection.off('input.search input.searchcheck'); + return; + } + + // Unbind the duplicated `keyup` event + self.$selection.off('keyup.search'); + } + ); + + this.$selection.on( + 'keyup.search input.search', + '.select2-search--inline', + function (evt) { + // IE will trigger the `input` event when a placeholder is used on a + // search box. To get around this issue, we are forced to ignore all + // `input` events in IE and keep using `keyup`. + if (disableInputEvents && evt.type === 'input') { + self.$selection.off('input.search input.searchcheck'); + return; + } + + var key = evt.which; + + // We can freely ignore events from modifier keys + if (key == KEYS.SHIFT || key == KEYS.CTRL || key == KEYS.ALT) { + return; + } + + // Tabbing will be handled during the `keydown` phase + if (key == KEYS.TAB) { + return; + } + + self.handleSearch(evt); + } + ); + }; + + /** + * This method will transfer the tabindex attribute from the rendered + * selection to the search box. This allows for the search box to be used as + * the primary focus instead of the selection container. + * + * @private + */ + Search.prototype._transferTabIndex = function (decorated) { + this.$search.attr('tabindex', this.$selection.attr('tabindex')); + this.$selection.attr('tabindex', '-1'); + }; + + Search.prototype.createPlaceholder = function (decorated, placeholder) { + this.$search.attr('placeholder', placeholder.text); + }; + + Search.prototype.update = function (decorated, data) { + var searchHadFocus = this.$search[0] == document.activeElement; + + this.$search.attr('placeholder', ''); + + decorated.call(this, data); + + this.$selection.find('.select2-selection__rendered') + .append(this.$searchContainer); + + this.resizeSearch(); + if (searchHadFocus) { + this.$search.focus(); + } + }; + + Search.prototype.handleSearch = function () { + this.resizeSearch(); + + if (!this._keyUpPrevented) { + var input = this.$search.val(); + + this.trigger('query', { + term: input + }); + } + + this._keyUpPrevented = false; + }; + + Search.prototype.searchRemoveChoice = function (decorated, item) { + this.trigger('unselect', { + data: item + }); + + this.$search.val(item.text); + this.handleSearch(); + }; + + Search.prototype.resizeSearch = function () { + this.$search.css('width', '25px'); + + var width = ''; + + if (this.$search.attr('placeholder') !== '') { + width = this.$selection.find('.select2-selection__rendered').innerWidth(); + } else { + var minimumWidth = this.$search.val().length + 1; + + width = (minimumWidth * 0.75) + 'em'; + } + + this.$search.css('width', width); + }; + + return Search; +}); + +S2.define('select2/selection/eventRelay',[ + 'jquery' +], function ($) { + function EventRelay () { } + + EventRelay.prototype.bind = function (decorated, container, $container) { + var self = this; + var relayEvents = [ + 'open', 'opening', + 'close', 'closing', + 'select', 'selecting', + 'unselect', 'unselecting' + ]; + + var preventableEvents = ['opening', 'closing', 'selecting', 'unselecting']; + + decorated.call(this, container, $container); + + container.on('*', function (name, params) { + // Ignore events that should not be relayed + if ($.inArray(name, relayEvents) === -1) { + return; + } + + // The parameters should always be an object + params = params || {}; + + // Generate the jQuery event for the Select2 event + var evt = $.Event('select2:' + name, { + params: params + }); + + self.$element.trigger(evt); + + // Only handle preventable events if it was one + if ($.inArray(name, preventableEvents) === -1) { + return; + } + + params.prevented = evt.isDefaultPrevented(); + }); + }; + + return EventRelay; +}); + +S2.define('select2/translation',[ + 'jquery', + 'require' +], function ($, require) { + function Translation (dict) { + this.dict = dict || {}; + } + + Translation.prototype.all = function () { + return this.dict; + }; + + Translation.prototype.get = function (key) { + return this.dict[key]; + }; + + Translation.prototype.extend = function (translation) { + this.dict = $.extend({}, translation.all(), this.dict); + }; + + // Static functions + + Translation._cache = {}; + + Translation.loadPath = function (path) { + if (!(path in Translation._cache)) { + var translations = require(path); + + Translation._cache[path] = translations; + } + + return new Translation(Translation._cache[path]); + }; + + return Translation; +}); + +S2.define('select2/diacritics',[ + +], function () { + var diacritics = { + '\u24B6': 'A', + '\uFF21': 'A', + '\u00C0': 'A', + '\u00C1': 'A', + '\u00C2': 'A', + '\u1EA6': 'A', + '\u1EA4': 'A', + '\u1EAA': 'A', + '\u1EA8': 'A', + '\u00C3': 'A', + '\u0100': 'A', + '\u0102': 'A', + '\u1EB0': 'A', + '\u1EAE': 'A', + '\u1EB4': 'A', + '\u1EB2': 'A', + '\u0226': 'A', + '\u01E0': 'A', + '\u00C4': 'A', + '\u01DE': 'A', + '\u1EA2': 'A', + '\u00C5': 'A', + '\u01FA': 'A', + '\u01CD': 'A', + '\u0200': 'A', + '\u0202': 'A', + '\u1EA0': 'A', + '\u1EAC': 'A', + '\u1EB6': 'A', + '\u1E00': 'A', + '\u0104': 'A', + '\u023A': 'A', + '\u2C6F': 'A', + '\uA732': 'AA', + '\u00C6': 'AE', + '\u01FC': 'AE', + '\u01E2': 'AE', + '\uA734': 'AO', + '\uA736': 'AU', + '\uA738': 'AV', + '\uA73A': 'AV', + '\uA73C': 'AY', + '\u24B7': 'B', + '\uFF22': 'B', + '\u1E02': 'B', + '\u1E04': 'B', + '\u1E06': 'B', + '\u0243': 'B', + '\u0182': 'B', + '\u0181': 'B', + '\u24B8': 'C', + '\uFF23': 'C', + '\u0106': 'C', + '\u0108': 'C', + '\u010A': 'C', + '\u010C': 'C', + '\u00C7': 'C', + '\u1E08': 'C', + '\u0187': 'C', + '\u023B': 'C', + '\uA73E': 'C', + '\u24B9': 'D', + '\uFF24': 'D', + '\u1E0A': 'D', + '\u010E': 'D', + '\u1E0C': 'D', + '\u1E10': 'D', + '\u1E12': 'D', + '\u1E0E': 'D', + '\u0110': 'D', + '\u018B': 'D', + '\u018A': 'D', + '\u0189': 'D', + '\uA779': 'D', + '\u01F1': 'DZ', + '\u01C4': 'DZ', + '\u01F2': 'Dz', + '\u01C5': 'Dz', + '\u24BA': 'E', + '\uFF25': 'E', + '\u00C8': 'E', + '\u00C9': 'E', + '\u00CA': 'E', + '\u1EC0': 'E', + '\u1EBE': 'E', + '\u1EC4': 'E', + '\u1EC2': 'E', + '\u1EBC': 'E', + '\u0112': 'E', + '\u1E14': 'E', + '\u1E16': 'E', + '\u0114': 'E', + '\u0116': 'E', + '\u00CB': 'E', + '\u1EBA': 'E', + '\u011A': 'E', + '\u0204': 'E', + '\u0206': 'E', + '\u1EB8': 'E', + '\u1EC6': 'E', + '\u0228': 'E', + '\u1E1C': 'E', + '\u0118': 'E', + '\u1E18': 'E', + '\u1E1A': 'E', + '\u0190': 'E', + '\u018E': 'E', + '\u24BB': 'F', + '\uFF26': 'F', + '\u1E1E': 'F', + '\u0191': 'F', + '\uA77B': 'F', + '\u24BC': 'G', + '\uFF27': 'G', + '\u01F4': 'G', + '\u011C': 'G', + '\u1E20': 'G', + '\u011E': 'G', + '\u0120': 'G', + '\u01E6': 'G', + '\u0122': 'G', + '\u01E4': 'G', + '\u0193': 'G', + '\uA7A0': 'G', + '\uA77D': 'G', + '\uA77E': 'G', + '\u24BD': 'H', + '\uFF28': 'H', + '\u0124': 'H', + '\u1E22': 'H', + '\u1E26': 'H', + '\u021E': 'H', + '\u1E24': 'H', + '\u1E28': 'H', + '\u1E2A': 'H', + '\u0126': 'H', + '\u2C67': 'H', + '\u2C75': 'H', + '\uA78D': 'H', + '\u24BE': 'I', + '\uFF29': 'I', + '\u00CC': 'I', + '\u00CD': 'I', + '\u00CE': 'I', + '\u0128': 'I', + '\u012A': 'I', + '\u012C': 'I', + '\u0130': 'I', + '\u00CF': 'I', + '\u1E2E': 'I', + '\u1EC8': 'I', + '\u01CF': 'I', + '\u0208': 'I', + '\u020A': 'I', + '\u1ECA': 'I', + '\u012E': 'I', + '\u1E2C': 'I', + '\u0197': 'I', + '\u24BF': 'J', + '\uFF2A': 'J', + '\u0134': 'J', + '\u0248': 'J', + '\u24C0': 'K', + '\uFF2B': 'K', + '\u1E30': 'K', + '\u01E8': 'K', + '\u1E32': 'K', + '\u0136': 'K', + '\u1E34': 'K', + '\u0198': 'K', + '\u2C69': 'K', + '\uA740': 'K', + '\uA742': 'K', + '\uA744': 'K', + '\uA7A2': 'K', + '\u24C1': 'L', + '\uFF2C': 'L', + '\u013F': 'L', + '\u0139': 'L', + '\u013D': 'L', + '\u1E36': 'L', + '\u1E38': 'L', + '\u013B': 'L', + '\u1E3C': 'L', + '\u1E3A': 'L', + '\u0141': 'L', + '\u023D': 'L', + '\u2C62': 'L', + '\u2C60': 'L', + '\uA748': 'L', + '\uA746': 'L', + '\uA780': 'L', + '\u01C7': 'LJ', + '\u01C8': 'Lj', + '\u24C2': 'M', + '\uFF2D': 'M', + '\u1E3E': 'M', + '\u1E40': 'M', + '\u1E42': 'M', + '\u2C6E': 'M', + '\u019C': 'M', + '\u24C3': 'N', + '\uFF2E': 'N', + '\u01F8': 'N', + '\u0143': 'N', + '\u00D1': 'N', + '\u1E44': 'N', + '\u0147': 'N', + '\u1E46': 'N', + '\u0145': 'N', + '\u1E4A': 'N', + '\u1E48': 'N', + '\u0220': 'N', + '\u019D': 'N', + '\uA790': 'N', + '\uA7A4': 'N', + '\u01CA': 'NJ', + '\u01CB': 'Nj', + '\u24C4': 'O', + '\uFF2F': 'O', + '\u00D2': 'O', + '\u00D3': 'O', + '\u00D4': 'O', + '\u1ED2': 'O', + '\u1ED0': 'O', + '\u1ED6': 'O', + '\u1ED4': 'O', + '\u00D5': 'O', + '\u1E4C': 'O', + '\u022C': 'O', + '\u1E4E': 'O', + '\u014C': 'O', + '\u1E50': 'O', + '\u1E52': 'O', + '\u014E': 'O', + '\u022E': 'O', + '\u0230': 'O', + '\u00D6': 'O', + '\u022A': 'O', + '\u1ECE': 'O', + '\u0150': 'O', + '\u01D1': 'O', + '\u020C': 'O', + '\u020E': 'O', + '\u01A0': 'O', + '\u1EDC': 'O', + '\u1EDA': 'O', + '\u1EE0': 'O', + '\u1EDE': 'O', + '\u1EE2': 'O', + '\u1ECC': 'O', + '\u1ED8': 'O', + '\u01EA': 'O', + '\u01EC': 'O', + '\u00D8': 'O', + '\u01FE': 'O', + '\u0186': 'O', + '\u019F': 'O', + '\uA74A': 'O', + '\uA74C': 'O', + '\u01A2': 'OI', + '\uA74E': 'OO', + '\u0222': 'OU', + '\u24C5': 'P', + '\uFF30': 'P', + '\u1E54': 'P', + '\u1E56': 'P', + '\u01A4': 'P', + '\u2C63': 'P', + '\uA750': 'P', + '\uA752': 'P', + '\uA754': 'P', + '\u24C6': 'Q', + '\uFF31': 'Q', + '\uA756': 'Q', + '\uA758': 'Q', + '\u024A': 'Q', + '\u24C7': 'R', + '\uFF32': 'R', + '\u0154': 'R', + '\u1E58': 'R', + '\u0158': 'R', + '\u0210': 'R', + '\u0212': 'R', + '\u1E5A': 'R', + '\u1E5C': 'R', + '\u0156': 'R', + '\u1E5E': 'R', + '\u024C': 'R', + '\u2C64': 'R', + '\uA75A': 'R', + '\uA7A6': 'R', + '\uA782': 'R', + '\u24C8': 'S', + '\uFF33': 'S', + '\u1E9E': 'S', + '\u015A': 'S', + '\u1E64': 'S', + '\u015C': 'S', + '\u1E60': 'S', + '\u0160': 'S', + '\u1E66': 'S', + '\u1E62': 'S', + '\u1E68': 'S', + '\u0218': 'S', + '\u015E': 'S', + '\u2C7E': 'S', + '\uA7A8': 'S', + '\uA784': 'S', + '\u24C9': 'T', + '\uFF34': 'T', + '\u1E6A': 'T', + '\u0164': 'T', + '\u1E6C': 'T', + '\u021A': 'T', + '\u0162': 'T', + '\u1E70': 'T', + '\u1E6E': 'T', + '\u0166': 'T', + '\u01AC': 'T', + '\u01AE': 'T', + '\u023E': 'T', + '\uA786': 'T', + '\uA728': 'TZ', + '\u24CA': 'U', + '\uFF35': 'U', + '\u00D9': 'U', + '\u00DA': 'U', + '\u00DB': 'U', + '\u0168': 'U', + '\u1E78': 'U', + '\u016A': 'U', + '\u1E7A': 'U', + '\u016C': 'U', + '\u00DC': 'U', + '\u01DB': 'U', + '\u01D7': 'U', + '\u01D5': 'U', + '\u01D9': 'U', + '\u1EE6': 'U', + '\u016E': 'U', + '\u0170': 'U', + '\u01D3': 'U', + '\u0214': 'U', + '\u0216': 'U', + '\u01AF': 'U', + '\u1EEA': 'U', + '\u1EE8': 'U', + '\u1EEE': 'U', + '\u1EEC': 'U', + '\u1EF0': 'U', + '\u1EE4': 'U', + '\u1E72': 'U', + '\u0172': 'U', + '\u1E76': 'U', + '\u1E74': 'U', + '\u0244': 'U', + '\u24CB': 'V', + '\uFF36': 'V', + '\u1E7C': 'V', + '\u1E7E': 'V', + '\u01B2': 'V', + '\uA75E': 'V', + '\u0245': 'V', + '\uA760': 'VY', + '\u24CC': 'W', + '\uFF37': 'W', + '\u1E80': 'W', + '\u1E82': 'W', + '\u0174': 'W', + '\u1E86': 'W', + '\u1E84': 'W', + '\u1E88': 'W', + '\u2C72': 'W', + '\u24CD': 'X', + '\uFF38': 'X', + '\u1E8A': 'X', + '\u1E8C': 'X', + '\u24CE': 'Y', + '\uFF39': 'Y', + '\u1EF2': 'Y', + '\u00DD': 'Y', + '\u0176': 'Y', + '\u1EF8': 'Y', + '\u0232': 'Y', + '\u1E8E': 'Y', + '\u0178': 'Y', + '\u1EF6': 'Y', + '\u1EF4': 'Y', + '\u01B3': 'Y', + '\u024E': 'Y', + '\u1EFE': 'Y', + '\u24CF': 'Z', + '\uFF3A': 'Z', + '\u0179': 'Z', + '\u1E90': 'Z', + '\u017B': 'Z', + '\u017D': 'Z', + '\u1E92': 'Z', + '\u1E94': 'Z', + '\u01B5': 'Z', + '\u0224': 'Z', + '\u2C7F': 'Z', + '\u2C6B': 'Z', + '\uA762': 'Z', + '\u24D0': 'a', + '\uFF41': 'a', + '\u1E9A': 'a', + '\u00E0': 'a', + '\u00E1': 'a', + '\u00E2': 'a', + '\u1EA7': 'a', + '\u1EA5': 'a', + '\u1EAB': 'a', + '\u1EA9': 'a', + '\u00E3': 'a', + '\u0101': 'a', + '\u0103': 'a', + '\u1EB1': 'a', + '\u1EAF': 'a', + '\u1EB5': 'a', + '\u1EB3': 'a', + '\u0227': 'a', + '\u01E1': 'a', + '\u00E4': 'a', + '\u01DF': 'a', + '\u1EA3': 'a', + '\u00E5': 'a', + '\u01FB': 'a', + '\u01CE': 'a', + '\u0201': 'a', + '\u0203': 'a', + '\u1EA1': 'a', + '\u1EAD': 'a', + '\u1EB7': 'a', + '\u1E01': 'a', + '\u0105': 'a', + '\u2C65': 'a', + '\u0250': 'a', + '\uA733': 'aa', + '\u00E6': 'ae', + '\u01FD': 'ae', + '\u01E3': 'ae', + '\uA735': 'ao', + '\uA737': 'au', + '\uA739': 'av', + '\uA73B': 'av', + '\uA73D': 'ay', + '\u24D1': 'b', + '\uFF42': 'b', + '\u1E03': 'b', + '\u1E05': 'b', + '\u1E07': 'b', + '\u0180': 'b', + '\u0183': 'b', + '\u0253': 'b', + '\u24D2': 'c', + '\uFF43': 'c', + '\u0107': 'c', + '\u0109': 'c', + '\u010B': 'c', + '\u010D': 'c', + '\u00E7': 'c', + '\u1E09': 'c', + '\u0188': 'c', + '\u023C': 'c', + '\uA73F': 'c', + '\u2184': 'c', + '\u24D3': 'd', + '\uFF44': 'd', + '\u1E0B': 'd', + '\u010F': 'd', + '\u1E0D': 'd', + '\u1E11': 'd', + '\u1E13': 'd', + '\u1E0F': 'd', + '\u0111': 'd', + '\u018C': 'd', + '\u0256': 'd', + '\u0257': 'd', + '\uA77A': 'd', + '\u01F3': 'dz', + '\u01C6': 'dz', + '\u24D4': 'e', + '\uFF45': 'e', + '\u00E8': 'e', + '\u00E9': 'e', + '\u00EA': 'e', + '\u1EC1': 'e', + '\u1EBF': 'e', + '\u1EC5': 'e', + '\u1EC3': 'e', + '\u1EBD': 'e', + '\u0113': 'e', + '\u1E15': 'e', + '\u1E17': 'e', + '\u0115': 'e', + '\u0117': 'e', + '\u00EB': 'e', + '\u1EBB': 'e', + '\u011B': 'e', + '\u0205': 'e', + '\u0207': 'e', + '\u1EB9': 'e', + '\u1EC7': 'e', + '\u0229': 'e', + '\u1E1D': 'e', + '\u0119': 'e', + '\u1E19': 'e', + '\u1E1B': 'e', + '\u0247': 'e', + '\u025B': 'e', + '\u01DD': 'e', + '\u24D5': 'f', + '\uFF46': 'f', + '\u1E1F': 'f', + '\u0192': 'f', + '\uA77C': 'f', + '\u24D6': 'g', + '\uFF47': 'g', + '\u01F5': 'g', + '\u011D': 'g', + '\u1E21': 'g', + '\u011F': 'g', + '\u0121': 'g', + '\u01E7': 'g', + '\u0123': 'g', + '\u01E5': 'g', + '\u0260': 'g', + '\uA7A1': 'g', + '\u1D79': 'g', + '\uA77F': 'g', + '\u24D7': 'h', + '\uFF48': 'h', + '\u0125': 'h', + '\u1E23': 'h', + '\u1E27': 'h', + '\u021F': 'h', + '\u1E25': 'h', + '\u1E29': 'h', + '\u1E2B': 'h', + '\u1E96': 'h', + '\u0127': 'h', + '\u2C68': 'h', + '\u2C76': 'h', + '\u0265': 'h', + '\u0195': 'hv', + '\u24D8': 'i', + '\uFF49': 'i', + '\u00EC': 'i', + '\u00ED': 'i', + '\u00EE': 'i', + '\u0129': 'i', + '\u012B': 'i', + '\u012D': 'i', + '\u00EF': 'i', + '\u1E2F': 'i', + '\u1EC9': 'i', + '\u01D0': 'i', + '\u0209': 'i', + '\u020B': 'i', + '\u1ECB': 'i', + '\u012F': 'i', + '\u1E2D': 'i', + '\u0268': 'i', + '\u0131': 'i', + '\u24D9': 'j', + '\uFF4A': 'j', + '\u0135': 'j', + '\u01F0': 'j', + '\u0249': 'j', + '\u24DA': 'k', + '\uFF4B': 'k', + '\u1E31': 'k', + '\u01E9': 'k', + '\u1E33': 'k', + '\u0137': 'k', + '\u1E35': 'k', + '\u0199': 'k', + '\u2C6A': 'k', + '\uA741': 'k', + '\uA743': 'k', + '\uA745': 'k', + '\uA7A3': 'k', + '\u24DB': 'l', + '\uFF4C': 'l', + '\u0140': 'l', + '\u013A': 'l', + '\u013E': 'l', + '\u1E37': 'l', + '\u1E39': 'l', + '\u013C': 'l', + '\u1E3D': 'l', + '\u1E3B': 'l', + '\u017F': 'l', + '\u0142': 'l', + '\u019A': 'l', + '\u026B': 'l', + '\u2C61': 'l', + '\uA749': 'l', + '\uA781': 'l', + '\uA747': 'l', + '\u01C9': 'lj', + '\u24DC': 'm', + '\uFF4D': 'm', + '\u1E3F': 'm', + '\u1E41': 'm', + '\u1E43': 'm', + '\u0271': 'm', + '\u026F': 'm', + '\u24DD': 'n', + '\uFF4E': 'n', + '\u01F9': 'n', + '\u0144': 'n', + '\u00F1': 'n', + '\u1E45': 'n', + '\u0148': 'n', + '\u1E47': 'n', + '\u0146': 'n', + '\u1E4B': 'n', + '\u1E49': 'n', + '\u019E': 'n', + '\u0272': 'n', + '\u0149': 'n', + '\uA791': 'n', + '\uA7A5': 'n', + '\u01CC': 'nj', + '\u24DE': 'o', + '\uFF4F': 'o', + '\u00F2': 'o', + '\u00F3': 'o', + '\u00F4': 'o', + '\u1ED3': 'o', + '\u1ED1': 'o', + '\u1ED7': 'o', + '\u1ED5': 'o', + '\u00F5': 'o', + '\u1E4D': 'o', + '\u022D': 'o', + '\u1E4F': 'o', + '\u014D': 'o', + '\u1E51': 'o', + '\u1E53': 'o', + '\u014F': 'o', + '\u022F': 'o', + '\u0231': 'o', + '\u00F6': 'o', + '\u022B': 'o', + '\u1ECF': 'o', + '\u0151': 'o', + '\u01D2': 'o', + '\u020D': 'o', + '\u020F': 'o', + '\u01A1': 'o', + '\u1EDD': 'o', + '\u1EDB': 'o', + '\u1EE1': 'o', + '\u1EDF': 'o', + '\u1EE3': 'o', + '\u1ECD': 'o', + '\u1ED9': 'o', + '\u01EB': 'o', + '\u01ED': 'o', + '\u00F8': 'o', + '\u01FF': 'o', + '\u0254': 'o', + '\uA74B': 'o', + '\uA74D': 'o', + '\u0275': 'o', + '\u01A3': 'oi', + '\u0223': 'ou', + '\uA74F': 'oo', + '\u24DF': 'p', + '\uFF50': 'p', + '\u1E55': 'p', + '\u1E57': 'p', + '\u01A5': 'p', + '\u1D7D': 'p', + '\uA751': 'p', + '\uA753': 'p', + '\uA755': 'p', + '\u24E0': 'q', + '\uFF51': 'q', + '\u024B': 'q', + '\uA757': 'q', + '\uA759': 'q', + '\u24E1': 'r', + '\uFF52': 'r', + '\u0155': 'r', + '\u1E59': 'r', + '\u0159': 'r', + '\u0211': 'r', + '\u0213': 'r', + '\u1E5B': 'r', + '\u1E5D': 'r', + '\u0157': 'r', + '\u1E5F': 'r', + '\u024D': 'r', + '\u027D': 'r', + '\uA75B': 'r', + '\uA7A7': 'r', + '\uA783': 'r', + '\u24E2': 's', + '\uFF53': 's', + '\u00DF': 's', + '\u015B': 's', + '\u1E65': 's', + '\u015D': 's', + '\u1E61': 's', + '\u0161': 's', + '\u1E67': 's', + '\u1E63': 's', + '\u1E69': 's', + '\u0219': 's', + '\u015F': 's', + '\u023F': 's', + '\uA7A9': 's', + '\uA785': 's', + '\u1E9B': 's', + '\u24E3': 't', + '\uFF54': 't', + '\u1E6B': 't', + '\u1E97': 't', + '\u0165': 't', + '\u1E6D': 't', + '\u021B': 't', + '\u0163': 't', + '\u1E71': 't', + '\u1E6F': 't', + '\u0167': 't', + '\u01AD': 't', + '\u0288': 't', + '\u2C66': 't', + '\uA787': 't', + '\uA729': 'tz', + '\u24E4': 'u', + '\uFF55': 'u', + '\u00F9': 'u', + '\u00FA': 'u', + '\u00FB': 'u', + '\u0169': 'u', + '\u1E79': 'u', + '\u016B': 'u', + '\u1E7B': 'u', + '\u016D': 'u', + '\u00FC': 'u', + '\u01DC': 'u', + '\u01D8': 'u', + '\u01D6': 'u', + '\u01DA': 'u', + '\u1EE7': 'u', + '\u016F': 'u', + '\u0171': 'u', + '\u01D4': 'u', + '\u0215': 'u', + '\u0217': 'u', + '\u01B0': 'u', + '\u1EEB': 'u', + '\u1EE9': 'u', + '\u1EEF': 'u', + '\u1EED': 'u', + '\u1EF1': 'u', + '\u1EE5': 'u', + '\u1E73': 'u', + '\u0173': 'u', + '\u1E77': 'u', + '\u1E75': 'u', + '\u0289': 'u', + '\u24E5': 'v', + '\uFF56': 'v', + '\u1E7D': 'v', + '\u1E7F': 'v', + '\u028B': 'v', + '\uA75F': 'v', + '\u028C': 'v', + '\uA761': 'vy', + '\u24E6': 'w', + '\uFF57': 'w', + '\u1E81': 'w', + '\u1E83': 'w', + '\u0175': 'w', + '\u1E87': 'w', + '\u1E85': 'w', + '\u1E98': 'w', + '\u1E89': 'w', + '\u2C73': 'w', + '\u24E7': 'x', + '\uFF58': 'x', + '\u1E8B': 'x', + '\u1E8D': 'x', + '\u24E8': 'y', + '\uFF59': 'y', + '\u1EF3': 'y', + '\u00FD': 'y', + '\u0177': 'y', + '\u1EF9': 'y', + '\u0233': 'y', + '\u1E8F': 'y', + '\u00FF': 'y', + '\u1EF7': 'y', + '\u1E99': 'y', + '\u1EF5': 'y', + '\u01B4': 'y', + '\u024F': 'y', + '\u1EFF': 'y', + '\u24E9': 'z', + '\uFF5A': 'z', + '\u017A': 'z', + '\u1E91': 'z', + '\u017C': 'z', + '\u017E': 'z', + '\u1E93': 'z', + '\u1E95': 'z', + '\u01B6': 'z', + '\u0225': 'z', + '\u0240': 'z', + '\u2C6C': 'z', + '\uA763': 'z', + '\u0386': '\u0391', + '\u0388': '\u0395', + '\u0389': '\u0397', + '\u038A': '\u0399', + '\u03AA': '\u0399', + '\u038C': '\u039F', + '\u038E': '\u03A5', + '\u03AB': '\u03A5', + '\u038F': '\u03A9', + '\u03AC': '\u03B1', + '\u03AD': '\u03B5', + '\u03AE': '\u03B7', + '\u03AF': '\u03B9', + '\u03CA': '\u03B9', + '\u0390': '\u03B9', + '\u03CC': '\u03BF', + '\u03CD': '\u03C5', + '\u03CB': '\u03C5', + '\u03B0': '\u03C5', + '\u03C9': '\u03C9', + '\u03C2': '\u03C3' + }; + + return diacritics; +}); + +S2.define('select2/data/base',[ + '../utils' +], function (Utils) { + function BaseAdapter ($element, options) { + BaseAdapter.__super__.constructor.call(this); + } + + Utils.Extend(BaseAdapter, Utils.Observable); + + BaseAdapter.prototype.current = function (callback) { + throw new Error('The `current` method must be defined in child classes.'); + }; + + BaseAdapter.prototype.query = function (params, callback) { + throw new Error('The `query` method must be defined in child classes.'); + }; + + BaseAdapter.prototype.bind = function (container, $container) { + // Can be implemented in subclasses + }; + + BaseAdapter.prototype.destroy = function () { + // Can be implemented in subclasses + }; + + BaseAdapter.prototype.generateResultId = function (container, data) { + var id = container.id + '-result-'; + + id += Utils.generateChars(4); + + if (data.id != null) { + id += '-' + data.id.toString(); + } else { + id += '-' + Utils.generateChars(4); + } + return id; + }; + + return BaseAdapter; +}); + +S2.define('select2/data/select',[ + './base', + '../utils', + 'jquery' +], function (BaseAdapter, Utils, $) { + function SelectAdapter ($element, options) { + this.$element = $element; + this.options = options; + + SelectAdapter.__super__.constructor.call(this); + } + + Utils.Extend(SelectAdapter, BaseAdapter); + + SelectAdapter.prototype.current = function (callback) { + var data = []; + var self = this; + + this.$element.find(':selected').each(function () { + var $option = $(this); + + var option = self.item($option); + + data.push(option); + }); + + callback(data); + }; + + SelectAdapter.prototype.select = function (data) { + var self = this; + + data.selected = true; + + // If data.element is a DOM node, use it instead + if ($(data.element).is('option')) { + data.element.selected = true; + + this.$element.trigger('change'); + + return; + } + + if (this.$element.prop('multiple')) { + this.current(function (currentData) { + var val = []; + + data = [data]; + data.push.apply(data, currentData); + + for (var d = 0; d < data.length; d++) { + var id = data[d].id; + + if ($.inArray(id, val) === -1) { + val.push(id); + } + } + + self.$element.val(val); + self.$element.trigger('change'); + }); + } else { + var val = data.id; + + this.$element.val(val); + this.$element.trigger('change'); + } + }; + + SelectAdapter.prototype.unselect = function (data) { + var self = this; + + if (!this.$element.prop('multiple')) { + return; + } + + data.selected = false; + + if ($(data.element).is('option')) { + data.element.selected = false; + + this.$element.trigger('change'); + + return; + } + + this.current(function (currentData) { + var val = []; + + for (var d = 0; d < currentData.length; d++) { + var id = currentData[d].id; + + if (id !== data.id && $.inArray(id, val) === -1) { + val.push(id); + } + } + + self.$element.val(val); + + self.$element.trigger('change'); + }); + }; + + SelectAdapter.prototype.bind = function (container, $container) { + var self = this; + + this.container = container; + + container.on('select', function (params) { + self.select(params.data); + }); + + container.on('unselect', function (params) { + self.unselect(params.data); + }); + }; + + SelectAdapter.prototype.destroy = function () { + // Remove anything added to child elements + this.$element.find('*').each(function () { + // Remove any custom data set by Select2 + $.removeData(this, 'data'); + }); + }; + + SelectAdapter.prototype.query = function (params, callback) { + var data = []; + var self = this; + + var $options = this.$element.children(); + + $options.each(function () { + var $option = $(this); + + if (!$option.is('option') && !$option.is('optgroup')) { + return; + } + + var option = self.item($option); + + var matches = self.matches(params, option); + + if (matches !== null) { + data.push(matches); + } + }); + + callback({ + results: data + }); + }; + + SelectAdapter.prototype.addOptions = function ($options) { + Utils.appendMany(this.$element, $options); + }; + + SelectAdapter.prototype.option = function (data) { + var option; + + if (data.children) { + option = document.createElement('optgroup'); + option.label = data.text; + } else { + option = document.createElement('option'); + + if (option.textContent !== undefined) { + option.textContent = data.text; + } else { + option.innerText = data.text; + } + } + + if (data.id) { + option.value = data.id; + } + + if (data.disabled) { + option.disabled = true; + } + + if (data.selected) { + option.selected = true; + } + + if (data.title) { + option.title = data.title; + } + + var $option = $(option); + + var normalizedData = this._normalizeItem(data); + normalizedData.element = option; + + // Override the option's data with the combined data + $.data(option, 'data', normalizedData); + + return $option; + }; + + SelectAdapter.prototype.item = function ($option) { + var data = {}; + + data = $.data($option[0], 'data'); + + if (data != null) { + return data; + } + + if ($option.is('option')) { + data = { + id: $option.val(), + text: $option.text(), + disabled: $option.prop('disabled'), + selected: $option.prop('selected'), + title: $option.prop('title') + }; + } else if ($option.is('optgroup')) { + data = { + text: $option.prop('label'), + children: [], + title: $option.prop('title') + }; + + var $children = $option.children('option'); + var children = []; + + for (var c = 0; c < $children.length; c++) { + var $child = $($children[c]); + + var child = this.item($child); + + children.push(child); + } + + data.children = children; + } + + data = this._normalizeItem(data); + data.element = $option[0]; + + $.data($option[0], 'data', data); + + return data; + }; + + SelectAdapter.prototype._normalizeItem = function (item) { + if (!$.isPlainObject(item)) { + item = { + id: item, + text: item + }; + } + + item = $.extend({}, { + text: '' + }, item); + + var defaults = { + selected: false, + disabled: false + }; + + if (item.id != null) { + item.id = item.id.toString(); + } + + if (item.text != null) { + item.text = item.text.toString(); + } + + if (item._resultId == null && item.id && this.container != null) { + item._resultId = this.generateResultId(this.container, item); + } + + return $.extend({}, defaults, item); + }; + + SelectAdapter.prototype.matches = function (params, data) { + var matcher = this.options.get('matcher'); + + return matcher(params, data); + }; + + return SelectAdapter; +}); + +S2.define('select2/data/array',[ + './select', + '../utils', + 'jquery' +], function (SelectAdapter, Utils, $) { + function ArrayAdapter ($element, options) { + var data = options.get('data') || []; + + ArrayAdapter.__super__.constructor.call(this, $element, options); + + this.addOptions(this.convertToOptions(data)); + } + + Utils.Extend(ArrayAdapter, SelectAdapter); + + ArrayAdapter.prototype.select = function (data) { + var $option = this.$element.find('option').filter(function (i, elm) { + return elm.value == data.id.toString(); + }); + + if ($option.length === 0) { + $option = this.option(data); + + this.addOptions($option); + } + + ArrayAdapter.__super__.select.call(this, data); + }; + + ArrayAdapter.prototype.convertToOptions = function (data) { + var self = this; + + var $existing = this.$element.find('option'); + var existingIds = $existing.map(function () { + return self.item($(this)).id; + }).get(); + + var $options = []; + + // Filter out all items except for the one passed in the argument + function onlyItem (item) { + return function () { + return $(this).val() == item.id; + }; + } + + for (var d = 0; d < data.length; d++) { + var item = this._normalizeItem(data[d]); + + // Skip items which were pre-loaded, only merge the data + if ($.inArray(item.id, existingIds) >= 0) { + var $existingOption = $existing.filter(onlyItem(item)); + + var existingData = this.item($existingOption); + var newData = $.extend(true, {}, item, existingData); + + var $newOption = this.option(newData); + + $existingOption.replaceWith($newOption); + + continue; + } + + var $option = this.option(item); + + if (item.children) { + var $children = this.convertToOptions(item.children); + + Utils.appendMany($option, $children); + } + + $options.push($option); + } + + return $options; + }; + + return ArrayAdapter; +}); + +S2.define('select2/data/ajax',[ + './array', + '../utils', + 'jquery' +], function (ArrayAdapter, Utils, $) { + function AjaxAdapter ($element, options) { + this.ajaxOptions = this._applyDefaults(options.get('ajax')); + + if (this.ajaxOptions.processResults != null) { + this.processResults = this.ajaxOptions.processResults; + } + + AjaxAdapter.__super__.constructor.call(this, $element, options); + } + + Utils.Extend(AjaxAdapter, ArrayAdapter); + + AjaxAdapter.prototype._applyDefaults = function (options) { + var defaults = { + data: function (params) { + return $.extend({}, params, { + q: params.term + }); + }, + transport: function (params, success, failure) { + var $request = $.ajax(params); + + $request.then(success); + $request.fail(failure); + + return $request; + } + }; + + return $.extend({}, defaults, options, true); + }; + + AjaxAdapter.prototype.processResults = function (results) { + return results; + }; + + AjaxAdapter.prototype.query = function (params, callback) { + var matches = []; + var self = this; + + if (this._request != null) { + // JSONP requests cannot always be aborted + if ($.isFunction(this._request.abort)) { + this._request.abort(); + } + + this._request = null; + } + + var options = $.extend({ + type: 'GET' + }, this.ajaxOptions); + + if (typeof options.url === 'function') { + options.url = options.url.call(this.$element, params); + } + + if (typeof options.data === 'function') { + options.data = options.data.call(this.$element, params); + } + + function request () { + var $request = options.transport(options, function (data) { + var results = self.processResults(data, params); + + if (self.options.get('debug') && window.console && console.error) { + // Check to make sure that the response included a `results` key. + if (!results || !results.results || !$.isArray(results.results)) { + console.error( + 'Select2: The AJAX results did not return an array in the ' + + '`results` key of the response.' + ); + } + } + + callback(results); + }, function () { + // Attempt to detect if a request was aborted + // Only works if the transport exposes a status property + if ($request.status && $request.status === '0') { + return; + } + + self.trigger('results:message', { + message: 'errorLoading' + }); + }); + + self._request = $request; + } + + if (this.ajaxOptions.delay && params.term != null) { + if (this._queryTimeout) { + window.clearTimeout(this._queryTimeout); + } + + this._queryTimeout = window.setTimeout(request, this.ajaxOptions.delay); + } else { + request(); + } + }; + + return AjaxAdapter; +}); + +S2.define('select2/data/tags',[ + 'jquery' +], function ($) { + function Tags (decorated, $element, options) { + var tags = options.get('tags'); + + var createTag = options.get('createTag'); + + if (createTag !== undefined) { + this.createTag = createTag; + } + + var insertTag = options.get('insertTag'); + + if (insertTag !== undefined) { + this.insertTag = insertTag; + } + + decorated.call(this, $element, options); + + if ($.isArray(tags)) { + for (var t = 0; t < tags.length; t++) { + var tag = tags[t]; + var item = this._normalizeItem(tag); + + var $option = this.option(item); + + this.$element.append($option); + } + } + } + + Tags.prototype.query = function (decorated, params, callback) { + var self = this; + + this._removeOldTags(); + + if (params.term == null || params.page != null) { + decorated.call(this, params, callback); + return; + } + + function wrapper (obj, child) { + var data = obj.results; + + for (var i = 0; i < data.length; i++) { + var option = data[i]; + + var checkChildren = ( + option.children != null && + !wrapper({ + results: option.children + }, true) + ); + + var checkText = option.text === params.term; + + if (checkText || checkChildren) { + if (child) { + return false; + } + + obj.data = data; + callback(obj); + + return; + } + } + + if (child) { + return true; + } + + var tag = self.createTag(params); + + if (tag != null) { + var $option = self.option(tag); + $option.attr('data-select2-tag', true); + + self.addOptions([$option]); + + self.insertTag(data, tag); + } + + obj.results = data; + + callback(obj); + } + + decorated.call(this, params, wrapper); + }; + + Tags.prototype.createTag = function (decorated, params) { + var term = $.trim(params.term); + + if (term === '') { + return null; + } + + return { + id: term, + text: term + }; + }; + + Tags.prototype.insertTag = function (_, data, tag) { + data.unshift(tag); + }; + + Tags.prototype._removeOldTags = function (_) { + var tag = this._lastTag; + + var $options = this.$element.find('option[data-select2-tag]'); + + $options.each(function () { + if (this.selected) { + return; + } + + $(this).remove(); + }); + }; + + return Tags; +}); + +S2.define('select2/data/tokenizer',[ + 'jquery' +], function ($) { + function Tokenizer (decorated, $element, options) { + var tokenizer = options.get('tokenizer'); + + if (tokenizer !== undefined) { + this.tokenizer = tokenizer; + } + + decorated.call(this, $element, options); + } + + Tokenizer.prototype.bind = function (decorated, container, $container) { + decorated.call(this, container, $container); + + this.$search = container.dropdown.$search || container.selection.$search || + $container.find('.select2-search__field'); + }; + + Tokenizer.prototype.query = function (decorated, params, callback) { + var self = this; + + function createAndSelect (data) { + // Normalize the data object so we can use it for checks + var item = self._normalizeItem(data); + + // Check if the data object already exists as a tag + // Select it if it doesn't + var $existingOptions = self.$element.find('option').filter(function () { + return $(this).val() === item.id; + }); + + // If an existing option wasn't found for it, create the option + if (!$existingOptions.length) { + var $option = self.option(item); + $option.attr('data-select2-tag', true); + + self._removeOldTags(); + self.addOptions([$option]); + } + + // Select the item, now that we know there is an option for it + select(item); + } + + function select (data) { + self.trigger('select', { + data: data + }); + } + + params.term = params.term || ''; + + var tokenData = this.tokenizer(params, this.options, createAndSelect); + + if (tokenData.term !== params.term) { + // Replace the search term if we have the search box + if (this.$search.length) { + this.$search.val(tokenData.term); + this.$search.focus(); + } + + params.term = tokenData.term; + } + + decorated.call(this, params, callback); + }; + + Tokenizer.prototype.tokenizer = function (_, params, options, callback) { + var separators = options.get('tokenSeparators') || []; + var term = params.term; + var i = 0; + + var createTag = this.createTag || function (params) { + return { + id: params.term, + text: params.term + }; + }; + + while (i < term.length) { + var termChar = term[i]; + + if ($.inArray(termChar, separators) === -1) { + i++; + + continue; + } + + var part = term.substr(0, i); + var partParams = $.extend({}, params, { + term: part + }); + + var data = createTag(partParams); + + if (data == null) { + i++; + continue; + } + + callback(data); + + // Reset the term to not include the tokenized portion + term = term.substr(i + 1) || ''; + i = 0; + } + + return { + term: term + }; + }; + + return Tokenizer; +}); + +S2.define('select2/data/minimumInputLength',[ + +], function () { + function MinimumInputLength (decorated, $e, options) { + this.minimumInputLength = options.get('minimumInputLength'); + + decorated.call(this, $e, options); + } + + MinimumInputLength.prototype.query = function (decorated, params, callback) { + params.term = params.term || ''; + + if (params.term.length < this.minimumInputLength) { + this.trigger('results:message', { + message: 'inputTooShort', + args: { + minimum: this.minimumInputLength, + input: params.term, + params: params + } + }); + + return; + } + + decorated.call(this, params, callback); + }; + + return MinimumInputLength; +}); + +S2.define('select2/data/maximumInputLength',[ + +], function () { + function MaximumInputLength (decorated, $e, options) { + this.maximumInputLength = options.get('maximumInputLength'); + + decorated.call(this, $e, options); + } + + MaximumInputLength.prototype.query = function (decorated, params, callback) { + params.term = params.term || ''; + + if (this.maximumInputLength > 0 && + params.term.length > this.maximumInputLength) { + this.trigger('results:message', { + message: 'inputTooLong', + args: { + maximum: this.maximumInputLength, + input: params.term, + params: params + } + }); + + return; + } + + decorated.call(this, params, callback); + }; + + return MaximumInputLength; +}); + +S2.define('select2/data/maximumSelectionLength',[ + +], function (){ + function MaximumSelectionLength (decorated, $e, options) { + this.maximumSelectionLength = options.get('maximumSelectionLength'); + + decorated.call(this, $e, options); + } + + MaximumSelectionLength.prototype.query = + function (decorated, params, callback) { + var self = this; + + this.current(function (currentData) { + var count = currentData != null ? currentData.length : 0; + if (self.maximumSelectionLength > 0 && + count >= self.maximumSelectionLength) { + self.trigger('results:message', { + message: 'maximumSelected', + args: { + maximum: self.maximumSelectionLength + } + }); + return; + } + decorated.call(self, params, callback); + }); + }; + + return MaximumSelectionLength; +}); + +S2.define('select2/dropdown',[ + 'jquery', + './utils' +], function ($, Utils) { + function Dropdown ($element, options) { + this.$element = $element; + this.options = options; + + Dropdown.__super__.constructor.call(this); + } + + Utils.Extend(Dropdown, Utils.Observable); + + Dropdown.prototype.render = function () { + var $dropdown = $( + '<span class="select2-dropdown">' + + '<span class="select2-results"></span>' + + '</span>' + ); + + $dropdown.attr('dir', this.options.get('dir')); + + this.$dropdown = $dropdown; + + return $dropdown; + }; + + Dropdown.prototype.bind = function () { + // Should be implemented in subclasses + }; + + Dropdown.prototype.position = function ($dropdown, $container) { + // Should be implmented in subclasses + }; + + Dropdown.prototype.destroy = function () { + // Remove the dropdown from the DOM + this.$dropdown.remove(); + }; + + return Dropdown; +}); + +S2.define('select2/dropdown/search',[ + 'jquery', + '../utils' +], function ($, Utils) { + function Search () { } + + Search.prototype.render = function (decorated) { + var $rendered = decorated.call(this); + + var $search = $( + '<span class="select2-search select2-search--dropdown">' + + '<input class="select2-search__field" type="search" tabindex="-1"' + + ' autocomplete="off" autocorrect="off" autocapitalize="off"' + + ' spellcheck="false" role="textbox" />' + + '</span>' + ); + + this.$searchContainer = $search; + this.$search = $search.find('input'); + + $rendered.prepend($search); + + return $rendered; + }; + + Search.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + this.$search.on('keydown', function (evt) { + self.trigger('keypress', evt); + + self._keyUpPrevented = evt.isDefaultPrevented(); + }); + + // Workaround for browsers which do not support the `input` event + // This will prevent double-triggering of events for browsers which support + // both the `keyup` and `input` events. + this.$search.on('input', function (evt) { + // Unbind the duplicated `keyup` event + $(this).off('keyup'); + }); + + this.$search.on('keyup input', function (evt) { + self.handleSearch(evt); + }); + + container.on('open', function () { + self.$search.attr('tabindex', 0); + + self.$search.focus(); + + window.setTimeout(function () { + self.$search.focus(); + }, 0); + }); + + container.on('close', function () { + self.$search.attr('tabindex', -1); + + self.$search.val(''); + }); + + container.on('focus', function () { + if (container.isOpen()) { + self.$search.focus(); + } + }); + + container.on('results:all', function (params) { + if (params.query.term == null || params.query.term === '') { + var showSearch = self.showSearch(params); + + if (showSearch) { + self.$searchContainer.removeClass('select2-search--hide'); + } else { + self.$searchContainer.addClass('select2-search--hide'); + } + } + }); + }; + + Search.prototype.handleSearch = function (evt) { + if (!this._keyUpPrevented) { + var input = this.$search.val(); + + this.trigger('query', { + term: input + }); + } + + this._keyUpPrevented = false; + }; + + Search.prototype.showSearch = function (_, params) { + return true; + }; + + return Search; +}); + +S2.define('select2/dropdown/hidePlaceholder',[ + +], function () { + function HidePlaceholder (decorated, $element, options, dataAdapter) { + this.placeholder = this.normalizePlaceholder(options.get('placeholder')); + + decorated.call(this, $element, options, dataAdapter); + } + + HidePlaceholder.prototype.append = function (decorated, data) { + data.results = this.removePlaceholder(data.results); + + decorated.call(this, data); + }; + + HidePlaceholder.prototype.normalizePlaceholder = function (_, placeholder) { + if (typeof placeholder === 'string') { + placeholder = { + id: '', + text: placeholder + }; + } + + return placeholder; + }; + + HidePlaceholder.prototype.removePlaceholder = function (_, data) { + var modifiedData = data.slice(0); + + for (var d = data.length - 1; d >= 0; d--) { + var item = data[d]; + + if (this.placeholder.id === item.id) { + modifiedData.splice(d, 1); + } + } + + return modifiedData; + }; + + return HidePlaceholder; +}); + +S2.define('select2/dropdown/infiniteScroll',[ + 'jquery' +], function ($) { + function InfiniteScroll (decorated, $element, options, dataAdapter) { + this.lastParams = {}; + + decorated.call(this, $element, options, dataAdapter); + + this.$loadingMore = this.createLoadingMore(); + this.loading = false; + } + + InfiniteScroll.prototype.append = function (decorated, data) { + this.$loadingMore.remove(); + this.loading = false; + + decorated.call(this, data); + + if (this.showLoadingMore(data)) { + this.$results.append(this.$loadingMore); + } + }; + + InfiniteScroll.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + container.on('query', function (params) { + self.lastParams = params; + self.loading = true; + }); + + container.on('query:append', function (params) { + self.lastParams = params; + self.loading = true; + }); + + this.$results.on('scroll', function () { + var isLoadMoreVisible = $.contains( + document.documentElement, + self.$loadingMore[0] + ); + + if (self.loading || !isLoadMoreVisible) { + return; + } + + var currentOffset = self.$results.offset().top + + self.$results.outerHeight(false); + var loadingMoreOffset = self.$loadingMore.offset().top + + self.$loadingMore.outerHeight(false); + + if (currentOffset + 50 >= loadingMoreOffset) { + self.loadMore(); + } + }); + }; + + InfiniteScroll.prototype.loadMore = function () { + this.loading = true; + + var params = $.extend({}, {page: 1}, this.lastParams); + + params.page++; + + this.trigger('query:append', params); + }; + + InfiniteScroll.prototype.showLoadingMore = function (_, data) { + return data.pagination && data.pagination.more; + }; + + InfiniteScroll.prototype.createLoadingMore = function () { + var $option = $( + '<li ' + + 'class="select2-results__option select2-results__option--load-more"' + + 'role="treeitem" aria-disabled="true"></li>' + ); + + var message = this.options.get('translations').get('loadingMore'); + + $option.html(message(this.lastParams)); + + return $option; + }; + + return InfiniteScroll; +}); + +S2.define('select2/dropdown/attachBody',[ + 'jquery', + '../utils' +], function ($, Utils) { + function AttachBody (decorated, $element, options) { + this.$dropdownParent = options.get('dropdownParent') || $(document.body); + + decorated.call(this, $element, options); + } + + AttachBody.prototype.bind = function (decorated, container, $container) { + var self = this; + + var setupResultsEvents = false; + + decorated.call(this, container, $container); + + container.on('open', function () { + self._showDropdown(); + self._attachPositioningHandler(container); + + if (!setupResultsEvents) { + setupResultsEvents = true; + + container.on('results:all', function () { + self._positionDropdown(); + self._resizeDropdown(); + }); + + container.on('results:append', function () { + self._positionDropdown(); + self._resizeDropdown(); + }); + } + }); + + container.on('close', function () { + self._hideDropdown(); + self._detachPositioningHandler(container); + }); + + this.$dropdownContainer.on('mousedown', function (evt) { + evt.stopPropagation(); + }); + }; + + AttachBody.prototype.destroy = function (decorated) { + decorated.call(this); + + this.$dropdownContainer.remove(); + }; + + AttachBody.prototype.position = function (decorated, $dropdown, $container) { + // Clone all of the container classes + $dropdown.attr('class', $container.attr('class')); + + $dropdown.removeClass('select2'); + $dropdown.addClass('select2-container--open'); + + $dropdown.css({ + position: 'absolute', + top: -999999 + }); + + this.$container = $container; + }; + + AttachBody.prototype.render = function (decorated) { + var $container = $('<span></span>'); + + var $dropdown = decorated.call(this); + $container.append($dropdown); + + this.$dropdownContainer = $container; + + return $container; + }; + + AttachBody.prototype._hideDropdown = function (decorated) { + this.$dropdownContainer.detach(); + }; + + AttachBody.prototype._attachPositioningHandler = + function (decorated, container) { + var self = this; + + var scrollEvent = 'scroll.select2.' + container.id; + var resizeEvent = 'resize.select2.' + container.id; + var orientationEvent = 'orientationchange.select2.' + container.id; + + var $watchers = this.$container.parents().filter(Utils.hasScroll); + $watchers.each(function () { + $(this).data('select2-scroll-position', { + x: $(this).scrollLeft(), + y: $(this).scrollTop() + }); + }); + + $watchers.on(scrollEvent, function (ev) { + var position = $(this).data('select2-scroll-position'); + $(this).scrollTop(position.y); + }); + + $(window).on(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent, + function (e) { + self._positionDropdown(); + self._resizeDropdown(); + }); + }; + + AttachBody.prototype._detachPositioningHandler = + function (decorated, container) { + var scrollEvent = 'scroll.select2.' + container.id; + var resizeEvent = 'resize.select2.' + container.id; + var orientationEvent = 'orientationchange.select2.' + container.id; + + var $watchers = this.$container.parents().filter(Utils.hasScroll); + $watchers.off(scrollEvent); + + $(window).off(scrollEvent + ' ' + resizeEvent + ' ' + orientationEvent); + }; + + AttachBody.prototype._positionDropdown = function () { + var $window = $(window); + + var isCurrentlyAbove = this.$dropdown.hasClass('select2-dropdown--above'); + var isCurrentlyBelow = this.$dropdown.hasClass('select2-dropdown--below'); + + var newDirection = null; + + var offset = this.$container.offset(); + + offset.bottom = offset.top + this.$container.outerHeight(false); + + var container = { + height: this.$container.outerHeight(false) + }; + + container.top = offset.top; + container.bottom = offset.top + container.height; + + var dropdown = { + height: this.$dropdown.outerHeight(false) + }; + + var viewport = { + top: $window.scrollTop(), + bottom: $window.scrollTop() + $window.height() + }; + + var enoughRoomAbove = viewport.top < (offset.top - dropdown.height); + var enoughRoomBelow = viewport.bottom > (offset.bottom + dropdown.height); + + var css = { + left: offset.left, + top: container.bottom + }; + + // Determine what the parent element is to use for calciulating the offset + var $offsetParent = this.$dropdownParent; + + // For statically positoned elements, we need to get the element + // that is determining the offset + if ($offsetParent.css('position') === 'static') { + $offsetParent = $offsetParent.offsetParent(); + } + + var parentOffset = $offsetParent.offset(); + + css.top -= parentOffset.top; + css.left -= parentOffset.left; + + if (!isCurrentlyAbove && !isCurrentlyBelow) { + newDirection = 'below'; + } + + if (!enoughRoomBelow && enoughRoomAbove && !isCurrentlyAbove) { + newDirection = 'above'; + } else if (!enoughRoomAbove && enoughRoomBelow && isCurrentlyAbove) { + newDirection = 'below'; + } + + if (newDirection == 'above' || + (isCurrentlyAbove && newDirection !== 'below')) { + css.top = container.top - parentOffset.top - dropdown.height; + } + + if (newDirection != null) { + this.$dropdown + .removeClass('select2-dropdown--below select2-dropdown--above') + .addClass('select2-dropdown--' + newDirection); + this.$container + .removeClass('select2-container--below select2-container--above') + .addClass('select2-container--' + newDirection); + } + + this.$dropdownContainer.css(css); + }; + + AttachBody.prototype._resizeDropdown = function () { + var css = { + width: this.$container.outerWidth(false) + 'px' + }; + + if (this.options.get('dropdownAutoWidth')) { + css.minWidth = css.width; + css.position = 'relative'; + css.width = 'auto'; + } + + this.$dropdown.css(css); + }; + + AttachBody.prototype._showDropdown = function (decorated) { + this.$dropdownContainer.appendTo(this.$dropdownParent); + + this._positionDropdown(); + this._resizeDropdown(); + }; + + return AttachBody; +}); + +S2.define('select2/dropdown/minimumResultsForSearch',[ + +], function () { + function countResults (data) { + var count = 0; + + for (var d = 0; d < data.length; d++) { + var item = data[d]; + + if (item.children) { + count += countResults(item.children); + } else { + count++; + } + } + + return count; + } + + function MinimumResultsForSearch (decorated, $element, options, dataAdapter) { + this.minimumResultsForSearch = options.get('minimumResultsForSearch'); + + if (this.minimumResultsForSearch < 0) { + this.minimumResultsForSearch = Infinity; + } + + decorated.call(this, $element, options, dataAdapter); + } + + MinimumResultsForSearch.prototype.showSearch = function (decorated, params) { + if (countResults(params.data.results) < this.minimumResultsForSearch) { + return false; + } + + return decorated.call(this, params); + }; + + return MinimumResultsForSearch; +}); + +S2.define('select2/dropdown/selectOnClose',[ + +], function () { + function SelectOnClose () { } + + SelectOnClose.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + container.on('close', function (params) { + self._handleSelectOnClose(params); + }); + }; + + SelectOnClose.prototype._handleSelectOnClose = function (_, params) { + if (params && params.originalSelect2Event != null) { + var event = params.originalSelect2Event; + + // Don't select an item if the close event was triggered from a select or + // unselect event + if (event._type === 'select' || event._type === 'unselect') { + return; + } + } + + var $highlightedResults = this.getHighlightedResults(); + + // Only select highlighted results + if ($highlightedResults.length < 1) { + return; + } + + var data = $highlightedResults.data('data'); + + // Don't re-select already selected resulte + if ( + (data.element != null && data.element.selected) || + (data.element == null && data.selected) + ) { + return; + } + + this.trigger('select', { + data: data + }); + }; + + return SelectOnClose; +}); + +S2.define('select2/dropdown/closeOnSelect',[ + +], function () { + function CloseOnSelect () { } + + CloseOnSelect.prototype.bind = function (decorated, container, $container) { + var self = this; + + decorated.call(this, container, $container); + + container.on('select', function (evt) { + self._selectTriggered(evt); + }); + + container.on('unselect', function (evt) { + self._selectTriggered(evt); + }); + }; + + CloseOnSelect.prototype._selectTriggered = function (_, evt) { + var originalEvent = evt.originalEvent; + + // Don't close if the control key is being held + if (originalEvent && originalEvent.ctrlKey) { + return; + } + + this.trigger('close', { + originalEvent: originalEvent, + originalSelect2Event: evt + }); + }; + + return CloseOnSelect; +}); + +S2.define('select2/i18n/en',[],function () { + // English + return { + errorLoading: function () { + return 'The results could not be loaded.'; + }, + inputTooLong: function (args) { + var overChars = args.input.length - args.maximum; + + var message = 'Please delete ' + overChars + ' character'; + + if (overChars != 1) { + message += 's'; + } + + return message; + }, + inputTooShort: function (args) { + var remainingChars = args.minimum - args.input.length; + + var message = 'Please enter ' + remainingChars + ' or more characters'; + + return message; + }, + loadingMore: function () { + return 'Loading more results…'; + }, + maximumSelected: function (args) { + var message = 'You can only select ' + args.maximum + ' item'; + + if (args.maximum != 1) { + message += 's'; + } + + return message; + }, + noResults: function () { + return 'No results found'; + }, + searching: function () { + return 'Searching…'; + } + }; +}); + +S2.define('select2/defaults',[ + 'jquery', + 'require', + + './results', + + './selection/single', + './selection/multiple', + './selection/placeholder', + './selection/allowClear', + './selection/search', + './selection/eventRelay', + + './utils', + './translation', + './diacritics', + + './data/select', + './data/array', + './data/ajax', + './data/tags', + './data/tokenizer', + './data/minimumInputLength', + './data/maximumInputLength', + './data/maximumSelectionLength', + + './dropdown', + './dropdown/search', + './dropdown/hidePlaceholder', + './dropdown/infiniteScroll', + './dropdown/attachBody', + './dropdown/minimumResultsForSearch', + './dropdown/selectOnClose', + './dropdown/closeOnSelect', + + './i18n/en' +], function ($, require, + + ResultsList, + + SingleSelection, MultipleSelection, Placeholder, AllowClear, + SelectionSearch, EventRelay, + + Utils, Translation, DIACRITICS, + + SelectData, ArrayData, AjaxData, Tags, Tokenizer, + MinimumInputLength, MaximumInputLength, MaximumSelectionLength, + + Dropdown, DropdownSearch, HidePlaceholder, InfiniteScroll, + AttachBody, MinimumResultsForSearch, SelectOnClose, CloseOnSelect, + + EnglishTranslation) { + function Defaults () { + this.reset(); + } + + Defaults.prototype.apply = function (options) { + options = $.extend(true, {}, this.defaults, options); + + if (options.dataAdapter == null) { + if (options.ajax != null) { + options.dataAdapter = AjaxData; + } else if (options.data != null) { + options.dataAdapter = ArrayData; + } else { + options.dataAdapter = SelectData; + } + + if (options.minimumInputLength > 0) { + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + MinimumInputLength + ); + } + + if (options.maximumInputLength > 0) { + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + MaximumInputLength + ); + } + + if (options.maximumSelectionLength > 0) { + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + MaximumSelectionLength + ); + } + + if (options.tags) { + options.dataAdapter = Utils.Decorate(options.dataAdapter, Tags); + } + + if (options.tokenSeparators != null || options.tokenizer != null) { + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + Tokenizer + ); + } + + if (options.query != null) { + var Query = require(options.amdBase + 'compat/query'); + + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + Query + ); + } + + if (options.initSelection != null) { + var InitSelection = require(options.amdBase + 'compat/initSelection'); + + options.dataAdapter = Utils.Decorate( + options.dataAdapter, + InitSelection + ); + } + } + + if (options.resultsAdapter == null) { + options.resultsAdapter = ResultsList; + + if (options.ajax != null) { + options.resultsAdapter = Utils.Decorate( + options.resultsAdapter, + InfiniteScroll + ); + } + + if (options.placeholder != null) { + options.resultsAdapter = Utils.Decorate( + options.resultsAdapter, + HidePlaceholder + ); + } + + if (options.selectOnClose) { + options.resultsAdapter = Utils.Decorate( + options.resultsAdapter, + SelectOnClose + ); + } + } + + if (options.dropdownAdapter == null) { + if (options.multiple) { + options.dropdownAdapter = Dropdown; + } else { + var SearchableDropdown = Utils.Decorate(Dropdown, DropdownSearch); + + options.dropdownAdapter = SearchableDropdown; + } + + if (options.minimumResultsForSearch !== 0) { + options.dropdownAdapter = Utils.Decorate( + options.dropdownAdapter, + MinimumResultsForSearch + ); + } + + if (options.closeOnSelect) { + options.dropdownAdapter = Utils.Decorate( + options.dropdownAdapter, + CloseOnSelect + ); + } + + if ( + options.dropdownCssClass != null || + options.dropdownCss != null || + options.adaptDropdownCssClass != null + ) { + var DropdownCSS = require(options.amdBase + 'compat/dropdownCss'); + + options.dropdownAdapter = Utils.Decorate( + options.dropdownAdapter, + DropdownCSS + ); + } + + options.dropdownAdapter = Utils.Decorate( + options.dropdownAdapter, + AttachBody + ); + } + + if (options.selectionAdapter == null) { + if (options.multiple) { + options.selectionAdapter = MultipleSelection; + } else { + options.selectionAdapter = SingleSelection; + } + + // Add the placeholder mixin if a placeholder was specified + if (options.placeholder != null) { + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + Placeholder + ); + } + + if (options.allowClear) { + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + AllowClear + ); + } + + if (options.multiple) { + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + SelectionSearch + ); + } + + if ( + options.containerCssClass != null || + options.containerCss != null || + options.adaptContainerCssClass != null + ) { + var ContainerCSS = require(options.amdBase + 'compat/containerCss'); + + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + ContainerCSS + ); + } + + options.selectionAdapter = Utils.Decorate( + options.selectionAdapter, + EventRelay + ); + } + + if (typeof options.language === 'string') { + // Check if the language is specified with a region + if (options.language.indexOf('-') > 0) { + // Extract the region information if it is included + var languageParts = options.language.split('-'); + var baseLanguage = languageParts[0]; + + options.language = [options.language, baseLanguage]; + } else { + options.language = [options.language]; + } + } + + if ($.isArray(options.language)) { + var languages = new Translation(); + options.language.push('en'); + + var languageNames = options.language; + + for (var l = 0; l < languageNames.length; l++) { + var name = languageNames[l]; + var language = {}; + + try { + // Try to load it with the original name + language = Translation.loadPath(name); + } catch (e) { + try { + // If we couldn't load it, check if it wasn't the full path + name = this.defaults.amdLanguageBase + name; + language = Translation.loadPath(name); + } catch (ex) { + // The translation could not be loaded at all. Sometimes this is + // because of a configuration problem, other times this can be + // because of how Select2 helps load all possible translation files. + if (options.debug && window.console && console.warn) { + console.warn( + 'Select2: The language file for "' + name + '" could not be ' + + 'automatically loaded. A fallback will be used instead.' + ); + } + + continue; + } + } + + languages.extend(language); + } + + options.translations = languages; + } else { + var baseTranslation = Translation.loadPath( + this.defaults.amdLanguageBase + 'en' + ); + var customTranslation = new Translation(options.language); + + customTranslation.extend(baseTranslation); + + options.translations = customTranslation; + } + + return options; + }; + + Defaults.prototype.reset = function () { + function stripDiacritics (text) { + // Used 'uni range + named function' from http://jsperf.com/diacritics/18 + function match(a) { + return DIACRITICS[a] || a; + } + + return text.replace(/[^\u0000-\u007E]/g, match); + } + + function matcher (params, data) { + // Always return the object if there is nothing to compare + if ($.trim(params.term) === '') { + return data; + } + + // Do a recursive check for options with children + if (data.children && data.children.length > 0) { + // Clone the data object if there are children + // This is required as we modify the object to remove any non-matches + var match = $.extend(true, {}, data); + + // Check each child of the option + for (var c = data.children.length - 1; c >= 0; c--) { + var child = data.children[c]; + + var matches = matcher(params, child); + + // If there wasn't a match, remove the object in the array + if (matches == null) { + match.children.splice(c, 1); + } + } + + // If any children matched, return the new object + if (match.children.length > 0) { + return match; + } + + // If there were no matching children, check just the plain object + return matcher(params, match); + } + + var original = stripDiacritics(data.text).toUpperCase(); + var term = stripDiacritics(params.term).toUpperCase(); + + // Check if the text contains the term + if (original.indexOf(term) > -1) { + return data; + } + + // If it doesn't contain the term, don't return anything + return null; + } + + this.defaults = { + amdBase: './', + amdLanguageBase: './i18n/', + closeOnSelect: true, + debug: false, + dropdownAutoWidth: false, + escapeMarkup: Utils.escapeMarkup, + language: EnglishTranslation, + matcher: matcher, + minimumInputLength: 0, + maximumInputLength: 0, + maximumSelectionLength: 0, + minimumResultsForSearch: 0, + selectOnClose: false, + sorter: function (data) { + return data; + }, + templateResult: function (result) { + return result.text; + }, + templateSelection: function (selection) { + return selection.text; + }, + theme: 'default', + width: 'resolve' + }; + }; + + Defaults.prototype.set = function (key, value) { + var camelKey = $.camelCase(key); + + var data = {}; + data[camelKey] = value; + + var convertedData = Utils._convertData(data); + + $.extend(this.defaults, convertedData); + }; + + var defaults = new Defaults(); + + return defaults; +}); + +S2.define('select2/options',[ + 'require', + 'jquery', + './defaults', + './utils' +], function (require, $, Defaults, Utils) { + function Options (options, $element) { + this.options = options; + + if ($element != null) { + this.fromElement($element); + } + + this.options = Defaults.apply(this.options); + + if ($element && $element.is('input')) { + var InputCompat = require(this.get('amdBase') + 'compat/inputData'); + + this.options.dataAdapter = Utils.Decorate( + this.options.dataAdapter, + InputCompat + ); + } + } + + Options.prototype.fromElement = function ($e) { + var excludedData = ['select2']; + + if (this.options.multiple == null) { + this.options.multiple = $e.prop('multiple'); + } + + if (this.options.disabled == null) { + this.options.disabled = $e.prop('disabled'); + } + + if (this.options.language == null) { + if ($e.prop('lang')) { + this.options.language = $e.prop('lang').toLowerCase(); + } else if ($e.closest('[lang]').prop('lang')) { + this.options.language = $e.closest('[lang]').prop('lang'); + } + } + + if (this.options.dir == null) { + if ($e.prop('dir')) { + this.options.dir = $e.prop('dir'); + } else if ($e.closest('[dir]').prop('dir')) { + this.options.dir = $e.closest('[dir]').prop('dir'); + } else { + this.options.dir = 'ltr'; + } + } + + $e.prop('disabled', this.options.disabled); + $e.prop('multiple', this.options.multiple); + + if ($e.data('select2Tags')) { + if (this.options.debug && window.console && console.warn) { + console.warn( + 'Select2: The `data-select2-tags` attribute has been changed to ' + + 'use the `data-data` and `data-tags="true"` attributes and will be ' + + 'removed in future versions of Select2.' + ); + } + + $e.data('data', $e.data('select2Tags')); + $e.data('tags', true); + } + + if ($e.data('ajaxUrl')) { + if (this.options.debug && window.console && console.warn) { + console.warn( + 'Select2: The `data-ajax-url` attribute has been changed to ' + + '`data-ajax--url` and support for the old attribute will be removed' + + ' in future versions of Select2.' + ); + } + + $e.attr('ajax--url', $e.data('ajaxUrl')); + $e.data('ajax--url', $e.data('ajaxUrl')); + } + + var dataset = {}; + + // Prefer the element's `dataset` attribute if it exists + // jQuery 1.x does not correctly handle data attributes with multiple dashes + if ($.fn.jquery && $.fn.jquery.substr(0, 2) == '1.' && $e[0].dataset) { + dataset = $.extend(true, {}, $e[0].dataset, $e.data()); + } else { + dataset = $e.data(); + } + + var data = $.extend(true, {}, dataset); + + data = Utils._convertData(data); + + for (var key in data) { + if ($.inArray(key, excludedData) > -1) { + continue; + } + + if ($.isPlainObject(this.options[key])) { + $.extend(this.options[key], data[key]); + } else { + this.options[key] = data[key]; + } + } + + return this; + }; + + Options.prototype.get = function (key) { + return this.options[key]; + }; + + Options.prototype.set = function (key, val) { + this.options[key] = val; + }; + + return Options; +}); + +S2.define('select2/core',[ + 'jquery', + './options', + './utils', + './keys' +], function ($, Options, Utils, KEYS) { + var Select2 = function ($element, options) { + if ($element.data('select2') != null) { + $element.data('select2').destroy(); + } + + this.$element = $element; + + this.id = this._generateId($element); + + options = options || {}; + + this.options = new Options(options, $element); + + Select2.__super__.constructor.call(this); + + // Set up the tabindex + + var tabindex = $element.attr('tabindex') || 0; + $element.data('old-tabindex', tabindex); + $element.attr('tabindex', '-1'); + + // Set up containers and adapters + + var DataAdapter = this.options.get('dataAdapter'); + this.dataAdapter = new DataAdapter($element, this.options); + + var $container = this.render(); + + this._placeContainer($container); + + var SelectionAdapter = this.options.get('selectionAdapter'); + this.selection = new SelectionAdapter($element, this.options); + this.$selection = this.selection.render(); + + this.selection.position(this.$selection, $container); + + var DropdownAdapter = this.options.get('dropdownAdapter'); + this.dropdown = new DropdownAdapter($element, this.options); + this.$dropdown = this.dropdown.render(); + + this.dropdown.position(this.$dropdown, $container); + + var ResultsAdapter = this.options.get('resultsAdapter'); + this.results = new ResultsAdapter($element, this.options, this.dataAdapter); + this.$results = this.results.render(); + + this.results.position(this.$results, this.$dropdown); + + // Bind events + + var self = this; + + // Bind the container to all of the adapters + this._bindAdapters(); + + // Register any DOM event handlers + this._registerDomEvents(); + + // Register any internal event handlers + this._registerDataEvents(); + this._registerSelectionEvents(); + this._registerDropdownEvents(); + this._registerResultsEvents(); + this._registerEvents(); + + // Set the initial state + this.dataAdapter.current(function (initialData) { + self.trigger('selection:update', { + data: initialData + }); + }); + + // Hide the original select + $element.addClass('select2-hidden-accessible'); + $element.attr('aria-hidden', 'true'); + + // Synchronize any monitored attributes + this._syncAttributes(); + + $element.data('select2', this); + }; + + Utils.Extend(Select2, Utils.Observable); + + Select2.prototype._generateId = function ($element) { + var id = ''; + + if ($element.attr('id') != null) { + id = $element.attr('id'); + } else if ($element.attr('name') != null) { + id = $element.attr('name') + '-' + Utils.generateChars(2); + } else { + id = Utils.generateChars(4); + } + + id = id.replace(/(:|\.|\[|\]|,)/g, ''); + id = 'select2-' + id; + + return id; + }; + + Select2.prototype._placeContainer = function ($container) { + $container.insertAfter(this.$element); + + var width = this._resolveWidth(this.$element, this.options.get('width')); + + if (width != null) { + $container.css('width', width); + } + }; + + Select2.prototype._resolveWidth = function ($element, method) { + var WIDTH = /^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i; + + if (method == 'resolve') { + var styleWidth = this._resolveWidth($element, 'style'); + + if (styleWidth != null) { + return styleWidth; + } + + return this._resolveWidth($element, 'element'); + } + + if (method == 'element') { + var elementWidth = $element.outerWidth(false); + + if (elementWidth <= 0) { + return 'auto'; + } + + return elementWidth + 'px'; + } + + if (method == 'style') { + var style = $element.attr('style'); + + if (typeof(style) !== 'string') { + return null; + } + + var attrs = style.split(';'); + + for (var i = 0, l = attrs.length; i < l; i = i + 1) { + var attr = attrs[i].replace(/\s/g, ''); + var matches = attr.match(WIDTH); + + if (matches !== null && matches.length >= 1) { + return matches[1]; + } + } + + return null; + } + + return method; + }; + + Select2.prototype._bindAdapters = function () { + this.dataAdapter.bind(this, this.$container); + this.selection.bind(this, this.$container); + + this.dropdown.bind(this, this.$container); + this.results.bind(this, this.$container); + }; + + Select2.prototype._registerDomEvents = function () { + var self = this; + + this.$element.on('change.select2', function () { + self.dataAdapter.current(function (data) { + self.trigger('selection:update', { + data: data + }); + }); + }); + + this.$element.on('focus.select2', function (evt) { + self.trigger('focus', evt); + }); + + this._syncA = Utils.bind(this._syncAttributes, this); + this._syncS = Utils.bind(this._syncSubtree, this); + + if (this.$element[0].attachEvent) { + this.$element[0].attachEvent('onpropertychange', this._syncA); + } + + var observer = window.MutationObserver || + window.WebKitMutationObserver || + window.MozMutationObserver + ; + + if (observer != null) { + this._observer = new observer(function (mutations) { + $.each(mutations, self._syncA); + $.each(mutations, self._syncS); + }); + this._observer.observe(this.$element[0], { + attributes: true, + childList: true, + subtree: false + }); + } else if (this.$element[0].addEventListener) { + this.$element[0].addEventListener( + 'DOMAttrModified', + self._syncA, + false + ); + this.$element[0].addEventListener( + 'DOMNodeInserted', + self._syncS, + false + ); + this.$element[0].addEventListener( + 'DOMNodeRemoved', + self._syncS, + false + ); + } + }; + + Select2.prototype._registerDataEvents = function () { + var self = this; + + this.dataAdapter.on('*', function (name, params) { + self.trigger(name, params); + }); + }; + + Select2.prototype._registerSelectionEvents = function () { + var self = this; + var nonRelayEvents = ['toggle', 'focus']; + + this.selection.on('toggle', function () { + self.toggleDropdown(); + }); + + this.selection.on('focus', function (params) { + self.focus(params); + }); + + this.selection.on('*', function (name, params) { + if ($.inArray(name, nonRelayEvents) !== -1) { + return; + } + + self.trigger(name, params); + }); + }; + + Select2.prototype._registerDropdownEvents = function () { + var self = this; + + this.dropdown.on('*', function (name, params) { + self.trigger(name, params); + }); + }; + + Select2.prototype._registerResultsEvents = function () { + var self = this; + + this.results.on('*', function (name, params) { + self.trigger(name, params); + }); + }; + + Select2.prototype._registerEvents = function () { + var self = this; + + this.on('open', function () { + self.$container.addClass('select2-container--open'); + }); + + this.on('close', function () { + self.$container.removeClass('select2-container--open'); + }); + + this.on('enable', function () { + self.$container.removeClass('select2-container--disabled'); + }); + + this.on('disable', function () { + self.$container.addClass('select2-container--disabled'); + }); + + this.on('blur', function () { + self.$container.removeClass('select2-container--focus'); + }); + + this.on('query', function (params) { + if (!self.isOpen()) { + self.trigger('open', {}); + } + + this.dataAdapter.query(params, function (data) { + self.trigger('results:all', { + data: data, + query: params + }); + }); + }); + + this.on('query:append', function (params) { + this.dataAdapter.query(params, function (data) { + self.trigger('results:append', { + data: data, + query: params + }); + }); + }); + + this.on('keypress', function (evt) { + var key = evt.which; + + if (self.isOpen()) { + if (key === KEYS.ESC || key === KEYS.TAB || + (key === KEYS.UP && evt.altKey)) { + self.close(); + + evt.preventDefault(); + } else if (key === KEYS.ENTER) { + self.trigger('results:select', {}); + + evt.preventDefault(); + } else if ((key === KEYS.SPACE && evt.ctrlKey)) { + self.trigger('results:toggle', {}); + + evt.preventDefault(); + } else if (key === KEYS.UP) { + self.trigger('results:previous', {}); + + evt.preventDefault(); + } else if (key === KEYS.DOWN) { + self.trigger('results:next', {}); + + evt.preventDefault(); + } + } else { + if (key === KEYS.ENTER || key === KEYS.SPACE || + (key === KEYS.DOWN && evt.altKey)) { + self.open(); + + evt.preventDefault(); + } + } + }); + }; + + Select2.prototype._syncAttributes = function () { + this.options.set('disabled', this.$element.prop('disabled')); + + if (this.options.get('disabled')) { + if (this.isOpen()) { + this.close(); + } + + this.trigger('disable', {}); + } else { + this.trigger('enable', {}); + } + }; + + Select2.prototype._syncSubtree = function (evt, mutations) { + var changed = false; + var self = this; + + // Ignore any mutation events raised for elements that aren't options or + // optgroups. This handles the case when the select element is destroyed + if ( + evt && evt.target && ( + evt.target.nodeName !== 'OPTION' && evt.target.nodeName !== 'OPTGROUP' + ) + ) { + return; + } + + if (!mutations) { + // If mutation events aren't supported, then we can only assume that the + // change affected the selections + changed = true; + } else if (mutations.addedNodes && mutations.addedNodes.length > 0) { + for (var n = 0; n < mutations.addedNodes.length; n++) { + var node = mutations.addedNodes[n]; + + if (node.selected) { + changed = true; + } + } + } else if (mutations.removedNodes && mutations.removedNodes.length > 0) { + changed = true; + } + + // Only re-pull the data if we think there is a change + if (changed) { + this.dataAdapter.current(function (currentData) { + self.trigger('selection:update', { + data: currentData + }); + }); + } + }; + + /** + * Override the trigger method to automatically trigger pre-events when + * there are events that can be prevented. + */ + Select2.prototype.trigger = function (name, args) { + var actualTrigger = Select2.__super__.trigger; + var preTriggerMap = { + 'open': 'opening', + 'close': 'closing', + 'select': 'selecting', + 'unselect': 'unselecting' + }; + + if (args === undefined) { + args = {}; + } + + if (name in preTriggerMap) { + var preTriggerName = preTriggerMap[name]; + var preTriggerArgs = { + prevented: false, + name: name, + args: args + }; + + actualTrigger.call(this, preTriggerName, preTriggerArgs); + + if (preTriggerArgs.prevented) { + args.prevented = true; + + return; + } + } + + actualTrigger.call(this, name, args); + }; + + Select2.prototype.toggleDropdown = function () { + if (this.options.get('disabled')) { + return; + } + + if (this.isOpen()) { + this.close(); + } else { + this.open(); + } + }; + + Select2.prototype.open = function () { + if (this.isOpen()) { + return; + } + + this.trigger('query', {}); + }; + + Select2.prototype.close = function () { + if (!this.isOpen()) { + return; + } + + this.trigger('close', {}); + }; + + Select2.prototype.isOpen = function () { + return this.$container.hasClass('select2-container--open'); + }; + + Select2.prototype.hasFocus = function () { + return this.$container.hasClass('select2-container--focus'); + }; + + Select2.prototype.focus = function (data) { + // No need to re-trigger focus events if we are already focused + if (this.hasFocus()) { + return; + } + + this.$container.addClass('select2-container--focus'); + this.trigger('focus', {}); + }; + + Select2.prototype.enable = function (args) { + if (this.options.get('debug') && window.console && console.warn) { + console.warn( + 'Select2: The `select2("enable")` method has been deprecated and will' + + ' be removed in later Select2 versions. Use $element.prop("disabled")' + + ' instead.' + ); + } + + if (args == null || args.length === 0) { + args = [true]; + } + + var disabled = !args[0]; + + this.$element.prop('disabled', disabled); + }; + + Select2.prototype.data = function () { + if (this.options.get('debug') && + arguments.length > 0 && window.console && console.warn) { + console.warn( + 'Select2: Data can no longer be set using `select2("data")`. You ' + + 'should consider setting the value instead using `$element.val()`.' + ); + } + + var data = []; + + this.dataAdapter.current(function (currentData) { + data = currentData; + }); + + return data; + }; + + Select2.prototype.val = function (args) { + if (this.options.get('debug') && window.console && console.warn) { + console.warn( + 'Select2: The `select2("val")` method has been deprecated and will be' + + ' removed in later Select2 versions. Use $element.val() instead.' + ); + } + + if (args == null || args.length === 0) { + return this.$element.val(); + } + + var newVal = args[0]; + + if ($.isArray(newVal)) { + newVal = $.map(newVal, function (obj) { + return obj.toString(); + }); + } + + this.$element.val(newVal).trigger('change'); + }; + + Select2.prototype.destroy = function () { + this.$container.remove(); + + if (this.$element[0].detachEvent) { + this.$element[0].detachEvent('onpropertychange', this._syncA); + } + + if (this._observer != null) { + this._observer.disconnect(); + this._observer = null; + } else if (this.$element[0].removeEventListener) { + this.$element[0] + .removeEventListener('DOMAttrModified', this._syncA, false); + this.$element[0] + .removeEventListener('DOMNodeInserted', this._syncS, false); + this.$element[0] + .removeEventListener('DOMNodeRemoved', this._syncS, false); + } + + this._syncA = null; + this._syncS = null; + + this.$element.off('.select2'); + this.$element.attr('tabindex', this.$element.data('old-tabindex')); + + this.$element.removeClass('select2-hidden-accessible'); + this.$element.attr('aria-hidden', 'false'); + this.$element.removeData('select2'); + + this.dataAdapter.destroy(); + this.selection.destroy(); + this.dropdown.destroy(); + this.results.destroy(); + + this.dataAdapter = null; + this.selection = null; + this.dropdown = null; + this.results = null; + }; + + Select2.prototype.render = function () { + var $container = $( + '<span class="select2 select2-container">' + + '<span class="selection"></span>' + + '<span class="dropdown-wrapper" aria-hidden="true"></span>' + + '</span>' + ); + + $container.attr('dir', this.options.get('dir')); + + this.$container = $container; + + this.$container.addClass('select2-container--' + this.options.get('theme')); + + $container.data('element', this.$element); + + return $container; + }; + + return Select2; +}); + +S2.define('jquery-mousewheel',[ + 'jquery' +], function ($) { + // Used to shim jQuery.mousewheel for non-full builds. + return $; +}); + +S2.define('jquery.select2',[ + 'jquery', + 'jquery-mousewheel', + + './select2/core', + './select2/defaults' +], function ($, _, Select2, Defaults) { + if ($.fn.select2 == null) { + // All methods that should return the element + var thisMethods = ['open', 'close', 'destroy']; + + $.fn.select2 = function (options) { + options = options || {}; + + if (typeof options === 'object') { + this.each(function () { + var instanceOptions = $.extend(true, {}, options); + + var instance = new Select2($(this), instanceOptions); + }); + + return this; + } else if (typeof options === 'string') { + var ret; + var args = Array.prototype.slice.call(arguments, 1); + + this.each(function () { + var instance = $(this).data('select2'); + + if (instance == null && window.console && console.error) { + console.error( + 'The select2(\'' + options + '\') method was called on an ' + + 'element that is not using Select2.' + ); + } + + ret = instance[options].apply(instance, args); + }); + + // Check if we should be returning `this` + if ($.inArray(options, thisMethods) > -1) { + return this; + } + + return ret; + } else { + throw new Error('Invalid arguments for Select2: ' + options); + } + }; + } + + if ($.fn.select2.defaults == null) { + $.fn.select2.defaults = Defaults; + } + + return Select2; +}); + + // Return the AMD loader configuration so it can be used outside of this file + return { + define: S2.define, + require: S2.require + }; +}()); + + // Autoload the jQuery bindings + // We know that all of the modules exist above this, so we're safe + var select2 = S2.require('jquery.select2'); + + // Hold the AMD module references on the jQuery function that was just loaded + // This allows Select2 to use the internal loader outside of this file, such + // as in the language files. + jQuery.fn.select2.amd = S2; + + // Return the Select2 instance for anyone who is importing it. + return select2; +})); diff --git a/ishtar_common/static/select2/js/select2.min.js b/ishtar_common/static/select2/js/select2.min.js index b56419e2e..43f0a651e 100644 --- a/ishtar_common/static/select2/js/select2.min.js +++ b/ishtar_common/static/select2/js/select2.min.js @@ -1,23 +1,3 @@ -/* -Copyright 2014 Igor Vaynberg - -Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014 - -This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU -General Public License version 2 (the "GPL License"). You may choose either license to govern your -use of this software only upon the condition that you accept all of the terms of either the Apache -License or the GPL License. - -You may obtain a copy of the Apache License and the GPL License at: - -http://www.apache.org/licenses/LICENSE-2.0 -http://www.gnu.org/licenses/gpl-2.0.html - -Unless required by applicable law or agreed to in writing, software distributed under the Apache License -or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, -either express or implied. See the Apache License and the GPL License for the specific language governing -permissions and limitations under the Apache License and the GPL License. -*/ -!function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b; -var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text -},matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery);
\ No newline at end of file +/*! Select2 4.0.3 | https://github.com/select2/select2/blob/master/LICENSE.md */!function(a){"function"==typeof define&&define.amd?define(["jquery"],a):a("object"==typeof exports?require("jquery"):jQuery)}(function(a){var b=function(){if(a&&a.fn&&a.fn.select2&&a.fn.select2.amd)var b=a.fn.select2.amd;var b;return function(){if(!b||!b.requirejs){b?c=b:b={};var a,c,d;!function(b){function e(a,b){return u.call(a,b)}function f(a,b){var c,d,e,f,g,h,i,j,k,l,m,n=b&&b.split("/"),o=s.map,p=o&&o["*"]||{};if(a&&"."===a.charAt(0))if(b){for(a=a.split("/"),g=a.length-1,s.nodeIdCompat&&w.test(a[g])&&(a[g]=a[g].replace(w,"")),a=n.slice(0,n.length-1).concat(a),k=0;k<a.length;k+=1)if(m=a[k],"."===m)a.splice(k,1),k-=1;else if(".."===m){if(1===k&&(".."===a[2]||".."===a[0]))break;k>0&&(a.splice(k-1,2),k-=2)}a=a.join("/")}else 0===a.indexOf("./")&&(a=a.substring(2));if((n||p)&&o){for(c=a.split("/"),k=c.length;k>0;k-=1){if(d=c.slice(0,k).join("/"),n)for(l=n.length;l>0;l-=1)if(e=o[n.slice(0,l).join("/")],e&&(e=e[d])){f=e,h=k;break}if(f)break;!i&&p&&p[d]&&(i=p[d],j=k)}!f&&i&&(f=i,h=j),f&&(c.splice(0,h,f),a=c.join("/"))}return a}function g(a,c){return function(){var d=v.call(arguments,0);return"string"!=typeof d[0]&&1===d.length&&d.push(null),n.apply(b,d.concat([a,c]))}}function h(a){return function(b){return f(b,a)}}function i(a){return function(b){q[a]=b}}function j(a){if(e(r,a)){var c=r[a];delete r[a],t[a]=!0,m.apply(b,c)}if(!e(q,a)&&!e(t,a))throw new Error("No "+a);return q[a]}function k(a){var b,c=a?a.indexOf("!"):-1;return c>-1&&(b=a.substring(0,c),a=a.substring(c+1,a.length)),[b,a]}function l(a){return function(){return s&&s.config&&s.config[a]||{}}}var m,n,o,p,q={},r={},s={},t={},u=Object.prototype.hasOwnProperty,v=[].slice,w=/\.js$/;o=function(a,b){var c,d=k(a),e=d[0];return a=d[1],e&&(e=f(e,b),c=j(e)),e?a=c&&c.normalize?c.normalize(a,h(b)):f(a,b):(a=f(a,b),d=k(a),e=d[0],a=d[1],e&&(c=j(e))),{f:e?e+"!"+a:a,n:a,pr:e,p:c}},p={require:function(a){return g(a)},exports:function(a){var b=q[a];return"undefined"!=typeof b?b:q[a]={}},module:function(a){return{id:a,uri:"",exports:q[a],config:l(a)}}},m=function(a,c,d,f){var h,k,l,m,n,s,u=[],v=typeof d;if(f=f||a,"undefined"===v||"function"===v){for(c=!c.length&&d.length?["require","exports","module"]:c,n=0;n<c.length;n+=1)if(m=o(c[n],f),k=m.f,"require"===k)u[n]=p.require(a);else if("exports"===k)u[n]=p.exports(a),s=!0;else if("module"===k)h=u[n]=p.module(a);else if(e(q,k)||e(r,k)||e(t,k))u[n]=j(k);else{if(!m.p)throw new Error(a+" missing "+k);m.p.load(m.n,g(f,!0),i(k),{}),u[n]=q[k]}l=d?d.apply(q[a],u):void 0,a&&(h&&h.exports!==b&&h.exports!==q[a]?q[a]=h.exports:l===b&&s||(q[a]=l))}else a&&(q[a]=d)},a=c=n=function(a,c,d,e,f){if("string"==typeof a)return p[a]?p[a](c):j(o(a,c).f);if(!a.splice){if(s=a,s.deps&&n(s.deps,s.callback),!c)return;c.splice?(a=c,c=d,d=null):a=b}return c=c||function(){},"function"==typeof d&&(d=e,e=f),e?m(b,a,c,d):setTimeout(function(){m(b,a,c,d)},4),n},n.config=function(a){return n(a)},a._defined=q,d=function(a,b,c){if("string"!=typeof a)throw new Error("See almond README: incorrect module build, no module name");b.splice||(c=b,b=[]),e(q,a)||e(r,a)||(r[a]=[a,b,c])},d.amd={jQuery:!0}}(),b.requirejs=a,b.require=c,b.define=d}}(),b.define("almond",function(){}),b.define("jquery",[],function(){var b=a||$;return null==b&&console&&console.error&&console.error("Select2: An instance of jQuery or a jQuery-compatible library was not found. Make sure that you are including jQuery before Select2 on your web page."),b}),b.define("select2/utils",["jquery"],function(a){function b(a){var b=a.prototype,c=[];for(var d in b){var e=b[d];"function"==typeof e&&"constructor"!==d&&c.push(d)}return c}var c={};c.Extend=function(a,b){function c(){this.constructor=a}var d={}.hasOwnProperty;for(var e in b)d.call(b,e)&&(a[e]=b[e]);return c.prototype=b.prototype,a.prototype=new c,a.__super__=b.prototype,a},c.Decorate=function(a,c){function d(){var b=Array.prototype.unshift,d=c.prototype.constructor.length,e=a.prototype.constructor;d>0&&(b.call(arguments,a.prototype.constructor),e=c.prototype.constructor),e.apply(this,arguments)}function e(){this.constructor=d}var f=b(c),g=b(a);c.displayName=a.displayName,d.prototype=new e;for(var h=0;h<g.length;h++){var i=g[h];d.prototype[i]=a.prototype[i]}for(var j=(function(a){var b=function(){};a in d.prototype&&(b=d.prototype[a]);var e=c.prototype[a];return function(){var a=Array.prototype.unshift;return a.call(arguments,b),e.apply(this,arguments)}}),k=0;k<f.length;k++){var l=f[k];d.prototype[l]=j(l)}return d};var d=function(){this.listeners={}};return d.prototype.on=function(a,b){this.listeners=this.listeners||{},a in this.listeners?this.listeners[a].push(b):this.listeners[a]=[b]},d.prototype.trigger=function(a){var b=Array.prototype.slice,c=b.call(arguments,1);this.listeners=this.listeners||{},null==c&&(c=[]),0===c.length&&c.push({}),c[0]._type=a,a in this.listeners&&this.invoke(this.listeners[a],b.call(arguments,1)),"*"in this.listeners&&this.invoke(this.listeners["*"],arguments)},d.prototype.invoke=function(a,b){for(var c=0,d=a.length;d>c;c++)a[c].apply(this,b)},c.Observable=d,c.generateChars=function(a){for(var b="",c=0;a>c;c++){var d=Math.floor(36*Math.random());b+=d.toString(36)}return b},c.bind=function(a,b){return function(){a.apply(b,arguments)}},c._convertData=function(a){for(var b in a){var c=b.split("-"),d=a;if(1!==c.length){for(var e=0;e<c.length;e++){var f=c[e];f=f.substring(0,1).toLowerCase()+f.substring(1),f in d||(d[f]={}),e==c.length-1&&(d[f]=a[b]),d=d[f]}delete a[b]}}return a},c.hasScroll=function(b,c){var d=a(c),e=c.style.overflowX,f=c.style.overflowY;return e!==f||"hidden"!==f&&"visible"!==f?"scroll"===e||"scroll"===f?!0:d.innerHeight()<c.scrollHeight||d.innerWidth()<c.scrollWidth:!1},c.escapeMarkup=function(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return"string"!=typeof a?a:String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})},c.appendMany=function(b,c){if("1.7"===a.fn.jquery.substr(0,3)){var d=a();a.map(c,function(a){d=d.add(a)}),c=d}b.append(c)},c}),b.define("select2/results",["jquery","./utils"],function(a,b){function c(a,b,d){this.$element=a,this.data=d,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<ul class="select2-results__options" role="tree"></ul>');return this.options.get("multiple")&&b.attr("aria-multiselectable","true"),this.$results=b,b},c.prototype.clear=function(){this.$results.empty()},c.prototype.displayMessage=function(b){var c=this.options.get("escapeMarkup");this.clear(),this.hideLoading();var d=a('<li role="treeitem" aria-live="assertive" class="select2-results__option"></li>'),e=this.options.get("translations").get(b.message);d.append(c(e(b.args))),d[0].className+=" select2-results__message",this.$results.append(d)},c.prototype.hideMessages=function(){this.$results.find(".select2-results__message").remove()},c.prototype.append=function(a){this.hideLoading();var b=[];if(null==a.results||0===a.results.length)return void(0===this.$results.children().length&&this.trigger("results:message",{message:"noResults"}));a.results=this.sort(a.results);for(var c=0;c<a.results.length;c++){var d=a.results[c],e=this.option(d);b.push(e)}this.$results.append(b)},c.prototype.position=function(a,b){var c=b.find(".select2-results");c.append(a)},c.prototype.sort=function(a){var b=this.options.get("sorter");return b(a)},c.prototype.highlightFirstItem=function(){var a=this.$results.find(".select2-results__option[aria-selected]"),b=a.filter("[aria-selected=true]");b.length>0?b.first().trigger("mouseenter"):a.first().trigger("mouseenter"),this.ensureHighlightVisible()},c.prototype.setClasses=function(){var b=this;this.data.current(function(c){var d=a.map(c,function(a){return a.id.toString()}),e=b.$results.find(".select2-results__option[aria-selected]");e.each(function(){var b=a(this),c=a.data(this,"data"),e=""+c.id;null!=c.element&&c.element.selected||null==c.element&&a.inArray(e,d)>-1?b.attr("aria-selected","true"):b.attr("aria-selected","false")})})},c.prototype.showLoading=function(a){this.hideLoading();var b=this.options.get("translations").get("searching"),c={disabled:!0,loading:!0,text:b(a)},d=this.option(c);d.className+=" loading-results",this.$results.prepend(d)},c.prototype.hideLoading=function(){this.$results.find(".loading-results").remove()},c.prototype.option=function(b){var c=document.createElement("li");c.className="select2-results__option";var d={role:"treeitem","aria-selected":"false"};b.disabled&&(delete d["aria-selected"],d["aria-disabled"]="true"),null==b.id&&delete d["aria-selected"],null!=b._resultId&&(c.id=b._resultId),b.title&&(c.title=b.title),b.children&&(d.role="group",d["aria-label"]=b.text,delete d["aria-selected"]);for(var e in d){var f=d[e];c.setAttribute(e,f)}if(b.children){var g=a(c),h=document.createElement("strong");h.className="select2-results__group";a(h);this.template(b,h);for(var i=[],j=0;j<b.children.length;j++){var k=b.children[j],l=this.option(k);i.push(l)}var m=a("<ul></ul>",{"class":"select2-results__options select2-results__options--nested"});m.append(i),g.append(h),g.append(m)}else this.template(b,c);return a.data(c,"data",b),c},c.prototype.bind=function(b,c){var d=this,e=b.id+"-results";this.$results.attr("id",e),b.on("results:all",function(a){d.clear(),d.append(a.data),b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("results:append",function(a){d.append(a.data),b.isOpen()&&d.setClasses()}),b.on("query",function(a){d.hideMessages(),d.showLoading(a)}),b.on("select",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("unselect",function(){b.isOpen()&&(d.setClasses(),d.highlightFirstItem())}),b.on("open",function(){d.$results.attr("aria-expanded","true"),d.$results.attr("aria-hidden","false"),d.setClasses(),d.ensureHighlightVisible()}),b.on("close",function(){d.$results.attr("aria-expanded","false"),d.$results.attr("aria-hidden","true"),d.$results.removeAttr("aria-activedescendant")}),b.on("results:toggle",function(){var a=d.getHighlightedResults();0!==a.length&&a.trigger("mouseup")}),b.on("results:select",function(){var a=d.getHighlightedResults();if(0!==a.length){var b=a.data("data");"true"==a.attr("aria-selected")?d.trigger("close",{}):d.trigger("select",{data:b})}}),b.on("results:previous",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a);if(0!==c){var e=c-1;0===a.length&&(e=0);var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top,h=f.offset().top,i=d.$results.scrollTop()+(h-g);0===e?d.$results.scrollTop(0):0>h-g&&d.$results.scrollTop(i)}}),b.on("results:next",function(){var a=d.getHighlightedResults(),b=d.$results.find("[aria-selected]"),c=b.index(a),e=c+1;if(!(e>=b.length)){var f=b.eq(e);f.trigger("mouseenter");var g=d.$results.offset().top+d.$results.outerHeight(!1),h=f.offset().top+f.outerHeight(!1),i=d.$results.scrollTop()+h-g;0===e?d.$results.scrollTop(0):h>g&&d.$results.scrollTop(i)}}),b.on("results:focus",function(a){a.element.addClass("select2-results__option--highlighted")}),b.on("results:message",function(a){d.displayMessage(a)}),a.fn.mousewheel&&this.$results.on("mousewheel",function(a){var b=d.$results.scrollTop(),c=d.$results.get(0).scrollHeight-b+a.deltaY,e=a.deltaY>0&&b-a.deltaY<=0,f=a.deltaY<0&&c<=d.$results.height();e?(d.$results.scrollTop(0),a.preventDefault(),a.stopPropagation()):f&&(d.$results.scrollTop(d.$results.get(0).scrollHeight-d.$results.height()),a.preventDefault(),a.stopPropagation())}),this.$results.on("mouseup",".select2-results__option[aria-selected]",function(b){var c=a(this),e=c.data("data");return"true"===c.attr("aria-selected")?void(d.options.get("multiple")?d.trigger("unselect",{originalEvent:b,data:e}):d.trigger("close",{})):void d.trigger("select",{originalEvent:b,data:e})}),this.$results.on("mouseenter",".select2-results__option[aria-selected]",function(b){var c=a(this).data("data");d.getHighlightedResults().removeClass("select2-results__option--highlighted"),d.trigger("results:focus",{data:c,element:a(this)})})},c.prototype.getHighlightedResults=function(){var a=this.$results.find(".select2-results__option--highlighted");return a},c.prototype.destroy=function(){this.$results.remove()},c.prototype.ensureHighlightVisible=function(){var a=this.getHighlightedResults();if(0!==a.length){var b=this.$results.find("[aria-selected]"),c=b.index(a),d=this.$results.offset().top,e=a.offset().top,f=this.$results.scrollTop()+(e-d),g=e-d;f-=2*a.outerHeight(!1),2>=c?this.$results.scrollTop(0):(g>this.$results.outerHeight()||0>g)&&this.$results.scrollTop(f)}},c.prototype.template=function(b,c){var d=this.options.get("templateResult"),e=this.options.get("escapeMarkup"),f=d(b,c);null==f?c.style.display="none":"string"==typeof f?c.innerHTML=e(f):a(c).append(f)},c}),b.define("select2/keys",[],function(){var a={BACKSPACE:8,TAB:9,ENTER:13,SHIFT:16,CTRL:17,ALT:18,ESC:27,SPACE:32,PAGE_UP:33,PAGE_DOWN:34,END:35,HOME:36,LEFT:37,UP:38,RIGHT:39,DOWN:40,DELETE:46};return a}),b.define("select2/selection/base",["jquery","../utils","../keys"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,b.Observable),d.prototype.render=function(){var b=a('<span class="select2-selection" role="combobox" aria-haspopup="true" aria-expanded="false"></span>');return this._tabindex=0,null!=this.$element.data("old-tabindex")?this._tabindex=this.$element.data("old-tabindex"):null!=this.$element.attr("tabindex")&&(this._tabindex=this.$element.attr("tabindex")),b.attr("title",this.$element.attr("title")),b.attr("tabindex",this._tabindex),this.$selection=b,b},d.prototype.bind=function(a,b){var d=this,e=(a.id+"-container",a.id+"-results");this.container=a,this.$selection.on("focus",function(a){d.trigger("focus",a)}),this.$selection.on("blur",function(a){d._handleBlur(a)}),this.$selection.on("keydown",function(a){d.trigger("keypress",a),a.which===c.SPACE&&a.preventDefault()}),a.on("results:focus",function(a){d.$selection.attr("aria-activedescendant",a.data._resultId)}),a.on("selection:update",function(a){d.update(a.data)}),a.on("open",function(){d.$selection.attr("aria-expanded","true"),d.$selection.attr("aria-owns",e),d._attachCloseHandler(a)}),a.on("close",function(){d.$selection.attr("aria-expanded","false"),d.$selection.removeAttr("aria-activedescendant"),d.$selection.removeAttr("aria-owns"),d.$selection.focus(),d._detachCloseHandler(a)}),a.on("enable",function(){d.$selection.attr("tabindex",d._tabindex)}),a.on("disable",function(){d.$selection.attr("tabindex","-1")})},d.prototype._handleBlur=function(b){var c=this;window.setTimeout(function(){document.activeElement==c.$selection[0]||a.contains(c.$selection[0],document.activeElement)||c.trigger("blur",b)},1)},d.prototype._attachCloseHandler=function(b){a(document.body).on("mousedown.select2."+b.id,function(b){var c=a(b.target),d=c.closest(".select2"),e=a(".select2.select2-container--open");e.each(function(){var b=a(this);if(this!=d[0]){var c=b.data("element");c.select2("close")}})})},d.prototype._detachCloseHandler=function(b){a(document.body).off("mousedown.select2."+b.id)},d.prototype.position=function(a,b){var c=b.find(".selection");c.append(a)},d.prototype.destroy=function(){this._detachCloseHandler(this.container)},d.prototype.update=function(a){throw new Error("The `update` method must be defined in child classes.")},d}),b.define("select2/selection/single",["jquery","./base","../utils","../keys"],function(a,b,c,d){function e(){e.__super__.constructor.apply(this,arguments)}return c.Extend(e,b),e.prototype.render=function(){var a=e.__super__.render.call(this);return a.addClass("select2-selection--single"),a.html('<span class="select2-selection__rendered"></span><span class="select2-selection__arrow" role="presentation"><b role="presentation"></b></span>'),a},e.prototype.bind=function(a,b){var c=this;e.__super__.bind.apply(this,arguments);var d=a.id+"-container";this.$selection.find(".select2-selection__rendered").attr("id",d),this.$selection.attr("aria-labelledby",d),this.$selection.on("mousedown",function(a){1===a.which&&c.trigger("toggle",{originalEvent:a})}),this.$selection.on("focus",function(a){}),this.$selection.on("blur",function(a){}),a.on("focus",function(b){a.isOpen()||c.$selection.focus()}),a.on("selection:update",function(a){c.update(a.data)})},e.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},e.prototype.display=function(a,b){var c=this.options.get("templateSelection"),d=this.options.get("escapeMarkup");return d(c(a,b))},e.prototype.selectionContainer=function(){return a("<span></span>")},e.prototype.update=function(a){if(0===a.length)return void this.clear();var b=a[0],c=this.$selection.find(".select2-selection__rendered"),d=this.display(b,c);c.empty().append(d),c.prop("title",b.title||b.text)},e}),b.define("select2/selection/multiple",["jquery","./base","../utils"],function(a,b,c){function d(a,b){d.__super__.constructor.apply(this,arguments)}return c.Extend(d,b),d.prototype.render=function(){var a=d.__super__.render.call(this);return a.addClass("select2-selection--multiple"),a.html('<ul class="select2-selection__rendered"></ul>'),a},d.prototype.bind=function(b,c){var e=this;d.__super__.bind.apply(this,arguments),this.$selection.on("click",function(a){e.trigger("toggle",{originalEvent:a})}),this.$selection.on("click",".select2-selection__choice__remove",function(b){if(!e.options.get("disabled")){var c=a(this),d=c.parent(),f=d.data("data");e.trigger("unselect",{originalEvent:b,data:f})}})},d.prototype.clear=function(){this.$selection.find(".select2-selection__rendered").empty()},d.prototype.display=function(a,b){var c=this.options.get("templateSelection"),d=this.options.get("escapeMarkup");return d(c(a,b))},d.prototype.selectionContainer=function(){var b=a('<li class="select2-selection__choice"><span class="select2-selection__choice__remove" role="presentation">×</span></li>');return b},d.prototype.update=function(a){if(this.clear(),0!==a.length){for(var b=[],d=0;d<a.length;d++){var e=a[d],f=this.selectionContainer(),g=this.display(e,f);f.append(g),f.prop("title",e.title||e.text),f.data("data",e),b.push(f)}var h=this.$selection.find(".select2-selection__rendered");c.appendMany(h,b)}},d}),b.define("select2/selection/placeholder",["../utils"],function(a){function b(a,b,c){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c)}return b.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},b.prototype.createPlaceholder=function(a,b){var c=this.selectionContainer();return c.html(this.display(b)),c.addClass("select2-selection__placeholder").removeClass("select2-selection__choice"),c},b.prototype.update=function(a,b){var c=1==b.length&&b[0].id!=this.placeholder.id,d=b.length>1;if(d||c)return a.call(this,b);this.clear();var e=this.createPlaceholder(this.placeholder);this.$selection.find(".select2-selection__rendered").append(e)},b}),b.define("select2/selection/allowClear",["jquery","../keys"],function(a,b){function c(){}return c.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),null==this.placeholder&&this.options.get("debug")&&window.console&&console.error&&console.error("Select2: The `allowClear` option should be used in combination with the `placeholder` option."),this.$selection.on("mousedown",".select2-selection__clear",function(a){d._handleClear(a)}),b.on("keypress",function(a){d._handleKeyboardClear(a,b)})},c.prototype._handleClear=function(a,b){if(!this.options.get("disabled")){var c=this.$selection.find(".select2-selection__clear");if(0!==c.length){b.stopPropagation();for(var d=c.data("data"),e=0;e<d.length;e++){var f={data:d[e]};if(this.trigger("unselect",f),f.prevented)return}this.$element.val(this.placeholder.id).trigger("change"),this.trigger("toggle",{})}}},c.prototype._handleKeyboardClear=function(a,c,d){d.isOpen()||(c.which==b.DELETE||c.which==b.BACKSPACE)&&this._handleClear(c)},c.prototype.update=function(b,c){if(b.call(this,c),!(this.$selection.find(".select2-selection__placeholder").length>0||0===c.length)){var d=a('<span class="select2-selection__clear">×</span>');d.data("data",c),this.$selection.find(".select2-selection__rendered").prepend(d)}},c}),b.define("select2/selection/search",["jquery","../utils","../keys"],function(a,b,c){function d(a,b,c){a.call(this,b,c)}return d.prototype.render=function(b){var c=a('<li class="select2-search select2-search--inline"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" aria-autocomplete="list" /></li>');this.$searchContainer=c,this.$search=c.find("input");var d=b.call(this);return this._transferTabIndex(),d},d.prototype.bind=function(a,b,d){var e=this;a.call(this,b,d),b.on("open",function(){e.$search.trigger("focus")}),b.on("close",function(){e.$search.val(""),e.$search.removeAttr("aria-activedescendant"),e.$search.trigger("focus")}),b.on("enable",function(){e.$search.prop("disabled",!1),e._transferTabIndex()}),b.on("disable",function(){e.$search.prop("disabled",!0)}),b.on("focus",function(a){e.$search.trigger("focus")}),b.on("results:focus",function(a){e.$search.attr("aria-activedescendant",a.id)}),this.$selection.on("focusin",".select2-search--inline",function(a){e.trigger("focus",a)}),this.$selection.on("focusout",".select2-search--inline",function(a){e._handleBlur(a)}),this.$selection.on("keydown",".select2-search--inline",function(a){a.stopPropagation(),e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented();var b=a.which;if(b===c.BACKSPACE&&""===e.$search.val()){var d=e.$searchContainer.prev(".select2-selection__choice");if(d.length>0){var f=d.data("data");e.searchRemoveChoice(f),a.preventDefault()}}});var f=document.documentMode,g=f&&11>=f;this.$selection.on("input.searchcheck",".select2-search--inline",function(a){return g?void e.$selection.off("input.search input.searchcheck"):void e.$selection.off("keyup.search")}),this.$selection.on("keyup.search input.search",".select2-search--inline",function(a){if(g&&"input"===a.type)return void e.$selection.off("input.search input.searchcheck");var b=a.which;b!=c.SHIFT&&b!=c.CTRL&&b!=c.ALT&&b!=c.TAB&&e.handleSearch(a)})},d.prototype._transferTabIndex=function(a){this.$search.attr("tabindex",this.$selection.attr("tabindex")),this.$selection.attr("tabindex","-1")},d.prototype.createPlaceholder=function(a,b){this.$search.attr("placeholder",b.text)},d.prototype.update=function(a,b){var c=this.$search[0]==document.activeElement;this.$search.attr("placeholder",""),a.call(this,b),this.$selection.find(".select2-selection__rendered").append(this.$searchContainer),this.resizeSearch(),c&&this.$search.focus()},d.prototype.handleSearch=function(){if(this.resizeSearch(),!this._keyUpPrevented){var a=this.$search.val();this.trigger("query",{term:a})}this._keyUpPrevented=!1},d.prototype.searchRemoveChoice=function(a,b){this.trigger("unselect",{data:b}),this.$search.val(b.text),this.handleSearch()},d.prototype.resizeSearch=function(){this.$search.css("width","25px");var a="";if(""!==this.$search.attr("placeholder"))a=this.$selection.find(".select2-selection__rendered").innerWidth();else{var b=this.$search.val().length+1;a=.75*b+"em"}this.$search.css("width",a)},d}),b.define("select2/selection/eventRelay",["jquery"],function(a){function b(){}return b.prototype.bind=function(b,c,d){var e=this,f=["open","opening","close","closing","select","selecting","unselect","unselecting"],g=["opening","closing","selecting","unselecting"];b.call(this,c,d),c.on("*",function(b,c){if(-1!==a.inArray(b,f)){c=c||{};var d=a.Event("select2:"+b,{params:c});e.$element.trigger(d),-1!==a.inArray(b,g)&&(c.prevented=d.isDefaultPrevented())}})},b}),b.define("select2/translation",["jquery","require"],function(a,b){function c(a){this.dict=a||{}}return c.prototype.all=function(){return this.dict},c.prototype.get=function(a){return this.dict[a]},c.prototype.extend=function(b){this.dict=a.extend({},b.all(),this.dict)},c._cache={},c.loadPath=function(a){if(!(a in c._cache)){var d=b(a);c._cache[a]=d}return new c(c._cache[a])},c}),b.define("select2/diacritics",[],function(){var a={"Ⓐ":"A","Ａ":"A","À":"A","Á":"A","Â":"A","Ầ":"A","Ấ":"A","Ẫ":"A","Ẩ":"A","Ã":"A","Ā":"A","Ă":"A","Ằ":"A","Ắ":"A","Ẵ":"A","Ẳ":"A","Ȧ":"A","Ǡ":"A","Ä":"A","Ǟ":"A","Ả":"A","Å":"A","Ǻ":"A","Ǎ":"A","Ȁ":"A","Ȃ":"A","Ạ":"A","Ậ":"A","Ặ":"A","Ḁ":"A","Ą":"A","Ⱥ":"A","Ɐ":"A","Ꜳ":"AA","Æ":"AE","Ǽ":"AE","Ǣ":"AE","Ꜵ":"AO","Ꜷ":"AU","Ꜹ":"AV","Ꜻ":"AV","Ꜽ":"AY","Ⓑ":"B","Ｂ":"B","Ḃ":"B","Ḅ":"B","Ḇ":"B","Ƀ":"B","Ƃ":"B","Ɓ":"B","Ⓒ":"C","Ｃ":"C","Ć":"C","Ĉ":"C","Ċ":"C","Č":"C","Ç":"C","Ḉ":"C","Ƈ":"C","Ȼ":"C","Ꜿ":"C","Ⓓ":"D","Ｄ":"D","Ḋ":"D","Ď":"D","Ḍ":"D","Ḑ":"D","Ḓ":"D","Ḏ":"D","Đ":"D","Ƌ":"D","Ɗ":"D","Ɖ":"D","Ꝺ":"D","DZ":"DZ","DŽ":"DZ","Dz":"Dz","Dž":"Dz","Ⓔ":"E","Ｅ":"E","È":"E","É":"E","Ê":"E","Ề":"E","Ế":"E","Ễ":"E","Ể":"E","Ẽ":"E","Ē":"E","Ḕ":"E","Ḗ":"E","Ĕ":"E","Ė":"E","Ë":"E","Ẻ":"E","Ě":"E","Ȅ":"E","Ȇ":"E","Ẹ":"E","Ệ":"E","Ȩ":"E","Ḝ":"E","Ę":"E","Ḙ":"E","Ḛ":"E","Ɛ":"E","Ǝ":"E","Ⓕ":"F","Ｆ":"F","Ḟ":"F","Ƒ":"F","Ꝼ":"F","Ⓖ":"G","Ｇ":"G","Ǵ":"G","Ĝ":"G","Ḡ":"G","Ğ":"G","Ġ":"G","Ǧ":"G","Ģ":"G","Ǥ":"G","Ɠ":"G","Ꞡ":"G","Ᵹ":"G","Ꝿ":"G","Ⓗ":"H","Ｈ":"H","Ĥ":"H","Ḣ":"H","Ḧ":"H","Ȟ":"H","Ḥ":"H","Ḩ":"H","Ḫ":"H","Ħ":"H","Ⱨ":"H","Ⱶ":"H","Ɥ":"H","Ⓘ":"I","Ｉ":"I","Ì":"I","Í":"I","Î":"I","Ĩ":"I","Ī":"I","Ĭ":"I","İ":"I","Ï":"I","Ḯ":"I","Ỉ":"I","Ǐ":"I","Ȉ":"I","Ȋ":"I","Ị":"I","Į":"I","Ḭ":"I","Ɨ":"I","Ⓙ":"J","Ｊ":"J","Ĵ":"J","Ɉ":"J","Ⓚ":"K","Ｋ":"K","Ḱ":"K","Ǩ":"K","Ḳ":"K","Ķ":"K","Ḵ":"K","Ƙ":"K","Ⱪ":"K","Ꝁ":"K","Ꝃ":"K","Ꝅ":"K","Ꞣ":"K","Ⓛ":"L","Ｌ":"L","Ŀ":"L","Ĺ":"L","Ľ":"L","Ḷ":"L","Ḹ":"L","Ļ":"L","Ḽ":"L","Ḻ":"L","Ł":"L","Ƚ":"L","Ɫ":"L","Ⱡ":"L","Ꝉ":"L","Ꝇ":"L","Ꞁ":"L","LJ":"LJ","Lj":"Lj","Ⓜ":"M","Ｍ":"M","Ḿ":"M","Ṁ":"M","Ṃ":"M","Ɱ":"M","Ɯ":"M","Ⓝ":"N","Ｎ":"N","Ǹ":"N","Ń":"N","Ñ":"N","Ṅ":"N","Ň":"N","Ṇ":"N","Ņ":"N","Ṋ":"N","Ṉ":"N","Ƞ":"N","Ɲ":"N","Ꞑ":"N","Ꞥ":"N","NJ":"NJ","Nj":"Nj","Ⓞ":"O","Ｏ":"O","Ò":"O","Ó":"O","Ô":"O","Ồ":"O","Ố":"O","Ỗ":"O","Ổ":"O","Õ":"O","Ṍ":"O","Ȭ":"O","Ṏ":"O","Ō":"O","Ṑ":"O","Ṓ":"O","Ŏ":"O","Ȯ":"O","Ȱ":"O","Ö":"O","Ȫ":"O","Ỏ":"O","Ő":"O","Ǒ":"O","Ȍ":"O","Ȏ":"O","Ơ":"O","Ờ":"O","Ớ":"O","Ỡ":"O","Ở":"O","Ợ":"O","Ọ":"O","Ộ":"O","Ǫ":"O","Ǭ":"O","Ø":"O","Ǿ":"O","Ɔ":"O","Ɵ":"O","Ꝋ":"O","Ꝍ":"O","Ƣ":"OI","Ꝏ":"OO","Ȣ":"OU","Ⓟ":"P","Ｐ":"P","Ṕ":"P","Ṗ":"P","Ƥ":"P","Ᵽ":"P","Ꝑ":"P","Ꝓ":"P","Ꝕ":"P","Ⓠ":"Q","Ｑ":"Q","Ꝗ":"Q","Ꝙ":"Q","Ɋ":"Q","Ⓡ":"R","Ｒ":"R","Ŕ":"R","Ṙ":"R","Ř":"R","Ȑ":"R","Ȓ":"R","Ṛ":"R","Ṝ":"R","Ŗ":"R","Ṟ":"R","Ɍ":"R","Ɽ":"R","Ꝛ":"R","Ꞧ":"R","Ꞃ":"R","Ⓢ":"S","Ｓ":"S","ẞ":"S","Ś":"S","Ṥ":"S","Ŝ":"S","Ṡ":"S","Š":"S","Ṧ":"S","Ṣ":"S","Ṩ":"S","Ș":"S","Ş":"S","Ȿ":"S","Ꞩ":"S","Ꞅ":"S","Ⓣ":"T","Ｔ":"T","Ṫ":"T","Ť":"T","Ṭ":"T","Ț":"T","Ţ":"T","Ṱ":"T","Ṯ":"T","Ŧ":"T","Ƭ":"T","Ʈ":"T","Ⱦ":"T","Ꞇ":"T","Ꜩ":"TZ","Ⓤ":"U","Ｕ":"U","Ù":"U","Ú":"U","Û":"U","Ũ":"U","Ṹ":"U","Ū":"U","Ṻ":"U","Ŭ":"U","Ü":"U","Ǜ":"U","Ǘ":"U","Ǖ":"U","Ǚ":"U","Ủ":"U","Ů":"U","Ű":"U","Ǔ":"U","Ȕ":"U","Ȗ":"U","Ư":"U","Ừ":"U","Ứ":"U","Ữ":"U","Ử":"U","Ự":"U","Ụ":"U","Ṳ":"U","Ų":"U","Ṷ":"U","Ṵ":"U","Ʉ":"U","Ⓥ":"V","Ｖ":"V","Ṽ":"V","Ṿ":"V","Ʋ":"V","Ꝟ":"V","Ʌ":"V","Ꝡ":"VY","Ⓦ":"W","Ｗ":"W","Ẁ":"W","Ẃ":"W","Ŵ":"W","Ẇ":"W","Ẅ":"W","Ẉ":"W","Ⱳ":"W","Ⓧ":"X","Ｘ":"X","Ẋ":"X","Ẍ":"X","Ⓨ":"Y","Ｙ":"Y","Ỳ":"Y","Ý":"Y","Ŷ":"Y","Ỹ":"Y","Ȳ":"Y","Ẏ":"Y","Ÿ":"Y","Ỷ":"Y","Ỵ":"Y","Ƴ":"Y","Ɏ":"Y","Ỿ":"Y","Ⓩ":"Z","Ｚ":"Z","Ź":"Z","Ẑ":"Z","Ż":"Z","Ž":"Z","Ẓ":"Z","Ẕ":"Z","Ƶ":"Z","Ȥ":"Z","Ɀ":"Z","Ⱬ":"Z","Ꝣ":"Z","ⓐ":"a","ａ":"a","ẚ":"a","à":"a","á":"a","â":"a","ầ":"a","ấ":"a","ẫ":"a","ẩ":"a","ã":"a","ā":"a","ă":"a","ằ":"a","ắ":"a","ẵ":"a","ẳ":"a","ȧ":"a","ǡ":"a","ä":"a","ǟ":"a","ả":"a","å":"a","ǻ":"a","ǎ":"a","ȁ":"a","ȃ":"a","ạ":"a","ậ":"a","ặ":"a","ḁ":"a","ą":"a","ⱥ":"a","ɐ":"a","ꜳ":"aa","æ":"ae","ǽ":"ae","ǣ":"ae","ꜵ":"ao","ꜷ":"au","ꜹ":"av","ꜻ":"av","ꜽ":"ay","ⓑ":"b","ｂ":"b","ḃ":"b","ḅ":"b","ḇ":"b","ƀ":"b","ƃ":"b","ɓ":"b","ⓒ":"c","ｃ":"c","ć":"c","ĉ":"c","ċ":"c","č":"c","ç":"c","ḉ":"c","ƈ":"c","ȼ":"c","ꜿ":"c","ↄ":"c","ⓓ":"d","ｄ":"d","ḋ":"d","ď":"d","ḍ":"d","ḑ":"d","ḓ":"d","ḏ":"d","đ":"d","ƌ":"d","ɖ":"d","ɗ":"d","ꝺ":"d","dz":"dz","dž":"dz","ⓔ":"e","ｅ":"e","è":"e","é":"e","ê":"e","ề":"e","ế":"e","ễ":"e","ể":"e","ẽ":"e","ē":"e","ḕ":"e","ḗ":"e","ĕ":"e","ė":"e","ë":"e","ẻ":"e","ě":"e","ȅ":"e","ȇ":"e","ẹ":"e","ệ":"e","ȩ":"e","ḝ":"e","ę":"e","ḙ":"e","ḛ":"e","ɇ":"e","ɛ":"e","ǝ":"e","ⓕ":"f","ｆ":"f","ḟ":"f","ƒ":"f","ꝼ":"f","ⓖ":"g","ｇ":"g","ǵ":"g","ĝ":"g","ḡ":"g","ğ":"g","ġ":"g","ǧ":"g","ģ":"g","ǥ":"g","ɠ":"g","ꞡ":"g","ᵹ":"g","ꝿ":"g","ⓗ":"h","ｈ":"h","ĥ":"h","ḣ":"h","ḧ":"h","ȟ":"h","ḥ":"h","ḩ":"h","ḫ":"h","ẖ":"h","ħ":"h","ⱨ":"h","ⱶ":"h","ɥ":"h","ƕ":"hv","ⓘ":"i","ｉ":"i","ì":"i","í":"i","î":"i","ĩ":"i","ī":"i","ĭ":"i","ï":"i","ḯ":"i","ỉ":"i","ǐ":"i","ȉ":"i","ȋ":"i","ị":"i","į":"i","ḭ":"i","ɨ":"i","ı":"i","ⓙ":"j","ｊ":"j","ĵ":"j","ǰ":"j","ɉ":"j","ⓚ":"k","ｋ":"k","ḱ":"k","ǩ":"k","ḳ":"k","ķ":"k","ḵ":"k","ƙ":"k","ⱪ":"k","ꝁ":"k","ꝃ":"k","ꝅ":"k","ꞣ":"k","ⓛ":"l","ｌ":"l","ŀ":"l","ĺ":"l","ľ":"l","ḷ":"l","ḹ":"l","ļ":"l","ḽ":"l","ḻ":"l","ſ":"l","ł":"l","ƚ":"l","ɫ":"l","ⱡ":"l","ꝉ":"l","ꞁ":"l","ꝇ":"l","lj":"lj","ⓜ":"m","ｍ":"m","ḿ":"m","ṁ":"m","ṃ":"m","ɱ":"m","ɯ":"m","ⓝ":"n","ｎ":"n","ǹ":"n","ń":"n","ñ":"n","ṅ":"n","ň":"n","ṇ":"n","ņ":"n","ṋ":"n","ṉ":"n","ƞ":"n","ɲ":"n","ʼn":"n","ꞑ":"n","ꞥ":"n","nj":"nj","ⓞ":"o","ｏ":"o","ò":"o","ó":"o","ô":"o","ồ":"o","ố":"o","ỗ":"o","ổ":"o","õ":"o","ṍ":"o","ȭ":"o","ṏ":"o","ō":"o","ṑ":"o","ṓ":"o","ŏ":"o","ȯ":"o","ȱ":"o","ö":"o","ȫ":"o","ỏ":"o","ő":"o","ǒ":"o","ȍ":"o","ȏ":"o","ơ":"o","ờ":"o","ớ":"o","ỡ":"o","ở":"o","ợ":"o","ọ":"o","ộ":"o","ǫ":"o","ǭ":"o","ø":"o","ǿ":"o","ɔ":"o","ꝋ":"o","ꝍ":"o","ɵ":"o","ƣ":"oi","ȣ":"ou","ꝏ":"oo","ⓟ":"p","ｐ":"p","ṕ":"p","ṗ":"p","ƥ":"p","ᵽ":"p","ꝑ":"p","ꝓ":"p","ꝕ":"p","ⓠ":"q","ｑ":"q","ɋ":"q","ꝗ":"q","ꝙ":"q","ⓡ":"r","ｒ":"r","ŕ":"r","ṙ":"r","ř":"r","ȑ":"r","ȓ":"r","ṛ":"r","ṝ":"r","ŗ":"r","ṟ":"r","ɍ":"r","ɽ":"r","ꝛ":"r","ꞧ":"r","ꞃ":"r","ⓢ":"s","ｓ":"s","ß":"s","ś":"s","ṥ":"s","ŝ":"s","ṡ":"s","š":"s","ṧ":"s","ṣ":"s","ṩ":"s","ș":"s","ş":"s","ȿ":"s","ꞩ":"s","ꞅ":"s","ẛ":"s","ⓣ":"t","ｔ":"t","ṫ":"t","ẗ":"t","ť":"t","ṭ":"t","ț":"t","ţ":"t","ṱ":"t","ṯ":"t","ŧ":"t","ƭ":"t","ʈ":"t","ⱦ":"t","ꞇ":"t","ꜩ":"tz","ⓤ":"u","ｕ":"u","ù":"u","ú":"u","û":"u","ũ":"u","ṹ":"u","ū":"u","ṻ":"u","ŭ":"u","ü":"u","ǜ":"u","ǘ":"u","ǖ":"u","ǚ":"u","ủ":"u","ů":"u","ű":"u","ǔ":"u","ȕ":"u","ȗ":"u","ư":"u","ừ":"u","ứ":"u","ữ":"u","ử":"u","ự":"u","ụ":"u","ṳ":"u","ų":"u","ṷ":"u","ṵ":"u","ʉ":"u","ⓥ":"v","ｖ":"v","ṽ":"v","ṿ":"v","ʋ":"v","ꝟ":"v","ʌ":"v","ꝡ":"vy","ⓦ":"w","ｗ":"w","ẁ":"w","ẃ":"w","ŵ":"w","ẇ":"w","ẅ":"w","ẘ":"w","ẉ":"w","ⱳ":"w","ⓧ":"x","ｘ":"x","ẋ":"x","ẍ":"x","ⓨ":"y","ｙ":"y","ỳ":"y","ý":"y","ŷ":"y","ỹ":"y","ȳ":"y","ẏ":"y","ÿ":"y","ỷ":"y","ẙ":"y","ỵ":"y","ƴ":"y","ɏ":"y","ỿ":"y","ⓩ":"z","ｚ":"z","ź":"z","ẑ":"z","ż":"z","ž":"z","ẓ":"z","ẕ":"z","ƶ":"z","ȥ":"z","ɀ":"z","ⱬ":"z","ꝣ":"z","Ά":"Α","Έ":"Ε","Ή":"Η","Ί":"Ι","Ϊ":"Ι","Ό":"Ο","Ύ":"Υ","Ϋ":"Υ","Ώ":"Ω","ά":"α","έ":"ε","ή":"η","ί":"ι","ϊ":"ι","ΐ":"ι","ό":"ο","ύ":"υ","ϋ":"υ","ΰ":"υ","ω":"ω","ς":"σ"};return a}),b.define("select2/data/base",["../utils"],function(a){function b(a,c){b.__super__.constructor.call(this)}return a.Extend(b,a.Observable),b.prototype.current=function(a){throw new Error("The `current` method must be defined in child classes.")},b.prototype.query=function(a,b){throw new Error("The `query` method must be defined in child classes.")},b.prototype.bind=function(a,b){},b.prototype.destroy=function(){},b.prototype.generateResultId=function(b,c){var d=b.id+"-result-";return d+=a.generateChars(4),d+=null!=c.id?"-"+c.id.toString():"-"+a.generateChars(4)},b}),b.define("select2/data/select",["./base","../utils","jquery"],function(a,b,c){function d(a,b){this.$element=a,this.options=b,d.__super__.constructor.call(this)}return b.Extend(d,a),d.prototype.current=function(a){var b=[],d=this;this.$element.find(":selected").each(function(){var a=c(this),e=d.item(a);b.push(e)}),a(b)},d.prototype.select=function(a){var b=this;if(a.selected=!0,c(a.element).is("option"))return a.element.selected=!0,void this.$element.trigger("change"); +if(this.$element.prop("multiple"))this.current(function(d){var e=[];a=[a],a.push.apply(a,d);for(var f=0;f<a.length;f++){var g=a[f].id;-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")});else{var d=a.id;this.$element.val(d),this.$element.trigger("change")}},d.prototype.unselect=function(a){var b=this;if(this.$element.prop("multiple"))return a.selected=!1,c(a.element).is("option")?(a.element.selected=!1,void this.$element.trigger("change")):void this.current(function(d){for(var e=[],f=0;f<d.length;f++){var g=d[f].id;g!==a.id&&-1===c.inArray(g,e)&&e.push(g)}b.$element.val(e),b.$element.trigger("change")})},d.prototype.bind=function(a,b){var c=this;this.container=a,a.on("select",function(a){c.select(a.data)}),a.on("unselect",function(a){c.unselect(a.data)})},d.prototype.destroy=function(){this.$element.find("*").each(function(){c.removeData(this,"data")})},d.prototype.query=function(a,b){var d=[],e=this,f=this.$element.children();f.each(function(){var b=c(this);if(b.is("option")||b.is("optgroup")){var f=e.item(b),g=e.matches(a,f);null!==g&&d.push(g)}}),b({results:d})},d.prototype.addOptions=function(a){b.appendMany(this.$element,a)},d.prototype.option=function(a){var b;a.children?(b=document.createElement("optgroup"),b.label=a.text):(b=document.createElement("option"),void 0!==b.textContent?b.textContent=a.text:b.innerText=a.text),a.id&&(b.value=a.id),a.disabled&&(b.disabled=!0),a.selected&&(b.selected=!0),a.title&&(b.title=a.title);var d=c(b),e=this._normalizeItem(a);return e.element=b,c.data(b,"data",e),d},d.prototype.item=function(a){var b={};if(b=c.data(a[0],"data"),null!=b)return b;if(a.is("option"))b={id:a.val(),text:a.text(),disabled:a.prop("disabled"),selected:a.prop("selected"),title:a.prop("title")};else if(a.is("optgroup")){b={text:a.prop("label"),children:[],title:a.prop("title")};for(var d=a.children("option"),e=[],f=0;f<d.length;f++){var g=c(d[f]),h=this.item(g);e.push(h)}b.children=e}return b=this._normalizeItem(b),b.element=a[0],c.data(a[0],"data",b),b},d.prototype._normalizeItem=function(a){c.isPlainObject(a)||(a={id:a,text:a}),a=c.extend({},{text:""},a);var b={selected:!1,disabled:!1};return null!=a.id&&(a.id=a.id.toString()),null!=a.text&&(a.text=a.text.toString()),null==a._resultId&&a.id&&null!=this.container&&(a._resultId=this.generateResultId(this.container,a)),c.extend({},b,a)},d.prototype.matches=function(a,b){var c=this.options.get("matcher");return c(a,b)},d}),b.define("select2/data/array",["./select","../utils","jquery"],function(a,b,c){function d(a,b){var c=b.get("data")||[];d.__super__.constructor.call(this,a,b),this.addOptions(this.convertToOptions(c))}return b.Extend(d,a),d.prototype.select=function(a){var b=this.$element.find("option").filter(function(b,c){return c.value==a.id.toString()});0===b.length&&(b=this.option(a),this.addOptions(b)),d.__super__.select.call(this,a)},d.prototype.convertToOptions=function(a){function d(a){return function(){return c(this).val()==a.id}}for(var e=this,f=this.$element.find("option"),g=f.map(function(){return e.item(c(this)).id}).get(),h=[],i=0;i<a.length;i++){var j=this._normalizeItem(a[i]);if(c.inArray(j.id,g)>=0){var k=f.filter(d(j)),l=this.item(k),m=c.extend(!0,{},j,l),n=this.option(m);k.replaceWith(n)}else{var o=this.option(j);if(j.children){var p=this.convertToOptions(j.children);b.appendMany(o,p)}h.push(o)}}return h},d}),b.define("select2/data/ajax",["./array","../utils","jquery"],function(a,b,c){function d(a,b){this.ajaxOptions=this._applyDefaults(b.get("ajax")),null!=this.ajaxOptions.processResults&&(this.processResults=this.ajaxOptions.processResults),d.__super__.constructor.call(this,a,b)}return b.Extend(d,a),d.prototype._applyDefaults=function(a){var b={data:function(a){return c.extend({},a,{q:a.term})},transport:function(a,b,d){var e=c.ajax(a);return e.then(b),e.fail(d),e}};return c.extend({},b,a,!0)},d.prototype.processResults=function(a){return a},d.prototype.query=function(a,b){function d(){var d=f.transport(f,function(d){var f=e.processResults(d,a);e.options.get("debug")&&window.console&&console.error&&(f&&f.results&&c.isArray(f.results)||console.error("Select2: The AJAX results did not return an array in the `results` key of the response.")),b(f)},function(){d.status&&"0"===d.status||e.trigger("results:message",{message:"errorLoading"})});e._request=d}var e=this;null!=this._request&&(c.isFunction(this._request.abort)&&this._request.abort(),this._request=null);var f=c.extend({type:"GET"},this.ajaxOptions);"function"==typeof f.url&&(f.url=f.url.call(this.$element,a)),"function"==typeof f.data&&(f.data=f.data.call(this.$element,a)),this.ajaxOptions.delay&&null!=a.term?(this._queryTimeout&&window.clearTimeout(this._queryTimeout),this._queryTimeout=window.setTimeout(d,this.ajaxOptions.delay)):d()},d}),b.define("select2/data/tags",["jquery"],function(a){function b(b,c,d){var e=d.get("tags"),f=d.get("createTag");void 0!==f&&(this.createTag=f);var g=d.get("insertTag");if(void 0!==g&&(this.insertTag=g),b.call(this,c,d),a.isArray(e))for(var h=0;h<e.length;h++){var i=e[h],j=this._normalizeItem(i),k=this.option(j);this.$element.append(k)}}return b.prototype.query=function(a,b,c){function d(a,f){for(var g=a.results,h=0;h<g.length;h++){var i=g[h],j=null!=i.children&&!d({results:i.children},!0),k=i.text===b.term;if(k||j)return f?!1:(a.data=g,void c(a))}if(f)return!0;var l=e.createTag(b);if(null!=l){var m=e.option(l);m.attr("data-select2-tag",!0),e.addOptions([m]),e.insertTag(g,l)}a.results=g,c(a)}var e=this;return this._removeOldTags(),null==b.term||null!=b.page?void a.call(this,b,c):void a.call(this,b,d)},b.prototype.createTag=function(b,c){var d=a.trim(c.term);return""===d?null:{id:d,text:d}},b.prototype.insertTag=function(a,b,c){b.unshift(c)},b.prototype._removeOldTags=function(b){var c=(this._lastTag,this.$element.find("option[data-select2-tag]"));c.each(function(){this.selected||a(this).remove()})},b}),b.define("select2/data/tokenizer",["jquery"],function(a){function b(a,b,c){var d=c.get("tokenizer");void 0!==d&&(this.tokenizer=d),a.call(this,b,c)}return b.prototype.bind=function(a,b,c){a.call(this,b,c),this.$search=b.dropdown.$search||b.selection.$search||c.find(".select2-search__field")},b.prototype.query=function(b,c,d){function e(b){var c=g._normalizeItem(b),d=g.$element.find("option").filter(function(){return a(this).val()===c.id});if(!d.length){var e=g.option(c);e.attr("data-select2-tag",!0),g._removeOldTags(),g.addOptions([e])}f(c)}function f(a){g.trigger("select",{data:a})}var g=this;c.term=c.term||"";var h=this.tokenizer(c,this.options,e);h.term!==c.term&&(this.$search.length&&(this.$search.val(h.term),this.$search.focus()),c.term=h.term),b.call(this,c,d)},b.prototype.tokenizer=function(b,c,d,e){for(var f=d.get("tokenSeparators")||[],g=c.term,h=0,i=this.createTag||function(a){return{id:a.term,text:a.term}};h<g.length;){var j=g[h];if(-1!==a.inArray(j,f)){var k=g.substr(0,h),l=a.extend({},c,{term:k}),m=i(l);null!=m?(e(m),g=g.substr(h+1)||"",h=0):h++}else h++}return{term:g}},b}),b.define("select2/data/minimumInputLength",[],function(){function a(a,b,c){this.minimumInputLength=c.get("minimumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){return b.term=b.term||"",b.term.length<this.minimumInputLength?void this.trigger("results:message",{message:"inputTooShort",args:{minimum:this.minimumInputLength,input:b.term,params:b}}):void a.call(this,b,c)},a}),b.define("select2/data/maximumInputLength",[],function(){function a(a,b,c){this.maximumInputLength=c.get("maximumInputLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){return b.term=b.term||"",this.maximumInputLength>0&&b.term.length>this.maximumInputLength?void this.trigger("results:message",{message:"inputTooLong",args:{maximum:this.maximumInputLength,input:b.term,params:b}}):void a.call(this,b,c)},a}),b.define("select2/data/maximumSelectionLength",[],function(){function a(a,b,c){this.maximumSelectionLength=c.get("maximumSelectionLength"),a.call(this,b,c)}return a.prototype.query=function(a,b,c){var d=this;this.current(function(e){var f=null!=e?e.length:0;return d.maximumSelectionLength>0&&f>=d.maximumSelectionLength?void d.trigger("results:message",{message:"maximumSelected",args:{maximum:d.maximumSelectionLength}}):void a.call(d,b,c)})},a}),b.define("select2/dropdown",["jquery","./utils"],function(a,b){function c(a,b){this.$element=a,this.options=b,c.__super__.constructor.call(this)}return b.Extend(c,b.Observable),c.prototype.render=function(){var b=a('<span class="select2-dropdown"><span class="select2-results"></span></span>');return b.attr("dir",this.options.get("dir")),this.$dropdown=b,b},c.prototype.bind=function(){},c.prototype.position=function(a,b){},c.prototype.destroy=function(){this.$dropdown.remove()},c}),b.define("select2/dropdown/search",["jquery","../utils"],function(a,b){function c(){}return c.prototype.render=function(b){var c=b.call(this),d=a('<span class="select2-search select2-search--dropdown"><input class="select2-search__field" type="search" tabindex="-1" autocomplete="off" autocorrect="off" autocapitalize="off" spellcheck="false" role="textbox" /></span>');return this.$searchContainer=d,this.$search=d.find("input"),c.prepend(d),c},c.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),this.$search.on("keydown",function(a){e.trigger("keypress",a),e._keyUpPrevented=a.isDefaultPrevented()}),this.$search.on("input",function(b){a(this).off("keyup")}),this.$search.on("keyup input",function(a){e.handleSearch(a)}),c.on("open",function(){e.$search.attr("tabindex",0),e.$search.focus(),window.setTimeout(function(){e.$search.focus()},0)}),c.on("close",function(){e.$search.attr("tabindex",-1),e.$search.val("")}),c.on("focus",function(){c.isOpen()&&e.$search.focus()}),c.on("results:all",function(a){if(null==a.query.term||""===a.query.term){var b=e.showSearch(a);b?e.$searchContainer.removeClass("select2-search--hide"):e.$searchContainer.addClass("select2-search--hide")}})},c.prototype.handleSearch=function(a){if(!this._keyUpPrevented){var b=this.$search.val();this.trigger("query",{term:b})}this._keyUpPrevented=!1},c.prototype.showSearch=function(a,b){return!0},c}),b.define("select2/dropdown/hidePlaceholder",[],function(){function a(a,b,c,d){this.placeholder=this.normalizePlaceholder(c.get("placeholder")),a.call(this,b,c,d)}return a.prototype.append=function(a,b){b.results=this.removePlaceholder(b.results),a.call(this,b)},a.prototype.normalizePlaceholder=function(a,b){return"string"==typeof b&&(b={id:"",text:b}),b},a.prototype.removePlaceholder=function(a,b){for(var c=b.slice(0),d=b.length-1;d>=0;d--){var e=b[d];this.placeholder.id===e.id&&c.splice(d,1)}return c},a}),b.define("select2/dropdown/infiniteScroll",["jquery"],function(a){function b(a,b,c,d){this.lastParams={},a.call(this,b,c,d),this.$loadingMore=this.createLoadingMore(),this.loading=!1}return b.prototype.append=function(a,b){this.$loadingMore.remove(),this.loading=!1,a.call(this,b),this.showLoadingMore(b)&&this.$results.append(this.$loadingMore)},b.prototype.bind=function(b,c,d){var e=this;b.call(this,c,d),c.on("query",function(a){e.lastParams=a,e.loading=!0}),c.on("query:append",function(a){e.lastParams=a,e.loading=!0}),this.$results.on("scroll",function(){var b=a.contains(document.documentElement,e.$loadingMore[0]);if(!e.loading&&b){var c=e.$results.offset().top+e.$results.outerHeight(!1),d=e.$loadingMore.offset().top+e.$loadingMore.outerHeight(!1);c+50>=d&&e.loadMore()}})},b.prototype.loadMore=function(){this.loading=!0;var b=a.extend({},{page:1},this.lastParams);b.page++,this.trigger("query:append",b)},b.prototype.showLoadingMore=function(a,b){return b.pagination&&b.pagination.more},b.prototype.createLoadingMore=function(){var b=a('<li class="select2-results__option select2-results__option--load-more"role="treeitem" aria-disabled="true"></li>'),c=this.options.get("translations").get("loadingMore");return b.html(c(this.lastParams)),b},b}),b.define("select2/dropdown/attachBody",["jquery","../utils"],function(a,b){function c(b,c,d){this.$dropdownParent=d.get("dropdownParent")||a(document.body),b.call(this,c,d)}return c.prototype.bind=function(a,b,c){var d=this,e=!1;a.call(this,b,c),b.on("open",function(){d._showDropdown(),d._attachPositioningHandler(b),e||(e=!0,b.on("results:all",function(){d._positionDropdown(),d._resizeDropdown()}),b.on("results:append",function(){d._positionDropdown(),d._resizeDropdown()}))}),b.on("close",function(){d._hideDropdown(),d._detachPositioningHandler(b)}),this.$dropdownContainer.on("mousedown",function(a){a.stopPropagation()})},c.prototype.destroy=function(a){a.call(this),this.$dropdownContainer.remove()},c.prototype.position=function(a,b,c){b.attr("class",c.attr("class")),b.removeClass("select2"),b.addClass("select2-container--open"),b.css({position:"absolute",top:-999999}),this.$container=c},c.prototype.render=function(b){var c=a("<span></span>"),d=b.call(this);return c.append(d),this.$dropdownContainer=c,c},c.prototype._hideDropdown=function(a){this.$dropdownContainer.detach()},c.prototype._attachPositioningHandler=function(c,d){var e=this,f="scroll.select2."+d.id,g="resize.select2."+d.id,h="orientationchange.select2."+d.id,i=this.$container.parents().filter(b.hasScroll);i.each(function(){a(this).data("select2-scroll-position",{x:a(this).scrollLeft(),y:a(this).scrollTop()})}),i.on(f,function(b){var c=a(this).data("select2-scroll-position");a(this).scrollTop(c.y)}),a(window).on(f+" "+g+" "+h,function(a){e._positionDropdown(),e._resizeDropdown()})},c.prototype._detachPositioningHandler=function(c,d){var e="scroll.select2."+d.id,f="resize.select2."+d.id,g="orientationchange.select2."+d.id,h=this.$container.parents().filter(b.hasScroll);h.off(e),a(window).off(e+" "+f+" "+g)},c.prototype._positionDropdown=function(){var b=a(window),c=this.$dropdown.hasClass("select2-dropdown--above"),d=this.$dropdown.hasClass("select2-dropdown--below"),e=null,f=this.$container.offset();f.bottom=f.top+this.$container.outerHeight(!1);var g={height:this.$container.outerHeight(!1)};g.top=f.top,g.bottom=f.top+g.height;var h={height:this.$dropdown.outerHeight(!1)},i={top:b.scrollTop(),bottom:b.scrollTop()+b.height()},j=i.top<f.top-h.height,k=i.bottom>f.bottom+h.height,l={left:f.left,top:g.bottom},m=this.$dropdownParent;"static"===m.css("position")&&(m=m.offsetParent());var n=m.offset();l.top-=n.top,l.left-=n.left,c||d||(e="below"),k||!j||c?!j&&k&&c&&(e="below"):e="above",("above"==e||c&&"below"!==e)&&(l.top=g.top-n.top-h.height),null!=e&&(this.$dropdown.removeClass("select2-dropdown--below select2-dropdown--above").addClass("select2-dropdown--"+e),this.$container.removeClass("select2-container--below select2-container--above").addClass("select2-container--"+e)),this.$dropdownContainer.css(l)},c.prototype._resizeDropdown=function(){var a={width:this.$container.outerWidth(!1)+"px"};this.options.get("dropdownAutoWidth")&&(a.minWidth=a.width,a.position="relative",a.width="auto"),this.$dropdown.css(a)},c.prototype._showDropdown=function(a){this.$dropdownContainer.appendTo(this.$dropdownParent),this._positionDropdown(),this._resizeDropdown()},c}),b.define("select2/dropdown/minimumResultsForSearch",[],function(){function a(b){for(var c=0,d=0;d<b.length;d++){var e=b[d];e.children?c+=a(e.children):c++}return c}function b(a,b,c,d){this.minimumResultsForSearch=c.get("minimumResultsForSearch"),this.minimumResultsForSearch<0&&(this.minimumResultsForSearch=1/0),a.call(this,b,c,d)}return b.prototype.showSearch=function(b,c){return a(c.data.results)<this.minimumResultsForSearch?!1:b.call(this,c)},b}),b.define("select2/dropdown/selectOnClose",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("close",function(a){d._handleSelectOnClose(a)})},a.prototype._handleSelectOnClose=function(a,b){if(b&&null!=b.originalSelect2Event){var c=b.originalSelect2Event;if("select"===c._type||"unselect"===c._type)return}var d=this.getHighlightedResults();if(!(d.length<1)){var e=d.data("data");null!=e.element&&e.element.selected||null==e.element&&e.selected||this.trigger("select",{data:e})}},a}),b.define("select2/dropdown/closeOnSelect",[],function(){function a(){}return a.prototype.bind=function(a,b,c){var d=this;a.call(this,b,c),b.on("select",function(a){d._selectTriggered(a)}),b.on("unselect",function(a){d._selectTriggered(a)})},a.prototype._selectTriggered=function(a,b){var c=b.originalEvent;c&&c.ctrlKey||this.trigger("close",{originalEvent:c,originalSelect2Event:b})},a}),b.define("select2/i18n/en",[],function(){return{errorLoading:function(){return"The results could not be loaded."},inputTooLong:function(a){var b=a.input.length-a.maximum,c="Please delete "+b+" character";return 1!=b&&(c+="s"),c},inputTooShort:function(a){var b=a.minimum-a.input.length,c="Please enter "+b+" or more characters";return c},loadingMore:function(){return"Loading more results…"},maximumSelected:function(a){var b="You can only select "+a.maximum+" item";return 1!=a.maximum&&(b+="s"),b},noResults:function(){return"No results found"},searching:function(){return"Searching…"}}}),b.define("select2/defaults",["jquery","require","./results","./selection/single","./selection/multiple","./selection/placeholder","./selection/allowClear","./selection/search","./selection/eventRelay","./utils","./translation","./diacritics","./data/select","./data/array","./data/ajax","./data/tags","./data/tokenizer","./data/minimumInputLength","./data/maximumInputLength","./data/maximumSelectionLength","./dropdown","./dropdown/search","./dropdown/hidePlaceholder","./dropdown/infiniteScroll","./dropdown/attachBody","./dropdown/minimumResultsForSearch","./dropdown/selectOnClose","./dropdown/closeOnSelect","./i18n/en"],function(a,b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u,v,w,x,y,z,A,B,C){function D(){this.reset()}D.prototype.apply=function(l){if(l=a.extend(!0,{},this.defaults,l),null==l.dataAdapter){if(null!=l.ajax?l.dataAdapter=o:null!=l.data?l.dataAdapter=n:l.dataAdapter=m,l.minimumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,r)),l.maximumInputLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,s)),l.maximumSelectionLength>0&&(l.dataAdapter=j.Decorate(l.dataAdapter,t)),l.tags&&(l.dataAdapter=j.Decorate(l.dataAdapter,p)),(null!=l.tokenSeparators||null!=l.tokenizer)&&(l.dataAdapter=j.Decorate(l.dataAdapter,q)),null!=l.query){var C=b(l.amdBase+"compat/query");l.dataAdapter=j.Decorate(l.dataAdapter,C)}if(null!=l.initSelection){var D=b(l.amdBase+"compat/initSelection");l.dataAdapter=j.Decorate(l.dataAdapter,D)}}if(null==l.resultsAdapter&&(l.resultsAdapter=c,null!=l.ajax&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,x)),null!=l.placeholder&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,w)),l.selectOnClose&&(l.resultsAdapter=j.Decorate(l.resultsAdapter,A))),null==l.dropdownAdapter){if(l.multiple)l.dropdownAdapter=u;else{var E=j.Decorate(u,v);l.dropdownAdapter=E}if(0!==l.minimumResultsForSearch&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,z)),l.closeOnSelect&&(l.dropdownAdapter=j.Decorate(l.dropdownAdapter,B)),null!=l.dropdownCssClass||null!=l.dropdownCss||null!=l.adaptDropdownCssClass){var F=b(l.amdBase+"compat/dropdownCss");l.dropdownAdapter=j.Decorate(l.dropdownAdapter,F)}l.dropdownAdapter=j.Decorate(l.dropdownAdapter,y)}if(null==l.selectionAdapter){if(l.multiple?l.selectionAdapter=e:l.selectionAdapter=d,null!=l.placeholder&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,f)),l.allowClear&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,g)),l.multiple&&(l.selectionAdapter=j.Decorate(l.selectionAdapter,h)),null!=l.containerCssClass||null!=l.containerCss||null!=l.adaptContainerCssClass){var G=b(l.amdBase+"compat/containerCss");l.selectionAdapter=j.Decorate(l.selectionAdapter,G)}l.selectionAdapter=j.Decorate(l.selectionAdapter,i)}if("string"==typeof l.language)if(l.language.indexOf("-")>0){var H=l.language.split("-"),I=H[0];l.language=[l.language,I]}else l.language=[l.language];if(a.isArray(l.language)){var J=new k;l.language.push("en");for(var K=l.language,L=0;L<K.length;L++){var M=K[L],N={};try{N=k.loadPath(M)}catch(O){try{M=this.defaults.amdLanguageBase+M,N=k.loadPath(M)}catch(P){l.debug&&window.console&&console.warn&&console.warn('Select2: The language file for "'+M+'" could not be automatically loaded. A fallback will be used instead.');continue}}J.extend(N)}l.translations=J}else{var Q=k.loadPath(this.defaults.amdLanguageBase+"en"),R=new k(l.language);R.extend(Q),l.translations=R}return l},D.prototype.reset=function(){function b(a){function b(a){return l[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function c(d,e){if(""===a.trim(d.term))return e;if(e.children&&e.children.length>0){for(var f=a.extend(!0,{},e),g=e.children.length-1;g>=0;g--){var h=e.children[g],i=c(d,h);null==i&&f.children.splice(g,1)}return f.children.length>0?f:c(d,f)}var j=b(e.text).toUpperCase(),k=b(d.term).toUpperCase();return j.indexOf(k)>-1?e:null}this.defaults={amdBase:"./",amdLanguageBase:"./i18n/",closeOnSelect:!0,debug:!1,dropdownAutoWidth:!1,escapeMarkup:j.escapeMarkup,language:C,matcher:c,minimumInputLength:0,maximumInputLength:0,maximumSelectionLength:0,minimumResultsForSearch:0,selectOnClose:!1,sorter:function(a){return a},templateResult:function(a){return a.text},templateSelection:function(a){return a.text},theme:"default",width:"resolve"}},D.prototype.set=function(b,c){var d=a.camelCase(b),e={};e[d]=c;var f=j._convertData(e);a.extend(this.defaults,f)};var E=new D;return E}),b.define("select2/options",["require","jquery","./defaults","./utils"],function(a,b,c,d){function e(b,e){if(this.options=b,null!=e&&this.fromElement(e),this.options=c.apply(this.options),e&&e.is("input")){var f=a(this.get("amdBase")+"compat/inputData");this.options.dataAdapter=d.Decorate(this.options.dataAdapter,f)}}return e.prototype.fromElement=function(a){var c=["select2"];null==this.options.multiple&&(this.options.multiple=a.prop("multiple")),null==this.options.disabled&&(this.options.disabled=a.prop("disabled")),null==this.options.language&&(a.prop("lang")?this.options.language=a.prop("lang").toLowerCase():a.closest("[lang]").prop("lang")&&(this.options.language=a.closest("[lang]").prop("lang"))),null==this.options.dir&&(a.prop("dir")?this.options.dir=a.prop("dir"):a.closest("[dir]").prop("dir")?this.options.dir=a.closest("[dir]").prop("dir"):this.options.dir="ltr"),a.prop("disabled",this.options.disabled),a.prop("multiple",this.options.multiple),a.data("select2Tags")&&(this.options.debug&&window.console&&console.warn&&console.warn('Select2: The `data-select2-tags` attribute has been changed to use the `data-data` and `data-tags="true"` attributes and will be removed in future versions of Select2.'),a.data("data",a.data("select2Tags")),a.data("tags",!0)),a.data("ajaxUrl")&&(this.options.debug&&window.console&&console.warn&&console.warn("Select2: The `data-ajax-url` attribute has been changed to `data-ajax--url` and support for the old attribute will be removed in future versions of Select2."),a.attr("ajax--url",a.data("ajaxUrl")),a.data("ajax--url",a.data("ajaxUrl")));var e={};e=b.fn.jquery&&"1."==b.fn.jquery.substr(0,2)&&a[0].dataset?b.extend(!0,{},a[0].dataset,a.data()):a.data();var f=b.extend(!0,{},e);f=d._convertData(f);for(var g in f)b.inArray(g,c)>-1||(b.isPlainObject(this.options[g])?b.extend(this.options[g],f[g]):this.options[g]=f[g]);return this},e.prototype.get=function(a){return this.options[a]},e.prototype.set=function(a,b){this.options[a]=b},e}),b.define("select2/core",["jquery","./options","./utils","./keys"],function(a,b,c,d){var e=function(a,c){null!=a.data("select2")&&a.data("select2").destroy(),this.$element=a,this.id=this._generateId(a),c=c||{},this.options=new b(c,a),e.__super__.constructor.call(this);var d=a.attr("tabindex")||0;a.data("old-tabindex",d),a.attr("tabindex","-1");var f=this.options.get("dataAdapter");this.dataAdapter=new f(a,this.options);var g=this.render();this._placeContainer(g);var h=this.options.get("selectionAdapter");this.selection=new h(a,this.options),this.$selection=this.selection.render(),this.selection.position(this.$selection,g);var i=this.options.get("dropdownAdapter");this.dropdown=new i(a,this.options),this.$dropdown=this.dropdown.render(),this.dropdown.position(this.$dropdown,g);var j=this.options.get("resultsAdapter");this.results=new j(a,this.options,this.dataAdapter),this.$results=this.results.render(),this.results.position(this.$results,this.$dropdown);var k=this;this._bindAdapters(),this._registerDomEvents(),this._registerDataEvents(),this._registerSelectionEvents(),this._registerDropdownEvents(),this._registerResultsEvents(),this._registerEvents(),this.dataAdapter.current(function(a){k.trigger("selection:update",{data:a})}),a.addClass("select2-hidden-accessible"),a.attr("aria-hidden","true"),this._syncAttributes(),a.data("select2",this)};return c.Extend(e,c.Observable),e.prototype._generateId=function(a){var b="";return b=null!=a.attr("id")?a.attr("id"):null!=a.attr("name")?a.attr("name")+"-"+c.generateChars(2):c.generateChars(4),b=b.replace(/(:|\.|\[|\]|,)/g,""),b="select2-"+b},e.prototype._placeContainer=function(a){a.insertAfter(this.$element);var b=this._resolveWidth(this.$element,this.options.get("width"));null!=b&&a.css("width",b)},e.prototype._resolveWidth=function(a,b){var c=/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i;if("resolve"==b){var d=this._resolveWidth(a,"style");return null!=d?d:this._resolveWidth(a,"element")}if("element"==b){var e=a.outerWidth(!1);return 0>=e?"auto":e+"px"}if("style"==b){var f=a.attr("style");if("string"!=typeof f)return null;for(var g=f.split(";"),h=0,i=g.length;i>h;h+=1){var j=g[h].replace(/\s/g,""),k=j.match(c);if(null!==k&&k.length>=1)return k[1]}return null}return b},e.prototype._bindAdapters=function(){this.dataAdapter.bind(this,this.$container),this.selection.bind(this,this.$container),this.dropdown.bind(this,this.$container),this.results.bind(this,this.$container)},e.prototype._registerDomEvents=function(){var b=this;this.$element.on("change.select2",function(){b.dataAdapter.current(function(a){b.trigger("selection:update",{data:a})})}),this.$element.on("focus.select2",function(a){b.trigger("focus",a)}),this._syncA=c.bind(this._syncAttributes,this),this._syncS=c.bind(this._syncSubtree,this),this.$element[0].attachEvent&&this.$element[0].attachEvent("onpropertychange",this._syncA);var d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver;null!=d?(this._observer=new d(function(c){a.each(c,b._syncA),a.each(c,b._syncS)}),this._observer.observe(this.$element[0],{attributes:!0,childList:!0,subtree:!1})):this.$element[0].addEventListener&&(this.$element[0].addEventListener("DOMAttrModified",b._syncA,!1),this.$element[0].addEventListener("DOMNodeInserted",b._syncS,!1),this.$element[0].addEventListener("DOMNodeRemoved",b._syncS,!1))},e.prototype._registerDataEvents=function(){var a=this;this.dataAdapter.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerSelectionEvents=function(){var b=this,c=["toggle","focus"];this.selection.on("toggle",function(){b.toggleDropdown()}),this.selection.on("focus",function(a){b.focus(a)}),this.selection.on("*",function(d,e){-1===a.inArray(d,c)&&b.trigger(d,e)})},e.prototype._registerDropdownEvents=function(){var a=this;this.dropdown.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerResultsEvents=function(){var a=this;this.results.on("*",function(b,c){a.trigger(b,c)})},e.prototype._registerEvents=function(){var a=this;this.on("open",function(){a.$container.addClass("select2-container--open")}),this.on("close",function(){a.$container.removeClass("select2-container--open")}),this.on("enable",function(){a.$container.removeClass("select2-container--disabled")}),this.on("disable",function(){a.$container.addClass("select2-container--disabled")}),this.on("blur",function(){a.$container.removeClass("select2-container--focus")}),this.on("query",function(b){a.isOpen()||a.trigger("open",{}),this.dataAdapter.query(b,function(c){a.trigger("results:all",{data:c,query:b})})}),this.on("query:append",function(b){this.dataAdapter.query(b,function(c){a.trigger("results:append",{data:c,query:b})})}),this.on("keypress",function(b){var c=b.which;a.isOpen()?c===d.ESC||c===d.TAB||c===d.UP&&b.altKey?(a.close(),b.preventDefault()):c===d.ENTER?(a.trigger("results:select",{}),b.preventDefault()):c===d.SPACE&&b.ctrlKey?(a.trigger("results:toggle",{}),b.preventDefault()):c===d.UP?(a.trigger("results:previous",{}),b.preventDefault()):c===d.DOWN&&(a.trigger("results:next",{}),b.preventDefault()):(c===d.ENTER||c===d.SPACE||c===d.DOWN&&b.altKey)&&(a.open(),b.preventDefault())})},e.prototype._syncAttributes=function(){this.options.set("disabled",this.$element.prop("disabled")),this.options.get("disabled")?(this.isOpen()&&this.close(),this.trigger("disable",{})):this.trigger("enable",{})},e.prototype._syncSubtree=function(a,b){var c=!1,d=this;if(!a||!a.target||"OPTION"===a.target.nodeName||"OPTGROUP"===a.target.nodeName){if(b)if(b.addedNodes&&b.addedNodes.length>0)for(var e=0;e<b.addedNodes.length;e++){var f=b.addedNodes[e];f.selected&&(c=!0)}else b.removedNodes&&b.removedNodes.length>0&&(c=!0);else c=!0;c&&this.dataAdapter.current(function(a){d.trigger("selection:update",{data:a})})}},e.prototype.trigger=function(a,b){var c=e.__super__.trigger,d={open:"opening",close:"closing",select:"selecting",unselect:"unselecting"};if(void 0===b&&(b={}),a in d){var f=d[a],g={prevented:!1,name:a,args:b};if(c.call(this,f,g),g.prevented)return void(b.prevented=!0)}c.call(this,a,b)},e.prototype.toggleDropdown=function(){this.options.get("disabled")||(this.isOpen()?this.close():this.open())},e.prototype.open=function(){this.isOpen()||this.trigger("query",{})},e.prototype.close=function(){this.isOpen()&&this.trigger("close",{})},e.prototype.isOpen=function(){return this.$container.hasClass("select2-container--open")},e.prototype.hasFocus=function(){return this.$container.hasClass("select2-container--focus")},e.prototype.focus=function(a){this.hasFocus()||(this.$container.addClass("select2-container--focus"),this.trigger("focus",{}))},e.prototype.enable=function(a){this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("enable")` method has been deprecated and will be removed in later Select2 versions. Use $element.prop("disabled") instead.'),(null==a||0===a.length)&&(a=[!0]);var b=!a[0];this.$element.prop("disabled",b)},e.prototype.data=function(){this.options.get("debug")&&arguments.length>0&&window.console&&console.warn&&console.warn('Select2: Data can no longer be set using `select2("data")`. You should consider setting the value instead using `$element.val()`.');var a=[];return this.dataAdapter.current(function(b){a=b}),a},e.prototype.val=function(b){if(this.options.get("debug")&&window.console&&console.warn&&console.warn('Select2: The `select2("val")` method has been deprecated and will be removed in later Select2 versions. Use $element.val() instead.'),null==b||0===b.length)return this.$element.val();var c=b[0];a.isArray(c)&&(c=a.map(c,function(a){return a.toString()})),this.$element.val(c).trigger("change")},e.prototype.destroy=function(){this.$container.remove(),this.$element[0].detachEvent&&this.$element[0].detachEvent("onpropertychange",this._syncA),null!=this._observer?(this._observer.disconnect(),this._observer=null):this.$element[0].removeEventListener&&(this.$element[0].removeEventListener("DOMAttrModified",this._syncA,!1),this.$element[0].removeEventListener("DOMNodeInserted",this._syncS,!1),this.$element[0].removeEventListener("DOMNodeRemoved",this._syncS,!1)),this._syncA=null,this._syncS=null,this.$element.off(".select2"),this.$element.attr("tabindex",this.$element.data("old-tabindex")),this.$element.removeClass("select2-hidden-accessible"),this.$element.attr("aria-hidden","false"),this.$element.removeData("select2"),this.dataAdapter.destroy(),this.selection.destroy(),this.dropdown.destroy(),this.results.destroy(),this.dataAdapter=null,this.selection=null,this.dropdown=null,this.results=null; +},e.prototype.render=function(){var b=a('<span class="select2 select2-container"><span class="selection"></span><span class="dropdown-wrapper" aria-hidden="true"></span></span>');return b.attr("dir",this.options.get("dir")),this.$container=b,this.$container.addClass("select2-container--"+this.options.get("theme")),b.data("element",this.$element),b},e}),b.define("jquery-mousewheel",["jquery"],function(a){return a}),b.define("jquery.select2",["jquery","jquery-mousewheel","./select2/core","./select2/defaults"],function(a,b,c,d){if(null==a.fn.select2){var e=["open","close","destroy"];a.fn.select2=function(b){if(b=b||{},"object"==typeof b)return this.each(function(){var d=a.extend(!0,{},b);new c(a(this),d)}),this;if("string"==typeof b){var d,f=Array.prototype.slice.call(arguments,1);return this.each(function(){var c=a(this).data("select2");null==c&&window.console&&console.error&&console.error("The select2('"+b+"') method was called on an element that is not using Select2."),d=c[b].apply(c,f)}),a.inArray(b,e)>-1?this:d}throw new Error("Invalid arguments for Select2: "+b)}}return null==a.fn.select2.defaults&&(a.fn.select2.defaults=d),c}),{define:b.define,require:b.require}}(),c=b.require("jquery.select2");return a.fn.select2.amd=b,c});
\ No newline at end of file diff --git a/ishtar_common/static/select2/js/select2_locale_fr.js b/ishtar_common/static/select2/js/select2_locale_fr.js deleted file mode 100644 index d5485d6be..000000000 --- a/ishtar_common/static/select2/js/select2_locale_fr.js +++ /dev/null @@ -1,18 +0,0 @@ -/** - * Select2 French translation - */ -(function ($) { - "use strict"; - - $.fn.select2.locales['fr'] = { - formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; }, - formatNoMatches: function () { return "Aucun résultat trouvé"; }, - formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; }, - formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); }, - formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); }, - formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; }, - formatSearching: function () { return "Recherche en cours…"; } - }; - - $.extend($.fn.select2.defaults, $.fn.select2.locales['fr']); -})(jQuery); diff --git a/ishtar_common/templates/base.html b/ishtar_common/templates/base.html index 614a83595..b20cb1ccb 100644 --- a/ishtar_common/templates/base.html +++ b/ishtar_common/templates/base.html @@ -90,15 +90,18 @@ <li id='section-{{section.idx}}'{% if section.css %} class="{{section.css}}"{% endif %}> {{section.label}} <ul> - {% for menu_item in section.childs %}{%if menu_item.available%} - {% if menu_item.childs %}<li id='subsection-{{menu_item.idx}}'{% if menu_item.css %} class="{{menu_item.css}}"{% endif %}>{{menu_item.label}} + {% for menu_item in section.childs %}{%if menu_item.available%} + {% if menu_item.childs %}<li id='subsection-{{menu_item.idx}}'{% if menu_item.css %} class="{{menu_item.css}}"{% endif %}>{{menu_item.label}} <ul> - {% for menu_subitem in menu_item.childs %}{%if menu_subitem.available%} - <li id='{{menu_subitem.idx}}'{% ifequal menu_subitem.idx CURRENT_ACTION %} class='selected'{% endifequal %}><a href='{% url "action" menu_subitem.idx%}'>{{menu_subitem.label}}</a></li> + {% for menu_subitem in menu_item.childs %}{% if menu_subitem.available %} + {% url 'action' menu_subitem.idx as item_url %} + <li id='{{menu_subitem.idx}}'{% if item_url in CURRENT_PATH %} class='selected'{% endif %}><a + href='{{item_url}}'>{{menu_subitem.label}}</a></li> {%endif%}{% endfor %}</ul></li> - {%else%} + {% else %} + {% url 'action' menu_item.idx as item_url %} <li id='{{menu_item.idx}}' - class="{% ifequal menu_item.idx CURRENT_ACTION %}selected{% endifequal %} {% if menu_item.css %}{{menu_item.css}}{% endif %}"><a href="{% url 'action' menu_item.idx%}">{{menu_item.label}}</a></li> + class="{% if item_url in CURRENT_PATH %}selected{% endif %} {% if menu_item.css %}{{menu_item.css}}{% endif %}"><a href="{{item_url}}">{{menu_item.label}}</a></li> {%endif%}{% endif %}{% endfor %} </ul> </li>{%endif%} diff --git a/ishtar_common/templates/ishtar/blocks/advanced_shortcut_menu.html b/ishtar_common/templates/ishtar/blocks/advanced_shortcut_menu.html index 1758bcf54..5cea8b5a7 100644 --- a/ishtar_common/templates/ishtar/blocks/advanced_shortcut_menu.html +++ b/ishtar_common/templates/ishtar/blocks/advanced_shortcut_menu.html @@ -42,5 +42,9 @@ </table> </fieldset> </form> -<script type='text/javascript'>var advanced_menu = true;</script> +<script type='text/javascript'> +var advanced_menu = true; +{% if SHORTCUT_SHOW == 'off' %}var shortcut_menu_hide = true; +{% else %}var shortcut_menu_hide = false;{% endif %} +</script> {% endif %} diff --git a/ishtar_common/templates/ishtar/blocks/shortcut_menu.html b/ishtar_common/templates/ishtar/blocks/shortcut_menu.html index 5973eba3f..c03cb3806 100644 --- a/ishtar_common/templates/ishtar/blocks/shortcut_menu.html +++ b/ishtar_common/templates/ishtar/blocks/shortcut_menu.html @@ -38,5 +38,8 @@ </div> </fieldset> </form> -<script type='text/javascript'>var advanced_menu = false;</script> +<script type='text/javascript'>var advanced_menu = false; +{% if SHORTCUT_SHOW == 'off' %}var shortcut_menu_hide = true; +{% else %}var shortcut_menu_hide = false;{% endif %} +</script> {% endif %} diff --git a/ishtar_common/templates/ishtar/blocks/window_tables/dynamic_documents.html b/ishtar_common/templates/ishtar/blocks/window_tables/dynamic_documents.html index f751cebe3..891cd0f6f 100644 --- a/ishtar_common/templates/ishtar/blocks/window_tables/dynamic_documents.html +++ b/ishtar_common/templates/ishtar/blocks/window_tables/dynamic_documents.html @@ -41,7 +41,7 @@ setTimeout( alert("{% trans "An error as occured during search. Check your query fields." %}"); } }); - {% if large %}jQuery("#grid_{{name}}").jqGrid('setGridHeight', 400);{% endif %} + {% if large %}jQuery("#grid_{{name}}").jqGrid('setGridHeight', 272);{% endif %} }, 200); </script> diff --git a/ishtar_common/templates/ishtar/dashboards/dashboard_main.html b/ishtar_common/templates/ishtar/dashboards/dashboard_main.html index 93e11d604..6a5a67a63 100644 --- a/ishtar_common/templates/ishtar/dashboards/dashboard_main.html +++ b/ishtar_common/templates/ishtar/dashboards/dashboard_main.html @@ -15,7 +15,16 @@ {% endblock %} {% block content %} <script> -$(function() { $( "#dash-tabs" ).tabs(); }); +$(function() { + $( "#dash-tabs" ).tabs({ + beforeActivate: function( event, ui ) { + $("#progress").show(); + }, + load: function( event, ui ) { + $("#progress").hide(); + } + }); +}); </script> <div id='dashboard'> <div id="dash-tabs"> diff --git a/ishtar_common/templatetags/window_tables.py b/ishtar_common/templatetags/window_tables.py index 960bc7184..bf4dd2b1a 100644 --- a/ishtar_common/templatetags/window_tables.py +++ b/ishtar_common/templatetags/window_tables.py @@ -71,7 +71,7 @@ ASSOCIATED_MODELS['containers'] = ( @register.simple_tag(takes_context=True) def dynamic_table_document( context, caption, associated_model, key, value, - table_cols='TABLE_COLS', output='html', large=False, + table_cols='TABLE_COLS', output='html', large=True, col_prefix=''): if not table_cols: table_cols = 'TABLE_COLS' @@ -135,9 +135,9 @@ def dynamic_table_document( @register.simple_tag(takes_context=True) -def dynamic_table_document_large( +def dynamic_table_document_small( context, caption, associated_model, key, value, table_cols='TABLE_COLS', output='html'): return dynamic_table_document( context, caption, associated_model, key, - value, table_cols, output, large=True) + value, table_cols, output, large=False) diff --git a/ishtar_common/urls.py b/ishtar_common/urls.py index 98bd55106..5abec4215 100644 --- a/ishtar_common/urls.py +++ b/ishtar_common/urls.py @@ -206,6 +206,10 @@ urlpatterns += patterns( name='activate-advanced-menu'), url(r'activate-simple-menu/$', 'activate_simple_shortcut_menu', name='activate-simple-menu'), + url(r'hide-shortcut-menu/$', 'hide_shortcut_menu', + name='hide-shortcut-menu'), + url(r'show-shortcut-menu/$', 'show_shortcut_menu', + name='show-shortcut-menu'), url(r'(?P<action_slug>' + actions + r')/$', 'action', name='action'), ) diff --git a/ishtar_common/views.py b/ishtar_common/views.py index 22591164f..e8a2c9e12 100644 --- a/ishtar_common/views.py +++ b/ishtar_common/views.py @@ -208,6 +208,16 @@ def get_autocomplete_generic(model, extra={'available': True}): return func +def hide_shortcut_menu(request): + request.session['SHORTCUT_SHOW'] = 'off' + return HttpResponse('OK', mimetype='text/plain') + + +def show_shortcut_menu(request): + request.session['SHORTCUT_SHOW'] = 'on' + return HttpResponse('OK', mimetype='text/plain') + + def activate_all_search(request): request.session['SHORTCUT_SEARCH'] = 'all' return HttpResponse('OK', mimetype='text/plain') @@ -249,9 +259,13 @@ def shortcut_menu(request): CURRENT_ITEMS.append((_(u"Treatment"), Treatment)) if hasattr(request.user, 'ishtaruser') and \ request.user.ishtaruser.advanced_shortcut_menu: - dct = {'current_menu': [], 'menu': [], - 'SHORTCUT_SEARCH': request.session['SHORTCUT_SEARCH'] - if 'SHORTCUT_SEARCH' in request.session else 'own'} + dct = { + 'current_menu': [], 'menu': [], + 'SHORTCUT_SEARCH': request.session['SHORTCUT_SEARCH'] + if 'SHORTCUT_SEARCH' in request.session else 'own', + 'SHORTCUT_SHOW': request.session['SHORTCUT_SHOW'] + if 'SHORTCUT_SHOW' in request.session else 'on' + } for lbl, model in CURRENT_ITEMS: model_name = model.SLUG @@ -267,7 +281,11 @@ def shortcut_menu(request): return render_to_response( 'ishtar/blocks/advanced_shortcut_menu.html', dct, context_instance=RequestContext(request)) - dct = {'current_menu': []} + dct = { + 'current_menu': [], + 'SHORTCUT_SHOW': request.session['SHORTCUT_SHOW'] + if 'SHORTCUT_SHOW' in request.session else 'off' + } current_selected_item = {} for lbl, model in CURRENT_ITEMS: new_selected_item = None @@ -427,14 +445,13 @@ def autocomplete_person_permissive(request, person_types=None, def autocomplete_person(request, person_types=None, attached_to=None, is_ishtar_user=None, permissive=False): - if not request.user.has_perm('ishtar_common.view_person', - models.Person) and \ - not request.user.has_perm('ishtar_common.view_own_person', - models.Person) \ - and not request.user.ishtaruser.has_right('person_search', - session=request.session): - return HttpResponse(mimetype='text/plain') - if not request.GET.get('term'): + all_items = request.user.has_perm('ishtar_common.view_person', + models.Person) + own_items = False + if not all_items: + own_items = request.user.has_perm('ishtar_common.view_own_person', + models.Person) + if not all_items and not own_items or not request.GET.get('term'): return HttpResponse(mimetype='text/plain') q = request.GET.get('term') limit = request.GET.get('limit', 20) @@ -461,6 +478,8 @@ def autocomplete_person(request, person_types=None, attached_to=None, pass if is_ishtar_user: query = query & Q(ishtaruser__isnull=False) + if own_items: + query &= models.Person.get_query_owns(request.user) persons = models.Person.objects.filter(query)[:limit] data = json.dumps([{'id': person.pk, 'value': unicode(person)} for person in persons if person]) @@ -568,22 +587,33 @@ def get_item(model, func_name, default_name, extra_request_keys=[], # check rights own = True # more restrictive by default allowed = False - if request.user.is_authenticated() and \ - request.user.ishtaruser.has_right('administrator', - session=request.session): + if specific_perms: + available_perms = specific_perms[:] + else: + available_perms = ['view_' + model.__name__.lower(), + 'view_own_' + model.__name__.lower()] + EMPTY = '' + if 'type' in dct: + data_type = dct.pop('type') + if not data_type: + EMPTY = '[]' + data_type = 'json' + if not request.user.is_authenticated(): + return HttpResponse(EMPTY, mimetype='text/plain') + + if request.user.ishtaruser.has_right('administrator', + session=request.session): allowed = True own = False else: for perm, lbl in model._meta.permissions: - # if not specific any perm is relevant (read right) - if specific_perms and perm not in specific_perms: + if perm not in available_perms: continue cperm = model._meta.app_label + '.' + perm - if request.user.has_perm(cperm)\ + if request.user.has_perm(cperm) \ or cperm in request.user.get_all_permissions() \ - or (request.user.is_authenticated() - and request.user.ishtaruser.has_right( - perm, session=request.session)): + or request.user.ishtaruser.has_right( + perm, session=request.session): allowed = True if "_own_" not in perm: own = False @@ -593,12 +623,6 @@ def get_item(model, func_name, default_name, extra_request_keys=[], if full == 'shortcut' and 'SHORTCUT_SEARCH' in request.session and \ request.session['SHORTCUT_SEARCH'] == 'own': own = True - EMPTY = '' - if 'type' in dct: - data_type = dct.pop('type') - if not data_type: - EMPTY = '[]' - data_type = 'json' if not allowed: return HttpResponse(EMPTY, mimetype='text/plain') @@ -880,7 +904,6 @@ def get_item(model, func_name, default_name, extra_request_keys=[], table_cols += model.EXTRA_FULL_FIELDS else: table_cols = model.TABLE_COLS - query_table_cols = [] for cols in table_cols: if type(cols) not in (list, tuple): @@ -898,6 +921,7 @@ def get_item(model, func_name, default_name, extra_request_keys=[], model.CONTEXTUAL_TABLE_COLS[contxt][col] if full == 'shortcut': query_table_cols = ['cached_label'] + table_cols = ['cached_label'] # manage sort tables manual_sort_key = None @@ -1085,7 +1109,7 @@ def get_item(model, func_name, default_name, extra_request_keys=[], if hasattr(model, 'COL_LINK') and k in model.COL_LINK: value = link_ext_template.format(value, value) res[k] = value - if full == 'shortcut': + if full == 'shortcut' and 'cached_label' in res: res['value'] = res.pop('cached_label') rows.append(res) if full == 'shortcut': @@ -1427,6 +1451,9 @@ def dashboard_main(request, dct, obj_id=None, *args, **kwargs): app_list.append((_(u"Context records"), 'contextrecords')) if profile.find: app_list.append((_(u"Finds"), 'finds')) + if profile.warehouse: + app_list.append((_(u"Treatment requests"), 'treatmentfiles')) + app_list.append((_(u"Treatments"), 'treatments')) dct = {'app_list': app_list} return render_to_response('ishtar/dashboards/dashboard_main.html', dct, context_instance=RequestContext(request)) @@ -1473,18 +1500,27 @@ def dashboard_main_detail(request, item_name): if item_name == 'files' and profile.files: lbl, dashboard = (_(u"Archaeological files"), models.Dashboard(File, **dashboard_kwargs)) - if item_name == 'operations': + elif item_name == 'operations': from archaeological_operations.models import Operation lbl, dashboard = (_(u"Operations"), models.Dashboard(Operation, **dashboard_kwargs)) - if item_name == 'contextrecords' and profile.context_record: + elif item_name == 'contextrecords' and profile.context_record: lbl, dashboard = ( _(u"Context records"), models.Dashboard(ContextRecord, slice=slicing, fltr=fltr)) - if item_name == 'finds' and profile.find: + elif item_name == 'finds' and profile.find: lbl, dashboard = (_(u"Finds"), models.Dashboard(Find, slice=slicing, fltr=fltr)) + elif item_name == 'treatmentfiles' and profile.warehouse: + lbl, dashboard = ( + _(u"Treatment requests"), + models.Dashboard(TreatmentFile, slice=slicing, fltr=fltr)) + elif item_name == 'treatments' and profile.warehouse: + lbl, dashboard = ( + _(u"Treatments"), + models.Dashboard(Treatment, slice=slicing, fltr=fltr, + date_source='start')) if not lbl: raise Http404 dct = {'lbl': lbl, 'dashboard': dashboard, diff --git a/ishtar_common/widgets.py b/ishtar_common/widgets.py index 3fbf24f29..94709406c 100644 --- a/ishtar_common/widgets.py +++ b/ishtar_common/widgets.py @@ -1,6 +1,6 @@ #!/usr/bin/env python # -*- coding: utf-8 -*- -# Copyright (C) 2010-2016 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> +# Copyright (C) 2010-2017 Étienne Loks <etienne.loks_AT_peacefrogsDOTnet> # Copyright (C) 2007 skam <massimo dot scamarcia at gmail.com> # (http://djangosnippets.org/snippets/233/) @@ -45,21 +45,89 @@ reverse_lazy = lazy(reverse, unicode) class Select2Multiple(forms.SelectMultiple): - class Media: + def __init__(self, attrs=None, choices=(), remote=None, model=None, + available=None): + super(Select2Multiple, self).__init__(attrs, choices) + self.remote = remote + self.available = available + self.model = model + + @property + def media(self): + media = super(Select2Multiple, self).media css = { 'all': ('select2/css/select2.css',) } - js = ('select2/js/select2.min.js', - 'select2/js/init.js') + js = ['select2/js/select2.min.js'] + for lang_code, lang in settings.LANGUAGES: + js.append('select2/js/i18n/{}.js'.format(lang_code)) + media.add_css(css) + media.add_js(js) + return media + + def get_q(self): + q = self.model.objects + if self.available: + q = q.filter(available=True) + return q + + def get_choices(self): + for i in self.get_q().all(): + yield (i.pk, unicode(i)) def render(self, name, value, attrs=None, choices=()): + self.remote = unicode(self.remote) + if self.remote in ('None', 'false'): + # test on lazy object is buggy... so we have this ugly test + self.remote = None + if not choices and not self.remote and self.model: + choices = self.get_choices() klass = attrs and attrs.get('class') or '' klass += ' ' if klass else '' + 'js-select2' if not attrs: attrs = {} attrs['class'] = klass - return super(Select2Multiple, self).render(name, value, attrs, + attrs['style'] = "width: 370px" + options = "" + if self.remote: + options = """{ + ajax: { + url: '%s', + delay: 250, + dataType: 'json', + minimumInputLength: 2, + processResults: function (data) { + if(!data) return {results: []}; + var result = $.map(data, function (item) { + return { + text: item['value'], + id: item['id'] + } + }); + return { + results: result + } + } + } + }""" % self.remote + if value: + choices = [] + if type(value) not in (list, tuple): + value = value.split(',') + for v in value: + try: + choices.append((v, self.model.objects.get(pk=v))) + except (self.model.DoesNotExist, ValueError): + # an old reference ? it should not happen + pass + html = super(Select2Multiple, self).render(name, value, attrs, choices) + html += """<script type="text/javascript"> + $(document).ready(function() {{ + $("#id_{}").select2({}); + }});</script> + """.format(name, options) + return mark_safe(html) class CheckboxSelectMultiple(CheckboxSelectMultipleBase): @@ -77,49 +145,35 @@ class CheckboxSelectMultiple(CheckboxSelectMultipleBase): choices) -class MultipleAutocompleteField(forms.MultipleChoiceField): +class Select2MultipleField(forms.MultipleChoiceField): def __init__(self, *args, **kwargs): - self.model = None + remote = None + if 'remote' in kwargs: + remote = kwargs.pop('remote') + self.model, self.remote = None, None if 'model' in kwargs: self.model = kwargs.pop('model') - if 'choices' not in kwargs and self.model: - kwargs['choices'] = [] - new = kwargs.pop('new') if 'new' in kwargs else None - if 'widget' not in kwargs and self.model: - kwargs['widget'] = JQueryAutoComplete( - reverse_lazy('autocomplete-' + self.model.__name__.lower()), - associated_model=self.model, new=new, - multiple=True) - super(MultipleAutocompleteField, self).__init__(*args, **kwargs) - - def get_choices(self): - return [(i.pk, unicode(i)) for i in self.model.objects.all()] + if remote: + self.remote = reverse_lazy( + 'autocomplete-' + self.model.__name__.lower()) + self.available = False + if 'available' in kwargs: + self.available = kwargs.pop('available') + kwargs['widget'] = Select2Multiple(model=self.model, + available=self.available, + remote=self.remote) + super(Select2MultipleField, self).__init__(*args, **kwargs) + + def get_q(self): + q = self.model.objects + if self.available: + q = q.filter(available=True) + return q def valid_value(self, value): if not self.model: - return super(MultipleAutocompleteField, self).valid_value(value) - return bool(self.model.objects.filter(pk=value).count()) - - def clean(self, value): - if value: - # clean JS messup with values - try: - if type(value) not in (list, tuple): - value = [int(value)] - else: - val = value - value = [] - for v in val: - v = unicode(v).strip('[').strip(']')\ - .strip('u').strip("'").strip('"') - value += [int(va.strip()) - for va in list(set(v.split(','))) - if va.strip()] - except (TypeError, ValueError): - value = [] - else: - value = [] - return super(MultipleAutocompleteField, self).clean(value) + return super(Select2MultipleField, self).valid_value(value) + return bool(self.get_q().filter(pk=value).count()) class DeleteWidget(forms.CheckboxInput): diff --git a/ishtar_common/wizards.py b/ishtar_common/wizards.py index 7950bcc7e..8d787d733 100644 --- a/ishtar_common/wizards.py +++ b/ishtar_common/wizards.py @@ -51,10 +51,16 @@ class MultiValueDict(BaseMultiValueDict): v = v() if type(v) in (list, tuple) and len(v) > 1: v = ",".join(v) - else: + elif type(v) not in (int, unicode): v = super(MultiValueDict, self).get(*args, **kwargs) return v + def getlist(self, *args, **kwargs): + lst = super(MultiValueDict, self).getlist(*args, **kwargs) + if type(lst) not in (tuple, list): + lst = [lst] + return lst + def check_rights(rights=[], redirect_url='/'): """ @@ -408,6 +414,8 @@ class Wizard(NamedUrlWizardView): for form in form_list: if not form.is_valid(): return self.render(form) + if hasattr(form, 'readonly') and form.readonly: + continue base_form = hasattr(form, 'forms') and form.forms[0] or form associated_models = hasattr(base_form, 'associated_models') and \ base_form.associated_models or {} @@ -817,7 +825,7 @@ class Wizard(NamedUrlWizardView): # get a form key frm = form.form if callable(frm): - frm = frm() + frm = frm(self.get_form_kwargs(step)) total_field = 0 if hasattr(frm, 'count_valid_fields'): diff --git a/scripts/2017-03-29-missing-rights.py b/scripts/2017-03-29-missing-rights.py new file mode 100644 index 000000000..81a9b86ee --- /dev/null +++ b/scripts/2017-03-29-missing-rights.py @@ -0,0 +1,24 @@ +from django.contrib.auth.models import Group, Permission + +for group in Group.objects.all(): + if ':' not in group.name or u"rattaché" in group.name: + continue + permissions = [] + for perm in group.permissions.all(): + codenames = perm.codename.split('_') + own_codename = codenames[0] + "_own_" + '_'.join(codenames[1:]) + if Permission.objects.filter(codename=own_codename).count(): + permissions.append(Permission.objects.get(codename=own_codename)) + if not permissions: + print(u'No permission: ' + group.name) + continue + names = group.name.split(':') + if Group.objects.filter(name__startswith=names[0] + u"rattaché", + name__endswith=names[1]).count(): + print(u'Already here: ' + group.name) + continue + name = names[0] + u"rattachés " + u":" + names[1] + new_group = Group.objects.create(name=name) + for perm in permissions: + new_group.permissions.add(perm) + print(u'New: ' + group.name) diff --git a/translations/de/ishtar_common.po b/translations/de/ishtar_common.po index 93bce7079..fd9aed80b 100644 --- a/translations/de/ishtar_common.po +++ b/translations/de/ishtar_common.po @@ -151,40 +151,40 @@ msgstr "" msgid "\"%(value)s\" not in %(values)s" msgstr "" -#: forms.py:73 +#: forms.py:74 msgid "Enter a valid name consisting of letters, spaces and hyphens." msgstr "" -#: forms.py:89 forms_common.py:626 +#: forms.py:90 forms_common.py:626 msgid "Confirm" msgstr "" -#: forms.py:94 +#: forms.py:95 msgid "Are you sure you want to delete?" msgstr "" -#: forms.py:103 +#: forms.py:129 msgid "There are identical items." msgstr "" -#: forms.py:141 forms.py:142 +#: forms.py:176 forms.py:177 msgid "Closing date" msgstr "" -#: forms.py:155 +#: forms.py:190 msgid "You should select an item." msgstr "" -#: forms.py:156 +#: forms.py:191 msgid "Add a new item" msgstr "" -#: forms.py:262 models.py:1482 +#: forms.py:297 models.py:1501 msgid "Template" msgstr "" #: forms_common.py:41 forms_common.py:59 forms_common.py:184 -#: forms_common.py:408 models.py:1548 models.py:2989 +#: forms_common.py:408 models.py:1567 models.py:3030 #: templates/blocks/JQueryAdvancedTown.html:19 #: templates/ishtar/sheet_organization.html:13 msgid "Town" @@ -200,8 +200,8 @@ msgid "" "french town Saint-Denis in the Seine-Saint-Denis department.</p>" msgstr "" -#: forms_common.py:68 forms_common.py:863 ishtar_menu.py:47 models.py:2610 -#: models.py:2791 models.py:2856 templates/ishtar/sheet_person.html:4 +#: forms_common.py:68 forms_common.py:863 ishtar_menu.py:47 models.py:2630 +#: models.py:2823 models.py:2885 templates/ishtar/sheet_person.html:4 msgid "Person" msgstr "" @@ -212,64 +212,64 @@ msgid "" msgstr "" #: forms_common.py:172 forms_common.py:329 forms_common.py:453 -#: ishtar_menu.py:75 models.py:2493 models.py:2584 +#: ishtar_menu.py:75 models.py:2513 models.py:2604 #: templates/ishtar/sheet_organization.html:4 msgid "Organization" msgstr "" #: forms_common.py:175 forms_common.py:212 forms_common.py:324 -#: forms_common.py:378 forms_common.py:448 models.py:1103 models.py:1481 -#: models.py:1750 models.py:1766 models.py:2003 models.py:2279 models.py:2487 -#: models.py:2596 models.py:2975 templates/ishtar/import_list.html:13 +#: forms_common.py:378 forms_common.py:448 models.py:1109 models.py:1500 +#: models.py:1769 models.py:1785 models.py:2023 models.py:2301 models.py:2507 +#: models.py:2616 models.py:3016 templates/ishtar/import_list.html:13 #: templates/ishtar/sheet_organization.html:8 #: templates/ishtar/sheet_organization.html:21 msgid "Name" msgstr "Name" -#: forms_common.py:176 models.py:1703 models.py:2134 +#: forms_common.py:176 models.py:1722 models.py:2154 msgid "Organization type" msgstr "" -#: forms_common.py:178 forms_common.py:402 models.py:1543 +#: forms_common.py:178 forms_common.py:402 models.py:1562 #: templates/ishtar/sheet_organization.html:10 msgid "Address" msgstr "" -#: forms_common.py:180 forms_common.py:405 models.py:1544 +#: forms_common.py:180 forms_common.py:405 models.py:1563 #: templates/ishtar/sheet_organization.html:11 msgid "Address complement" msgstr "" -#: forms_common.py:182 forms_common.py:406 models.py:1546 +#: forms_common.py:182 forms_common.py:406 models.py:1565 #: templates/ishtar/sheet_organization.html:12 msgid "Postal code" msgstr "Postleitzahl" -#: forms_common.py:185 forms_common.py:409 models.py:1549 +#: forms_common.py:185 forms_common.py:409 models.py:1568 msgid "Country" msgstr "" #: forms_common.py:187 forms_common.py:326 forms_common.py:382 -#: forms_common.py:450 forms_common.py:574 models.py:1576 +#: forms_common.py:450 forms_common.py:574 models.py:1595 msgid "Email" msgstr "E-Mail-Adresse" -#: forms_common.py:188 forms_common.py:385 models.py:1561 +#: forms_common.py:188 forms_common.py:385 models.py:1580 #: templates/ishtar/sheet_organization.html:14 #: templates/ishtar/sheet_person.html:21 #: templates/ishtar/wizard/wizard_person.html:17 msgid "Phone" msgstr "" -#: forms_common.py:189 forms_common.py:394 models.py:1573 +#: forms_common.py:189 forms_common.py:394 models.py:1592 #: templates/ishtar/sheet_organization.html:15 #: templates/ishtar/sheet_person.html:39 #: templates/ishtar/wizard/wizard_person.html:35 msgid "Mobile phone" msgstr "" -#: forms_common.py:213 forms_common.py:327 forms_common.py:451 models.py:2170 -#: models.py:2489 models.py:2910 templates/sheet_ope.html:85 +#: forms_common.py:213 forms_common.py:327 forms_common.py:451 models.py:2192 +#: models.py:2509 models.py:2951 templates/sheet_ope.html:85 #: templates/sheet_ope.html.py:105 templates/sheet_ope.html:126 #: templates/ishtar/import_list.html:14 #: templates/ishtar/sheet_organization.html:23 @@ -293,7 +293,7 @@ msgstr "" msgid "Organization to merge" msgstr "" -#: forms_common.py:325 forms_common.py:376 forms_common.py:449 models.py:2594 +#: forms_common.py:325 forms_common.py:376 forms_common.py:449 models.py:2614 #: templates/ishtar/sheet_organization.html:22 msgid "Surname" msgstr "" @@ -311,25 +311,25 @@ msgstr "" msgid "Identity" msgstr "" -#: forms_common.py:373 forms_common.py:781 forms_common.py:830 models.py:2135 -#: models.py:2588 models.py:2590 models.py:2907 templates/sheet_ope.html:104 +#: forms_common.py:373 forms_common.py:781 forms_common.py:830 models.py:2155 +#: models.py:2608 models.py:2610 models.py:2948 templates/sheet_ope.html:104 #: templates/ishtar/blocks/window_tables/documents.html:7 msgid "Title" msgstr "" -#: forms_common.py:374 models.py:2592 +#: forms_common.py:374 models.py:2612 msgid "Salutation" msgstr "" -#: forms_common.py:380 models.py:2598 +#: forms_common.py:380 models.py:2618 msgid "Raw name" msgstr "" -#: forms_common.py:383 models.py:1562 +#: forms_common.py:383 models.py:1581 msgid "Phone description" msgstr "" -#: forms_common.py:386 models.py:1564 models.py:1566 +#: forms_common.py:386 models.py:1583 models.py:1585 msgid "Phone description 2" msgstr "" @@ -337,11 +337,11 @@ msgstr "" msgid "Phone 2" msgstr "" -#: forms_common.py:390 models.py:1570 +#: forms_common.py:390 models.py:1589 msgid "Phone description 3" msgstr "" -#: forms_common.py:392 models.py:1568 +#: forms_common.py:392 models.py:1587 msgid "Phone 3" msgstr "" @@ -349,23 +349,23 @@ msgstr "" msgid "Current organization" msgstr "" -#: forms_common.py:411 models.py:1551 +#: forms_common.py:411 models.py:1570 msgid "Other address: address" msgstr "" -#: forms_common.py:414 models.py:1554 +#: forms_common.py:414 models.py:1573 msgid "Other address: address complement" msgstr "" -#: forms_common.py:416 models.py:1555 +#: forms_common.py:416 models.py:1574 msgid "Other address: postal code" msgstr "" -#: forms_common.py:418 models.py:1557 +#: forms_common.py:418 models.py:1576 msgid "Other address: town" msgstr "" -#: forms_common.py:420 models.py:1559 +#: forms_common.py:420 models.py:1578 msgid "Other address: country" msgstr "" @@ -381,7 +381,7 @@ msgstr "Benutzername" msgid "Account search" msgstr "" -#: forms_common.py:512 forms_common.py:552 forms_common.py:556 models.py:2541 +#: forms_common.py:512 forms_common.py:552 forms_common.py:556 models.py:2561 msgid "Person type" msgstr "" @@ -389,7 +389,7 @@ msgstr "" msgid "Account" msgstr "" -#: forms_common.py:577 wizards.py:1339 +#: forms_common.py:577 wizards.py:1347 msgid "New password" msgstr "" @@ -413,7 +413,7 @@ msgstr "" msgid "Send the new password by email?" msgstr "" -#: forms_common.py:636 forms_common.py:649 models.py:2990 +#: forms_common.py:636 forms_common.py:649 models.py:3031 msgid "Towns" msgstr "" @@ -429,7 +429,7 @@ msgstr "" msgid "Documentation informations" msgstr "" -#: forms_common.py:783 forms_common.py:831 models.py:2136 models.py:2882 +#: forms_common.py:783 forms_common.py:831 models.py:2156 models.py:2923 msgid "Source type" msgstr "" @@ -441,37 +441,37 @@ msgstr "" msgid "Internal reference" msgstr "" -#: forms_common.py:791 models.py:2921 +#: forms_common.py:791 models.py:2962 msgid "Numerical ressource (web address)" msgstr "" -#: forms_common.py:792 models.py:2923 +#: forms_common.py:792 models.py:2964 msgid "Receipt date" msgstr "" -#: forms_common.py:794 models.py:2304 models.py:2925 +#: forms_common.py:794 models.py:2327 models.py:2966 msgid "Creation date" msgstr "Gründungsdatum" -#: forms_common.py:797 models.py:2928 +#: forms_common.py:797 models.py:2969 msgid "Receipt date in documentation" msgstr "" -#: forms_common.py:799 forms_common.py:835 models.py:379 models.py:696 -#: models.py:2030 models.py:2602 models.py:2935 +#: forms_common.py:799 forms_common.py:835 models.py:381 models.py:698 +#: models.py:2050 models.py:2622 models.py:2976 msgid "Comment" msgstr "" -#: forms_common.py:801 forms_common.py:834 models.py:1105 models.py:1770 -#: models.py:1957 models.py:2004 models.py:2934 templates/sheet_ope.html:128 +#: forms_common.py:801 forms_common.py:834 models.py:1111 models.py:1789 +#: models.py:1977 models.py:2024 models.py:2975 templates/sheet_ope.html:128 msgid "Description" msgstr "Beschreibung" -#: forms_common.py:804 models.py:2936 +#: forms_common.py:804 models.py:2977 msgid "Additional information" msgstr "" -#: forms_common.py:806 forms_common.py:838 models.py:2938 +#: forms_common.py:806 forms_common.py:838 models.py:2979 msgid "Has a duplicate" msgstr "" @@ -486,7 +486,7 @@ msgid "" "p>" msgstr "" -#: forms_common.py:827 forms_common.py:856 forms_common.py:890 models.py:2861 +#: forms_common.py:827 forms_common.py:856 forms_common.py:890 models.py:2890 #: templates/ishtar/wizard/wizard_person_deletion.html:124 msgid "Author" msgstr "" @@ -499,7 +499,7 @@ msgstr "" msgid "Would you like to delete this documentation?" msgstr "" -#: forms_common.py:864 models.py:2137 models.py:2848 models.py:2858 +#: forms_common.py:864 models.py:2157 models.py:2877 models.py:2887 msgid "Author type" msgstr "" @@ -511,7 +511,7 @@ msgstr "" msgid "There are identical authors." msgstr "" -#: forms_common.py:901 models.py:2862 models.py:2917 +#: forms_common.py:901 models.py:2891 models.py:2958 #: templates/sheet_ope.html:106 #: templates/ishtar/blocks/window_tables/documents.html:9 msgid "Authors" @@ -529,7 +529,7 @@ msgstr "" msgid "Deletion" msgstr "" -#: ishtar_menu.py:39 models.py:1277 views.py:1608 +#: ishtar_menu.py:39 models.py:1283 views.py:1644 msgid "Global variables" msgstr "" @@ -557,19 +557,19 @@ msgstr "" msgid "Manual merge" msgstr "" -#: ishtar_menu.py:109 models.py:2315 +#: ishtar_menu.py:109 models.py:2335 msgid "Imports" msgstr "" -#: ishtar_menu.py:112 views.py:1616 +#: ishtar_menu.py:112 views.py:1652 msgid "New import" msgstr "" -#: ishtar_menu.py:116 views.py:1630 +#: ishtar_menu.py:116 views.py:1666 msgid "Current imports" msgstr "" -#: ishtar_menu.py:120 views.py:1669 +#: ishtar_menu.py:120 views.py:1705 msgid "Old imports" msgstr "" @@ -577,258 +577,258 @@ msgstr "" msgid "Not a valid item." msgstr "" -#: models.py:199 +#: models.py:201 msgid "A selected item is not a valid item." msgstr "" -#: models.py:210 +#: models.py:212 msgid "This item already exists." msgstr "" -#: models.py:375 models.py:695 models.py:1516 models.py:1528 models.py:1954 +#: models.py:377 models.py:697 models.py:1535 models.py:1547 models.py:1973 msgid "Label" msgstr "" -#: models.py:377 +#: models.py:379 msgid "Textual ID" msgstr "" -#: models.py:380 models.py:698 models.py:1485 +#: models.py:382 models.py:700 models.py:1504 msgid "Available" msgstr "" -#: models.py:722 models.py:2076 +#: models.py:724 models.py:2096 msgid "Key" msgstr "" -#: models.py:728 +#: models.py:730 msgid "Specific key to an import" msgstr "" -#: models.py:820 +#: models.py:826 msgid "Last editor" msgstr "" -#: models.py:823 +#: models.py:829 msgid "Creator" msgstr "" -#: models.py:965 models.py:2846 models.py:3001 models.py:3057 +#: models.py:971 models.py:2874 models.py:3042 models.py:3098 msgid "Order" msgstr "" -#: models.py:966 +#: models.py:972 msgid "Symmetrical" msgstr "" -#: models.py:967 +#: models.py:973 msgid "Tiny label" msgstr "" -#: models.py:981 +#: models.py:987 msgid "Cannot have symmetrical and an inverse_relation" msgstr "" -#: models.py:1097 +#: models.py:1103 msgid "Euro" msgstr "" -#: models.py:1098 +#: models.py:1104 msgid "US dollar" msgstr "" -#: models.py:1104 models.py:1768 +#: models.py:1110 models.py:1787 msgid "Slug" msgstr "" -#: models.py:1107 +#: models.py:1113 msgid "CSS color code for base module" msgstr "" -#: models.py:1109 +#: models.py:1115 msgid "Files module" msgstr "" -#: models.py:1111 +#: models.py:1117 msgid "CSS color code for files module" msgstr "" -#: models.py:1113 +#: models.py:1119 msgid "Context records module" msgstr "" -#: models.py:1116 +#: models.py:1122 msgid "CSS color code for context record module" msgstr "" -#: models.py:1118 +#: models.py:1124 msgid "Finds module" msgstr "" -#: models.py:1119 +#: models.py:1125 msgid "Need context records module" msgstr "" -#: models.py:1121 +#: models.py:1127 msgid "CSS color code for find module" msgstr "" -#: models.py:1124 +#: models.py:1130 msgid "Warehouses module" msgstr "" -#: models.py:1125 +#: models.py:1131 msgid "Need finds module" msgstr "" -#: models.py:1127 +#: models.py:1133 msgid "CSS code for warehouse module" msgstr "" -#: models.py:1129 +#: models.py:1135 msgid "Mapping module" msgstr "" -#: models.py:1131 +#: models.py:1137 msgid "CSS code for mapping module" msgstr "" -#: models.py:1134 +#: models.py:1140 msgid "Home page" msgstr "" -#: models.py:1135 +#: models.py:1141 #, python-brace-format msgid "" "Homepage of Ishtar - if not defined a default homepage will appear. Use the " "markdown syntax. {random_image} can be used to display a random image." msgstr "" -#: models.py:1139 +#: models.py:1145 msgid "File external id" msgstr "" -#: models.py:1141 +#: models.py:1147 msgid "" "Formula to manage file external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " "be destructive." msgstr "" -#: models.py:1146 +#: models.py:1152 msgid "Parcel external id" msgstr "" -#: models.py:1149 +#: models.py:1155 msgid "" "Formula to manage parcel external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " "be destructive." msgstr "" -#: models.py:1154 +#: models.py:1160 msgid "Context record external id" msgstr "" -#: models.py:1156 +#: models.py:1162 msgid "" "Formula to manage context record external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " "data can be destructive." msgstr "" -#: models.py:1161 +#: models.py:1167 msgid "Base find external id" msgstr "" -#: models.py:1163 +#: models.py:1169 msgid "" "Formula to manage base find external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " "data can be destructive." msgstr "" -#: models.py:1168 +#: models.py:1174 msgid "Find external id" msgstr "" -#: models.py:1170 +#: models.py:1176 msgid "" "Formula to manage find external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " "be destructive." msgstr "" -#: models.py:1175 +#: models.py:1181 msgid "Container external id" msgstr "" -#: models.py:1177 +#: models.py:1183 msgid "" "Formula to manage container external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " "data can be destructive." msgstr "" -#: models.py:1182 +#: models.py:1188 msgid "Warehouse external id" msgstr "" -#: models.py:1184 +#: models.py:1190 msgid "" "Formula to manage warehouse external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " "data can be destructive." msgstr "" -#: models.py:1189 +#: models.py:1195 msgid "Raw name for person" msgstr "" -#: models.py:1191 +#: models.py:1197 msgid "" "Formula to manage person raw_name. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " "be destructive." msgstr "" -#: models.py:1195 +#: models.py:1201 msgid "Current active" msgstr "" -#: models.py:1196 +#: models.py:1202 msgid "Currency" msgstr "" -#: models.py:1200 +#: models.py:1206 msgid "Ishtar site profile" msgstr "" -#: models.py:1201 +#: models.py:1207 msgid "Ishtar site profiles" msgstr "" -#: models.py:1270 +#: models.py:1276 msgid "Variable name" msgstr "" -#: models.py:1271 +#: models.py:1277 msgid "Description of the variable" msgstr "" -#: models.py:1273 models.py:2077 +#: models.py:1279 models.py:2097 msgid "Value" msgstr "" -#: models.py:1276 +#: models.py:1282 msgid "Global variable" msgstr "" -#: models.py:1386 models.py:1416 +#: models.py:1405 models.py:1435 msgid "Total" msgstr "" -#: models.py:1393 models.py:1517 models.py:1529 +#: models.py:1412 models.py:1536 models.py:1548 #: templates/ishtar/sheet_person.html:24 #: templates/ishtar/dashboards/dashboard_main_detail.html:141 #: templates/ishtar/dashboards/dashboard_main_detail_users.html:26 @@ -836,643 +836,663 @@ msgstr "" msgid "Number" msgstr "" -#: models.py:1480 +#: models.py:1499 msgid "Administrative Act" msgstr "" -#: models.py:1484 +#: models.py:1503 msgid "Associated object" msgstr "" -#: models.py:1488 +#: models.py:1507 msgid "Document template" msgstr "" -#: models.py:1489 +#: models.py:1508 msgid "Document templates" msgstr "" -#: models.py:1520 models.py:1530 models.py:2299 +#: models.py:1539 models.py:1549 models.py:2321 msgid "State" msgstr "" -#: models.py:1534 templates/blocks/JQueryAdvancedTown.html:12 +#: models.py:1553 templates/blocks/JQueryAdvancedTown.html:12 msgid "Department" msgstr "" -#: models.py:1535 +#: models.py:1554 msgid "Departments" msgstr "" -#: models.py:1572 +#: models.py:1591 msgid "Raw phone" msgstr "" -#: models.py:1578 +#: models.py:1597 msgid "Alternative address is prefered" msgstr "" -#: models.py:1617 +#: models.py:1636 msgid "Tel: " msgstr "" -#: models.py:1621 +#: models.py:1640 msgid "Mobile: " msgstr "" -#: models.py:1625 +#: models.py:1644 msgid "Email: " msgstr "E-Mail-Adresse:" -#: models.py:1630 +#: models.py:1649 msgid "Merge key" msgstr "" -#: models.py:1704 +#: models.py:1723 msgid "Organization types" msgstr "" -#: models.py:1751 +#: models.py:1770 msgid "Class name" msgstr "" -#: models.py:1754 +#: models.py:1773 msgid "Importer - Model" msgstr "" -#: models.py:1755 +#: models.py:1774 msgid "Importer - Models" msgstr "" -#: models.py:1772 templates/ishtar/dashboards/dashboard_main.html:25 +#: models.py:1791 templates/ishtar/dashboards/dashboard_main.html:34 msgid "Users" msgstr "" -#: models.py:1775 +#: models.py:1794 msgid "Associated model" msgstr "" -#: models.py:1778 +#: models.py:1797 msgid "Models that can accept new items" msgstr "" -#: models.py:1779 +#: models.py:1798 msgid "Leave blank for no restrictions" msgstr "" -#: models.py:1781 +#: models.py:1800 msgid "Is template" msgstr "" -#: models.py:1782 +#: models.py:1801 msgid "Unicity keys (separator \";\")" msgstr "" -#: models.py:1786 +#: models.py:1805 msgid "Importer - Type" msgstr "" -#: models.py:1787 +#: models.py:1806 msgid "Importer - Types" msgstr "" -#: models.py:1886 +#: models.py:1905 msgid "Importer - Default" msgstr "" -#: models.py:1887 +#: models.py:1906 msgid "Importer - Defaults" msgstr "" -#: models.py:1922 +#: models.py:1941 msgid "Importer - Default value" msgstr "" -#: models.py:1923 +#: models.py:1942 msgid "Importer - Default values" msgstr "" -#: models.py:1956 +#: models.py:1976 msgid "Column number" msgstr "" -#: models.py:1959 +#: models.py:1979 msgid "Required" msgstr "" -#: models.py:1961 +#: models.py:1981 msgid "Export field name" msgstr "" -#: models.py:1962 +#: models.py:1982 msgid "" "Fill this field if the field name is ambiguous for export. For instance: " "concatenated fields." msgstr "" -#: models.py:1967 +#: models.py:1987 msgid "Importer - Column" msgstr "" -#: models.py:1968 +#: models.py:1988 msgid "Importer - Columns" msgstr "" -#: models.py:1988 +#: models.py:2008 msgid "Field name" msgstr "" -#: models.py:1990 models.py:2024 +#: models.py:2010 models.py:2044 msgid "Force creation of new items" msgstr "" -#: models.py:1992 models.py:2026 +#: models.py:2012 models.py:2046 msgid "Concatenate with existing" msgstr "" -#: models.py:1994 models.py:2028 +#: models.py:2014 models.py:2048 msgid "Concatenate character" msgstr "" -#: models.py:1998 +#: models.py:2018 msgid "Importer - Duplicate field" msgstr "" -#: models.py:1999 +#: models.py:2019 msgid "Importer - Duplicate fields" msgstr "" -#: models.py:2006 +#: models.py:2026 msgid "Regular expression" msgstr "" -#: models.py:2009 +#: models.py:2029 msgid "Importer - Regular expression" msgstr "" -#: models.py:2010 +#: models.py:2030 msgid "Importer - Regular expressions" msgstr "" -#: models.py:2033 +#: models.py:2053 msgid "Importer - Target" msgstr "" -#: models.py:2034 +#: models.py:2054 msgid "Importer - Targets" msgstr "" -#: models.py:2058 views.py:549 +#: models.py:2078 views.py:568 msgid "True" msgstr "" -#: models.py:2059 views.py:551 +#: models.py:2079 views.py:570 msgid "False" msgstr "" -#: models.py:2078 +#: models.py:2098 msgid "Is set" msgstr "" -#: models.py:2085 +#: models.py:2105 msgid "Importer - Target key" msgstr "" -#: models.py:2086 +#: models.py:2106 msgid "Importer - Targets keys" msgstr "" -#: models.py:2138 models.py:2913 +#: models.py:2158 models.py:2954 msgid "Format" msgstr "" -#: models.py:2139 models.py:3005 +#: models.py:2159 models.py:3046 msgid "Operation type" msgstr "" -#: models.py:2140 +#: models.py:2160 msgid "Period" msgstr "" -#: models.py:2141 +#: models.py:2161 msgid "Report state" msgstr "" -#: models.py:2142 +#: models.py:2162 msgid "Remain type" msgstr "" -#: models.py:2143 +#: models.py:2163 msgid "Unit" msgstr "" -#: models.py:2144 +#: models.py:2165 msgid "Activity type" msgstr "" -#: models.py:2145 +#: models.py:2166 msgid "Material" msgstr "" -#: models.py:2147 +#: models.py:2168 msgid "Conservatory state" msgstr "" -#: models.py:2148 +#: models.py:2169 msgid "Container type" msgstr "" -#: models.py:2149 +#: models.py:2170 msgid "Preservation type" msgstr "" -#: models.py:2150 +#: models.py:2171 msgid "Object type" msgstr "" -#: models.py:2151 +#: models.py:2172 msgid "Integrity type" msgstr "" -#: models.py:2152 +#: models.py:2174 msgid "Remarkability type" msgstr "" -#: models.py:2153 +#: models.py:2175 msgid "Batch type" msgstr "" -#: models.py:2155 +#: models.py:2177 msgid "Identification type" msgstr "" -#: models.py:2157 +#: models.py:2179 msgid "Context record relation type" msgstr "" -#: models.py:2158 models.py:3063 +#: models.py:2180 models.py:3104 msgid "Spatial reference system" msgstr "" -#: models.py:2159 models.py:2891 +#: models.py:2181 models.py:2932 msgid "Support type" msgstr "" -#: models.py:2160 models.py:2553 +#: models.py:2182 models.py:2573 msgid "Title type" msgstr "" -#: models.py:2166 +#: models.py:2188 msgid "Integer" msgstr "" -#: models.py:2167 +#: models.py:2189 msgid "Float" msgstr "" -#: models.py:2168 +#: models.py:2190 msgid "String" msgstr "" -#: models.py:2169 templates/sheet_ope.html:86 +#: models.py:2191 templates/sheet_ope.html:86 msgid "Date" msgstr "" -#: models.py:2171 templates/sheet_ope.html:61 templates/sheet_ope.html.py:83 +#: models.py:2193 templates/sheet_ope.html:61 templates/sheet_ope.html.py:83 #: templates/ishtar/dashboards/dashboard_main_detail.html:126 msgid "Year" msgstr "" -#: models.py:2172 +#: models.py:2194 msgid "String to boolean" msgstr "" -#: models.py:2173 +#: models.py:2195 msgctxt "filesystem" msgid "File" msgstr "" -#: models.py:2174 +#: models.py:2196 msgid "Unknow type" msgstr "" -#: models.py:2190 +#: models.py:2212 msgid "4 digit year. e.g.: \"2015\"" msgstr "" -#: models.py:2191 +#: models.py:2213 msgid "4 digit year/month/day. e.g.: \"2015/02/04\"" msgstr "" -#: models.py:2192 +#: models.py:2214 msgid "Day/month/4 digit year. e.g.: \"04/02/2015\"" msgstr "" -#: models.py:2202 +#: models.py:2224 msgid "Options" msgstr "" -#: models.py:2204 +#: models.py:2226 msgid "Split character(s)" msgstr "" -#: models.py:2208 +#: models.py:2230 msgid "Importer - Formater type" msgstr "" -#: models.py:2209 +#: models.py:2231 msgid "Importer - Formater types" msgstr "" -#: models.py:2261 templates/ishtar/dashboards/dashboard_main_detail.html:63 +#: models.py:2283 templates/ishtar/dashboards/dashboard_main_detail.html:63 msgid "Created" msgstr "" -#: models.py:2262 +#: models.py:2284 msgid "Analyse in progress" msgstr "" -#: models.py:2263 +#: models.py:2285 msgid "Analysed" msgstr "" -#: models.py:2264 +#: models.py:2286 msgid "Import pending" msgstr "" -#: models.py:2265 +#: models.py:2287 msgid "Import in progress" msgstr "" -#: models.py:2266 +#: models.py:2288 msgid "Finished with errors" msgstr "" -#: models.py:2267 +#: models.py:2289 msgid "Finished" msgstr "" -#: models.py:2268 +#: models.py:2290 msgid "Archived" msgstr "" -#: models.py:2283 +#: models.py:2305 msgid "Imported file" msgstr "" -#: models.py:2285 +#: models.py:2307 msgid "Associated images (zip file)" msgstr "" -#: models.py:2287 +#: models.py:2309 msgid "Encoding" msgstr "" -#: models.py:2289 +#: models.py:2311 msgid "Skip lines" msgstr "" -#: models.py:2290 templates/ishtar/import_list.html:51 +#: models.py:2312 templates/ishtar/import_list.html:51 msgid "Error file" msgstr "" -#: models.py:2293 +#: models.py:2315 msgid "Result file" msgstr "" -#: models.py:2296 templates/ishtar/import_list.html:57 +#: models.py:2318 templates/ishtar/import_list.html:57 msgid "Match file" msgstr "" -#: models.py:2302 +#: models.py:2324 msgid "Conservative import" msgstr "" -#: models.py:2307 +#: models.py:2328 msgid "End date" msgstr "" -#: models.py:2309 +#: models.py:2331 msgid "Remaining seconds" msgstr "" -#: models.py:2314 +#: models.py:2334 msgid "Import" msgstr "" -#: models.py:2343 +#: models.py:2363 msgid "Analyse" msgstr "" -#: models.py:2345 models.py:2348 +#: models.py:2365 models.py:2368 msgid "Re-analyse" msgstr "" -#: models.py:2346 +#: models.py:2366 msgid "Launch import" msgstr "" -#: models.py:2349 +#: models.py:2369 msgid "Re-import" msgstr "" -#: models.py:2350 +#: models.py:2370 msgid "Archive" msgstr "" -#: models.py:2352 +#: models.py:2372 msgid "Unarchive" msgstr "" -#: models.py:2353 widgets.py:130 templates/ishtar/form_delete.html:11 +#: models.py:2373 widgets.py:184 templates/ishtar/form_delete.html:11 msgid "Delete" msgstr "" -#: models.py:2494 +#: models.py:2514 msgid "Organizations" msgstr "" -#: models.py:2496 +#: models.py:2516 msgid "Can view all Organizations" msgstr "" -#: models.py:2497 +#: models.py:2517 msgid "Can view own Organization" msgstr "" -#: models.py:2498 +#: models.py:2518 msgid "Can add own Organization" msgstr "" -#: models.py:2500 +#: models.py:2520 msgid "Can change own Organization" msgstr "" -#: models.py:2502 +#: models.py:2522 msgid "Can delete own Organization" msgstr "" -#: models.py:2537 +#: models.py:2557 msgid "Groups" msgstr "" -#: models.py:2542 +#: models.py:2562 msgid "Person types" msgstr "" -#: models.py:2554 +#: models.py:2574 msgid "Title types" msgstr "" -#: models.py:2563 +#: models.py:2583 msgid "Mr" msgstr "" -#: models.py:2564 +#: models.py:2584 msgid "Miss" msgstr "" -#: models.py:2565 +#: models.py:2585 msgid "Mr and Mrs" msgstr "" -#: models.py:2566 +#: models.py:2586 msgid "Mrs" msgstr "" -#: models.py:2567 +#: models.py:2587 msgid "Doctor" msgstr "" -#: models.py:2600 +#: models.py:2620 msgid "Contact type" msgstr "" -#: models.py:2603 models.py:2667 +#: models.py:2623 models.py:2687 msgid "Types" msgstr "" -#: models.py:2606 +#: models.py:2626 msgid "Is attached to" msgstr "" -#: models.py:2611 +#: models.py:2631 msgid "Persons" msgstr "" -#: models.py:2613 +#: models.py:2633 msgid "Can view all Persons" msgstr "" -#: models.py:2614 +#: models.py:2634 msgid "Can view own Person" msgstr "" -#: models.py:2615 +#: models.py:2635 msgid "Can add own Person" msgstr "" -#: models.py:2616 +#: models.py:2636 msgid "Can change own Person" msgstr "" -#: models.py:2617 +#: models.py:2637 msgid "Can delete own Person" msgstr "" -#: models.py:2794 +#: models.py:2826 msgid "Advanced shortcut menu" msgstr "" -#: models.py:2797 +#: models.py:2829 msgid "Ishtar user" msgstr "" -#: models.py:2798 +#: models.py:2830 msgid "Ishtar users" msgstr "" -#: models.py:2842 +#: models.py:2870 msgid "To modify the password use the form in Auth > User" msgstr "" -#: models.py:2849 +#: models.py:2878 msgid "Author types" msgstr "" -#: models.py:2883 +#: models.py:2895 +msgid "Can view all Authors" +msgstr "" + +#: models.py:2897 +msgid "Can view own Author" +msgstr "" + +#: models.py:2899 +msgid "Can add own Author" +msgstr "" + +#: models.py:2901 +msgid "Can change own Author" +msgstr "" + +#: models.py:2903 +msgid "Can delete own Author" +msgstr "" + +#: models.py:2924 msgid "Source types" msgstr "" -#: models.py:2892 +#: models.py:2933 msgid "Support types" msgstr "" -#: models.py:2899 +#: models.py:2940 msgid "Format type" msgstr "" -#: models.py:2900 +#: models.py:2941 msgid "Format types" msgstr "" -#: models.py:2908 +#: models.py:2949 msgid "External ID" msgstr "" -#: models.py:2911 +#: models.py:2952 msgid "Support" msgstr "" -#: models.py:2915 +#: models.py:2956 msgid "Scale" msgstr "" -#: models.py:2929 +#: models.py:2970 msgid "Item number" msgstr "" -#: models.py:2930 +#: models.py:2971 msgid "Ref." msgstr "" -#: models.py:2933 +#: models.py:2974 msgid "Internal ref." msgstr "" -#: models.py:2976 +#: models.py:3017 msgid "Surface (m2)" msgstr "" -#: models.py:2977 templates/sheet_ope.html:46 templates/sheet_ope.html.py:107 +#: models.py:3018 templates/sheet_ope.html:46 templates/sheet_ope.html.py:107 msgid "Localisation" msgstr "Lokalisierung" -#: models.py:3002 +#: models.py:3043 msgid "Is preventive" msgstr "" -#: models.py:3006 +#: models.py:3047 msgid "Operation types" msgstr "" -#: models.py:3035 +#: models.py:3076 msgid "Preventive" msgstr "" -#: models.py:3036 +#: models.py:3077 msgid "Research" msgstr "" -#: models.py:3059 +#: models.py:3100 msgid "Authority name" msgstr "" -#: models.py:3060 +#: models.py:3101 msgid "Authority SRID" msgstr "" -#: models.py:3064 +#: models.py:3105 msgid "Spatial reference systems" msgstr "" @@ -1516,108 +1536,116 @@ msgstr "" msgid "Account deletion" msgstr "" -#: views.py:241 +#: views.py:251 msgid "Archaeological file" msgstr "" -#: views.py:242 +#: views.py:252 msgid "Operation" msgstr "" -#: views.py:244 +#: views.py:254 msgid "Context record" msgstr "" -#: views.py:246 +#: views.py:256 msgid "Find" msgstr "" -#: views.py:248 +#: views.py:258 msgid "Treatment request" msgstr "" -#: views.py:249 +#: views.py:259 msgid "Treatment" msgstr "" -#: views.py:1363 views.py:1406 +#: views.py:1387 views.py:1430 msgid "Operation not permitted." msgstr "" -#: views.py:1365 +#: views.py:1389 #, python-format msgid "New %s" msgstr "" -#: views.py:1424 views.py:1474 +#: views.py:1448 views.py:1501 msgid "Archaeological files" msgstr "" -#: views.py:1425 views.py:1478 +#: views.py:1449 views.py:1505 msgid "Operations" msgstr "" -#: views.py:1427 views.py:1482 +#: views.py:1451 views.py:1509 msgid "Context records" msgstr "" -#: views.py:1429 views.py:1485 +#: views.py:1453 views.py:1512 msgid "Finds" msgstr "" -#: views.py:1683 templates/ishtar/import_list.html:47 +#: views.py:1455 views.py:1517 +msgid "Treatment requests" +msgstr "" + +#: views.py:1456 views.py:1521 +msgid "Treatments" +msgstr "" + +#: views.py:1719 templates/ishtar/import_list.html:47 msgid "Link unmatched items" msgstr "" -#: views.py:1698 +#: views.py:1734 msgid "Delete import" msgstr "" -#: views.py:1737 +#: views.py:1773 msgid "Merge persons" msgstr "" -#: views.py:1761 +#: views.py:1797 msgid "Select the main person" msgstr "" -#: views.py:1770 +#: views.py:1806 msgid "Merge organization" msgstr "" -#: views.py:1780 +#: views.py:1816 msgid "Select the main organization" msgstr "" -#: views.py:1820 views.py:1836 +#: views.py:1856 views.py:1872 msgid "Corporation manager" msgstr "" -#: widgets.py:259 widgets.py:366 widgets.py:481 +#: widgets.py:313 widgets.py:420 widgets.py:535 msgid "Search..." msgstr "" -#: widgets.py:670 templatetags/window_tables.py:96 +#: widgets.py:724 templatetags/window_tables.py:96 msgid "No results" msgstr "" -#: widgets.py:671 templatetags/window_tables.py:97 +#: widgets.py:725 templatetags/window_tables.py:97 msgid "Loading..." msgstr "" -#: widgets.py:672 +#: widgets.py:726 msgid "Remove" msgstr "" -#: wizards.py:374 templates/ishtar/import_delete.html:21 +#: wizards.py:380 templates/ishtar/import_delete.html:21 msgid "Yes" msgstr "" -#: wizards.py:376 +#: wizards.py:382 msgid "No" msgstr "" -#: wizards.py:1396 +#: wizards.py:1404 #, python-format msgid "[%(app_name)s] Account creation/modification" msgstr "" @@ -1692,19 +1720,19 @@ msgstr "" msgid ":" msgstr "" -#: templates/base.html:120 +#: templates/base.html:123 msgid "Processing..." msgstr "" -#: templates/base.html:121 +#: templates/base.html:124 msgid "This can be long." msgstr "" -#: templates/base.html:122 +#: templates/base.html:125 msgid "Time to take a coffee?" msgstr "" -#: templates/base.html:123 +#: templates/base.html:126 msgid "Time to take another coffee?" msgstr "" diff --git a/translations/fr/archaeological_context_records.po b/translations/fr/archaeological_context_records.po index 3b0762092..5146f7b43 100644 --- a/translations/fr/archaeological_context_records.po +++ b/translations/fr/archaeological_context_records.po @@ -10,18 +10,18 @@ msgstr "" "MIME-Version: 1.0\n" "Content-Transfer-Encoding: 8bit\n" "Content-Type: text/plain; charset=UTF-8\n" -"PO-Revision-Date: 2017-03-21 06:22-0400\n" -"Last-Translator: Étienne Loks <etienne.loks@iggdrasil.net>\n" +"PO-Revision-Date: 2017-04-07 05:29-0400\n" +"Last-Translator: Valérie-Emma Leroux <emma@iggdrasil.net>\n" "Language-Team: \n" "Language: fr\n" "Plural-Forms: nplurals=2; plural=n>1;\n" "X-Generator: Zanata 3.9.6\n" -#: forms.py:47 forms.py:51 models.py:216 models.py:589 wizards.py:77 +#: forms.py:47 forms.py:51 models.py:216 models.py:599 wizards.py:77 msgid "Operation" msgstr "Opération" -#: forms.py:59 forms.py:141 models.py:218 models.py:557 +#: forms.py:59 forms.py:141 models.py:218 models.py:567 msgid "ID" msgstr "Identifiant" @@ -73,11 +73,11 @@ msgstr "Vous devez sélectionner au moins une Unité d'Enregistrement." msgid "General" msgstr "Général" -#: forms.py:140 models.py:181 models.py:214 models.py:559 +#: forms.py:140 models.py:181 models.py:214 models.py:569 msgid "Parcel" msgstr "Parcelle" -#: forms.py:143 models.py:219 models.py:560 +#: forms.py:143 models.py:219 models.py:570 #: templates/ishtar/sheet_contextrecord.html:30 msgid "Description" msgstr "Description" @@ -114,7 +114,7 @@ msgstr "Profondeur (m)" msgid "Depth of appearance (m)" msgstr "Profondeur d'apparition" -#: forms.py:156 forms.py:376 models.py:241 models.py:558 +#: forms.py:156 forms.py:376 models.py:241 models.py:568 msgid "Context record type" msgstr "Type d'Unité d'Enregistrement" @@ -163,7 +163,7 @@ msgstr "Qualité" msgid "Dating type" msgstr "Type de datation" -#: forms.py:285 ishtar_menu.py:29 models.py:619 +#: forms.py:285 ishtar_menu.py:29 models.py:641 msgid "Context record" msgstr "Unité d'Enregistrement" @@ -332,7 +332,7 @@ msgstr "Type de documentation" msgid "Documentation types" msgstr "Types de documentation" -#: models.py:172 models.py:561 +#: models.py:172 models.py:571 msgid "Periods" msgstr "Périodes" @@ -441,74 +441,94 @@ msgctxt "short" msgid "Context record" msgstr "UE" -#: models.py:491 +#: models.py:501 msgid "Inverse relation" msgstr "Relation inverse" -#: models.py:495 models.py:518 models.py:556 +#: models.py:505 models.py:528 models.py:566 msgid "Relation type" msgstr "Type de relation" -#: models.py:496 +#: models.py:506 msgid "Relation types" msgstr "Types de relation" -#: models.py:513 +#: models.py:523 msgid "ID (left)" msgstr "ID (gauche)" -#: models.py:514 +#: models.py:524 msgid "Context record type (left)" msgstr "Type d'UE (gauche)" -#: models.py:515 +#: models.py:525 msgid "Parcel (left)" msgstr "Parcelle (gauche)" -#: models.py:516 +#: models.py:526 msgid "Description (left)" msgstr "Description (gauche)" -#: models.py:517 +#: models.py:527 msgid "Periods (left)" msgstr "Périodes (gauche)" -#: models.py:519 +#: models.py:529 msgid "ID (right)" msgstr "ID (droit)" -#: models.py:520 +#: models.py:530 msgid "Context record type (right)" msgstr "Type d'UE (droite)" -#: models.py:521 +#: models.py:531 msgid "Parcel (right)" msgstr "Parcelle (droite)" -#: models.py:522 +#: models.py:532 msgid "Description (right)" msgstr "Description (droite)" -#: models.py:523 +#: models.py:533 msgid "Periods (right)" msgstr "Périodes (droite)" -#: models.py:532 +#: models.py:542 msgid "Record relation" msgstr "Relation entre Unités d'Enregistrement" -#: models.py:533 +#: models.py:543 msgid "Record relations" msgstr "Relations entre Unités d'Enregistrement" -#: models.py:616 +#: models.py:626 msgid "Context record documentation" msgstr "Documentation d'une Unité d'Enregistrement" -#: models.py:617 +#: models.py:627 msgid "Context record documentations" msgstr "Documentations des Unités d'Enregistrement" +#: models.py:630 +msgid "Can view all Context record sources" +msgstr "Peut voir toutes les Documentations d'unité d'enregistrement" + +#: models.py:632 +msgid "Can view own Context record source" +msgstr "Peut voir sa propre Documentation d'unité d'enregistrement" + +#: models.py:634 +msgid "Can add own Context record source" +msgstr "Peut ajouter sa propre Documentation d'unité d'enregistrement" + +#: models.py:636 +msgid "Can change own Context record source" +msgstr "Peut modifier sa propre Documentation d'unité d'enregistrement" + +#: models.py:638 +msgid "Can delete own Context record source" +msgstr "Peut supprimer sa propre Documentation d'unité d'enregistrement" + #: views.py:102 msgid "New context record" msgstr "Ajouter une Unité d'Enregistrement" diff --git a/translations/fr/archaeological_files.po b/translations/fr/archaeological_files.po index 23d75e0d0..d80de4637 100644 --- a/translations/fr/archaeological_files.po +++ b/translations/fr/archaeological_files.po @@ -18,7 +18,7 @@ msgstr "" "Plural-Forms: nplurals=2; plural=n>1;\n" "X-Generator: Zanata 3.9.6\n" -#: forms.py:47 forms.py:210 forms.py:255 forms.py:396 forms.py:423 +#: forms.py:47 forms.py:210 forms.py:255 forms.py:394 forms.py:421 #: models.py:108 templates/ishtar/sheet_file.html:144 msgid "Year" msgstr "Année" @@ -31,15 +31,15 @@ msgstr "Référence numérique" msgid "Other reference" msgstr "Autre référence" -#: forms.py:52 forms.py:431 +#: forms.py:52 forms.py:429 msgid "Parcel (section/number/public domain)" msgstr "Parcelle (section/numéro/domaine public)" -#: forms.py:55 forms.py:407 forms.py:434 models.py:558 +#: forms.py:55 forms.py:405 forms.py:432 models.py:558 msgid "Department" msgstr "Département" -#: forms.py:56 forms.py:443 +#: forms.py:56 forms.py:441 msgid "File name" msgstr "Nom du dossier" @@ -63,7 +63,7 @@ msgstr "Type de permis" msgid "Permit reference" msgstr "Référence du permis" -#: forms.py:63 forms.py:227 forms.py:364 models.py:180 +#: forms.py:63 forms.py:227 forms.py:362 models.py:180 #: templates/ishtar/sheet_file.html:97 msgid "Comment" msgstr "Commentaire" @@ -72,19 +72,19 @@ msgstr "Commentaire" msgid "In charge" msgstr "Responsable" -#: forms.py:72 forms.py:281 forms.py:445 models.py:126 +#: forms.py:72 forms.py:281 forms.py:443 models.py:126 msgid "General contractor" msgstr "Aménageur" -#: forms.py:79 forms.py:453 +#: forms.py:79 forms.py:451 msgid "Organization of general contractor" msgstr "Organisation de l'aménageur" -#: forms.py:87 forms.py:476 +#: forms.py:87 forms.py:474 msgid "Created by" msgstr "Créé par" -#: forms.py:94 forms.py:484 +#: forms.py:94 forms.py:482 msgid "Modified by" msgstr "Modifié par" @@ -178,83 +178,83 @@ msgstr "Surface totale aménagée (m2)" msgid "Research archaeology" msgstr "Archéologie programmée" -#: forms.py:341 models.py:183 templates/ishtar/sheet_file.html:88 +#: forms.py:340 models.py:183 templates/ishtar/sheet_file.html:88 msgid "Departments" msgstr "Départements" -#: forms.py:351 models.py:192 +#: forms.py:349 models.py:192 msgid "Scientist in charge" msgstr "Responsable scientifique" -#: forms.py:353 models.py:186 templates/ishtar/sheet_file.html:90 +#: forms.py:351 models.py:186 templates/ishtar/sheet_file.html:90 msgid "Requested operation type" msgstr "Type d'opération demandée" -#: forms.py:355 +#: forms.py:353 msgid "Lead organization" msgstr "Organisation porteuse du projet" -#: forms.py:371 models.py:196 templates/ishtar/sheet_file.html:95 +#: forms.py:369 models.py:196 templates/ishtar/sheet_file.html:95 msgid "Classified area" msgstr "Au sein d'un site classé" -#: forms.py:373 models.py:198 templates/ishtar/sheet_file.html:96 +#: forms.py:371 models.py:198 templates/ishtar/sheet_file.html:96 msgid "Protected area" msgstr "Au sein d'un secteur sauvegardé" -#: forms.py:387 +#: forms.py:385 msgid "Would you like to close this archaeological file?" msgstr "Voulez-vous clore ce dossier archéologique ?" -#: forms.py:392 +#: forms.py:390 msgid "Would you like to delete this archaeological file ?" msgstr "Voulez-vous supprimer ce dossier archéologique ?" -#: forms.py:397 forms.py:424 forms.py:547 +#: forms.py:395 forms.py:422 forms.py:545 msgid "Index" msgstr "Index" -#: forms.py:401 forms.py:428 forms.py:533 +#: forms.py:399 forms.py:426 forms.py:531 msgid "Act type" msgstr "Type d'acte" -#: forms.py:402 +#: forms.py:400 msgid "Object (full text search)" msgstr "Objet (recherche texte intégral)" -#: forms.py:429 +#: forms.py:427 msgid "Indexed?" msgstr "Indexé ?" -#: forms.py:435 +#: forms.py:433 msgid "Object" msgstr "Objet" -#: forms.py:439 +#: forms.py:437 msgid "Signature date after" msgstr "Date de signature après" -#: forms.py:441 +#: forms.py:439 msgid "Signature date before" msgstr "Date de signature avant" -#: forms.py:461 +#: forms.py:459 msgid "File numeric reference" msgstr "Dossier : réf. numérique" -#: forms.py:462 +#: forms.py:460 msgid "File year" msgstr "Dossier : année" -#: forms.py:464 +#: forms.py:462 msgid "File other reference" msgstr "Dossier : autre référence" -#: forms.py:466 +#: forms.py:464 msgid "File in charge" msgstr "Dossier : responsable" -#: forms.py:474 +#: forms.py:472 msgid "File permit reference" msgstr "Dossier : réf. du permis" diff --git a/translations/fr/archaeological_finds.po b/translations/fr/archaeological_finds.po index 32c8a4861..9168704ed 100644 --- a/translations/fr/archaeological_finds.po +++ b/translations/fr/archaeological_finds.po @@ -11,176 +11,176 @@ msgstr "" "MIME-Version: 1.0\n" "Content-Transfer-Encoding: 8bit\n" "Content-Type: text/plain; charset=UTF-8\n" -"PO-Revision-Date: 2017-03-21 06:23-0400\n" -"Last-Translator: Étienne Loks <etienne.loks@iggdrasil.net>\n" +"PO-Revision-Date: 2017-04-07 05:49-0400\n" +"Last-Translator: Valérie-Emma Leroux <emma@iggdrasil.net>\n" "Language-Team: \n" "Language: fr\n" "Plural-Forms: nplurals=2; plural=n>1;\n" "X-Generator: Zanata 3.9.6\n" -#: forms.py:93 forms.py:97 models_finds.py:505 wizards.py:64 +#: forms.py:93 forms.py:97 models_finds.py:519 wizards.py:64 msgid "Context record" msgstr "Unité d'Enregistrement" -#: forms.py:126 ishtar_menu.py:32 models_finds.py:668 models_finds.py:1071 -#: models_finds.py:1080 models_treatments.py:281 +#: forms.py:126 ishtar_menu.py:32 models_finds.py:683 models_finds.py:1114 +#: models_finds.py:1135 models_treatments.py:298 #: templates/ishtar/sheet_find.html:5 msgid "Find" msgstr "Mobilier" -#: forms.py:140 forms.py:333 forms.py:601 models_finds.py:151 -#: models_finds.py:599 +#: forms.py:140 forms.py:337 forms.py:605 models_finds.py:150 +#: models_finds.py:613 msgid "Free ID" msgstr "ID libre" -#: forms.py:142 models_finds.py:651 +#: forms.py:142 models_finds.py:666 msgid "Previous ID" msgstr "Identifiant précédent" -#: forms.py:143 forms.py:364 forms_treatments.py:134 models_finds.py:155 -#: models_finds.py:600 models_treatments.py:127 +#: forms.py:143 forms.py:368 forms_treatments.py:134 models_finds.py:154 +#: models_finds.py:614 models_treatments.py:128 msgid "Description" msgstr "Description" -#: forms.py:146 forms.py:366 models_finds.py:164 +#: forms.py:146 forms.py:370 models_finds.py:163 msgid "Batch/object" msgstr "Lot/objet" -#: forms.py:148 models_finds.py:628 +#: forms.py:148 models_finds.py:643 msgid "Is complete?" msgstr "Est complet ?" -#: forms.py:151 forms.py:354 forms.py:605 models_finds.py:51 +#: forms.py:151 forms.py:358 forms.py:609 models_finds.py:50 msgid "Material type" msgstr "Type de matériau" -#: forms.py:152 forms.py:358 models_finds.py:63 models_finds.py:604 +#: forms.py:154 forms.py:362 models_finds.py:62 models_finds.py:618 msgid "Conservatory state" msgstr "État sanitaire" -#: forms.py:155 models_finds.py:606 +#: forms.py:157 models_finds.py:620 msgid "Conservatory comment" msgstr "Commentaire relatif à la conservation" -#: forms.py:158 models_finds.py:113 models_finds.py:631 +#: forms.py:160 models_finds.py:112 models_finds.py:646 msgid "Object types" msgstr "Types d'objet" -#: forms.py:160 forms.py:357 models_finds.py:72 +#: forms.py:164 forms.py:361 models_finds.py:71 msgid "Preservation type" msgstr "Type de conservation" -#: forms.py:163 forms.py:360 models_finds.py:633 +#: forms.py:167 forms.py:364 models_finds.py:648 msgid "Integrity / interest" msgstr "Intégrité / intérêt" -#: forms.py:166 forms.py:362 models_finds.py:636 +#: forms.py:170 forms.py:366 models_finds.py:651 msgid "Remarkability" msgstr "Remarquabilité" -#: forms.py:169 models_finds.py:169 +#: forms.py:173 models_finds.py:168 msgid "Point of topographic reference" msgstr "Point de référence topographique" -#: forms.py:172 models_finds.py:171 +#: forms.py:176 models_finds.py:170 msgid "X" msgstr "X" -#: forms.py:173 models_finds.py:172 +#: forms.py:177 models_finds.py:171 msgid "Y" msgstr "Y" -#: forms.py:174 models_finds.py:173 +#: forms.py:178 models_finds.py:172 msgid "Z" msgstr "Z" -#: forms.py:176 models_finds.py:181 +#: forms.py:180 models_finds.py:180 msgid "Spatial Reference System" msgstr "Système de référence spatiale" -#: forms.py:179 models_finds.py:174 +#: forms.py:183 models_finds.py:173 msgid "Estimated error for X" msgstr "Erreur estimée pour X" -#: forms.py:181 models_finds.py:176 +#: forms.py:185 models_finds.py:175 msgid "Estimated error for Y" msgstr "Erreur estimée pour Y" -#: forms.py:183 models_finds.py:178 +#: forms.py:187 models_finds.py:177 msgid "Estimated error for Z" msgstr "Erreur estimée pour Z" -#: forms.py:184 models_finds.py:640 +#: forms.py:188 models_finds.py:655 msgid "Length (cm)" msgstr "Longueur (cm)" -#: forms.py:185 models_finds.py:641 +#: forms.py:189 models_finds.py:656 msgid "Width (cm)" msgstr "Largeur (cm)" -#: forms.py:186 models_finds.py:642 +#: forms.py:190 models_finds.py:657 msgid "Height (cm)" msgstr "Hauteur (cm)" -#: forms.py:187 models_finds.py:643 +#: forms.py:191 models_finds.py:658 msgid "Diameter (cm)" msgstr "Diamètre (cm)" -#: forms.py:188 models_finds.py:644 +#: forms.py:192 models_finds.py:659 msgid "Thickness (cm)" msgstr "Épaisseur (cm)" -#: forms.py:189 forms.py:606 models_finds.py:611 +#: forms.py:193 forms.py:610 models_finds.py:625 msgid "Volume (l)" msgstr "Volume (l)" -#: forms.py:190 forms.py:607 models_finds.py:612 +#: forms.py:194 forms.py:611 models_finds.py:626 msgid "Weight (g)" msgstr "Poids (g)" -#: forms.py:192 models_finds.py:645 +#: forms.py:196 models_finds.py:660 msgid "Dimensions comment" msgstr "Commentaire concernant les dimensions" -#: forms.py:193 forms.py:608 models_finds.py:615 +#: forms.py:197 forms.py:612 models_finds.py:629 msgid "Find number" msgstr "Mobilier (en nombre)" -#: forms.py:195 models_finds.py:639 +#: forms.py:199 models_finds.py:654 msgid "Minimum number of individuals (MNI)" msgstr "Nombre minimum d'individus (NMI)" -#: forms.py:196 models_finds.py:647 +#: forms.py:200 models_finds.py:662 msgid "Mark" msgstr "Marque" -#: forms.py:197 forms.py:367 models_finds.py:653 +#: forms.py:201 forms.py:371 models_finds.py:668 msgid "Check" msgstr "Vérification" -#: forms.py:199 models_finds.py:655 +#: forms.py:203 models_finds.py:670 msgid "Check date" msgstr "Date de vérification" -#: forms.py:200 forms_treatments.py:132 forms_treatments.py:434 -#: models_finds.py:156 models_finds.py:648 models_treatments.py:126 -#: models_treatments.py:494 +#: forms.py:204 forms_treatments.py:132 forms_treatments.py:434 +#: models_finds.py:155 models_finds.py:663 models_treatments.py:127 +#: models_treatments.py:511 msgid "Comment" msgstr "Commentaires" -#: forms.py:203 models_finds.py:649 +#: forms.py:207 models_finds.py:664 msgid "Comment on dating" msgstr "Commentaire général sur les datations" -#: forms.py:204 models_finds.py:657 +#: forms.py:208 models_finds.py:672 msgid "Estimated value" msgstr "Valeur estimée" -#: forms.py:206 forms_treatments.py:151 +#: forms.py:210 forms_treatments.py:151 msgid "Image" msgstr "Image" -#: forms.py:207 forms_treatments.py:152 +#: forms.py:211 forms_treatments.py:152 #, python-format msgid "" "<p>Heavy images are resized to: %(width)dx%(height)d (ratio is preserved).</" @@ -189,204 +189,204 @@ msgstr "" "<p>Les images trop grandes sont retaillées en : %(width)dx%(height)d (le " "ratio est conservé).</p>" -#: forms.py:281 +#: forms.py:285 msgid "" "You should at least provide X, Y and the spatial reference system used." msgstr "" "Vous devez au minimum fournir X, Y et le système de référence spatiale " "utilisé." -#: forms.py:290 +#: forms.py:294 msgid "" "Coordinates are not relevant for the spatial reference system used: {}." msgstr "" "Les coordonnées ne sont pas pertinentes pour le système de référence " "spatiale utilisé : {}." -#: forms.py:296 forms.py:327 models_finds.py:623 +#: forms.py:300 forms.py:331 models_finds.py:637 msgid "Dating" msgstr "Datation" -#: forms.py:301 forms.py:353 +#: forms.py:305 forms.py:357 msgid "Period" msgstr "Période" -#: forms.py:302 forms_treatments.py:138 forms_treatments.py:436 -#: models_finds.py:1085 models_treatments.py:129 models_treatments.py:292 +#: forms.py:306 forms_treatments.py:138 forms_treatments.py:436 +#: models_finds.py:1140 models_treatments.py:130 models_treatments.py:309 #: templates/ishtar/sheet_find.html:91 templates/ishtar/sheet_find.html:133 msgid "Start date" msgstr "Date de début" -#: forms.py:304 models_finds.py:1086 models_treatments.py:293 +#: forms.py:308 models_finds.py:1141 models_treatments.py:310 #: templates/ishtar/sheet_find.html:92 templates/ishtar/sheet_find.html:134 msgid "End date" msgstr "Date de fin" -#: forms.py:305 +#: forms.py:309 msgid "Quality" msgstr "Qualité" -#: forms.py:307 +#: forms.py:311 msgid "Dating type" msgstr "Type de datation" -#: forms.py:309 +#: forms.py:313 msgid "Precise dating" msgstr "Datation précise" -#: forms.py:331 models_finds.py:188 +#: forms.py:335 models_finds.py:187 msgid "Short ID" msgstr "ID court" -#: forms.py:332 models_finds.py:191 +#: forms.py:336 models_finds.py:190 msgid "Complete ID" msgstr "ID complet" -#: forms.py:336 forms_treatments.py:54 forms_treatments.py:96 +#: forms.py:340 forms_treatments.py:54 forms_treatments.py:96 #: forms_treatments.py:284 forms_treatments.py:356 forms_treatments.py:406 -#: forms_treatments.py:489 models_treatments.py:102 models_treatments.py:466 +#: forms_treatments.py:489 models_treatments.py:103 models_treatments.py:483 msgid "Year" msgstr "Année" -#: forms.py:338 +#: forms.py:342 msgid "Operation's number (index by year)" msgstr "Numéro de l'opération (index par année)" -#: forms.py:341 +#: forms.py:345 msgid "Code PATRIARCHE" msgstr "Code PATRIARCHE" -#: forms.py:345 +#: forms.py:349 msgid "Archaeological site" msgstr "Entité archéologique" -#: forms.py:351 +#: forms.py:355 msgid "Search within related operations" msgstr "Rechercher parmi les opérations liées" -#: forms.py:355 models_finds.py:112 +#: forms.py:359 models_finds.py:111 msgid "Object type" msgstr "Type d'objet" -#: forms.py:368 forms_treatments.py:57 +#: forms.py:372 forms_treatments.py:57 msgid "Has an image?" msgstr "Dispose d'une image ?" -#: forms.py:417 +#: forms.py:421 msgid "Warehouse (location)" msgstr "Dépôt (lieu)" -#: forms.py:423 +#: forms.py:427 msgid "Warehouse (responsible)" msgstr "Dépôt (responsable)" -#: forms.py:428 +#: forms.py:432 msgid "Container ID" msgstr "Identifiant du contenant" -#: forms.py:429 +#: forms.py:433 msgid "Container ref." msgstr "Réf. contenant" -#: forms.py:433 forms.py:456 views.py:149 +#: forms.py:437 forms.py:460 views.py:149 msgid "Find search" msgstr "Rechercher un mobilier" -#: forms.py:481 templates/ishtar/sheet_treatment.html:46 +#: forms.py:485 templates/ishtar/sheet_treatment.html:46 msgid "Upstream finds" msgstr "Mobilier amont" -#: forms.py:483 models_finds.py:669 +#: forms.py:487 models_finds.py:684 msgid "Finds" msgstr "Mobilier" -#: forms.py:495 +#: forms.py:499 msgid "You should at least select one archaeological find." msgstr "Vous devez sélectionner au moins un mobilier archéologique." -#: forms.py:598 +#: forms.py:602 msgid "Resulting find" msgstr "Mobilier résultant" -#: forms.py:603 +#: forms.py:607 msgid "Precise description" msgstr "Description précise" -#: forms.py:618 +#: forms.py:622 msgid "Resulting finds" msgstr "Mobiliers résultants" -#: forms.py:623 +#: forms.py:627 msgid "Would you like to delete this find?" msgstr "Voulez-vous supprimer ce mobilier ?" -#: forms.py:627 models_treatments.py:90 +#: forms.py:631 models_treatments.py:91 msgid "Upstream find" msgstr "Mobilier amont" -#: forms.py:640 +#: forms.py:644 msgid "Archaeological find search" msgstr "Rechercher un mobilier" -#: forms.py:642 +#: forms.py:646 msgid "You should select an archaeological find." msgstr "Vous devez sélectionner du mobilier." -#: forms.py:647 +#: forms.py:651 msgid "Year of the operation" msgstr "Année de l'opération" -#: forms.py:649 +#: forms.py:653 msgid "Numeric reference" msgstr "Référence numérique" -#: forms.py:656 +#: forms.py:660 msgid "Period of the archaeological find" msgstr "Période du mobilier" -#: forms.py:658 +#: forms.py:662 msgid "Material type of the archaeological find" msgstr "Type de matériau du mobilier" -#: forms.py:660 +#: forms.py:664 msgid "Description of the archaeological find" msgstr "Description du mobilier" -#: forms.py:672 forms_treatments.py:590 forms_treatments.py:616 +#: forms.py:676 forms_treatments.py:590 forms_treatments.py:616 msgid "Documentation search" msgstr "Rechercher une documentation" -#: forms.py:674 forms_treatments.py:592 forms_treatments.py:618 +#: forms.py:678 forms_treatments.py:592 forms_treatments.py:618 msgid "You should select a document." msgstr "Vous devez sélectionner un document." -#: forms.py:691 +#: forms.py:695 msgid "Another basket already exists with this name." msgstr "Un autre panier existant utilise déjà ce nom." -#: forms.py:701 forms.py:705 forms_treatments.py:175 ishtar_menu.py:57 +#: forms.py:705 forms.py:709 forms_treatments.py:175 ishtar_menu.py:57 msgid "Basket" msgstr "Panier" -#: forms_treatments.py:52 forms_treatments.py:92 models_treatments.py:98 +#: forms_treatments.py:52 forms_treatments.py:92 models_treatments.py:99 #: templates/ishtar/sheet_find.html:85 templates/ishtar/sheet_find.html:127 msgid "Label" msgstr "Intitulé" -#: forms_treatments.py:53 forms_treatments.py:95 models_treatments.py:100 +#: forms_treatments.py:53 forms_treatments.py:95 models_treatments.py:101 msgid "Other ref." msgstr "Autre réf." #: forms_treatments.py:55 forms_treatments.py:237 forms_treatments.py:285 #: forms_treatments.py:348 forms_treatments.py:357 forms_treatments.py:459 -#: forms_treatments.py:490 forms_treatments.py:557 models_treatments.py:104 -#: models_treatments.py:468 +#: forms_treatments.py:490 forms_treatments.py:557 models_treatments.py:105 +#: models_treatments.py:485 msgid "Index" msgstr "Index" #: forms_treatments.py:56 forms_treatments.py:101 forms_treatments.py:301 -#: forms_treatments.py:578 models_treatments.py:56 models_treatments.py:109 -#: models_treatments.py:291 +#: forms_treatments.py:578 models_treatments.py:56 models_treatments.py:110 +#: models_treatments.py:308 msgid "Treatment type" msgstr "Type de traitement" @@ -398,7 +398,7 @@ msgstr "Rechercher un traitement" msgid "Base treatment" msgstr "Traitement de base" -#: forms_treatments.py:103 models_treatments.py:92 models_treatments.py:111 +#: forms_treatments.py:103 models_treatments.py:93 models_treatments.py:112 #: templates/ishtar/sheet_find.html:87 templates/ishtar/sheet_find.html:129 msgid "State" msgstr "État" @@ -407,15 +407,15 @@ msgstr "État" msgid "Target" msgstr "Destination" -#: forms_treatments.py:107 forms_treatments.py:417 models_treatments.py:119 +#: forms_treatments.py:107 forms_treatments.py:417 models_treatments.py:120 msgid "Responsible" msgstr "Responsable" -#: forms_treatments.py:113 models_treatments.py:122 +#: forms_treatments.py:113 models_treatments.py:123 msgid "Organization" msgstr "Organisation" -#: forms_treatments.py:119 models_treatments.py:114 models_treatments.py:294 +#: forms_treatments.py:119 models_treatments.py:115 models_treatments.py:311 msgid "Location" msgstr "Lieu" @@ -427,12 +427,12 @@ msgstr "Contenant (pertinent dans le cadre du conditionnement)" msgid "External ref." msgstr "Réf. externe" -#: forms_treatments.py:136 models_treatments.py:128 +#: forms_treatments.py:136 models_treatments.py:129 msgid "Goal" msgstr "But" -#: forms_treatments.py:140 forms_treatments.py:442 models_treatments.py:130 -#: models_treatments.py:488 +#: forms_treatments.py:140 forms_treatments.py:442 models_treatments.py:131 +#: models_treatments.py:505 msgid "Closing date" msgstr "Date de clôture" @@ -481,12 +481,12 @@ msgstr "Un responsable ou une organisation doit être défini." msgid "Another treatment with this index exists for {}." msgstr "Un autre traitement avec cet index existe pour {}." -#: forms_treatments.py:262 models_treatments.py:107 +#: forms_treatments.py:262 models_treatments.py:108 msgid "Associated request" msgstr "Demande associée" #: forms_treatments.py:266 forms_treatments.py:397 ishtar_menu.py:108 -#: models_treatments.py:499 models_treatments.py:521 models_treatments.py:584 +#: models_treatments.py:516 models_treatments.py:544 models_treatments.py:619 #: wizards.py:187 templates/ishtar/sheet_treatmentfile.html:5 msgid "Treatment request" msgstr "Demande de traitement" @@ -545,7 +545,7 @@ msgstr "Référence interne du traitement" msgid "Modified by" msgstr "Modifié par" -#: forms_treatments.py:354 forms_treatments.py:404 models_treatments.py:473 +#: forms_treatments.py:354 forms_treatments.py:404 models_treatments.py:490 msgid "Name" msgstr "Nom" @@ -553,7 +553,7 @@ msgstr "Nom" msgid "Internal ref." msgstr "Réf. interne" -#: forms_treatments.py:358 forms_treatments.py:415 models_treatments.py:91 +#: forms_treatments.py:358 forms_treatments.py:415 models_treatments.py:92 #: templates/ishtar/sheet_find.html:86 templates/ishtar/sheet_find.html:128 #: templates/ishtar/sheet_find.html:228 msgid "Type" @@ -563,12 +563,12 @@ msgstr "Type" msgid "In charge" msgstr "Responsable" -#: forms_treatments.py:366 forms_treatments.py:423 models_treatments.py:482 +#: forms_treatments.py:366 forms_treatments.py:423 models_treatments.py:499 #: templates/ishtar/sheet_treatmentfile.html:31 msgid "Applicant" msgstr "Demandeur" -#: forms_treatments.py:372 forms_treatments.py:429 models_treatments.py:486 +#: forms_treatments.py:372 forms_treatments.py:429 models_treatments.py:503 #: templates/ishtar/sheet_treatmentfile.html:38 msgid "Applicant organisation" msgstr "Organisation du demandeur" @@ -577,7 +577,7 @@ msgstr "Organisation du demandeur" msgid "Treatment request search" msgstr "Rechercher une demande de traitement" -#: forms_treatments.py:439 models_treatments.py:492 +#: forms_treatments.py:439 models_treatments.py:509 msgid "Reception date" msgstr "Date de réception" @@ -609,8 +609,8 @@ msgstr "Index de la demande de traitement" msgid "Treatment request internal reference" msgstr "Référence interne de la demande de traitement" -#: forms_treatments.py:508 forms_treatments.py:604 models_treatments.py:451 -#: models_treatments.py:475 +#: forms_treatments.py:508 forms_treatments.py:604 models_treatments.py:468 +#: models_treatments.py:492 msgid "Treatment request type" msgstr "Type de demande de traitement" @@ -652,7 +652,7 @@ msgstr "Gestion des éléments" msgid "Documentation" msgstr "Documentation" -#: ishtar_menu.py:133 ishtar_menu.py:214 models_finds.py:1082 +#: ishtar_menu.py:133 ishtar_menu.py:214 models_finds.py:1137 msgid "Administrative act" msgstr "Acte administratif" @@ -665,8 +665,8 @@ msgstr "Documents" msgid "Source" msgstr "Documentation" -#: ishtar_menu.py:185 models_treatments.py:147 models_treatments.py:283 -#: models_treatments.py:567 models_treatments.py:570 +#: ishtar_menu.py:185 models_treatments.py:148 models_treatments.py:300 +#: models_treatments.py:590 models_treatments.py:593 #: templates/ishtar/sheet_treatment.html:5 msgid "Treatment" msgstr "Traitement" @@ -675,113 +675,113 @@ msgstr "Traitement" msgid "Simple treatments" msgstr "Traitements simples" -#: models_finds.py:44 +#: models_finds.py:43 msgid "Code" msgstr "Code" -#: models_finds.py:45 +#: models_finds.py:44 msgid "Recommendation" msgstr "Recommandation" -#: models_finds.py:48 +#: models_finds.py:47 msgid "Parent material" msgstr "Matériau parent" -#: models_finds.py:52 models_finds.py:525 models_finds.py:602 +#: models_finds.py:51 models_finds.py:539 models_finds.py:616 msgid "Material types" msgstr "Types de matériau" -#: models_finds.py:60 +#: models_finds.py:59 msgid "Parent conservatory state" msgstr "État sanitaire - parent" -#: models_finds.py:64 +#: models_finds.py:63 msgid "Conservatory states" msgstr "États sanitaires" -#: models_finds.py:73 +#: models_finds.py:72 msgid "Preservation types" msgstr "Types de conservation" -#: models_finds.py:81 +#: models_finds.py:80 msgid "Integrity / interest type" msgstr "Type d'intégrité / intérêt" -#: models_finds.py:82 +#: models_finds.py:81 msgid "Integrity / interest types" msgstr "Types d'intégrité / intérêt" -#: models_finds.py:90 +#: models_finds.py:89 msgid "Remarkability type" msgstr "Type de remarquabilité" -#: models_finds.py:91 +#: models_finds.py:90 msgid "Remarkability types" msgstr "Types de remarquabilité" -#: models_finds.py:98 models_finds.py:598 models_treatments.py:40 -#: models_treatments.py:287 +#: models_finds.py:97 models_finds.py:612 models_treatments.py:40 +#: models_treatments.py:304 msgid "Order" msgstr "Ordre" -#: models_finds.py:100 +#: models_finds.py:99 msgid "Batch type" msgstr "Type de lot" -#: models_finds.py:101 +#: models_finds.py:100 msgid "Batch types" msgstr "Types de lot" -#: models_finds.py:109 +#: models_finds.py:108 msgid "Parent" msgstr "Parent" -#: models_finds.py:152 models_finds.py:595 models_treatments.py:124 -#: models_treatments.py:471 +#: models_finds.py:151 models_finds.py:609 models_treatments.py:125 +#: models_treatments.py:488 msgid "External ID" msgstr "ID externe" -#: models_finds.py:154 models_finds.py:597 +#: models_finds.py:153 models_finds.py:611 msgid "External ID is set automatically" msgstr "L'identifiant externe est configuré automatiquement" -#: models_finds.py:157 +#: models_finds.py:156 msgid "Special interest" msgstr "Intérêt spécifique" -#: models_finds.py:161 +#: models_finds.py:160 msgid "Context Record" msgstr "Unité d'Enregistrement" -#: models_finds.py:162 +#: models_finds.py:161 msgid "Discovery date" msgstr "Date de découverte" -#: models_finds.py:167 +#: models_finds.py:166 msgid "Material index" msgstr "Index matériel" -#: models_finds.py:183 +#: models_finds.py:182 msgid "Point (2D)" msgstr "Point (2D)" -#: models_finds.py:184 +#: models_finds.py:183 msgid "Point" msgstr "Point" -#: models_finds.py:185 +#: models_finds.py:184 msgid "Line" msgstr "Ligne" -#: models_finds.py:186 +#: models_finds.py:185 msgid "Polygon" msgstr "Polygon" -#: models_finds.py:189 models_finds.py:192 +#: models_finds.py:188 models_finds.py:191 msgid "Cached value - do not edit" msgstr "Valeur en cache - ne pas éditer" -#: models_finds.py:197 models_finds.py:593 +#: models_finds.py:197 models_finds.py:607 msgid "Base find" msgstr "Mobilier de base" @@ -809,149 +809,169 @@ msgstr "Peut modifier son propre Mobilier de base" msgid "Can delete own Base find" msgstr "Peut supprimer son propre Mobilier de base" -#: models_finds.py:430 +#: models_finds.py:443 msgid "g" msgstr "g" -#: models_finds.py:431 +#: models_finds.py:444 msgid "kg" msgstr "kg" -#: models_finds.py:433 +#: models_finds.py:446 msgid "Not checked" msgstr "Non vérifié" -#: models_finds.py:434 +#: models_finds.py:447 msgid "Checked but incorrect" msgstr "Vérifié mais incorrect" -#: models_finds.py:435 +#: models_finds.py:448 msgid "Checked and correct" msgstr "Vérifié et correct" -#: models_finds.py:506 +#: models_finds.py:520 msgid "Base find - Short ID" msgstr "Mobilier de base - ID court" -#: models_finds.py:507 +#: models_finds.py:521 msgid "Base find - Complete ID" msgstr "Mobilier de base - ID complet" -#: models_finds.py:509 +#: models_finds.py:523 msgid "Operation (code)" msgstr "Opération (code)" -#: models_finds.py:511 +#: models_finds.py:525 msgid "Town" msgstr "Ville" -#: models_finds.py:513 +#: models_finds.py:527 msgid "Operation (name)" msgstr "Opération (nom)" -#: models_finds.py:515 +#: models_finds.py:529 msgid "Parcel" msgstr "Parcelle" -#: models_finds.py:516 +#: models_finds.py:530 msgid "Batch" msgstr "Lot" -#: models_finds.py:517 +#: models_finds.py:531 msgid "Base find - Comment" msgstr "Mobilier de base - Commentaires" -#: models_finds.py:518 +#: models_finds.py:532 msgid "Base find - Description" msgstr "Mobilier de base - Description" -#: models_finds.py:519 +#: models_finds.py:533 msgid "Base find - Topographic localisation" msgstr "Mobilier de base - Localisation topographique" -#: models_finds.py:521 +#: models_finds.py:535 msgid "Base find - Special interest" msgstr "Mobilier de base - Intérêt spécifique" -#: models_finds.py:522 +#: models_finds.py:536 msgid "Base find - Discovery date" msgstr "Mobilier de base - Date de découverte" -#: models_finds.py:523 models_finds.py:626 models_treatments.py:131 -#: models_treatments.py:295 templates/ishtar/sheet_find.html:90 +#: models_finds.py:537 models_finds.py:640 models_treatments.py:132 +#: models_treatments.py:312 templates/ishtar/sheet_find.html:90 #: templates/ishtar/sheet_find.html:132 msgid "Container" msgstr "Contenant" -#: models_finds.py:524 +#: models_finds.py:538 msgid "Periods" msgstr "Périodes" -#: models_finds.py:609 +#: models_finds.py:623 msgid "Type of preservation to consider" msgstr "Mesures de conservation à envisager" -#: models_finds.py:613 +#: models_finds.py:627 msgid "Weight unit" msgstr "Unité de poids" -#: models_finds.py:619 templates/ishtar/sheet_find.html:78 +#: models_finds.py:633 templates/ishtar/sheet_find.html:78 msgid "Upstream treatment" msgstr "Traitement amont" -#: models_finds.py:622 templates/ishtar/sheet_find.html:120 +#: models_finds.py:636 templates/ishtar/sheet_find.html:120 msgid "Downstream treatment" msgstr "Traitement aval" -#: models_finds.py:660 +#: models_finds.py:675 msgid "Collection" msgstr "Collection" -#: models_finds.py:662 models_treatments.py:143 models_treatments.py:495 +#: models_finds.py:677 models_treatments.py:144 models_treatments.py:512 msgid "Cached name" msgstr "Nom en cache" -#: models_finds.py:671 +#: models_finds.py:686 msgid "Can view all Finds" msgstr "Peut voir tout le Mobilier" -#: models_finds.py:672 +#: models_finds.py:687 msgid "Can view own Find" msgstr "Peut voir son propre Mobilier" -#: models_finds.py:673 +#: models_finds.py:688 msgid "Can add own Find" msgstr "Peut ajouter son propre Mobilier" -#: models_finds.py:674 +#: models_finds.py:689 msgid "Can change own Find" msgstr "Peut modifier son propre Mobilier" -#: models_finds.py:675 +#: models_finds.py:690 msgid "Can delete own Find" msgstr "Peut supprimer son propre Mobilier" -#: models_finds.py:681 +#: models_finds.py:696 msgid "FIND" msgstr "MOBILIER" -#: models_finds.py:1069 +#: models_finds.py:1100 msgid "Find documentation" msgstr "Documentation de mobilier" -#: models_finds.py:1070 +#: models_finds.py:1101 msgid "Find documentations" msgstr "Documentations de mobilier" -#: models_finds.py:1083 +#: models_finds.py:1104 +msgid "Can view all Find sources" +msgstr "Peut voir toutes les Documentations de mobilier" + +#: models_finds.py:1106 +msgid "Can view own Find source" +msgstr "Peut voir sa propre Documentation de mobilier" + +#: models_finds.py:1108 +msgid "Can add own Find source" +msgstr "Peut ajouter sa propre Documentation de mobilier" + +#: models_finds.py:1110 +msgid "Can change own Find source" +msgstr "Peut modifier sa propre Documentation de mobilier" + +#: models_finds.py:1112 +msgid "Can delete own Find source" +msgstr "Peut suprimer sa propre Documentation de mobilier" + +#: models_finds.py:1138 msgid "Person" msgstr "Individu" -#: models_finds.py:1089 +#: models_finds.py:1144 msgid "Property" msgstr "Propriété" -#: models_finds.py:1090 +#: models_finds.py:1145 msgid "Properties" msgstr "Propriétés" @@ -995,138 +1015,202 @@ msgstr "Type d'état de traitement" msgid "Treatment state types" msgstr "Types d'état de traitement" -#: models_treatments.py:89 +#: models_treatments.py:90 msgid "Downstream find" msgstr "Mobilier aval" -#: models_treatments.py:116 +#: models_treatments.py:117 msgid "Location where the treatment is done. Target warehouse for a move." msgstr "" "Endroit où le traitement est réalisé. Renseignez le dépôt de destination " "pour un déplacement." -#: models_treatments.py:133 +#: models_treatments.py:134 msgid "Estimated cost" msgstr "Coût estimé" -#: models_treatments.py:135 +#: models_treatments.py:136 msgid "Quoted cost" msgstr "Coût devisé" -#: models_treatments.py:137 +#: models_treatments.py:138 msgid "Realized cost" msgstr "Coût réalisé" -#: models_treatments.py:139 +#: models_treatments.py:140 msgid "Insurance cost" msgstr "Coût d'assurance" -#: models_treatments.py:141 +#: models_treatments.py:142 msgid "Target a basket" msgstr "Appliquer à un panier" -#: models_treatments.py:148 templates/ishtar/sheet_find.html:75 +#: models_treatments.py:149 templates/ishtar/sheet_find.html:75 #: templates/ishtar/sheet_treatmentfile.html:46 msgid "Treatments" msgstr "Traitements" -#: models_treatments.py:151 +#: models_treatments.py:152 msgid "Can view all Treatments" msgstr "Peut voir tous les Traitements" -#: models_treatments.py:152 +#: models_treatments.py:153 msgid "Can view own Treatment" msgstr "Peut voir son propre Traitement" -#: models_treatments.py:153 +#: models_treatments.py:154 msgid "Can add own Treatment" msgstr "Peut ajouter son propre Traitement" -#: models_treatments.py:154 +#: models_treatments.py:155 msgid "Can change own Treatment" msgstr "Peut modifier son propre Traitement" -#: models_treatments.py:155 +#: models_treatments.py:156 msgid "Can delete own Treatment" msgstr "Peut supprimer son propre Traitement" -#: models_treatments.py:167 +#: models_treatments.py:168 msgid "TREATMENT" msgstr "TRAITEMENT" -#: models_treatments.py:296 templates/ishtar/sheet_find.html:89 +#: models_treatments.py:313 templates/ishtar/sheet_find.html:89 #: templates/ishtar/sheet_find.html:131 msgid "Doer" msgstr "Opérateur" -#: models_treatments.py:297 models_treatments.py:298 +#: models_treatments.py:314 models_treatments.py:315 msgid "Related finds" msgstr "Mobilier associé" -#: models_treatments.py:440 +#: models_treatments.py:457 msgid "Is upstream" msgstr "Est en amont" -#: models_treatments.py:452 +#: models_treatments.py:469 msgid "Treatment request types" msgstr "Types de demande de traitement" -#: models_treatments.py:469 +#: models_treatments.py:486 msgid "Internal reference" msgstr "Référence interne" -#: models_treatments.py:478 +#: models_treatments.py:495 msgid "Person in charge" msgstr "Personne responsable" -#: models_treatments.py:490 +#: models_treatments.py:507 msgid "Creation date" msgstr "Date de création" -#: models_treatments.py:500 +#: models_treatments.py:517 msgid "Treatment requests" msgstr "Demandes de traitement" -#: models_treatments.py:504 +#: models_treatments.py:521 msgid "Can view all Treatment requests" msgstr "Peut voir toutes les Demandes de traitement" -#: models_treatments.py:506 +#: models_treatments.py:523 +msgid "Can add Treatment request" +msgstr "Peut ajouter une Demande de traitement" + +#: models_treatments.py:525 +msgid "Can change Treatment request" +msgstr "Peut modifier une Demande de traitement" + +#: models_treatments.py:527 +msgid "Can delete Treatment request" +msgstr "Peut supprimer une Demande de traitement" + +#: models_treatments.py:529 msgid "Can view own Treatment request" msgstr "Peut voir sa propre Demande de traitement" -#: models_treatments.py:508 +#: models_treatments.py:531 msgid "Can add own Treatment request" msgstr "Peut ajouter sa propre Demande de traitement" -#: models_treatments.py:510 +#: models_treatments.py:533 msgid "Can change own Treatment request" msgstr "Peut modifier sa propre Demande de traitement" -#: models_treatments.py:512 +#: models_treatments.py:535 msgid "Can delete own Treatment request" msgstr "Peut supprimer sa propre Demande de traitement" -#: models_treatments.py:574 +#: models_treatments.py:597 msgid "Treatment documentation" msgstr "Documentation de traitement" -#: models_treatments.py:575 +#: models_treatments.py:598 msgid "Treament documentations" msgstr "Documentations de traitement" -#: models_treatments.py:588 +#: models_treatments.py:601 +msgid "Can view all Treatment source" +msgstr "Peut voir toutes les Documentations de traitement" + +#: models_treatments.py:603 +msgid "Can view own Treatment source" +msgstr "Peut voir sa propre Documentation de traitement" + +#: models_treatments.py:605 +msgid "Can add own Treatment source" +msgstr "Peut ajouter sa propre Documentation de traitement" + +#: models_treatments.py:607 +msgid "Can change own Treatment source" +msgstr "Peut modifier sa propre Documentation de traitement" + +#: models_treatments.py:609 +msgid "Can delete own Treatment source" +msgstr "Peut supprimer sa propre Documentation de traitement" + +#: models_treatments.py:623 msgid "Treatment file" msgstr "Dossier de traitement" -#: models_treatments.py:592 +#: models_treatments.py:627 msgid "Treatment request documentation" msgstr "Documentation de demande de traitement" -#: models_treatments.py:593 +#: models_treatments.py:628 msgid "Treatment request documentations" msgstr "Documentations de demande de traitement" +#: models_treatments.py:631 +msgid "Can view all Treatment request source" +msgstr "Peut voir toutes les Documentations de demande de traitement" + +#: models_treatments.py:633 +msgid "Can add Treatment request source" +msgstr "Peut ajouter une Documentation de demande de traitement" + +#: models_treatments.py:635 +msgid "Can change Treatment request source" +msgstr "Peut modifier une Documentation de demande de traitement" + +#: models_treatments.py:637 +msgid "Can delete Treatment request source" +msgstr "Peut supprimer une Documentation de demande de traitement" + +#: models_treatments.py:639 +msgid "Can view own Treatment request source" +msgstr "Peut voir sa propre Documentation de demande de traitement" + +#: models_treatments.py:641 +msgid "Can add own Treatment request source" +msgstr "Peut ajouter sa propre Documentation de demande de traitement" + +#: models_treatments.py:643 +msgid "Can change own Treatment request source" +msgstr "Peut modifier sa propre Documentation de demande de traitement" + +#: models_treatments.py:645 +msgid "Can delete own Treatment request source" +msgstr "Peut supprimer sa propre Documentation de demande de traitement" + #: views.py:138 msgid "New find" msgstr "Ajouter un mobilier" diff --git a/translations/fr/archaeological_operations.po b/translations/fr/archaeological_operations.po index af55782dc..f5d721c46 100644 --- a/translations/fr/archaeological_operations.po +++ b/translations/fr/archaeological_operations.po @@ -12,20 +12,20 @@ msgstr "" "MIME-Version: 1.0\n" "Content-Transfer-Encoding: 8bit\n" "Content-Type: text/plain; charset=UTF-8\n" -"PO-Revision-Date: 2017-03-16 05:04-0400\n" -"Last-Translator: Étienne Loks <etienne.loks@iggdrasil.net>\n" +"PO-Revision-Date: 2017-04-07 05:51-0400\n" +"Last-Translator: Valérie-Emma Leroux <emma@iggdrasil.net>\n" "Language-Team: \n" "Language: fr\n" "Plural-Forms: nplurals=2; plural=n>1;\n" "X-Generator: Zanata 3.9.6\n" -#: forms.py:69 forms.py:371 forms.py:1013 forms.py:1035 forms.py:1039 -#: models.py:1247 templates/ishtar/sheet_operation.html:151 +#: forms.py:69 forms.py:371 forms.py:1047 forms.py:1069 forms.py:1073 +#: models.py:1252 templates/ishtar/sheet_operation.html:153 #: templates/ishtar/blocks/window_tables/parcels.html:10 msgid "Parcels" msgstr "Parcelles" -#: forms.py:72 forms.py:205 forms.py:989 models.py:1233 +#: forms.py:72 forms.py:205 forms.py:1023 models.py:1238 #: templates/ishtar/blocks/window_tables/parcels.html:7 #: templates/ishtar/dashboards/dashboard_operation.html:432 #: templates/ishtar/dashboards/dashboard_operation.html:446 @@ -34,22 +34,22 @@ msgstr "Parcelles" msgid "Town" msgstr "Commune" -#: forms.py:74 forms.py:455 forms.py:756 forms.py:1259 models.py:272 -#: models.py:1039 models.py:1231 +#: forms.py:74 forms.py:481 forms.py:783 forms.py:1293 models.py:276 +#: models.py:1044 models.py:1236 #: templates/ishtar/blocks/window_tables/parcels.html:8 msgid "Year" msgstr "Année" -#: forms.py:77 models.py:1234 +#: forms.py:77 models.py:1239 #: templates/ishtar/blocks/window_tables/parcels.html:9 msgid "Section" msgstr "Section" -#: forms.py:80 models.py:1236 +#: forms.py:80 models.py:1241 msgid "Parcel number" msgstr "Numéro de parcelle" -#: forms.py:82 models.py:1238 models.py:1255 models.py:1304 +#: forms.py:82 models.py:1243 models.py:1260 models.py:1309 msgid "Public domain" msgstr "Domaine public" @@ -85,45 +85,49 @@ msgstr "Il y a des parcelles identiques." msgid "Relation type" msgstr "Type de relation" -#: forms.py:383 ishtar_menu.py:30 models.py:368 models.py:849 models.py:884 -#: models.py:917 models.py:1021 models.py:1230 wizards.py:344 wizards.py:355 +#: forms.py:383 ishtar_menu.py:30 models.py:372 models.py:847 models.py:882 +#: models.py:922 models.py:1026 models.py:1235 wizards.py:353 wizards.py:364 #: templates/ishtar/sheet_operation.html:4 msgid "Operation" msgstr "Opération" -#: forms.py:403 +#: forms.py:406 msgid ":" msgstr ": " -#: forms.py:411 forms.py:607 forms.py:1224 +#: forms.py:414 forms.py:633 forms.py:1258 msgid "You should select an operation." msgstr "Vous devez sélectionner une opération." -#: forms.py:415 +#: forms.py:418 msgid "You should select a relation type." msgstr "Vous devez sélectionner un type de relation." -#: forms.py:445 +#: forms.py:421 +msgid "An operation cannot be related to herself." +msgstr "Une opération ne peut être associée à elle-même." + +#: forms.py:451 msgid "Current relations" msgstr "Relations actuelles" -#: forms.py:447 +#: forms.py:453 msgid "Deleted relations" msgstr "Relations supprimées" -#: forms.py:451 templates/ishtar/sheet_operation.html:85 +#: forms.py:477 templates/ishtar/sheet_operation.html:86 msgid "Relations" msgstr "Relations" -#: forms.py:456 forms.py:1230 models.py:273 +#: forms.py:482 forms.py:1264 models.py:277 msgid "Numeric reference" msgstr "Identifiant numérique" -#: forms.py:462 forms.py:1270 +#: forms.py:488 forms.py:1304 msgid "Parcel (section/number/public domain)" msgstr "Parcelle (section/numéro/domaine public)" -#: forms.py:465 forms.py:1273 models.py:850 +#: forms.py:491 forms.py:1307 models.py:848 #: templates/ishtar/dashboards/dashboard_operation.html:390 #: templates/ishtar/dashboards/dashboard_operation.html:411 #: templates/ishtar/dashboards/dashboard_operation.html:643 @@ -132,253 +136,257 @@ msgstr "Parcelle (section/numéro/domaine public)" msgid "Department" msgstr "Département" -#: forms.py:466 forms.py:1101 models.py:86 +#: forms.py:492 forms.py:1135 models.py:86 #: templates/ishtar/sheet_operation.html:22 #: templates/ishtar/blocks/window_tables/archaeologicalsites.html:8 msgid "Name" msgstr "Nom" -#: forms.py:468 forms.py:752 models.py:334 +#: forms.py:494 forms.py:779 models.py:338 msgid "Address / Locality" msgstr "Adresse / Lieu-dit" -#: forms.py:470 forms.py:674 forms.py:754 forms.py:1236 models.py:280 +#: forms.py:496 forms.py:700 forms.py:781 forms.py:1270 models.py:284 msgid "Operation type" msgstr "Type d'opération" -#: forms.py:472 +#: forms.py:498 msgid "Is open?" msgstr "Est ouvert ?" -#: forms.py:480 forms.py:786 models.py:269 +#: forms.py:506 forms.py:813 models.py:269 msgid "In charge" msgstr "Responsable du suivi scientifique" -#: forms.py:487 models.py:1015 +#: forms.py:513 models.py:1020 msgid "Scientist in charge" msgstr "Responsable scientifique" -#: forms.py:489 forms.py:676 forms.py:776 models.py:267 +#: forms.py:515 forms.py:702 forms.py:803 models.py:267 msgid "Operator" msgstr "Opérateur" -#: forms.py:498 forms.py:1106 models.py:90 models.py:282 +#: forms.py:524 forms.py:1140 models.py:90 models.py:286 #: templates/ishtar/blocks/window_tables/archaeologicalsites.html:10 msgid "Remains" msgstr "Vestiges" -#: forms.py:499 forms.py:1084 forms.py:1103 models.py:88 models.py:288 +#: forms.py:525 forms.py:1118 forms.py:1137 models.py:88 models.py:292 #: templates/ishtar/blocks/window_tables/archaeologicalsites.html:9 msgid "Periods" msgstr "Périodes" -#: forms.py:500 +#: forms.py:526 msgid "Started before" msgstr "Commencé avant" -#: forms.py:502 +#: forms.py:528 msgid "Started after" msgstr "Commencé après" -#: forms.py:504 +#: forms.py:530 msgid "Ended before" msgstr "Terminé avant" -#: forms.py:506 +#: forms.py:532 msgid "Ended after" msgstr "Terminé après" -#: forms.py:509 +#: forms.py:535 msgid "Search within relations" msgstr "Rechercher parmi les relations" -#: forms.py:511 forms.py:841 +#: forms.py:537 forms.py:867 msgid "Comment" msgstr "Commentaire" -#: forms.py:512 +#: forms.py:538 msgid "Abstract (full text search)" msgstr "Résumé (recherche texte intégral)" -#: forms.py:514 forms.py:844 models.py:337 +#: forms.py:540 forms.py:870 models.py:341 msgid "Comment about scientific documentation" msgstr "Commentaire concernant la documentation scientifique" -#: forms.py:515 forms.py:846 models.py:349 +#: forms.py:541 forms.py:872 models.py:353 msgid "Record quality" msgstr "Qualité d'enregistrement" -#: forms.py:516 forms.py:811 models.py:300 +#: forms.py:542 forms.py:837 models.py:304 msgid "Report processing" msgstr "Traitement du rapport" -#: forms.py:518 forms.py:849 models.py:344 +#: forms.py:544 forms.py:875 models.py:348 msgid "Virtual operation" msgstr "Opération virtuelle" -#: forms.py:520 forms.py:1146 forms.py:1150 models.py:94 +#: forms.py:546 forms.py:1180 forms.py:1184 models.py:94 msgid "Archaeological site" msgstr "Entité archéologique" -#: forms.py:526 forms.py:1277 +#: forms.py:552 forms.py:1311 msgid "Created by" msgstr "Créé par" -#: forms.py:532 forms.py:1283 +#: forms.py:558 forms.py:1317 msgid "Modified by" msgstr "Modifié par" -#: forms.py:539 +#: forms.py:565 msgid "Documentation deadline before" msgstr "Date limite de rendu de la documentation avant" -#: forms.py:541 +#: forms.py:567 msgid "Documentation deadline after" msgstr "Date limite de rendu de la documentation après" -#: forms.py:543 forms.py:834 models.py:356 +#: forms.py:569 forms.py:860 models.py:360 msgid "Documentation received" msgstr "Documentation reçue" -#: forms.py:545 +#: forms.py:571 msgid "Finds deadline before" msgstr "Date limite de rendu du mobilier avant" -#: forms.py:547 +#: forms.py:573 msgid "Finds deadline after" msgstr "Date limite de rendu du mobilier après" -#: forms.py:549 forms.py:839 models.py:360 +#: forms.py:575 forms.py:865 models.py:364 msgid "Finds received" msgstr "Mobilier reçu" -#: forms.py:594 forms.py:1222 views.py:168 +#: forms.py:620 forms.py:1256 views.py:168 msgid "Operation search" msgstr "Rechercher une opération" -#: forms.py:638 +#: forms.py:664 msgid "Associated file" msgstr "Dossier associé" -#: forms.py:642 forms.py:937 models.py:516 models.py:916 models.py:1026 +#: forms.py:668 forms.py:971 models.py:520 models.py:921 models.py:1031 #: wizards.py:80 msgid "Archaeological file" msgstr "Dossier archéologique" -#: forms.py:649 forms.py:651 models.py:351 +#: forms.py:675 forms.py:677 models.py:355 msgid "Abstract" msgstr "Résumé" -#: forms.py:654 +#: forms.py:680 msgid "months" msgstr "mois" -#: forms.py:654 +#: forms.py:680 msgid "years" msgstr "années" -#: forms.py:656 models.py:253 +#: forms.py:682 models.py:253 msgid "Creation date" msgstr "Date de création" -#: forms.py:657 +#: forms.py:683 msgid "Start of field work" msgstr "Début du travail de terrain" -#: forms.py:659 +#: forms.py:685 msgid "All" msgstr "Tout" -#: forms.py:660 +#: forms.py:686 msgid "Preventive" msgstr "Préventif" -#: forms.py:661 +#: forms.py:687 msgid "Research" msgstr "Programmé" -#: forms.py:665 +#: forms.py:691 msgid "Slicing" msgstr "Découpage" -#: forms.py:668 +#: forms.py:694 msgid "Department detail" msgstr "Détail par département" -#: forms.py:670 +#: forms.py:696 msgid "Date get from" msgstr "Date obtenue depuis" -#: forms.py:672 +#: forms.py:698 msgid "Preventive/Research" msgstr "Préventif/Programmé" -#: forms.py:678 +#: forms.py:704 msgid "Date after" msgstr "Date après" -#: forms.py:680 +#: forms.py:706 msgid "Date before" msgstr "Date avant" -#: forms.py:682 +#: forms.py:708 msgid "With reports" msgstr "Avec un rapport" -#: forms.py:683 +#: forms.py:709 msgid "With finds" msgstr "Avec du mobilier" -#: forms.py:735 forms.py:1331 templates/ishtar/sheet_administrativeact.html:20 +#: forms.py:761 forms.py:1365 templates/ishtar/sheet_administrativeact.html:20 #: templates/ishtar/sheet_operation.html:26 msgid "General" msgstr "Général" -#: forms.py:750 models.py:333 +#: forms.py:777 models.py:337 msgid "Generic name" msgstr "Nom générique" -#: forms.py:761 models.py:302 +#: forms.py:788 models.py:306 msgid "Old code" msgstr "Ancien code" -#: forms.py:764 +#: forms.py:791 msgid "Head scientist" msgstr "Responsable scientifique" -#: forms.py:783 models.py:332 +#: forms.py:810 models.py:336 msgid "Operator reference" msgstr "Référence de l'opérateur" -#: forms.py:797 +#: forms.py:823 models.py:273 +msgid "Collaborators" +msgstr "Collaborateurs" + +#: forms.py:826 msgid "Total surface (m2)" msgstr "Surface totale (m2)" -#: forms.py:804 models.py:54 models.py:256 models.py:1443 +#: forms.py:830 models.py:54 models.py:256 models.py:1448 msgid "Start date" msgstr "Date de début" -#: forms.py:806 models.py:258 +#: forms.py:832 models.py:258 msgid "Excavation end date" msgstr "Date de fin de chantier" -#: forms.py:809 models.py:259 +#: forms.py:835 models.py:259 msgid "Report delivery date" msgstr "Date de livraison du rapport" -#: forms.py:831 models.py:353 +#: forms.py:857 models.py:357 msgid "Deadline for submission of the documentation" msgstr "Date limite de rendu de la documentation" -#: forms.py:836 models.py:358 +#: forms.py:862 models.py:362 msgid "Deadline for submission of the finds" msgstr "Date limite de rendu du mobilier" -#: forms.py:851 +#: forms.py:877 msgid "Image" msgstr "Image" -#: forms.py:852 +#: forms.py:878 #, python-format msgid "" "<p>Heavy images are resized to: %(width)dx%(height)d (ratio is preserved).</" @@ -387,19 +395,19 @@ msgstr "" "<p>Les images trop grandes sont retaillées en : %(width)dx%(height)d (le " "ratio est conservé).</p>" -#: forms.py:890 +#: forms.py:924 msgid "" "If you want to set an excavation end date you have to provide a start date." msgstr "" "Avant de renseigner la date de fin de chantier, il est nécessaire de " "renseigner une date de début." -#: forms.py:895 +#: forms.py:929 msgid "The excavation end date cannot be before the start date." msgstr "" "La date de fin de chantier ne peut être antérieure à la date de début." -#: forms.py:923 +#: forms.py:957 #, python-format msgid "" "Operation code already exists for year: %(year)d - use a value bigger than " @@ -408,106 +416,106 @@ msgstr "" "Ce code d'opération existe déjà pour l'année %(year)d - utilisez une valeur " "plus grande que %(last_val)d" -#: forms.py:927 +#: forms.py:961 msgid "Bad operation code" msgstr "Mauvais code d'opération" -#: forms.py:933 models.py:531 models.py:879 +#: forms.py:967 models.py:535 models.py:877 msgid "Operation code" msgstr "Code de l'opération" -#: forms.py:959 +#: forms.py:993 msgid "Preventive informations - excavation" msgstr "Information archéologie préventive - fouille" -#: forms.py:960 models.py:286 +#: forms.py:994 models.py:290 #: templates/ishtar/dashboards/dashboard_operation.html:701 msgid "Cost (euros)" msgstr "Coût (euros)" -#: forms.py:961 models.py:291 +#: forms.py:995 models.py:295 msgid "Scheduled man-days" msgstr "Jours-hommes prévus" -#: forms.py:963 models.py:294 +#: forms.py:997 models.py:298 msgid "Optional man-days" msgstr "Jours-hommes optionnels" -#: forms.py:965 models.py:297 +#: forms.py:999 models.py:301 msgid "Effective man-days" msgstr "Jours-hommes effectifs" -#: forms.py:975 +#: forms.py:1009 msgid "Preventive informations - diagnostic" msgstr "Information archéologie préventive - diagnostic" -#: forms.py:978 models.py:316 +#: forms.py:1012 models.py:320 msgid "Prescription on zoning" msgstr "Prescription sur zonage" -#: forms.py:980 models.py:319 +#: forms.py:1014 models.py:323 msgid "Prescription on large area" msgstr "Prescription sur une vaste surface" -#: forms.py:983 models.py:321 +#: forms.py:1017 models.py:325 msgid "Prescription on geoarchaeological context" msgstr "Prescription sur un contexte géoarchéologique" -#: forms.py:987 forms.py:1009 models.py:284 models.py:1049 +#: forms.py:1021 forms.py:1043 models.py:288 models.py:1054 msgid "Towns" msgstr "Communes" -#: forms.py:1016 models.py:1246 models.py:1441 +#: forms.py:1050 models.py:1251 models.py:1446 msgid "Parcel" msgstr "Parcelle" -#: forms.py:1068 models.py:46 +#: forms.py:1102 models.py:46 msgid "Remain types" msgstr "Types de vestige" -#: forms.py:1072 models.py:45 +#: forms.py:1106 models.py:45 msgid "Remain type" msgstr "Type de vestige" -#: forms.py:1088 templates/ishtar/sheet_operation.html:171 -#: templates/ishtar/sheet_operation.html:202 +#: forms.py:1122 templates/ishtar/sheet_operation.html:173 +#: templates/ishtar/sheet_operation.html:204 msgid "Period" msgstr "Période" -#: forms.py:1100 models.py:85 +#: forms.py:1134 models.py:85 msgid "Reference" msgstr "Référence" -#: forms.py:1129 +#: forms.py:1163 msgid "This reference already exists." msgstr "Cette référence existe déjà." -#: forms.py:1161 models.py:95 models.py:341 -#: templates/ishtar/sheet_operation.html:96 +#: forms.py:1195 models.py:95 models.py:345 +#: templates/ishtar/sheet_operation.html:97 msgid "Archaeological sites" msgstr "Entités archéologiques" -#: forms.py:1165 +#: forms.py:1199 msgid "Associated archaeological sites" msgstr "Entités archéologiques associées" -#: forms.py:1171 ishtar_menu.py:34 ishtar_menu.py:64 ishtar_menu.py:93 +#: forms.py:1205 ishtar_menu.py:34 ishtar_menu.py:64 ishtar_menu.py:93 msgid "Search" msgstr "Recherche" -#: forms.py:1176 +#: forms.py:1210 msgid "Would you like to close this operation?" msgstr "Voulez-vous clore cette opération ?" -#: forms.py:1181 +#: forms.py:1215 msgid "Would you like to delete this operation?" msgstr "Voulez-vous supprimer cette opération ?" -#: forms.py:1190 forms.py:1260 forms.py:1396 models.py:886 models.py:1006 +#: forms.py:1224 forms.py:1294 forms.py:1430 models.py:884 models.py:1011 msgid "Index" msgstr "Index" -#: forms.py:1216 +#: forms.py:1250 #, python-format msgid "" "Index already exists for operation: %(operation)s - use a value bigger than " @@ -516,48 +524,48 @@ msgstr "" "Cet index existe déjà pour l'opération : %(operation)s, utilisez une valeur " "plus grande que %(last_val)d" -#: forms.py:1228 +#: forms.py:1262 msgid "Operation's year" msgstr "Année de l'opération" -#: forms.py:1235 +#: forms.py:1269 msgid "Operation's town" msgstr "Commune de l'opération" -#: forms.py:1248 +#: forms.py:1282 msgid "Documentation search" msgstr "Rechercher une documentation" -#: forms.py:1250 +#: forms.py:1284 msgid "You should select a document." msgstr "Vous devez sélectionner un document." -#: forms.py:1267 forms.py:1334 models.py:930 models.py:1000 +#: forms.py:1301 forms.py:1368 models.py:935 models.py:1005 msgid "Act type" msgstr "Type d'acte" -#: forms.py:1268 forms.py:1466 +#: forms.py:1302 forms.py:1500 msgid "Indexed?" msgstr "Indexé ?" -#: forms.py:1274 forms.py:1339 models.py:1040 +#: forms.py:1308 forms.py:1373 models.py:1045 #: templates/ishtar/blocks/window_tables/administrativacts.html:10 msgid "Object" msgstr "Objet" -#: forms.py:1311 views.py:333 +#: forms.py:1345 views.py:348 msgid "Administrative act search" msgstr "Rechercher un acte administratif" -#: forms.py:1326 forms.py:1424 forms.py:1491 +#: forms.py:1360 forms.py:1458 forms.py:1525 msgid "You should select an administrative act." msgstr "Vous devez sélectionner un acte administratif." -#: forms.py:1342 models.py:1037 +#: forms.py:1376 models.py:1042 msgid "Signature date" msgstr "Date de signature" -#: forms.py:1384 +#: forms.py:1418 #, python-format msgid "" "This index already exists for year: %(year)d - use a value bigger than " @@ -566,31 +574,31 @@ msgstr "" "Cet index existe déjà pour l'année : %(year)d, utilisez une valeur plus " "grande que %(last_val)d" -#: forms.py:1388 +#: forms.py:1422 msgid "Bad index" msgstr "Mauvais index" -#: forms.py:1401 +#: forms.py:1435 msgid "Would you like to delete this administrative act?" msgstr "Voulez-vous supprimer cet acte administratif ?" -#: forms.py:1406 +#: forms.py:1440 msgid "Template" msgstr "Patron" -#: forms.py:1430 forms.py:1434 +#: forms.py:1464 forms.py:1468 msgid "This document is not intended for this type of act." msgstr "Ce document n'est pas destiné à ce type d'acte." -#: forms.py:1452 +#: forms.py:1486 msgid "Doc generation" msgstr "Génération de document" -#: forms.py:1454 +#: forms.py:1488 msgid "Generate the associated doc?" msgstr "Générer le document associé ?" -#: forms.py:1475 ishtar_menu.py:123 views.py:386 +#: forms.py:1509 ishtar_menu.py:123 views.py:401 msgctxt "admin act register" msgid "Register" msgstr "Registre" @@ -611,7 +619,7 @@ msgstr "Clôture" msgid "Deletion" msgstr "Suppression" -#: ishtar_menu.py:59 models.py:1056 +#: ishtar_menu.py:59 models.py:1061 #: templates/ishtar/sheet_administrativeact.html:4 msgid "Administrative act" msgstr "Acte administratif" @@ -636,16 +644,16 @@ msgstr "Tableau de bord" msgid "General informations" msgstr "Informations générales" -#: ishtar_menu.py:139 models.py:369 +#: ishtar_menu.py:139 models.py:373 #: templates/ishtar/dashboards/dashboard_operation.html:8 msgid "Operations" msgstr "Opérations" -#: models.py:53 models.py:71 models.py:1913 +#: models.py:53 models.py:71 models.py:1918 msgid "Order" msgstr "Ordre" -#: models.py:55 models.py:1444 +#: models.py:55 models.py:1449 msgid "End date" msgstr "Date de fin" @@ -761,359 +769,359 @@ msgstr "Date de clôture" msgid "In charge scientist" msgstr "Responsable du suivi scientifique" -#: models.py:277 models.py:1226 +#: models.py:281 models.py:1231 msgid "File" msgstr "Dossier" -#: models.py:281 +#: models.py:285 msgid "Surface (m2)" msgstr "Surface (m2)" -#: models.py:335 +#: models.py:339 msgid "General comment" msgstr "Commentaire général" -#: models.py:338 +#: models.py:342 msgid "Cached name" msgstr "Nom en cache" -#: models.py:346 +#: models.py:350 msgid "" "If checked, it means that this operation have not been officialy registered." msgstr "" "Si coché, cela signifie que cette opération n'a pas été officiellement " "enregistrée." -#: models.py:362 +#: models.py:366 msgid "Point" msgstr "Point" -#: models.py:363 +#: models.py:367 msgid "Multi polygon" msgstr "Polygones multi-parties" -#: models.py:371 +#: models.py:375 msgid "Can view all Operations" msgstr "Peut voir toutes les Opérations" -#: models.py:372 +#: models.py:376 msgid "Can view own Operation" msgstr "Peut voir sa propre Opération" -#: models.py:373 +#: models.py:377 msgid "Can add own Operation" msgstr "Peut ajouter sa propre Opération" -#: models.py:374 +#: models.py:378 msgid "Can change own Operation" msgstr "Peut modifier sa propre Opération" -#: models.py:375 +#: models.py:379 msgid "Can delete own Operation" msgstr "Peut supprimer sa propre Opération" -#: models.py:376 +#: models.py:380 msgid "Can close Operation" msgstr "Peut clore une Opération" -#: models.py:405 +#: models.py:409 msgid "OPE" msgstr "OPE" -#: models.py:479 +#: models.py:483 msgid "Intercommunal" msgstr "Intercommunal" -#: models.py:517 +#: models.py:521 msgid "Code patriarche" msgstr "Code patriarche" -#: models.py:557 +#: models.py:561 msgid "This operation code already exists for this year" msgstr "Ce code d'opération existe déjà pour cette année." -#: models.py:582 +#: models.py:588 msgid "Number of parcels" msgstr "Nombre de parcelles" -#: models.py:600 +#: models.py:598 msgid "Number of administrative acts" msgstr "Nombre d'actes administratifs" -#: models.py:608 +#: models.py:606 msgid "Number of indexed administrative acts" msgstr "Nombre d'actes administratifs indexés" -#: models.py:616 +#: models.py:614 msgid "Number of context records" msgstr "Nombre d'Unités d'Enregistrement" -#: models.py:652 +#: models.py:650 msgid "Number of finds" msgstr "Nombre d'éléments de mobilier" -#: models.py:697 +#: models.py:695 msgid "No type" msgstr "Pas de type" -#: models.py:728 +#: models.py:726 msgid "Number of sources" msgstr "Nombre de documents" -#: models.py:770 templates/ishtar/dashboards/dashboard_operation.html:309 +#: models.py:768 templates/ishtar/dashboards/dashboard_operation.html:309 #: templates/ishtar/dashboards/dashboard_operation.html:575 #: templates/ishtar/dashboards/dashboard_operation.html:611 msgid "Mean" msgstr "Moyenne" -#: models.py:820 +#: models.py:818 msgid "Inverse relation" msgstr "Relation inverse" -#: models.py:824 +#: models.py:822 msgid "Operation relation type" msgstr "Type de relation entre opérations" -#: models.py:825 +#: models.py:823 msgid "Operation relation types" msgstr "Types de relation entre opérations" -#: models.py:838 +#: models.py:836 msgid "Operation record relation" msgstr "Relation entre opérations" -#: models.py:839 +#: models.py:837 msgid "Operation record relations" msgstr "Relations entre opérations" -#: models.py:878 +#: models.py:876 msgid "Operation year" msgstr "Année de l'opération" -#: models.py:880 +#: models.py:878 msgid "Document code" msgstr "Code du document" -#: models.py:890 +#: models.py:888 msgid "Operation documentation" msgstr "Documentation d'une opération" -#: models.py:891 +#: models.py:889 msgid "Operation documentations" msgstr "Documentations des opérations" -#: models.py:894 +#: models.py:892 msgid "Can view all Operation sources" msgstr "Peut voir toutes les Documentations d'opération" -#: models.py:896 +#: models.py:894 msgid "Can view own Operation source" msgstr "Peut voir sa propre Documentation d'opération" -#: models.py:898 +#: models.py:896 msgid "Can add own Operation source" msgstr "Peut ajouter sa propre Documentation d'opération" -#: models.py:900 +#: models.py:898 msgid "Can change own Operation source" msgstr "Peut modifier sa propre Documentation d'opération" -#: models.py:902 +#: models.py:900 msgid "Can delete own Operation source" msgstr "Peut supprimer sa propre Documentation d'opération" -#: models.py:918 models.py:1031 +#: models.py:923 models.py:1036 msgid "Treatment request" msgstr "Demande de traitement" -#: models.py:919 models.py:1036 +#: models.py:924 models.py:1041 msgid "Treatment" msgstr "Traitement" -#: models.py:921 +#: models.py:926 msgid "Intended to" msgstr "Destiné à" -#: models.py:923 +#: models.py:928 msgid "Code" msgstr "Code" -#: models.py:926 +#: models.py:931 msgid "Associated template" msgstr "Patron associé" -#: models.py:927 +#: models.py:932 msgid "Indexed" msgstr "Indexé" -#: models.py:931 +#: models.py:936 msgid "Act types" msgstr "Types d'acte" -#: models.py:997 models.py:1077 +#: models.py:1002 models.py:1082 #: templates/ishtar/blocks/window_tables/administrativacts.html:7 #: templates/ishtar/blocks/window_tables/archaeologicalsites.html:7 msgid "Ref." msgstr "Réf." -#: models.py:1004 +#: models.py:1009 msgid "Person in charge of the operation" msgstr "Responsable d'opération" -#: models.py:1010 +#: models.py:1015 msgid "Archaeological preventive operator" msgstr "Opérateur d'archéologie préventive" -#: models.py:1018 +#: models.py:1023 msgid "Signatory" msgstr "Signataire" -#: models.py:1046 +#: models.py:1051 msgid "Departments" msgstr "Départements" -#: models.py:1047 +#: models.py:1052 msgid "Cached values get from associated departments" msgstr "Valeur en cache des départements associés" -#: models.py:1050 +#: models.py:1055 msgid "Cached values get from associated towns" msgstr "Valeur en cache des communes associées" -#: models.py:1057 templates/ishtar/sheet_operation.html:104 -#: templates/ishtar/sheet_operation.html:145 +#: models.py:1062 templates/ishtar/sheet_operation.html:105 +#: templates/ishtar/sheet_operation.html:147 msgid "Administrative acts" msgstr "Actes administratifs" -#: models.py:1060 +#: models.py:1065 msgid "Can view all Administrative acts" msgstr "Peut voir tous les Actes administratifs" -#: models.py:1062 +#: models.py:1067 msgid "Can view own Administrative act" msgstr "Peut voir son propre Acte administratif" -#: models.py:1064 +#: models.py:1069 msgid "Can add own Administrative act" msgstr "Peut ajouter son propre Acte administratif" -#: models.py:1066 +#: models.py:1071 msgid "Can change own Administrative act" msgstr "Peut modifier son propre Acte administratif" -#: models.py:1068 +#: models.py:1073 msgid "Can delete own Administrative act" msgstr "Peut supprimer son propre Acte administratif" -#: models.py:1171 +#: models.py:1176 msgid "This index already exists for this year" msgstr "Cet index existe déjà pour cette année." -#: models.py:1239 +#: models.py:1244 msgid "External ID" msgstr "ID externe" -#: models.py:1242 +#: models.py:1247 msgid "External ID is set automatically" msgstr "L'identifiant externe est configuré automatiquement" -#: models.py:1243 +#: models.py:1248 msgid "Address - Locality" msgstr "Adresse - Lieu-dit" -#: models.py:1439 +#: models.py:1444 msgid "Owner" msgstr "Propriétaire" -#: models.py:1447 +#: models.py:1452 msgid "Parcel owner" msgstr "Propriétaire de parcelle" -#: models.py:1448 +#: models.py:1453 msgid "Parcel owners" msgstr "Propriétaires de parcelle" -#: models.py:1474 +#: models.py:1479 msgid "Recorded" msgstr "Enregistré" -#: models.py:1475 +#: models.py:1480 msgid "Effective" msgstr "Effectif" -#: models.py:1476 +#: models.py:1481 msgid "Active" msgstr "Actif" -#: models.py:1477 +#: models.py:1482 msgid "Field completed" msgstr "Terrain achevé" -#: models.py:1478 +#: models.py:1483 msgid "Associated report" msgstr "Rapport associé" -#: models.py:1479 +#: models.py:1484 msgid "Closed" msgstr "Clos" -#: models.py:1480 +#: models.py:1485 msgid "Documented and closed" msgstr "Documenté et clos" -#: models.py:1914 +#: models.py:1919 msgid "Is preventive" msgstr "Préventif" -#: models.py:1917 +#: models.py:1922 msgid "Operation type old" msgstr "Type d'opération - ancien" -#: models.py:1918 +#: models.py:1923 msgid "Operation types old" msgstr "Types d'opération - ancien" -#: views.py:214 +#: views.py:223 msgid "New operation" msgstr "Ajouter une opération" -#: views.py:237 +#: views.py:267 msgid "Operation modification" msgstr "Modifier une opération" -#: views.py:280 +#: views.py:295 msgid "Operation closing" msgstr "Clôturer une opération" -#: views.py:291 +#: views.py:306 msgid "Operation deletion" msgstr "Supprimer une opération" -#: views.py:296 +#: views.py:311 msgid "Operation: source search" msgstr "Opération : rechercher une documentation associée" -#: views.py:304 +#: views.py:319 msgid "Operation: source creation" msgstr "Opération : ajouter une documentation associée" -#: views.py:312 +#: views.py:327 msgid "Operation: source modification" msgstr "Opération : modifier une documentation associée" -#: views.py:327 +#: views.py:342 msgid "Operation: source deletion" msgstr "Opération : supprimer une documentation associée" -#: views.py:346 +#: views.py:361 msgid "Operation: new administrative act" msgstr "Opération : ajouter un acte administratif" -#: views.py:356 +#: views.py:371 msgid "Operation: administrative act modification" msgstr "Opération : modification d'un acte administratif" -#: views.py:380 +#: views.py:395 msgid "Operation: administrative act deletion" msgstr "Opération : supprimer un acte administratif" @@ -1130,7 +1138,7 @@ msgstr "" "oubli, définissez-le à la première étape." #: templates/ishtar/sheet_administrativeact.html:36 -#: templates/ishtar/sheet_operation.html:40 +#: templates/ishtar/sheet_operation.html:41 msgid "Surface:" msgstr "Surface :" @@ -1150,92 +1158,96 @@ msgstr "Adresse" msgid "Begining date" msgstr "Date de début" -#: templates/ishtar/sheet_operation.html:36 +#: templates/ishtar/sheet_operation.html:37 msgid "State:" msgstr "État :" -#: templates/ishtar/sheet_operation.html:36 +#: templates/ishtar/sheet_operation.html:37 msgid "Active file" msgstr "Dossier actif" -#: templates/ishtar/sheet_operation.html:37 +#: templates/ishtar/sheet_operation.html:38 msgid "Closed operation" msgstr "Opération close" -#: templates/ishtar/sheet_operation.html:38 +#: templates/ishtar/sheet_operation.html:39 msgid "Closing date:" msgstr "Date de clôture :" -#: templates/ishtar/sheet_operation.html:38 +#: templates/ishtar/sheet_operation.html:39 msgid "by" msgstr "par" -#: templates/ishtar/sheet_operation.html:41 +#: templates/ishtar/sheet_operation.html:42 msgid "Cost:" msgstr "Coût :" -#: templates/ishtar/sheet_operation.html:42 +#: templates/ishtar/sheet_operation.html:43 msgid "Duration:" msgstr "Durée :" -#: templates/ishtar/sheet_operation.html:42 +#: templates/ishtar/sheet_operation.html:43 msgid "Day" msgstr "Jour" -#: templates/ishtar/sheet_operation.html:75 +#: templates/ishtar/sheet_operation.html:76 msgid "Localisation" msgstr "Localisation" -#: templates/ishtar/sheet_operation.html:100 +#: templates/ishtar/sheet_operation.html:101 msgid "Associated parcels" msgstr "Parcelles associées" -#: templates/ishtar/sheet_operation.html:108 +#: templates/ishtar/sheet_operation.html:109 msgid "Document from this operation" msgstr "Documents de cette opération" -#: templates/ishtar/sheet_operation.html:114 -#: templates/ishtar/sheet_operation.html:156 +#: templates/ishtar/sheet_operation.html:115 +#: templates/ishtar/sheet_operation.html:158 msgid "Context records" msgstr "Unités d'Enregistrement" -#: templates/ishtar/sheet_operation.html:119 +#: templates/ishtar/sheet_operation.html:120 msgid "Context record relations" msgstr "Relations entre Unités d'Enregistrement" -#: templates/ishtar/sheet_operation.html:124 +#: templates/ishtar/sheet_operation.html:125 msgid "Documents from associated context records" msgstr "Documents des Unités d'Enregistrement associées" -#: templates/ishtar/sheet_operation.html:129 -#: templates/ishtar/sheet_operation.html:179 +#: templates/ishtar/sheet_operation.html:130 +#: templates/ishtar/sheet_operation.html:181 msgid "Finds" msgstr "Mobilier" -#: templates/ishtar/sheet_operation.html:134 +#: templates/ishtar/sheet_operation.html:135 msgid "Documents from associated finds" msgstr "Documents du mobilier associé" -#: templates/ishtar/sheet_operation.html:139 +#: templates/ishtar/sheet_operation.html:140 msgid "Associated containers" msgstr "Contenants associés" -#: templates/ishtar/sheet_operation.html:143 +#: templates/ishtar/sheet_operation.html:144 msgid "Statistics" msgstr "Statistiques" -#: templates/ishtar/sheet_operation.html:163 -#: templates/ishtar/sheet_operation.html:217 +#: templates/ishtar/sheet_operation.html:145 +msgid "Theses number are updated hourly" +msgstr "Ces chiffres sont mis à jour toutes les heures" + +#: templates/ishtar/sheet_operation.html:165 +#: templates/ishtar/sheet_operation.html:219 #: templates/ishtar/blocks/window_tables/administrativacts.html:8 msgid "Type" msgstr "Type" -#: templates/ishtar/sheet_operation.html:163 -#: templates/ishtar/sheet_operation.html:171 -#: templates/ishtar/sheet_operation.html:186 -#: templates/ishtar/sheet_operation.html:194 -#: templates/ishtar/sheet_operation.html:202 -#: templates/ishtar/sheet_operation.html:217 +#: templates/ishtar/sheet_operation.html:165 +#: templates/ishtar/sheet_operation.html:173 +#: templates/ishtar/sheet_operation.html:188 +#: templates/ishtar/sheet_operation.html:196 +#: templates/ishtar/sheet_operation.html:204 +#: templates/ishtar/sheet_operation.html:219 #: templates/ishtar/dashboards/dashboard_operation.html:18 #: templates/ishtar/dashboards/dashboard_operation.html:164 #: templates/ishtar/dashboards/dashboard_operation.html:432 @@ -1244,19 +1256,19 @@ msgstr "Type" msgid "Number" msgstr "Nombre" -#: templates/ishtar/sheet_operation.html:186 +#: templates/ishtar/sheet_operation.html:188 msgid "Material type" msgstr "Type de matériau" -#: templates/ishtar/sheet_operation.html:194 +#: templates/ishtar/sheet_operation.html:196 msgid "Object type" msgstr "Type d'objet" -#: templates/ishtar/sheet_operation.html:210 +#: templates/ishtar/sheet_operation.html:212 msgid "Sources" msgstr "Documents" -#: templates/ishtar/sheet_operation.html:226 +#: templates/ishtar/sheet_operation.html:228 msgid "Finds by context records" msgstr "Mobilier par Unités d'Enregistrement" diff --git a/translations/fr/archaeological_warehouse.po b/translations/fr/archaeological_warehouse.po index 15d86d645..960b1c3c1 100644 --- a/translations/fr/archaeological_warehouse.po +++ b/translations/fr/archaeological_warehouse.po @@ -10,23 +10,23 @@ msgstr "" "MIME-Version: 1.0\n" "Content-Transfer-Encoding: 8bit\n" "Content-Type: text/plain; charset=UTF-8\n" -"PO-Revision-Date: 2017-03-21 06:24-0400\n" -"Last-Translator: Étienne Loks <etienne.loks@iggdrasil.net>\n" +"PO-Revision-Date: 2017-04-07 05:54-0400\n" +"Last-Translator: Valérie-Emma Leroux <emma@iggdrasil.net>\n" "Language-Team: \n" "Language: fr\n" "Plural-Forms: nplurals=2; plural=n>1;\n" "X-Generator: Zanata 3.9.6\n" -#: forms.py:36 forms.py:99 ishtar_menu.py:40 models.py:63 models.py:103 +#: forms.py:36 forms.py:99 ishtar_menu.py:40 models.py:65 models.py:204 #: templates/ishtar/sheet_warehouse.html:4 msgid "Warehouse" msgstr "Dépôt" -#: forms.py:45 forms.py:50 models.py:281 +#: forms.py:45 forms.py:50 models.py:389 msgid "Division" msgstr "Division" -#: forms.py:52 models.py:127 +#: forms.py:52 models.py:228 msgid "Order" msgstr "Ordre" @@ -34,15 +34,15 @@ msgstr "Ordre" msgid "There are identical divisions." msgstr "Il y a des divisions identiques" -#: forms.py:70 models.py:53 +#: forms.py:70 models.py:55 msgid "Divisions" msgstr "Divisions" -#: forms.py:74 forms.py:103 models.py:45 models.py:100 +#: forms.py:74 forms.py:103 models.py:47 models.py:201 msgid "Name" msgstr "Nom" -#: forms.py:75 forms.py:105 models.py:36 models.py:47 +#: forms.py:75 forms.py:105 models.py:38 models.py:49 msgid "Warehouse type" msgstr "Type de dépôt" @@ -54,11 +54,11 @@ msgstr "Commune" msgid "Warehouse search" msgstr "Rechercher un dépôt" -#: forms.py:108 models.py:50 +#: forms.py:108 models.py:52 msgid "Person in charge" msgstr "Responsable" -#: forms.py:114 forms.py:184 models.py:51 models.py:181 +#: forms.py:114 forms.py:184 models.py:53 models.py:282 msgid "Comment" msgstr "Commentaires" @@ -90,16 +90,16 @@ msgstr "Téléphone mobile" msgid "Would you like to delete this warehouse?" msgstr "Voulez-vous supprimer ce dépôt ?" -#: forms.py:158 models.py:192 models.py:279 +#: forms.py:158 models.py:293 models.py:386 #: templates/ishtar/sheet_container.html:4 msgid "Container" msgstr "Contenant" -#: forms.py:163 forms.py:237 models.py:142 +#: forms.py:163 forms.py:237 models.py:243 msgid "Ref." msgstr "Réf." -#: forms.py:164 forms.py:236 models.py:145 models.py:179 +#: forms.py:164 forms.py:236 models.py:246 models.py:280 msgid "Container type" msgstr "Type de contenant" @@ -107,7 +107,7 @@ msgstr "Type de contenant" msgid "Current location (warehouse)" msgstr "Lieu actuel (dépôt)" -#: forms.py:172 models.py:176 +#: forms.py:172 models.py:277 msgid "Responsible warehouse" msgstr "Dépôt responsable" @@ -160,7 +160,7 @@ msgstr "Date" msgid "Packaged finds" msgstr "Mobilier conditionné" -#: forms.py:280 models.py:182 +#: forms.py:280 models.py:283 msgid "Localisation" msgstr "Localisation" @@ -188,115 +188,116 @@ msgstr "Modification" msgid "Deletion" msgstr "Suppression" -#: ishtar_menu.py:57 models.py:193 templates/ishtar/sheet_warehouse.html:20 +#: ishtar_menu.py:57 models.py:294 templates/ishtar/sheet_warehouse.html:20 +#: templates/ishtar/sheet_warehouse.html:53 msgid "Containers" msgstr "Contenants" -#: models.py:37 +#: models.py:39 msgid "Warehouse types" msgstr "Types de dépôt" -#: models.py:56 models.py:187 +#: models.py:58 models.py:288 msgid "External ID" msgstr "ID externe" -#: models.py:58 models.py:189 +#: models.py:60 models.py:290 msgid "External ID is set automatically" msgstr "L'ID externe est attribué automatiquement" -#: models.py:64 +#: models.py:66 msgid "Warehouses" msgstr "Dépôts" -#: models.py:66 +#: models.py:68 msgid "Can view all Warehouses" msgstr "Peut voir tous les Dépôts" -#: models.py:67 +#: models.py:69 msgid "Can view own Warehouse" msgstr "Peut voir son propre Dépôt" -#: models.py:68 +#: models.py:70 msgid "Can add own Warehouse" msgstr "Peut ajouter son propre Dépôt" -#: models.py:69 +#: models.py:71 msgid "Can change own Warehouse" msgstr "Peut modifier son propre Dépôt" -#: models.py:70 +#: models.py:72 msgid "Can delete own Warehouse" msgstr "Peut supprimer son propre Dépôt" -#: models.py:102 +#: models.py:203 msgid "Description" msgstr "Description" -#: models.py:107 models.py:108 +#: models.py:208 models.py:209 msgid "Collection" msgstr "Collection" -#: models.py:117 +#: models.py:218 msgid "Warehouse division type" msgstr "Type de division de dépôt" -#: models.py:118 +#: models.py:219 msgid "Warehouse division types" msgstr "Types de division de dépôt" -#: models.py:138 +#: models.py:239 msgid "Length (mm)" msgstr "Longueur (mm)" -#: models.py:139 +#: models.py:240 msgid "Width (mm)" msgstr "Largeur (mm)" -#: models.py:140 +#: models.py:241 msgid "Height (mm)" msgstr "Hauteur (mm)" -#: models.py:141 +#: models.py:242 msgid "Volume (l)" msgstr "Volume (l)" -#: models.py:146 +#: models.py:247 msgid "Container types" msgstr "Types de contenant" -#: models.py:165 +#: models.py:266 msgid "Location - index" msgstr "Lieu - index" -#: models.py:166 +#: models.py:267 msgid "Precise localisation" msgstr "Localisation précise" -#: models.py:167 +#: models.py:268 msgid "Type" msgstr "Type" -#: models.py:173 +#: models.py:274 msgid "Location (warehouse)" msgstr "Lieu (dépôt)" -#: models.py:180 +#: models.py:281 msgid "Container ref." msgstr "Réf. du contenant" -#: models.py:184 +#: models.py:285 msgid "Cached location" msgstr "Lieu - en cache" -#: models.py:282 +#: models.py:390 msgid "Reference" msgstr "Référence" -#: models.py:285 +#: models.py:393 msgid "Container localisation" msgstr "Localisation de contenant" -#: models.py:286 +#: models.py:394 msgid "Container localisations" msgstr "Localisations de contenant" @@ -332,10 +333,38 @@ msgstr "Contenu" msgid "Attached containers" msgstr "Contenants associés" -#: templates/ishtar/wizard/wizard_containerlocalisation.html:6 +#: templates/ishtar/sheet_warehouse.html:29 +msgid "Statistics" +msgstr "Statistiques" + +#: templates/ishtar/sheet_warehouse.html:30 +msgid "Theses number are updated hourly" +msgstr "Ces chiffres sont mis à jour toutes les heures" + +#: templates/ishtar/sheet_warehouse.html:32 +msgid "Finds" +msgstr "Mobilier" + +#: templates/ishtar/sheet_warehouse.html:39 +msgid "Finds by location in the warehouse" +msgstr "Mobilier par lieu dans le dépôt" + +#: templates/ishtar/sheet_warehouse.html:59 +msgid "Containers by location in the warehouse" +msgstr "Contenants par lieu dans le dépôt" + +#: templates/ishtar/wizard/wizard_containerlocalisation.html:8 msgid "" "No division set for this warehouse. Define at least one division to localise " "containers in this warehouse." msgstr "" "Pas de division configurée pour ce dépôt. Définissez au moins une division " "pour localiser les contenants dans ce dépôt." + +#: templates/ishtar/wizard/wizard_warehouse_divisions.html:8 +msgid "" +"Containers with localisation are associated to this warehouse. You cannot " +"change divisions." +msgstr "" +"Des contenants localisés sont associés à ce dépôt. Vous ne pouvez pas " +"modifier les divisions." diff --git a/translations/fr/ishtar_common.po b/translations/fr/ishtar_common.po index 6a9d80265..1e09aba03 100644 --- a/translations/fr/ishtar_common.po +++ b/translations/fr/ishtar_common.po @@ -11,7 +11,7 @@ msgstr "" "MIME-Version: 1.0\n" "Content-Transfer-Encoding: 8bit\n" "Content-Type: text/plain; charset=UTF-8\n" -"PO-Revision-Date: 2017-03-21 01:54-0400\n" +"PO-Revision-Date: 2017-04-07 05:56-0400\n" "Last-Translator: Valérie-Emma Leroux <emma@iggdrasil.net>\n" "Language-Team: \n" "Language: fr\n" @@ -168,40 +168,40 @@ msgstr "résultat" msgid "\"%(value)s\" not in %(values)s" msgstr "\"%(value)s\" n'est pas dans %(values)s" -#: forms.py:73 +#: forms.py:74 msgid "Enter a valid name consisting of letters, spaces and hyphens." msgstr "Entrez un nom correct composé de lettres, espaces et tirets." -#: forms.py:89 forms_common.py:626 +#: forms.py:90 forms_common.py:626 msgid "Confirm" msgstr "Confirmer" -#: forms.py:94 +#: forms.py:95 msgid "Are you sure you want to delete?" msgstr "Êtes-vous sûr de vouloir supprimer ?" -#: forms.py:103 +#: forms.py:129 msgid "There are identical items." msgstr "Il y a des éléments identiques." -#: forms.py:141 forms.py:142 +#: forms.py:176 forms.py:177 msgid "Closing date" msgstr "Date de clôture" -#: forms.py:155 +#: forms.py:190 msgid "You should select an item." msgstr "Vous devez sélectionner un élément." -#: forms.py:156 +#: forms.py:191 msgid "Add a new item" msgstr "Ajouter un nouvel élément" -#: forms.py:262 models.py:1482 +#: forms.py:297 models.py:1501 msgid "Template" msgstr "Patron" #: forms_common.py:41 forms_common.py:59 forms_common.py:184 -#: forms_common.py:408 models.py:1548 models.py:2989 +#: forms_common.py:408 models.py:1567 models.py:3030 #: templates/blocks/JQueryAdvancedTown.html:19 #: templates/ishtar/sheet_organization.html:13 msgid "Town" @@ -224,8 +224,8 @@ msgstr "" "<p class='example'>Par exemple tapez « saint denis 93 » pour obtenir la " "commune Saint-Denis dans le département français de Seine-Saint-Denis.</p>" -#: forms_common.py:68 forms_common.py:863 ishtar_menu.py:47 models.py:2610 -#: models.py:2791 models.py:2856 templates/ishtar/sheet_person.html:4 +#: forms_common.py:68 forms_common.py:863 ishtar_menu.py:47 models.py:2630 +#: models.py:2823 models.py:2885 templates/ishtar/sheet_person.html:4 msgid "Person" msgstr "Personne" @@ -238,64 +238,64 @@ msgstr "" "pas possible." #: forms_common.py:172 forms_common.py:329 forms_common.py:453 -#: ishtar_menu.py:75 models.py:2493 models.py:2584 +#: ishtar_menu.py:75 models.py:2513 models.py:2604 #: templates/ishtar/sheet_organization.html:4 msgid "Organization" msgstr "Organisation" #: forms_common.py:175 forms_common.py:212 forms_common.py:324 -#: forms_common.py:378 forms_common.py:448 models.py:1103 models.py:1481 -#: models.py:1750 models.py:1766 models.py:2003 models.py:2279 models.py:2487 -#: models.py:2596 models.py:2975 templates/ishtar/import_list.html:13 +#: forms_common.py:378 forms_common.py:448 models.py:1109 models.py:1500 +#: models.py:1769 models.py:1785 models.py:2023 models.py:2301 models.py:2507 +#: models.py:2616 models.py:3016 templates/ishtar/import_list.html:13 #: templates/ishtar/sheet_organization.html:8 #: templates/ishtar/sheet_organization.html:21 msgid "Name" msgstr "Nom" -#: forms_common.py:176 models.py:1703 models.py:2134 +#: forms_common.py:176 models.py:1722 models.py:2154 msgid "Organization type" msgstr "Type d'organisation" -#: forms_common.py:178 forms_common.py:402 models.py:1543 +#: forms_common.py:178 forms_common.py:402 models.py:1562 #: templates/ishtar/sheet_organization.html:10 msgid "Address" msgstr "Adresse" -#: forms_common.py:180 forms_common.py:405 models.py:1544 +#: forms_common.py:180 forms_common.py:405 models.py:1563 #: templates/ishtar/sheet_organization.html:11 msgid "Address complement" msgstr "Complément d'adresse" -#: forms_common.py:182 forms_common.py:406 models.py:1546 +#: forms_common.py:182 forms_common.py:406 models.py:1565 #: templates/ishtar/sheet_organization.html:12 msgid "Postal code" msgstr "Code postal" -#: forms_common.py:185 forms_common.py:409 models.py:1549 +#: forms_common.py:185 forms_common.py:409 models.py:1568 msgid "Country" msgstr "Pays" #: forms_common.py:187 forms_common.py:326 forms_common.py:382 -#: forms_common.py:450 forms_common.py:574 models.py:1576 +#: forms_common.py:450 forms_common.py:574 models.py:1595 msgid "Email" msgstr "Courriel" -#: forms_common.py:188 forms_common.py:385 models.py:1561 +#: forms_common.py:188 forms_common.py:385 models.py:1580 #: templates/ishtar/sheet_organization.html:14 #: templates/ishtar/sheet_person.html:21 #: templates/ishtar/wizard/wizard_person.html:17 msgid "Phone" msgstr "Téléphone" -#: forms_common.py:189 forms_common.py:394 models.py:1573 +#: forms_common.py:189 forms_common.py:394 models.py:1592 #: templates/ishtar/sheet_organization.html:15 #: templates/ishtar/sheet_person.html:39 #: templates/ishtar/wizard/wizard_person.html:35 msgid "Mobile phone" msgstr "Téléphone portable" -#: forms_common.py:213 forms_common.py:327 forms_common.py:451 models.py:2170 -#: models.py:2489 models.py:2910 templates/sheet_ope.html:85 +#: forms_common.py:213 forms_common.py:327 forms_common.py:451 models.py:2192 +#: models.py:2509 models.py:2951 templates/sheet_ope.html:85 #: templates/sheet_ope.html.py:105 templates/sheet_ope.html:126 #: templates/ishtar/import_list.html:14 #: templates/ishtar/sheet_organization.html:23 @@ -319,7 +319,7 @@ msgstr "Fusionner tous les éléments dans" msgid "Organization to merge" msgstr "Organisation à fusionner" -#: forms_common.py:325 forms_common.py:376 forms_common.py:449 models.py:2594 +#: forms_common.py:325 forms_common.py:376 forms_common.py:449 models.py:2614 #: templates/ishtar/sheet_organization.html:22 msgid "Surname" msgstr "Prénom" @@ -337,25 +337,25 @@ msgstr "Personne à fusionner" msgid "Identity" msgstr "Identité" -#: forms_common.py:373 forms_common.py:781 forms_common.py:830 models.py:2135 -#: models.py:2588 models.py:2590 models.py:2907 templates/sheet_ope.html:104 +#: forms_common.py:373 forms_common.py:781 forms_common.py:830 models.py:2155 +#: models.py:2608 models.py:2610 models.py:2948 templates/sheet_ope.html:104 #: templates/ishtar/blocks/window_tables/documents.html:7 msgid "Title" msgstr "Titre" -#: forms_common.py:374 models.py:2592 +#: forms_common.py:374 models.py:2612 msgid "Salutation" msgstr "Formule d'appel" -#: forms_common.py:380 models.py:2598 +#: forms_common.py:380 models.py:2618 msgid "Raw name" msgstr "Nom brut" -#: forms_common.py:383 models.py:1562 +#: forms_common.py:383 models.py:1581 msgid "Phone description" msgstr "Type de téléphone" -#: forms_common.py:386 models.py:1564 models.py:1566 +#: forms_common.py:386 models.py:1583 models.py:1585 msgid "Phone description 2" msgstr "Type de téléphone 2" @@ -363,11 +363,11 @@ msgstr "Type de téléphone 2" msgid "Phone 2" msgstr "Téléphone 2" -#: forms_common.py:390 models.py:1570 +#: forms_common.py:390 models.py:1589 msgid "Phone description 3" msgstr "Type de téléphone 3" -#: forms_common.py:392 models.py:1568 +#: forms_common.py:392 models.py:1587 msgid "Phone 3" msgstr "Téléphone 3" @@ -375,23 +375,23 @@ msgstr "Téléphone 3" msgid "Current organization" msgstr "Organisation actuelle" -#: forms_common.py:411 models.py:1551 +#: forms_common.py:411 models.py:1570 msgid "Other address: address" msgstr "Autre adresse : adresse" -#: forms_common.py:414 models.py:1554 +#: forms_common.py:414 models.py:1573 msgid "Other address: address complement" msgstr "Autre adresse : complément d'adresse" -#: forms_common.py:416 models.py:1555 +#: forms_common.py:416 models.py:1574 msgid "Other address: postal code" msgstr "Autre adresse : code postal" -#: forms_common.py:418 models.py:1557 +#: forms_common.py:418 models.py:1576 msgid "Other address: town" msgstr "Autre adresse : ville" -#: forms_common.py:420 models.py:1559 +#: forms_common.py:420 models.py:1578 msgid "Other address: country" msgstr "Autre adresse : pays" @@ -407,7 +407,7 @@ msgstr "Nom d'utilisateur" msgid "Account search" msgstr "Rechercher un compte" -#: forms_common.py:512 forms_common.py:552 forms_common.py:556 models.py:2541 +#: forms_common.py:512 forms_common.py:552 forms_common.py:556 models.py:2561 msgid "Person type" msgstr "Type de personne" @@ -415,7 +415,7 @@ msgstr "Type de personne" msgid "Account" msgstr "Compte" -#: forms_common.py:577 wizards.py:1339 +#: forms_common.py:577 wizards.py:1347 msgid "New password" msgstr "Nouveau mot de passe" @@ -439,7 +439,7 @@ msgstr "Ce nom d'utilisateur existe déjà." msgid "Send the new password by email?" msgstr "Envoyer le nouveau mot de passe par courriel ?" -#: forms_common.py:636 forms_common.py:649 models.py:2990 +#: forms_common.py:636 forms_common.py:649 models.py:3031 msgid "Towns" msgstr "Communes" @@ -455,7 +455,7 @@ msgstr "Seul un choix peut être coché." msgid "Documentation informations" msgstr "Information sur le document" -#: forms_common.py:783 forms_common.py:831 models.py:2136 models.py:2882 +#: forms_common.py:783 forms_common.py:831 models.py:2156 models.py:2923 msgid "Source type" msgstr "Type de document" @@ -467,37 +467,37 @@ msgstr "Référence" msgid "Internal reference" msgstr "Référence interne" -#: forms_common.py:791 models.py:2921 +#: forms_common.py:791 models.py:2962 msgid "Numerical ressource (web address)" msgstr "Ressource numérique (adresse web)" -#: forms_common.py:792 models.py:2923 +#: forms_common.py:792 models.py:2964 msgid "Receipt date" msgstr "Date de réception" -#: forms_common.py:794 models.py:2304 models.py:2925 +#: forms_common.py:794 models.py:2327 models.py:2966 msgid "Creation date" msgstr "Date de création" -#: forms_common.py:797 models.py:2928 +#: forms_common.py:797 models.py:2969 msgid "Receipt date in documentation" msgstr "Date de réception en documentation" -#: forms_common.py:799 forms_common.py:835 models.py:379 models.py:696 -#: models.py:2030 models.py:2602 models.py:2935 +#: forms_common.py:799 forms_common.py:835 models.py:381 models.py:698 +#: models.py:2050 models.py:2622 models.py:2976 msgid "Comment" msgstr "Commentaire" -#: forms_common.py:801 forms_common.py:834 models.py:1105 models.py:1770 -#: models.py:1957 models.py:2004 models.py:2934 templates/sheet_ope.html:128 +#: forms_common.py:801 forms_common.py:834 models.py:1111 models.py:1789 +#: models.py:1977 models.py:2024 models.py:2975 templates/sheet_ope.html:128 msgid "Description" msgstr "Description" -#: forms_common.py:804 models.py:2936 +#: forms_common.py:804 models.py:2977 msgid "Additional information" msgstr "Information supplémentaire" -#: forms_common.py:806 forms_common.py:838 models.py:2938 +#: forms_common.py:806 forms_common.py:838 models.py:2979 msgid "Has a duplicate" msgstr "Existe en doublon" @@ -514,7 +514,7 @@ msgstr "" "<p>Les images trop grandes sont retaillées en : %(width)dx%(height)d (le " "ratio est conservé).</p>" -#: forms_common.py:827 forms_common.py:856 forms_common.py:890 models.py:2861 +#: forms_common.py:827 forms_common.py:856 forms_common.py:890 models.py:2890 #: templates/ishtar/wizard/wizard_person_deletion.html:124 msgid "Author" msgstr "Auteur" @@ -527,7 +527,7 @@ msgstr "Informations supplémentaires" msgid "Would you like to delete this documentation?" msgstr "Voulez-vous supprimer ce document ?" -#: forms_common.py:864 models.py:2137 models.py:2848 models.py:2858 +#: forms_common.py:864 models.py:2157 models.py:2877 models.py:2887 msgid "Author type" msgstr "Type d'auteur" @@ -539,7 +539,7 @@ msgstr "Sélection d'auteur" msgid "There are identical authors." msgstr "Il y a des auteurs identiques." -#: forms_common.py:901 models.py:2862 models.py:2917 +#: forms_common.py:901 models.py:2891 models.py:2958 #: templates/sheet_ope.html:106 #: templates/ishtar/blocks/window_tables/documents.html:9 msgid "Authors" @@ -557,7 +557,7 @@ msgstr "Ajout/modification" msgid "Deletion" msgstr "Suppression" -#: ishtar_menu.py:39 models.py:1277 views.py:1608 +#: ishtar_menu.py:39 models.py:1283 views.py:1644 msgid "Global variables" msgstr "Variables globales" @@ -585,19 +585,19 @@ msgstr "Fusion automatique" msgid "Manual merge" msgstr "Fusion manuelle" -#: ishtar_menu.py:109 models.py:2315 +#: ishtar_menu.py:109 models.py:2335 msgid "Imports" msgstr "Imports" -#: ishtar_menu.py:112 views.py:1616 +#: ishtar_menu.py:112 views.py:1652 msgid "New import" msgstr "Nouvel import" -#: ishtar_menu.py:116 views.py:1630 +#: ishtar_menu.py:116 views.py:1666 msgid "Current imports" msgstr "Imports en cours" -#: ishtar_menu.py:120 views.py:1669 +#: ishtar_menu.py:120 views.py:1705 msgid "Old imports" msgstr "Anciens imports" @@ -605,127 +605,127 @@ msgstr "Anciens imports" msgid "Not a valid item." msgstr "Élément invalide." -#: models.py:199 +#: models.py:201 msgid "A selected item is not a valid item." msgstr "Un élément sélectionné n'est pas valide." -#: models.py:210 +#: models.py:212 msgid "This item already exists." msgstr "Cet élément existe déjà." -#: models.py:375 models.py:695 models.py:1516 models.py:1528 models.py:1954 +#: models.py:377 models.py:697 models.py:1535 models.py:1547 models.py:1973 msgid "Label" msgstr "Libellé" -#: models.py:377 +#: models.py:379 msgid "Textual ID" msgstr "Identifiant textuel" -#: models.py:380 models.py:698 models.py:1485 +#: models.py:382 models.py:700 models.py:1504 msgid "Available" msgstr "Disponible" -#: models.py:722 models.py:2076 +#: models.py:724 models.py:2096 msgid "Key" msgstr "Clé" -#: models.py:728 +#: models.py:730 msgid "Specific key to an import" msgstr "Clé spécifique à un import" -#: models.py:820 +#: models.py:826 msgid "Last editor" msgstr "Dernier éditeur" -#: models.py:823 +#: models.py:829 msgid "Creator" msgstr "Créateur" -#: models.py:965 models.py:2846 models.py:3001 models.py:3057 +#: models.py:971 models.py:2874 models.py:3042 models.py:3098 msgid "Order" msgstr "Ordre" -#: models.py:966 +#: models.py:972 msgid "Symmetrical" msgstr "Symétrique" -#: models.py:967 +#: models.py:973 msgid "Tiny label" msgstr "Libellé court" -#: models.py:981 +#: models.py:987 msgid "Cannot have symmetrical and an inverse_relation" msgstr "Ne peut pas être symétrique et avoir une relation inverse" -#: models.py:1097 +#: models.py:1103 msgid "Euro" msgstr "Euro" -#: models.py:1098 +#: models.py:1104 msgid "US dollar" msgstr "Dollar US" -#: models.py:1104 models.py:1768 +#: models.py:1110 models.py:1787 msgid "Slug" msgstr "Identifiant texte" -#: models.py:1107 +#: models.py:1113 msgid "CSS color code for base module" msgstr "Code couleur CSS pour le tronc commun" -#: models.py:1109 +#: models.py:1115 msgid "Files module" msgstr "Module Dossiers" -#: models.py:1111 +#: models.py:1117 msgid "CSS color code for files module" msgstr "Code couleur CSS pour le module Dossier" -#: models.py:1113 +#: models.py:1119 msgid "Context records module" msgstr "Module Unités d'Enregistrement" -#: models.py:1116 +#: models.py:1122 msgid "CSS color code for context record module" msgstr "Code couleur CSS pour le module Unité d'Enregistrement" -#: models.py:1118 +#: models.py:1124 msgid "Finds module" msgstr "Module Mobilier" -#: models.py:1119 +#: models.py:1125 msgid "Need context records module" msgstr "Nécessite le module Unités d'Enregistrement" -#: models.py:1121 +#: models.py:1127 msgid "CSS color code for find module" msgstr "Code couleur CSS pour le module Mobilier" -#: models.py:1124 +#: models.py:1130 msgid "Warehouses module" msgstr "Module Dépôts" -#: models.py:1125 +#: models.py:1131 msgid "Need finds module" msgstr "Nécessite le module mobilier" -#: models.py:1127 +#: models.py:1133 msgid "CSS code for warehouse module" msgstr "Code couleur CSS pour le module Dépôt" -#: models.py:1129 +#: models.py:1135 msgid "Mapping module" msgstr "Module cartographique" -#: models.py:1131 +#: models.py:1137 msgid "CSS code for mapping module" msgstr "Code couleur CSS pour le module cartographique" -#: models.py:1134 +#: models.py:1140 msgid "Home page" msgstr "Page d'accueil" -#: models.py:1135 +#: models.py:1141 #, python-brace-format msgid "" "Homepage of Ishtar - if not defined a default homepage will appear. Use the " @@ -735,11 +735,11 @@ msgstr "" "défaut apparaît. Utiliser la syntaxe Markdown. {random_image} peut être " "utilisé pour afficher une image au hasard." -#: models.py:1139 +#: models.py:1145 msgid "File external id" msgstr "Identifiant externe de fichier" -#: models.py:1141 +#: models.py:1147 msgid "" "Formula to manage file external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " @@ -749,11 +749,11 @@ msgstr "" "précaution. Une formule incorrecte peut rendre l'application inutilisable et " "l'import de données externes peut alors être destructif." -#: models.py:1146 +#: models.py:1152 msgid "Parcel external id" msgstr "Identifiant externe de parcelle" -#: models.py:1149 +#: models.py:1155 msgid "" "Formula to manage parcel external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " @@ -763,11 +763,11 @@ msgstr "" "précaution. Une formule incorrecte peut rendre l'application inutilisable et " "l'import de données externes peut alors être destructif." -#: models.py:1154 +#: models.py:1160 msgid "Context record external id" msgstr "Identifiant externe d'unité d'enregistrement" -#: models.py:1156 +#: models.py:1162 msgid "" "Formula to manage context record external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " @@ -777,11 +777,11 @@ msgstr "" "manipuler avec précaution. Une formule incorrecte peut rendre l'application " "inutilisable et l'import de données externes peut alors être destructif." -#: models.py:1161 +#: models.py:1167 msgid "Base find external id" msgstr "Identifiant externe de mobilier de base" -#: models.py:1163 +#: models.py:1169 msgid "" "Formula to manage base find external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " @@ -791,11 +791,11 @@ msgstr "" "manipuler avec précaution. Une formule incorrecte peut rendre l'application " "inutilisable et l'import de données externes peut alors être destructif." -#: models.py:1168 +#: models.py:1174 msgid "Find external id" msgstr "Identifiant externe de mobilier" -#: models.py:1170 +#: models.py:1176 msgid "" "Formula to manage find external ID. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " @@ -805,11 +805,11 @@ msgstr "" "précaution. Une formule incorrecte peut rendre l'application inutilisable et " "l'import de données externes peut alors être destructif." -#: models.py:1175 +#: models.py:1181 msgid "Container external id" msgstr "ID externe du contenant" -#: models.py:1177 +#: models.py:1183 msgid "" "Formula to manage container external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " @@ -819,11 +819,11 @@ msgstr "" "précaution. Une formule incorrecte peut rendre l'application inutilisable et " "l'import de données externes peut alors être destructif." -#: models.py:1182 +#: models.py:1188 msgid "Warehouse external id" msgstr "ID externe du dépôt" -#: models.py:1184 +#: models.py:1190 msgid "" "Formula to manage warehouse external ID. Change this with care. With " "incorrect formula, the application might be unusable and import of external " @@ -833,11 +833,11 @@ msgstr "" "précaution. Une formule incorrecte peut rendre l'application inutilisable et " "l'import de données externes peut alors être destructif." -#: models.py:1189 +#: models.py:1195 msgid "Raw name for person" msgstr "Nom brut pour une personne" -#: models.py:1191 +#: models.py:1197 msgid "" "Formula to manage person raw_name. Change this with care. With incorrect " "formula, the application might be unusable and import of external data can " @@ -847,43 +847,43 @@ msgstr "" "Une formule incorrecte peut rendre l'application inutilisable et l'import de " "données externes peut alors être destructif." -#: models.py:1195 +#: models.py:1201 msgid "Current active" msgstr "Actuellement utilisé" -#: models.py:1196 +#: models.py:1202 msgid "Currency" msgstr "Devise" -#: models.py:1200 +#: models.py:1206 msgid "Ishtar site profile" msgstr "Profil d'instance Ishtar" -#: models.py:1201 +#: models.py:1207 msgid "Ishtar site profiles" msgstr "Profils d'instance Ishtar" -#: models.py:1270 +#: models.py:1276 msgid "Variable name" msgstr "Nom de la variable" -#: models.py:1271 +#: models.py:1277 msgid "Description of the variable" msgstr "Description de la variable" -#: models.py:1273 models.py:2077 +#: models.py:1279 models.py:2097 msgid "Value" msgstr "Valeur" -#: models.py:1276 +#: models.py:1282 msgid "Global variable" msgstr "Variable globale" -#: models.py:1386 models.py:1416 +#: models.py:1405 models.py:1435 msgid "Total" msgstr "Total" -#: models.py:1393 models.py:1517 models.py:1529 +#: models.py:1412 models.py:1536 models.py:1548 #: templates/ishtar/sheet_person.html:24 #: templates/ishtar/dashboards/dashboard_main_detail.html:141 #: templates/ishtar/dashboards/dashboard_main_detail_users.html:26 @@ -891,135 +891,135 @@ msgstr "Total" msgid "Number" msgstr "Nombre" -#: models.py:1480 +#: models.py:1499 msgid "Administrative Act" msgstr "Acte administratif" -#: models.py:1484 +#: models.py:1503 msgid "Associated object" msgstr "Objet associé" -#: models.py:1488 +#: models.py:1507 msgid "Document template" msgstr "Patron de document" -#: models.py:1489 +#: models.py:1508 msgid "Document templates" msgstr "Patrons de document" -#: models.py:1520 models.py:1530 models.py:2299 +#: models.py:1539 models.py:1549 models.py:2321 msgid "State" msgstr "État" -#: models.py:1534 templates/blocks/JQueryAdvancedTown.html:12 +#: models.py:1553 templates/blocks/JQueryAdvancedTown.html:12 msgid "Department" msgstr "Département" -#: models.py:1535 +#: models.py:1554 msgid "Departments" msgstr "Départements" -#: models.py:1572 +#: models.py:1591 msgid "Raw phone" msgstr "Téléphone brut" -#: models.py:1578 +#: models.py:1597 msgid "Alternative address is prefered" msgstr "L'adresse alternative est préférée" -#: models.py:1617 +#: models.py:1636 msgid "Tel: " msgstr "Tél :" -#: models.py:1621 +#: models.py:1640 msgid "Mobile: " msgstr "Mobile :" -#: models.py:1625 +#: models.py:1644 msgid "Email: " msgstr "Courriel :" -#: models.py:1630 +#: models.py:1649 msgid "Merge key" msgstr "Clé de fusion" -#: models.py:1704 +#: models.py:1723 msgid "Organization types" msgstr "Types d'organisation" -#: models.py:1751 +#: models.py:1770 msgid "Class name" msgstr "Nom de la classe" -#: models.py:1754 +#: models.py:1773 msgid "Importer - Model" msgstr "Importeur - Modèle" -#: models.py:1755 +#: models.py:1774 msgid "Importer - Models" msgstr "Importeur - Modèles" -#: models.py:1772 templates/ishtar/dashboards/dashboard_main.html:25 +#: models.py:1791 templates/ishtar/dashboards/dashboard_main.html:34 msgid "Users" msgstr "Utilisateurs" -#: models.py:1775 +#: models.py:1794 msgid "Associated model" msgstr "Modèle associé" -#: models.py:1778 +#: models.py:1797 msgid "Models that can accept new items" msgstr "Modèles qui peuvent accepter de nouveaux éléments" -#: models.py:1779 +#: models.py:1798 msgid "Leave blank for no restrictions" msgstr "Laissez vide pour aucune restriction" -#: models.py:1781 +#: models.py:1800 msgid "Is template" msgstr "Est un patron" -#: models.py:1782 +#: models.py:1801 msgid "Unicity keys (separator \";\")" msgstr "Clés d'unicité (séparateur « ; »)" -#: models.py:1786 +#: models.py:1805 msgid "Importer - Type" msgstr "Importeur - Type" -#: models.py:1787 +#: models.py:1806 msgid "Importer - Types" msgstr "Importeur - Types" -#: models.py:1886 +#: models.py:1905 msgid "Importer - Default" msgstr "Importeur - Par défaut" -#: models.py:1887 +#: models.py:1906 msgid "Importer - Defaults" msgstr "Importeur - Par défaut" -#: models.py:1922 +#: models.py:1941 msgid "Importer - Default value" msgstr "Importeur - Valeur par défaut" -#: models.py:1923 +#: models.py:1942 msgid "Importer - Default values" msgstr "Importeur - Valeurs par défaut" -#: models.py:1956 +#: models.py:1976 msgid "Column number" msgstr "Numéro de colonne" -#: models.py:1959 +#: models.py:1979 msgid "Required" msgstr "Requis" -#: models.py:1961 +#: models.py:1981 msgid "Export field name" msgstr "Exporter le nom du champ" -#: models.py:1962 +#: models.py:1982 msgid "" "Fill this field if the field name is ambiguous for export. For instance: " "concatenated fields." @@ -1027,511 +1027,531 @@ msgstr "" "Remplir ce champ si le nom du champ est ambigu pour l'export, par exemple " "dans le cas de champs concaténés." -#: models.py:1967 +#: models.py:1987 msgid "Importer - Column" msgstr "Importeur - Colonne" -#: models.py:1968 +#: models.py:1988 msgid "Importer - Columns" msgstr "Importeur - Colonnes" -#: models.py:1988 +#: models.py:2008 msgid "Field name" msgstr "Nom du champ" -#: models.py:1990 models.py:2024 +#: models.py:2010 models.py:2044 msgid "Force creation of new items" msgstr "Forcer la création de nouveaux éléments" -#: models.py:1992 models.py:2026 +#: models.py:2012 models.py:2046 msgid "Concatenate with existing" msgstr "Concaténer avec l'existant" -#: models.py:1994 models.py:2028 +#: models.py:2014 models.py:2048 msgid "Concatenate character" msgstr "Caractère de concaténation" -#: models.py:1998 +#: models.py:2018 msgid "Importer - Duplicate field" msgstr "Importeur - Champ dupliqué" -#: models.py:1999 +#: models.py:2019 msgid "Importer - Duplicate fields" msgstr "Importeur - Champs dupliqués" -#: models.py:2006 +#: models.py:2026 msgid "Regular expression" msgstr "Expression régulière" -#: models.py:2009 +#: models.py:2029 msgid "Importer - Regular expression" msgstr "Importeur - Expression régulière" -#: models.py:2010 +#: models.py:2030 msgid "Importer - Regular expressions" msgstr "Importeur - Expressions régulières" -#: models.py:2033 +#: models.py:2053 msgid "Importer - Target" msgstr "Importeur - Cible" -#: models.py:2034 +#: models.py:2054 msgid "Importer - Targets" msgstr "Importeur - Cibles" -#: models.py:2058 views.py:549 +#: models.py:2078 views.py:568 msgid "True" msgstr "Oui" -#: models.py:2059 views.py:551 +#: models.py:2079 views.py:570 msgid "False" msgstr "Non" -#: models.py:2078 +#: models.py:2098 msgid "Is set" msgstr "Est défini" -#: models.py:2085 +#: models.py:2105 msgid "Importer - Target key" msgstr "Importeur - Clé de rapprochement" -#: models.py:2086 +#: models.py:2106 msgid "Importer - Targets keys" msgstr "Importeur - Clés de rapprochement" -#: models.py:2138 models.py:2913 +#: models.py:2158 models.py:2954 msgid "Format" msgstr "Format" -#: models.py:2139 models.py:3005 +#: models.py:2159 models.py:3046 msgid "Operation type" msgstr "Type d'opération" -#: models.py:2140 +#: models.py:2160 msgid "Period" msgstr "Période" -#: models.py:2141 +#: models.py:2161 msgid "Report state" msgstr "État de rapport" -#: models.py:2142 +#: models.py:2162 msgid "Remain type" msgstr "Type de vestige" -#: models.py:2143 +#: models.py:2163 msgid "Unit" msgstr "Unité" -#: models.py:2144 +#: models.py:2165 msgid "Activity type" msgstr "Type d'activité" -#: models.py:2145 +#: models.py:2166 msgid "Material" msgstr "Matériau" -#: models.py:2147 +#: models.py:2168 msgid "Conservatory state" msgstr "État de conservation" -#: models.py:2148 +#: models.py:2169 msgid "Container type" msgstr "Type de contenant" -#: models.py:2149 +#: models.py:2170 msgid "Preservation type" msgstr "Type de conservation" -#: models.py:2150 +#: models.py:2171 msgid "Object type" msgstr "Type d'objet" -#: models.py:2151 +#: models.py:2172 msgid "Integrity type" msgstr "Type d'intégrité" -#: models.py:2152 +#: models.py:2174 msgid "Remarkability type" msgstr "Type de remarquabilité" -#: models.py:2153 +#: models.py:2175 msgid "Batch type" msgstr "Type de lot" -#: models.py:2155 +#: models.py:2177 msgid "Identification type" msgstr "Type d'identification" -#: models.py:2157 +#: models.py:2179 msgid "Context record relation type" msgstr "Type de relations entre Unités d'Enregistrement" -#: models.py:2158 models.py:3063 +#: models.py:2180 models.py:3104 msgid "Spatial reference system" msgstr "Système de référence spatiale" -#: models.py:2159 models.py:2891 +#: models.py:2181 models.py:2932 msgid "Support type" msgstr "Type de support" -#: models.py:2160 models.py:2553 +#: models.py:2182 models.py:2573 msgid "Title type" msgstr "Type de titre" -#: models.py:2166 +#: models.py:2188 msgid "Integer" msgstr "Entier" -#: models.py:2167 +#: models.py:2189 msgid "Float" msgstr "Nombre à virgule" -#: models.py:2168 +#: models.py:2190 msgid "String" msgstr "Chaîne de caractères" -#: models.py:2169 templates/sheet_ope.html:86 +#: models.py:2191 templates/sheet_ope.html:86 msgid "Date" msgstr "Date" -#: models.py:2171 templates/sheet_ope.html:61 templates/sheet_ope.html.py:83 +#: models.py:2193 templates/sheet_ope.html:61 templates/sheet_ope.html.py:83 #: templates/ishtar/dashboards/dashboard_main_detail.html:126 msgid "Year" msgstr "Année" -#: models.py:2172 +#: models.py:2194 msgid "String to boolean" msgstr "Chaîne de caractères vers booléen" -#: models.py:2173 +#: models.py:2195 msgctxt "filesystem" msgid "File" msgstr "Fichier" -#: models.py:2174 +#: models.py:2196 msgid "Unknow type" msgstr "Type inconnu" -#: models.py:2190 +#: models.py:2212 msgid "4 digit year. e.g.: \"2015\"" msgstr "Année sur 4 chiffres. Exemple : « 2015 »" -#: models.py:2191 +#: models.py:2213 msgid "4 digit year/month/day. e.g.: \"2015/02/04\"" msgstr "Année sur 4 chiffres/mois/jour. Exemple : « 2015/02/04 »" -#: models.py:2192 +#: models.py:2214 msgid "Day/month/4 digit year. e.g.: \"04/02/2015\"" msgstr "Jour/mois/année sur 4 chiffres. Exemple : « 04/02/2015 »" -#: models.py:2202 +#: models.py:2224 msgid "Options" msgstr "Options" -#: models.py:2204 +#: models.py:2226 msgid "Split character(s)" msgstr "Caractère(s) de séparation" -#: models.py:2208 +#: models.py:2230 msgid "Importer - Formater type" msgstr "Importeur - Type de mise en forme" -#: models.py:2209 +#: models.py:2231 msgid "Importer - Formater types" msgstr "Importeur - Types de mise en forme" -#: models.py:2261 templates/ishtar/dashboards/dashboard_main_detail.html:63 +#: models.py:2283 templates/ishtar/dashboards/dashboard_main_detail.html:63 msgid "Created" msgstr "Créé" -#: models.py:2262 +#: models.py:2284 msgid "Analyse in progress" msgstr "Analyse en cours" -#: models.py:2263 +#: models.py:2285 msgid "Analysed" msgstr "Analysé" -#: models.py:2264 +#: models.py:2286 msgid "Import pending" msgstr "Import en attente" -#: models.py:2265 +#: models.py:2287 msgid "Import in progress" msgstr "Import en cours" -#: models.py:2266 +#: models.py:2288 msgid "Finished with errors" msgstr "Terminé avec des erreurs" -#: models.py:2267 +#: models.py:2289 msgid "Finished" msgstr "Terminé" -#: models.py:2268 +#: models.py:2290 msgid "Archived" msgstr "Archivé" -#: models.py:2283 +#: models.py:2305 msgid "Imported file" msgstr "Fichier importé" -#: models.py:2285 +#: models.py:2307 msgid "Associated images (zip file)" msgstr "Images associées (fichier zip)" -#: models.py:2287 +#: models.py:2309 msgid "Encoding" msgstr "Codage" -#: models.py:2289 +#: models.py:2311 msgid "Skip lines" msgstr "Nombre de lignes d'entête" -#: models.py:2290 templates/ishtar/import_list.html:51 +#: models.py:2312 templates/ishtar/import_list.html:51 msgid "Error file" msgstr "Fichier erreur" -#: models.py:2293 +#: models.py:2315 msgid "Result file" msgstr "Fichier résultant" -#: models.py:2296 templates/ishtar/import_list.html:57 +#: models.py:2318 templates/ishtar/import_list.html:57 msgid "Match file" msgstr "Fichier de correspondance" -#: models.py:2302 +#: models.py:2324 msgid "Conservative import" msgstr "Import conservateur" -#: models.py:2307 +#: models.py:2328 msgid "End date" msgstr "Date de fin" -#: models.py:2309 +#: models.py:2331 msgid "Remaining seconds" msgstr "Secondes restantes" -#: models.py:2314 +#: models.py:2334 msgid "Import" msgstr "Import" -#: models.py:2343 +#: models.py:2363 msgid "Analyse" msgstr "Analyser" -#: models.py:2345 models.py:2348 +#: models.py:2365 models.py:2368 msgid "Re-analyse" msgstr "Analyser de nouveau " -#: models.py:2346 +#: models.py:2366 msgid "Launch import" msgstr "Lancer l'import" -#: models.py:2349 +#: models.py:2369 msgid "Re-import" msgstr "Ré-importer" -#: models.py:2350 +#: models.py:2370 msgid "Archive" msgstr "Archiver" -#: models.py:2352 +#: models.py:2372 msgid "Unarchive" msgstr "Désarchiver" -#: models.py:2353 widgets.py:130 templates/ishtar/form_delete.html:11 +#: models.py:2373 widgets.py:184 templates/ishtar/form_delete.html:11 msgid "Delete" msgstr "Supprimer" -#: models.py:2494 +#: models.py:2514 msgid "Organizations" msgstr "Organisations" -#: models.py:2496 +#: models.py:2516 msgid "Can view all Organizations" msgstr "Peut voir toutes les Organisations" -#: models.py:2497 +#: models.py:2517 msgid "Can view own Organization" msgstr "Peut voir sa propre Organisation" -#: models.py:2498 +#: models.py:2518 msgid "Can add own Organization" msgstr "Peut ajouter sa propre Organisation" -#: models.py:2500 +#: models.py:2520 msgid "Can change own Organization" msgstr "Peut modifier sa propre Organisation" -#: models.py:2502 +#: models.py:2522 msgid "Can delete own Organization" msgstr "Peut supprimer sa propre Organisation" -#: models.py:2537 +#: models.py:2557 msgid "Groups" msgstr "Groupes" -#: models.py:2542 +#: models.py:2562 msgid "Person types" msgstr "Types de personne" -#: models.py:2554 +#: models.py:2574 msgid "Title types" msgstr "Types de titre" -#: models.py:2563 +#: models.py:2583 msgid "Mr" msgstr "M." -#: models.py:2564 +#: models.py:2584 msgid "Miss" msgstr "Mlle" -#: models.py:2565 +#: models.py:2585 msgid "Mr and Mrs" msgstr "M. et Mme" -#: models.py:2566 +#: models.py:2586 msgid "Mrs" msgstr "Mme" -#: models.py:2567 +#: models.py:2587 msgid "Doctor" msgstr "Dr." -#: models.py:2600 +#: models.py:2620 msgid "Contact type" msgstr "Type de contact" -#: models.py:2603 models.py:2667 +#: models.py:2623 models.py:2687 msgid "Types" msgstr "Types" -#: models.py:2606 +#: models.py:2626 msgid "Is attached to" msgstr "Est rattaché à" -#: models.py:2611 +#: models.py:2631 msgid "Persons" msgstr "Personnes" -#: models.py:2613 +#: models.py:2633 msgid "Can view all Persons" msgstr "Peut voir toutes les Personnes" -#: models.py:2614 +#: models.py:2634 msgid "Can view own Person" msgstr "Peut voir sa propre Personne" -#: models.py:2615 +#: models.py:2635 msgid "Can add own Person" msgstr "Peut ajouter sa propre Personne" -#: models.py:2616 +#: models.py:2636 msgid "Can change own Person" msgstr "Peut modifier sa propre Personne" -#: models.py:2617 +#: models.py:2637 msgid "Can delete own Person" msgstr "Peut supprimer sa propre Personne" -#: models.py:2794 +#: models.py:2826 msgid "Advanced shortcut menu" msgstr "Menu de raccourci (avancé)" -#: models.py:2797 +#: models.py:2829 msgid "Ishtar user" msgstr "Utilisateur d'Ishtar" -#: models.py:2798 +#: models.py:2830 msgid "Ishtar users" msgstr "Utilisateurs d'Ishtar" -#: models.py:2842 +#: models.py:2870 msgid "To modify the password use the form in Auth > User" msgstr "" "Pour modifier le mot de passe, utilisez le formulaire dans Authentification " "> Utilisateurs" -#: models.py:2849 +#: models.py:2878 msgid "Author types" msgstr "Types d'auteur" -#: models.py:2883 +#: models.py:2895 +msgid "Can view all Authors" +msgstr "Peut voir tous les Auteurs" + +#: models.py:2897 +msgid "Can view own Author" +msgstr "Peut voir son propre Auteur" + +#: models.py:2899 +msgid "Can add own Author" +msgstr "Peut ajouter son propre Auteur" + +#: models.py:2901 +msgid "Can change own Author" +msgstr "Peut modifier son propre Auteur" + +#: models.py:2903 +msgid "Can delete own Author" +msgstr "Peut supprimer son propre Auteur" + +#: models.py:2924 msgid "Source types" msgstr "Types de document" -#: models.py:2892 +#: models.py:2933 msgid "Support types" msgstr "Types de support" -#: models.py:2899 +#: models.py:2940 msgid "Format type" msgstr "Type de format" -#: models.py:2900 +#: models.py:2941 msgid "Format types" msgstr "Types de format" -#: models.py:2908 +#: models.py:2949 msgid "External ID" msgstr "Identifiant externe" -#: models.py:2911 +#: models.py:2952 msgid "Support" msgstr "Support" -#: models.py:2915 +#: models.py:2956 msgid "Scale" msgstr "Échelle" -#: models.py:2929 +#: models.py:2970 msgid "Item number" msgstr "Numéro d'élément" -#: models.py:2930 +#: models.py:2971 msgid "Ref." msgstr "Réf." -#: models.py:2933 +#: models.py:2974 msgid "Internal ref." msgstr "Réf. interne" -#: models.py:2976 +#: models.py:3017 msgid "Surface (m2)" msgstr "Surface (m2)" -#: models.py:2977 templates/sheet_ope.html:46 templates/sheet_ope.html.py:107 +#: models.py:3018 templates/sheet_ope.html:46 templates/sheet_ope.html.py:107 msgid "Localisation" msgstr "Localisation" -#: models.py:3002 +#: models.py:3043 msgid "Is preventive" msgstr "Est du préventif" -#: models.py:3006 +#: models.py:3047 msgid "Operation types" msgstr "Types d'opération" -#: models.py:3035 +#: models.py:3076 msgid "Preventive" msgstr "Préventif" -#: models.py:3036 +#: models.py:3077 msgid "Research" msgstr "Programmé" -#: models.py:3059 +#: models.py:3100 msgid "Authority name" msgstr "Registre" -#: models.py:3060 +#: models.py:3101 msgid "Authority SRID" msgstr "SRID" -#: models.py:3064 +#: models.py:3105 msgid "Spatial reference systems" msgstr "Systèmes de référence spatiale" @@ -1575,108 +1595,116 @@ msgstr "Gérer les comptes" msgid "Account deletion" msgstr "Supprimer un compte" -#: views.py:241 +#: views.py:251 msgid "Archaeological file" msgstr "Dossier" -#: views.py:242 +#: views.py:252 msgid "Operation" msgstr "Opération" -#: views.py:244 +#: views.py:254 msgid "Context record" msgstr "Unité d'Enregistrement" -#: views.py:246 +#: views.py:256 msgid "Find" msgstr "Mobilier" -#: views.py:248 +#: views.py:258 msgid "Treatment request" msgstr "Demande de traitement" -#: views.py:249 +#: views.py:259 msgid "Treatment" msgstr "Traitement" -#: views.py:1363 views.py:1406 +#: views.py:1387 views.py:1430 msgid "Operation not permitted." msgstr "Opération non permise." -#: views.py:1365 +#: views.py:1389 #, python-format msgid "New %s" msgstr "Nouveau %s" -#: views.py:1424 views.py:1474 +#: views.py:1448 views.py:1501 msgid "Archaeological files" msgstr "Dossiers" -#: views.py:1425 views.py:1478 +#: views.py:1449 views.py:1505 msgid "Operations" msgstr "Opérations" -#: views.py:1427 views.py:1482 +#: views.py:1451 views.py:1509 msgid "Context records" msgstr "Unités d'Enregistrement" -#: views.py:1429 views.py:1485 +#: views.py:1453 views.py:1512 msgid "Finds" msgstr "Mobilier" -#: views.py:1683 templates/ishtar/import_list.html:47 +#: views.py:1455 views.py:1517 +msgid "Treatment requests" +msgstr "Demandes de traitement" + +#: views.py:1456 views.py:1521 +msgid "Treatments" +msgstr "Traitements" + +#: views.py:1719 templates/ishtar/import_list.html:47 msgid "Link unmatched items" msgstr "Associer les éléments non rapprochés" -#: views.py:1698 +#: views.py:1734 msgid "Delete import" msgstr "Supprimer un import" -#: views.py:1737 +#: views.py:1773 msgid "Merge persons" msgstr "Fusionner des personnes" -#: views.py:1761 +#: views.py:1797 msgid "Select the main person" msgstr "Choisir la personne principale" -#: views.py:1770 +#: views.py:1806 msgid "Merge organization" msgstr "Fusionner des organisations" -#: views.py:1780 +#: views.py:1816 msgid "Select the main organization" msgstr "Sélectionner l'organisation principale" -#: views.py:1820 views.py:1836 +#: views.py:1856 views.py:1872 msgid "Corporation manager" msgstr "Représentant de la personne morale" -#: widgets.py:259 widgets.py:366 widgets.py:481 +#: widgets.py:313 widgets.py:420 widgets.py:535 msgid "Search..." msgstr "Recherche..." -#: widgets.py:670 templatetags/window_tables.py:96 +#: widgets.py:724 templatetags/window_tables.py:96 msgid "No results" msgstr "Pas de résultats" -#: widgets.py:671 templatetags/window_tables.py:97 +#: widgets.py:725 templatetags/window_tables.py:97 msgid "Loading..." msgstr "Chargement..." -#: widgets.py:672 +#: widgets.py:726 msgid "Remove" msgstr "Enlever" -#: wizards.py:374 templates/ishtar/import_delete.html:21 +#: wizards.py:380 templates/ishtar/import_delete.html:21 msgid "Yes" msgstr "Oui" -#: wizards.py:376 +#: wizards.py:382 msgid "No" msgstr "Non" -#: wizards.py:1396 +#: wizards.py:1404 #, python-format msgid "[%(app_name)s] Account creation/modification" msgstr "[%(app_name)s] Création/modification du compte" @@ -1753,19 +1781,19 @@ msgstr "Éléments courants" msgid ":" msgstr " :" -#: templates/base.html:120 +#: templates/base.html:123 msgid "Processing..." msgstr "En traitement..." -#: templates/base.html:121 +#: templates/base.html:124 msgid "This can be long." msgstr "Cela peut être long." -#: templates/base.html:122 +#: templates/base.html:125 msgid "Time to take a coffee?" msgstr "Il est peut-être temps de prendre un café ?" -#: templates/base.html:123 +#: templates/base.html:126 msgid "Time to take another coffee?" msgstr "Pourquoi pas un autre café ?" diff --git a/version.py b/version.py index 8b36e12b1..d0ef38afd 100644 --- a/version.py +++ b/version.py @@ -1,4 +1,4 @@ -VERSION = (0, 99, 16) +VERSION = (0, 99, 17) def get_version(): |
